![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | yawning.txt | 2009-08-02 21:13 | 2.9K | |
![[DIR]](/icons/folder.gif) | working-memory/ | 2017-01-07 12:10 | - | |
![[TXT]](/icons/text.gif) | wireheads.txt | 2010-01-11 07:47 | 734 | |
![[TXT]](/icons/text.gif) | url.txt | 2023-01-25 08:53 | 12K | |
![[TXT]](/icons/text.gif) | url.bak.txt | 2016-01-07 06:10 | 8.6K | |
![[DIR]](/icons/folder.gif) | ultrasound/ | 2014-11-22 19:26 | - | |
![[DIR]](/icons/folder.gif) | tractography/ | 2012-06-23 16:07 | - | |
![[DIR]](/icons/folder.gif) | time-perception/ | 2012-07-09 10:37 | - | |
![[DIR]](/icons/folder.gif) | thehighestofmountains/ | 2024-05-27 06:13 | - | |
![[DIR]](/icons/folder.gif) | temporal-cortex/ | 2009-08-05 06:19 | - | |
![[DIR]](/icons/folder.gif) | tdcs/ | 2016-10-15 08:23 | - | |
![[DIR]](/icons/folder.gif) | sleep/ | 2017-04-22 21:18 | - | |
![[DIR]](/icons/folder.gif) | simulation/ | 2010-03-28 09:07 | - | |
![[ ]](/icons/unknown.gif) | rstb.2017.0287 | 2019-12-22 17:24 | 497K | |
![[DIR]](/icons/folder.gif) | randall-oreilly/ | 2016-01-06 15:43 | - | |
![[ ]](/icons/layout.gif) | patent - Computer-implemented simulated intelligence capabilities by neuroanatomically-based system architecture - Soren Solari - Simigence.pdf | 2015-12-30 21:29 | 5.3M | |
![[DIR]](/icons/folder.gif) | patch-clamp/ | 2014-11-28 15:08 | - | |
![[DIR]](/icons/folder.gif) | parasitism/ | 2015-06-23 16:46 | - | |
![[DIR]](/icons/folder.gif) | pam/ | 2010-07-09 22:06 | - | |
![[TXT]](/icons/text.gif) | notes.txt | 2014-12-30 14:30 | 5.4K | |
![[ ]](/icons/layout.gif) | neuroprotective potential of flavonoids- a multiplicity of effects.pdf | 2010-02-15 16:04 | 360K | |
![[DIR]](/icons/folder.gif) | netmorph/ | 2012-04-26 18:11 | - | |
![[DIR]](/icons/folder.gif) | nengo/ | 2016-11-12 05:52 | - | |
![[DIR]](/icons/folder.gif) | nematodeuploadproject/ | 2012-05-14 15:12 | - | |
![[DIR]](/icons/folder.gif) | music-distraction/ | 2016-09-10 19:29 | - | |
![[IMG]](/icons/image2.gif) | mouse-embryo-immunostained-for-axons-iDISCO.png | 2016-06-22 06:54 | 280K | |
![[DIR]](/icons/folder.gif) | motivation-effort/ | 2017-02-18 20:32 | - | |
![[TXT]](/icons/text.gif) | more-amphetamine-notes.txt | 2009-08-09 11:56 | 4.1K | |
![[DIR]](/icons/folder.gif) | memory/ | 2019-12-30 13:23 | - | |
![[DIR]](/icons/folder.gif) | megaptera/ | 2009-08-12 17:44 | - | |
![[ ]](/icons/layout.gif) | marblestone.stanford.cs379c.04-29-13.pdf | 2013-04-30 06:20 | 4.8M | |
![[DIR]](/icons/folder.gif) | magnetic-stimulation/ | 2012-07-10 14:08 | - | |
![[ ]](/icons/layout.gif) | lhx2 is required for neural patterning and midline axon guidance in the zebrafish forebrain.pdf | 2009-08-07 21:09 | 2.1M | |
![[DIR]](/icons/folder.gif) | left-prefrontal-cortex/ | 2009-08-09 12:31 | - | |
![[DIR]](/icons/folder.gif) | layer5/ | 2009-08-08 17:56 | - | |
![[DIR]](/icons/folder.gif) | language/ | 2015-05-28 16:32 | - | |
![[ ]](/icons/layout.gif) | john_vbm_methods.pdf | 2009-08-05 10:42 | 508K | |
![[DIR]](/icons/folder.gif) | ion-channel-journal-club/ | 2016-01-06 16:33 | - | |
![[TXT]](/icons/text.gif) | intelligence_and_genes.txt | 2010-06-02 09:14 | 756 | |
![[TXT]](/icons/text.gif) | inhibitory cortex.jpg.url.txt | 2010-01-26 19:01 | 93 | |
![[IMG]](/icons/image2.gif) | inhibitory cortex.jpg | 2010-01-26 19:01 | 174K | |
![[DIR]](/icons/folder.gif) | implants/ | 2018-04-18 09:42 | - | |
![[DIR]](/icons/folder.gif) | imagery/ | 2017-08-14 20:11 | - | |
![[IMG]](/icons/image2.gif) | human_chimpanzee_brain_differences.png | 2014-12-02 16:24 | 152K | |
![[TXT]](/icons/text.gif) | gyri.txt | 2009-08-08 17:31 | 4.8K | |
![[TXT]](/icons/text.gif) | gwas-associations-intelligence.2019-01-27.tsv | 2019-01-27 10:38 | 1.5M | |
![[TXT]](/icons/text.gif) | greenblue.jpg.url.txt | 2010-01-26 19:04 | 64 | |
![[IMG]](/icons/image2.gif) | greenblue.jpg | 2008-08-15 12:06 | 148K | |
![[ ]](/icons/layout.gif) | good - Subsecond changes in top-down control exerted by human medial frontal cortex during conflict and action selection - a combined TMS-EEG study.pdf | 2009-08-09 14:20 | 819K | |
![[TXT]](/icons/text.gif) | get.txt | 2020-01-04 10:43 | 15K | |
![[TXT]](/icons/text.gif) | genes-of-interest.txt | 2009-08-12 18:47 | 210 | |
![[IMG]](/icons/image2.gif) | gene_composition_of_human_brain.png | 2009-05-24 20:54 | 344K | |
![[DIR]](/icons/folder.gif) | fusiform-face-area/ | 2016-09-14 17:29 | - | |
![[IMG]](/icons/image2.gif) | functional-imaging-of-practice-results.png | 2009-05-14 01:28 | 580K | |
![[TXT]](/icons/text.gif) | flavonoids.txt | 2010-02-15 18:05 | 615 | |
![[IMG]](/icons/image2.gif) | fetal-brain.jpg | 2009-08-08 16:01 | 12K | |
![[IMG]](/icons/image2.gif) | fetal-MRI.jpg | 2009-08-08 15:59 | 36K | |
![[DIR]](/icons/folder.gif) | eeg/ | 2016-10-15 08:29 | - | |
![[TXT]](/icons/text.gif) | delusions-of-control.notes.txt | 2010-01-03 09:08 | 785 | |
![[DIR]](/icons/folder.gif) | cysts/ | 2017-03-04 21:11 | - | |
![[DIR]](/icons/folder.gif) | coordinates/ | 2009-08-08 07:32 | - | |
![[DIR]](/icons/folder.gif) | conversations-discourse/ | 2012-07-09 10:28 | - | |
![[IMG]](/icons/image2.gif) | connectome-circuit_mapping_strategies.png | 2009-05-24 20:51 | 584K | |
![[DIR]](/icons/folder.gif) | cognitiveconsilience/ | 2016-01-07 06:54 | - | |
![[DIR]](/icons/folder.gif) | coding/ | 2009-06-28 17:58 | - | |
![[IMG]](/icons/image2.gif) | caspase9-cerebrum2.png | 2009-08-08 06:25 | 473K | |
![[IMG]](/icons/image2.gif) | caspase9-cerebrum.png | 2009-08-08 06:19 | 183K | |
![[TXT]](/icons/text.gif) | brains-intelligence-and-how-they-do-not-correlate.html | 2004-07-08 13:44 | 9.6K | |
![[IMG]](/icons/image2.gif) | brain-from-a-blog.jpg | 2009-08-08 15:58 | 17K | |
![[DIR]](/icons/folder.gif) | brain-emulation/ | 2019-11-06 05:49 | - | |
![[ ]](/icons/layout.gif) | brain-emulation-roadmap-report.pdf | 2010-03-30 18:43 | 2.4M | |
![[DIR]](/icons/folder.gif) | bilateral-generalized-polymicrogyria/ | 2009-08-08 17:00 | - | |
![[DIR]](/icons/folder.gif) | bilateral-frontoparietal-polymicrogyria/ | 2009-08-08 17:01 | - | |
![[DIR]](/icons/folder.gif) | backups/ | 2010-02-15 18:04 | - | |
![[DIR]](/icons/folder.gif) | autism/ | 2016-05-26 14:54 | - | |
![[ ]](/icons/layout.gif) | alpha-e-catenin controls cerebral cortical size by regulating the hedgehog signaling pathway.pdf | 2009-08-08 09:56 | 340K | |
![[DIR]](/icons/folder.gif) | adhd/ | 2017-02-18 15:37 | - | |
![[TXT]](/icons/text.gif) | adhd.txt | 2009-08-09 14:46 | 12K | |
![[TXT]](/icons/text.gif) | Zoom out sequence from within the neocortical brain.swf.url.txt | 2010-01-26 19:15 | 100 | |
![[ ]](/icons/unknown.gif) | Zoom out sequence from within the neocortical brain.swf | 2009-08-28 05:25 | 29M | |
![[ ]](/icons/layout.gif) | ZNF804A rs1344706 interacts with COMT rs4680 to affect prefrontal volume in healthy adults - 2017.pdf | 2017-04-23 18:57 | 587K | |
![[ ]](/icons/layout.gif) | X-ray structures of general anaesthetics bound to a pentameric ligand-gated ion channel.pdf | 2011-01-20 14:03 | 1.2M | |
![[ ]](/icons/layout.gif) | Writing memories with light-addressable reinforcement circuitry.pdf | 2009-10-16 19:51 | 1.6M | |
![[ ]](/icons/layout.gif) | Working memory retention systems - a state of activated long-term memory.pdf | 2009-08-04 20:02 | 899K | |
![[ ]](/icons/layout.gif) | Working memory capacity predicts dopamine synthesis capacity in the human striatum.pdf | 2008-02-16 12:39 | 109K | |
![[ ]](/icons/layout.gif) | Working memory as an emergent property of the mind and brain.pdf | 2006-10-26 06:42 | 228K | |
![[ ]](/icons/layout.gif) | Wnt proteins promote neuronal differentiation in neural stem cell culture.pdf | 2009-08-07 20:32 | 351K | |
![[ ]](/icons/layout.gif) | Wireless Activation of Neurons in Brain Slices Using Nanostructured Semiconductor Photoelectrodes - Strowbridge - 2009.pdf | 2009-03-17 07:54 | 415K | |
![[ ]](/icons/layout.gif) | Willed action and attention to the selection of action in the dorsal prefrontal cortex (area 46) - 2004.pdf | 2010-01-03 07:56 | 1.0M | |
![[ ]](/icons/layout.gif) | Why you are probably not a brain in a vat.pdf | 2015-09-02 16:31 | 1.0M | |
![[ ]](/icons/layout.gif) | Why neurons have thousands of synapses: A theory of sequence memory in neocortex - 2015.pdf | 2015-12-02 17:00 | 4.4M | |
![[ ]](/icons/layout.gif) | Whole-brain imaging with single-cell resolution using chemical cocktails and computational analysis - Susaki - 2014.pdf | 2016-06-21 15:17 | 4.7M | |
![[ ]](/icons/layout.gif) | Whole-brain emulation and the evolution of superorganisms - Carl Shulman.pdf | 2012-06-13 14:14 | 173K | |
![[ ]](/icons/layout.gif) | Whole-brain calcium imaging with cellular resolution in freely behaving C. elegans.pdf | 2015-01-14 17:34 | 5.5M | |
![[ ]](/icons/layout.gif) | Whisker movements evoked by stimulation of single pyramidal cells in rat motor cortex.pdf | 2009-05-04 20:52 | 632K | |
![[ ]](/icons/layout.gif) | When the self represents the other - a new cognitive neuroscience view on psychological identification.pdf | 2010-01-03 08:37 | 182K | |
![[ ]](/icons/layout.gif) | What the heart forgets: Cardiac timing influences memory for words and is modulated by metacognition and interoceptive sensitivity.pdf | 2016-01-02 20:53 | 636K | |
![[ ]](/icons/layout.gif) | What is memory? The present state of the engram - 2016.pdf | 2016-05-19 14:58 | 1.5M | |
![[ ]](/icons/layout.gif) | What electrical microstimulation has revealed about the neural basis of cognition - 2004.pdf | 2010-12-01 04:55 | 148K | |
![[ ]](/icons/layout.gif) | Wearable pupil position detection system utilizing dye-sensitized photovoltaic devices.pdf | 2009-08-02 20:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Voltage sensitive dye imaging - technique review and models - 2010.pdf | 2010-12-01 11:35 | 461K | |
![[ ]](/icons/layout.gif) | Visual stimuli activate auditory cortex in the deaf.pdf | 2009-03-26 09:17 | 454K | |
![[ ]](/icons/layout.gif) | Visual imagery in brain-injured children.pdf | 2011-08-31 15:20 | 275K | |
![[ ]](/icons/layout.gif) | Visual image reconstruction from human brain activity using a combination of multiscale local image decoders.pdf | 2009-02-27 05:46 | 1.4M | |
![[ ]](/icons/layout.gif) | Visual deprivation - effects on functional and structural organization of the human brain due to early onset blindness.pdf | 2009-08-08 07:10 | 479K | |
![[ ]](/icons/layout.gif) | Vision one year after gene therapy for Leber's congenital amaurosis.pdf | 2009-08-15 17:25 | 233K | |
![[ ]](/icons/layout.gif) | Viral regulation of aquaporin 4, connexin 43, microcephalin and nucleolin.pdf | 2009-08-07 20:18 | 1.3M | |
![[ ]](/icons/layout.gif) | Virally delivered channelrhodopsin-2 safely and effectively restores visual function in multiple mouse models of blindness.pdf | 2013-03-21 13:30 | 811K | |
![[ ]](/icons/layout.gif) | Vertical nanowire electrode arrays as a scalable platform for intracellular interfacing to neuronal circuits.pdf | 2012-03-05 07:18 | 2.4M | |
![[ ]](/icons/layout.gif) | Using high-throughput barcode sequencing to efficiently map connectomes - v3 - 2017.pdf | 2017-04-25 23:01 | 4.8M | |
![[ ]](/icons/layout.gif) | Using high-throughput barcode sequencing to efficiently map connectomes - v2 - 2017.pdf | 2017-02-10 19:22 | 4.6M | |
![[ ]](/icons/layout.gif) | Using high-throughput barcode sequencing to efficiently map connectomes - 2017.pdf | 2017-01-14 10:26 | 4.6M | |
![[ ]](/icons/layout.gif) | Updating verbal and visuospatial working memory: Are the processes parallel?.pdf | 2009-09-23 22:46 | 577K | |
![[ ]](/icons/layout.gif) | Unique features of action potential initiation in cortical neurons.pdf | 2009-05-04 20:49 | 519K | |
![[ ]](/icons/layout.gif) | Understanding understanding source code with fMRI - 2014.pdf | 2014-03-01 11:44 | 592K | |
![[ ]](/icons/layout.gif) | Uncertainty-based competition between prefrontal and dorsolateral striatal systems for behavioral control.pdf | 2007-04-29 14:41 | 371K | |
![[ ]](/icons/layout.gif) | Ultrasound-guided in utero injections allow studies of the development and function of the eye.pdf | 2009-08-07 21:12 | 473K | |
![[ ]](/icons/layout.gif) | Twenty years of haunting eidetic imagery: where's the ghost? - 1979.pdf | 2022-08-16 17:23 | 8.2M | |
![[ ]](/icons/layout.gif) | Turning blood into brain - cells bearing neuronal antigens generated in vivo from bone marrow.pdf | 2009-08-07 20:25 | 1.0M | |
![[ ]](/icons/layout.gif) | Transplantable living scaffolds comprised of micro-tissue engineered aligned astrocyte networks to facilitate central nervous system regeneration - 2016.pdf | 2016-05-25 07:53 | 6.2M | |
![[ ]](/icons/layout.gif) | Transneuronal tracing with neurotropic viruses reveals network macroarchitecture.pdf | 2016-01-02 21:09 | 426K | |
![[ ]](/icons/layout.gif) | Transgenic strategies for combinatorial expression of fluorescent proteins in the nervous system.pdf | 2009-04-21 12:28 | 1.8M | |
![[ ]](/icons/layout.gif) | Transcriptomic insights into human brain evolution: acceleration, neutrality, heterochrony.pdf | 2014-10-09 01:41 | 538K | |
![[ ]](/icons/layout.gif) | Transcranial magnetic stimulation of left prefrontal cortex impairs working memory.pdf | 2009-08-04 19:52 | 116K | |
![[ ]](/icons/layout.gif) | Transcranial magnetic stimulation can measure and modulate learning and memory.pdf | 2009-04-12 15:17 | 190K | |
![[ ]](/icons/layout.gif) | Transcranial magnetic stimulation - new insights into representational cortical plasticity - 2003.pdf | 2007-05-30 05:18 | 293K | |
![[ ]](/icons/layout.gif) | Transcranial magnetic stimulation-induced switch into mania - a report of two cases.pdf | 2009-04-12 15:19 | 19K | |
![[ ]](/icons/layout.gif) | Training induces changes in white-matter architecture.pdf | 2009-12-31 11:13 | 290K | |
![[ ]](/icons/layout.gif) | Towards responsible use of cognitive-enhancing drugs by the healthy.pdf | 2011-06-11 17:57 | 666K | |
![[ ]](/icons/layout.gif) | Towards neuronal organoids: a method for long-term culturing of high-density hippocampal neurons - 2013.pdf | 2014-03-26 04:38 | 14M | |
![[ ]](/icons/layout.gif) | Towards comparative theoretical neuroanatomy of the cerebral cortex - Jan Karbowski - 2004.pdf | 2008-02-05 03:27 | 139K | |
![[ ]](/icons/layout.gif) | Towards a universal cortical algorithm: Examining hierarchical temporal memory in light of frontal cortical function.pdf | 2014-11-18 17:03 | 1.0M | |
![[ ]](/icons/layout.gif) | Towards an executive without a homunculus: computational models of the prefrontal cortex basal ganglia system.pdf | 2007-04-14 12:42 | 290K | |
![[ ]](/icons/layout.gif) | Towards a mathematical theory of cortical microcircuits.pdf | 2009-10-19 07:22 | 2.1M | |
![[ ]](/icons/layout.gif) | Toward better genetically encoded sensors of membrane potential - 2016.pdf | 2015-12-08 05:47 | 640K | |
![[ ]](/icons/layout.gif) | Topological analysis of the connectome of digital reconstructions of neural microcircuits - 2016.pdf | 2016-01-07 17:26 | 7.1M | |
![[ ]](/icons/layout.gif) | Tlx gene regulates the timing of neurogenesis in the cortex - proliferation versus differentiation.pdf | 2009-08-08 06:49 | 1.1M | |
![[ ]](/icons/layout.gif) | Time-dependent effect of transcranial direct current stimulation on the enhancement of working memory.pdf | 2009-08-04 16:55 | 96K | |
![[ ]](/icons/layout.gif) | Thrombospondin 1 accelerates synaptogenesis in hippocampal neurons through neuroligin 1.pdf | 2009-12-31 11:08 | 782K | |
![[ ]](/icons/layout.gif) | Three dimensional MEMS microfluidic perfusion system for thick brain slice cultures.pdf | 2007-01-03 10:18 | 575K | |
![[ ]](/icons/layout.gif) | Three controversial hypotheses concerning computation in the primate cortex.pdf | 2014-12-02 15:58 | 271K | |
![[ ]](/icons/layout.gif) | Three-dimensional structure of an AMPA receptor without associated stargazin and TARP proteins.pdf | 2009-04-22 10:38 | 366K | |
![[IMG]](/icons/image2.gif) | Three-dimensional imaging of living neurons and glia with AFM.pdf.1.png | 2009-05-24 20:55 | 176K | |
![[ ]](/icons/layout.gif) | Three-dimensional imaging of living neurons and glia with AFM.pdf | 2009-04-18 12:08 | 240K | |
![[ ]](/icons/layout.gif) | The world from a dog's point of view: a review and synthesis of dog cognition research.pdf | 2014-11-30 14:13 | 2.4M | |
![[ ]](/icons/layout.gif) | The will to persevere induced by electrical stimulation of the human cingulate gyrus.pdf | 2013-12-10 11:17 | 1.0M | |
![[ ]](/icons/layout.gif) | The visualization of the human brain post-mortem.pdf | 2013-10-03 09:24 | 30M | |
![[ ]](/icons/layout.gif) | Theta-burst microstimulation in the human entorhinal area improves memory specificity - 2017.pdf | 2018-03-29 04:23 | 1.7M | |
![[ ]](/icons/layout.gif) | The short splice variant of the gamma-2 subunit acts as an external modulator of GABA-A receptor function.pdf | 2010-04-10 18:55 | 1.5M | |
![[ ]](/icons/layout.gif) | The self in action - lessions from delusions of control - Frith - 2005.pdf | 2010-01-03 08:01 | 194K | |
![[ ]](/icons/layout.gif) | The role of the thalamus in the flow of information to the cortex.pdf | 2009-08-09 14:03 | 682K | |
![[ ]](/icons/layout.gif) | The role of the prefrontal cortex in the maintenance of verbal working memory: an event-related FMRI analysis.pdf | 2010-03-22 16:38 | 1.4M | |
![[ ]](/icons/layout.gif) | The role of the inferior frontal junction area in cognitive control.pdf | 2009-08-08 07:34 | 114K | |
![[ ]](/icons/layout.gif) | The role of the basal ganglia in bimanual coordination.pdf | 2009-06-08 04:31 | 568K | |
![[ ]](/icons/layout.gif) | Thermodynamic constraints on neural dimensions, firing rates, brain temperature and size.pdf | 2009-05-22 07:54 | 476K | |
![[ ]](/icons/layout.gif) | The ratio of 2nd to 4th digit length: a proxy for transactivation activity of the androgen receptor gene?.pdf | 2009-08-12 18:51 | 66K | |
![[ ]](/icons/layout.gif) | The prospects of whole brain emulation within the next half-century - 2013.pdf | 2016-06-27 09:04 | 450K | |
![[ ]](/icons/layout.gif) | The parieto-frontal integration (P-FIT) theory of intelligence - converging neuroimaging evidence.pdf | 2009-08-04 20:06 | 2.2M | |
![[ ]](/icons/layout.gif) | The nucleus accumbens as a nexus between values and goals in goal-directed behavior: a review and a new hypothesis.pdf | 2016-01-03 07:46 | 3.2M | |
![[ ]](/icons/layout.gif) | The nuclear DNA base 5-hydroxymethylcytosine is present in purkinje neurons and the brain.pdf | 2009-04-16 14:53 | 345K | |
![[ ]](/icons/layout.gif) | The neurobiological foundations of giftedness.pdf | 2013-05-15 02:17 | 253K | |
![[ ]](/icons/layout.gif) | The nature of individual differences in working memory capacity - active maintenance in primary memory and controlled search from secondary memory.pdf | 2009-06-09 14:16 | 684K | |
![[ ]](/icons/layout.gif) | The molecular memory code and synaptic plasticity: A synthesis - 2023.pdf | 2023-01-05 04:12 | 1.3M | |
![[ ]](/icons/layout.gif) | The metabolic cost of neural information.pdf | 2004-07-09 08:05 | 95K | |
![[ ]](/icons/layout.gif) | The mechanical basis of memory: the meshcode theory - 2020.pdf | 2020-05-07 01:16 | 820K | |
![[ ]](/icons/layout.gif) | The geometric structure of the brain fiber pathways.pdf | 2012-04-03 10:50 | 4.6M | |
![[ ]](/icons/layout.gif) | The geometric structure of the brain fiber pathways - supplementary.pdf | 2012-03-28 11:46 | 1.0M | |
![[ ]](/icons/layout.gif) | The genetic association between neocortical volume and general cognitive ability is driven by global surface area rather than thickness.pdf | 2014-02-26 07:51 | 337K | |
![[ ]](/icons/layout.gif) | The fallacy of favoring gradual replacement mind uploading over scan-and-copy - Randal Koene - 2016.pdf | 2015-11-24 17:16 | 254K | |
![[ ]](/icons/layout.gif) | The expected value of control: an integrative theory of anterior cingulate cortex function.pdf | 2014-03-03 12:20 | 1.9M | |
![[ ]](/icons/layout.gif) | The evolving capabilities of rhodopsin-based genetically encoded voltage indicators - 2015.pdf | 2016-05-25 21:40 | 741K | |
![[ ]](/icons/layout.gif) | The evolution of human speech - Lieberman - 2007.pdf | 2008-06-19 11:36 | 350K | |
![[ ]](/icons/layout.gif) | The evolution of distributed association networks in the human brain.pdf | 2014-12-01 16:12 | 3.7M | |
![[ ]](/icons/layout.gif) | The effects of short-term social and sensory isolation upon behavior, EEG and averaged evoked potentials in puppies.pdf | 2010-10-16 10:26 | 756K | |
![[ ]](/icons/layout.gif) | The effects of positive affect and arousal on working memory and executive attention.pdf | 2009-08-09 12:34 | 573K | |
![[ ]](/icons/layout.gif) | The effects of eye movements on emotional memories: using an objective measure of cognitive load - 2016.pdf | 2016-09-09 18:52 | 637K | |
![[ ]](/icons/layout.gif) | The distribution of toxoplasma gondii cysts in the brain of a mouse with latent toxoplasmosis: Implications for the behavioral manipulation hypothesis.pdf | 2011-12-15 03:25 | 1.0M | |
![[ ]](/icons/layout.gif) | The corticothalamocortical circuit drives higher-order cortex in the mouse.pdf | 2009-12-31 11:10 | 561K | |
![[ ]](/icons/layout.gif) | The cortical connectivity of the prefrontal cortex in the monkey brain.pdf | 2014-11-30 18:35 | 6.6M | |
![[ ]](/icons/layout.gif) | The contribution of single synapses to sensory representation in vivo.pdf | 2009-05-04 16:36 | 1.3M | |
![[ ]](/icons/layout.gif) | The contribution of individual subunits to the coupling of the voltage sensor to pore opening in Shaker K channels - effect of ILT mutations in heterotetramers.pdf | 2010-11-29 09:35 | 2.0M | |
![[ ]](/icons/layout.gif) | The connectome of a decision-making neural network in C elegans reconstructed from serial electron micrograph sections_ Travis A Jarrell et al_ Science 2012.pdf | 2012-07-26 14:40 | 6.4M | |
![[ ]](/icons/layout.gif) | The connectome of a decision-making neural network in C. elegans reconstructed from serial electron micrograph sections - 2012.pdf | 2012-07-26 13:54 | 6.4M | |
![[ ]](/icons/layout.gif) | The computational and neural basis of cognitive control: charted territory and new frontiers.pdf | 2014-08-06 18:14 | 659K | |
![[ ]](/icons/layout.gif) | The columnar organization of the neocortex - mountcastle97.pdf | 2009-06-28 18:00 | 1.7M | |
![[ ]](/icons/layout.gif) | The cognitive thalamus - 2015.pdf | 2016-01-02 09:22 | 157K | |
![[ ]](/icons/layout.gif) | The cerebro-cerebellum: Could it be loci of forward models?.pdf | 2016-01-02 04:25 | 953K | |
![[ ]](/icons/layout.gif) | The causal influence of brain size on human intelligence: Evidence from within-family phenotypic associations and GWAS modeling - 2019.pdf | 2019-12-04 20:09 | 928K | |
![[ ]](/icons/layout.gif) | The benefits of targeted memory reactivation for consolidation in sleep are contingent on memory accuracy and direct cue-memory associations - 2016.pdf | 2016-09-10 13:42 | 1.0M | |
![[ ]](/icons/layout.gif) | The architecture of intelligence: Converging evidence from studies of humans and animals.pdf | 2014-11-30 13:56 | 1.4M | |
![[ ]](/icons/layout.gif) | The aptabot: an inducibly affinity-switching, minimally invasive in vivo contrast agent - Russell Hanson - 2016.pdf | 2016-06-27 12:01 | 809K | |
![[ ]](/icons/layout.gif) | The Geometric Structure of the Brain Fiber Pathways_ Wedeen_ Science 2012.pdf | 2012-03-30 16:07 | 4.6M | |
![[ ]](/icons/layout.gif) | Thalamocortical up states - differential effects of intrinsic and extrinsic cortical inputs on persistent activity.pdf | 2010-01-11 08:58 | 688K | |
![[ ]](/icons/layout.gif) | Testing a neural coding hypothesis using surrogate data.pdf | 2016-01-06 09:08 | 1.0M | |
![[ ]](/icons/layout.gif) | Temporally precise single-cell-resolution optogenetics - 2017.pdf | 2018-03-08 03:46 | 22M | |
![[ ]](/icons/layout.gif) | Temporal Lobe Cortical Electrical Stimulation during the Encoding and Retrieval Phase Reduces False Memories.pdf | 2010-11-05 12:02 | 411K | |
![[ ]](/icons/layout.gif) | Targeted single-cell electroporation of mammalian neurons in vivo.pdf | 2012-03-01 17:44 | 718K | |
![[ ]](/icons/layout.gif) | Systemic gene delivery to the central nervous system using Adeno-associated virus - 2014.pdf | 2016-03-21 10:40 | 824K | |
![[ ]](/icons/layout.gif) | Syringe injectable electronics - 2015.pdf | 2017-03-28 08:02 | 1.9M | |
![[ ]](/icons/layout.gif) | Synthetic small molecules that control stem cell fate.pdf | 2009-08-07 20:46 | 109K | |
![[ ]](/icons/layout.gif) | Synaptic AMPA Receptor Exchange Maintains Bidirectional Plasticity.pdf | 2009-04-22 10:33 | 957K | |
![[ ]](/icons/layout.gif) | Switching from automatic to controlled action by monkey medial frontal cortex.pdf | 2014-11-13 18:54 | 500K | |
![[ ]](/icons/layout.gif) | Survival of the fattest - fat babies were the key to evolution of the large human brain.pdf | 2009-08-07 19:38 | 179K | |
![[ ]](/icons/layout.gif) | Super-resolution mapping of neuronal circuitry with an index-optimized clearing agent - 2016.pdf | 2016-04-12 01:24 | 6.5M | |
![[ ]](/icons/layout.gif) | Sulcal variability of twins.pdf | 2009-08-12 17:29 | 696K | |
![[ ]](/icons/layout.gif) | Subretinal injection and electroporation into adult mouse eyes.pdf | 2009-08-07 21:15 | 34M | |
![[ ]](/icons/layout.gif) | Subregion and cell type-restricted gene knockout in mouse brain - Cre loxp recombination system - 1996.pdf | 2002-06-26 13:43 | 2.8M | |
![[ ]](/icons/layout.gif) | Study of 300,486 individuals identifies 148 independent genetic loci influencing general cognitive function - 2018.pdf | 2018-05-22 08:23 | 3.1M | |
![[ ]](/icons/layout.gif) | Studying cerebellar circuits by remote control of selected neuronal types with GABA.pdf | 2014-04-24 18:14 | 401K | |
![[ ]](/icons/layout.gif) | Study and modulation of human cortical excitability with transcranial magnetic stimulation.pdf | 2009-09-24 12:34 | 4.6M | |
![[ ]](/icons/layout.gif) | Structure of the cerebral cortex of the humpback whale, Megaptera novaeangliae (Cetacea, Mysticeti, Balaenopteridae).pdf | 2009-08-12 17:34 | 2.4M | |
![[ ]](/icons/layout.gif) | Stimulation mapping of myelinated tracts in awake patients - 2016.pdf | 2017-02-19 18:21 | 957K | |
![[ ]](/icons/layout.gif) | Stereotaxic gene delivery in the rodent brain.pdf | 2009-08-10 18:09 | 1.5M | |
![[ ]](/icons/layout.gif) | Stepwise differentiation of pluripotent stem cells into retinal cells.pdf | 2009-08-10 18:26 | 1.1M | |
![[ ]](/icons/layout.gif) | SpikerBox - A low cost, open-source bioamplifier for increasing public participation in neurosciene inquiry.pdf | 2012-03-21 13:26 | 241K | |
![[ ]](/icons/layout.gif) | Speed of expertise acquisition depends upon inherited factors.pdf | 2010-04-24 00:13 | 272K | |
![[ ]](/icons/layout.gif) | Specific expression of long noncoding RNAs in the mouse brain.pdf | 2009-08-07 19:16 | 806K | |
![[ ]](/icons/layout.gif) | Specification of neural cell types - stem cells.pdf | 2009-08-07 20:26 | 2.6M | |
![[ ]](/icons/layout.gif) | Specification of motoneurons from human embryonic stem cells.pdf | 2009-08-07 20:42 | 736K | |
![[ ]](/icons/layout.gif) | Spatial organization of projection neurons in the mouse auditory cortex identified by in situ barcode sequencing - Zador - 2018.pdf | 2018-04-05 06:14 | 1.5M | |
![[ ]](/icons/layout.gif) | Spatial memory and hippocampal enhancement - 2015.pdf | 2017-01-29 14:32 | 1.4M | |
![[ ]](/icons/layout.gif) | Soft materials in neuroengineering for hard problems in neuroscience - 2015.pdf | 2015-04-08 10:04 | 3.6M | |
![[ ]](/icons/layout.gif) | Smile and laughter elicited by electrical stimulation of the frontal operculum - 2016.pdf | 2017-02-19 11:36 | 1.2M | |
![[ ]](/icons/layout.gif) | Slow recovery from excitation of thalamic reticular nucleus neurons probably limits the frequency of attentional shifts.pdf | 2009-08-09 13:59 | 1.6M | |
![[ ]](/icons/layout.gif) | Skull flexure from blast waves - a mechanism for brain injury with implications for helmet design.pdf | 2009-08-31 13:20 | 2.3M | |
![[ ]](/icons/layout.gif) | Siren call of metaphor - subverting the proper task of computational neurophysics.pdf | 2009-02-27 05:46 | 39K | |
![[ ]](/icons/layout.gif) | Single-channel recording of ligand-gated ion channels.pdf | 2009-08-10 18:03 | 493K | |
![[ ]](/icons/layout.gif) | Simultaneous all-optical manipulation and recording of neural circuit activity with cellular resolution in vivo - 2014.pdf | 2016-01-03 20:14 | 2.9M | |
![[ ]](/icons/layout.gif) | Simulating extracted connectomes - 2017.pdf | 2017-09-27 04:55 | 4.0M | |
![[ ]](/icons/layout.gif) | Short frontal lobe connections of the human brain.pdf | 2014-11-30 18:38 | 4.8M | |
![[ ]](/icons/layout.gif) | Sequencing the connectome - 2012.pdf | 2014-03-26 03:35 | 500K | |
![[ ]](/icons/layout.gif) | Sequence identification of 2375 human brain genes.pdf | 2009-08-11 08:10 | 376K | |
![[ ]](/icons/layout.gif) | Septo-temporal gradients of neurogenesis and activity in 13-month-old rats_ J S Snyder_ 2011.pdf | 2012-02-09 16:43 | 1.3M | |
![[ ]](/icons/layout.gif) | Selective suppression of hippocampal ripples impairs spatial memory.pdf | 2009-12-31 11:16 | 288K | |
![[ ]](/icons/layout.gif) | Selective disruption of the blood-brain barrier by photochemical internalization.pdf | 2009-04-22 10:26 | 205K | |
![[IMG]](/icons/image2.gif) | Selection of cortical dynamics for motor behaviour by the basal ganglia.pdf.basal-ganglia-organization.figure-2.png | 2016-01-03 07:16 | 169K | |
![[ ]](/icons/layout.gif) | Selection of cortical dynamics for motor behaviour by the basal ganglia.pdf | 2015-11-23 01:18 | 2.6M | |
![[ ]](/icons/layout.gif) | Segregation of human neural stem cells in the developing primate forebrain.pdf | 2009-08-07 21:01 | 1.6M | |
![[ ]](/icons/layout.gif) | Seeking the neural substrates of visual working memory storage.pdf | 2013-08-16 11:21 | 152K | |
![[ ]](/icons/layout.gif) | Seeing scenes: topographic visual hallucinations evoked by direct electrical stimulation of the parahippocampal place area - 2014.pdf | 2015-01-10 10:59 | 824K | |
![[ ]](/icons/layout.gif) | Scanpaths and repeated internet images.pdf | 2009-08-02 21:23 | 1.5M | |
![[ ]](/icons/layout.gif) | Scaling of the Mammalian Brain: the Maternal Energy Hypothesis.pdf | 2014-12-08 22:06 | 1.7M | |
![[ ]](/icons/layout.gif) | Saturated reconstruction of a volume of neocortex - 2015.pdf | 2016-06-21 11:24 | 5.0M | |
![[ ]](/icons/layout.gif) | SOCS3 Deletion Promotes Optic Nerve Regeneration In Vivo.pdf | 2009-12-11 10:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Rosetta brains: A strategy for molecularly-annotated connectomics - Marblestone - Church - Boyden - 2014.pdf | 2014-04-21 17:09 | 414K | |
![[ ]](/icons/layout.gif) | Role of mechanical factors in the morphology of the primate cerebral cortex.pdf | 2009-08-08 07:23 | 521K | |
![[ ]](/icons/layout.gif) | Role of layer 6 of V2 visual cortex in object-recognition memory.pdf | 2009-07-07 09:42 | 347K | |
![[ ]](/icons/layout.gif) | Roadmap on neurophotonics - 2016.pdf | 2017-10-01 14:11 | 4.5M | |
![[ ]](/icons/layout.gif) | Review: Human-animal neurological chimeras: humanized animals or human cells in an animal? - 2018.pdf | 2019-02-19 20:13 | 387K | |
![[ ]](/icons/layout.gif) | Review - neuroimaging studies of shifting attention.pdf | 2009-08-08 07:44 | 578K | |
![[ ]](/icons/layout.gif) | Review - 2007 - AMPA receptor trafficking.pdf | 2009-04-22 10:35 | 876K | |
![[ ]](/icons/layout.gif) | Retrovirus-mediated single-cell gene knockout technique in adult newborn neurons in vivo.pdf | 2009-08-10 18:10 | 221K | |
![[ ]](/icons/layout.gif) | Reticularis thalami neurons revisited - activity changes during shifts in states of vigilance.pdf | 2009-08-09 14:34 | 2.0M | |
![[ ]](/icons/layout.gif) | Resolving single cone inputs to visual receptive fields.pdf | 2009-08-03 17:53 | 306K | |
![[ ]](/icons/layout.gif) | Representing exact numbers visually using a mental abacus - 2012.pdf | 2011-05-18 09:40 | 2.3M | |
![[ ]](/icons/layout.gif) | Representation of number in the brain.pdf | 2009-07-31 14:13 | 1.7M | |
![[ ]](/icons/layout.gif) | Representation of internal models of action in the autistic brain.pdf | 2009-12-31 11:18 | 247K | |
![[ ]](/icons/layout.gif) | Remote control of neuronal activity with a light-gated glutamate receptor.pdf | 2009-04-22 02:48 | 907K | |
![[ ]](/icons/layout.gif) | Reliable neuronal logic devices from patterned hippocampal cultures.pdf | 2009-04-25 11:03 | 1.1M | |
![[ ]](/icons/layout.gif) | Releasing dentate nucleus cells from purkinje cell inhibition generates output from the cerebrocerebellum.pdf | 2014-10-03 10:38 | 2.2M | |
![[ ]](/icons/layout.gif) | Relation_of_mathematical_ability_to_psychosis.pdf | 2009-04-21 21:42 | 86K | |
![[ ]](/icons/layout.gif) | Regulatory genes controlling cell fate choice in embryonic and adult neural stem cells.pdf | 2009-08-07 20:29 | 298K | |
![[IMG]](/icons/image2.gif) | Regulation of cerebral cortical size by control of cell cycle exit in neural precursors.pdf.png | 2009-08-12 07:54 | 306K | |
![[ ]](/icons/layout.gif) | Regulation of cerebral cortical size by control of cell cycle exit in neural precursors.pdf | 2009-08-12 07:54 | 1.3M | |
![[ ]](/icons/layout.gif) | Regional functionality of the cerebellum - 2015.pdf | 2016-01-06 09:17 | 862K | |
![[ ]](/icons/layout.gif) | Regional control of cortical lamination.pdf | 2009-12-31 11:16 | 433K | |
![[ ]](/icons/layout.gif) | Reestablishment of damaged adult motor pathways by grafted embryonic cortical neurons.pdf | 2009-12-31 11:06 | 896K | |
![[ ]](/icons/layout.gif) | Reduced apoptosis and cytochrome-c-mediated caspase activation in mice lacking caspase9.pdf | 2009-08-08 06:16 | 910K | |
![[ ]](/icons/layout.gif) | Recovery from paralysis in adult rats using embryonic stem cells.pdf | 2009-08-07 20:47 | 1.3M | |
![[ ]](/icons/layout.gif) | Recording, labeling, and transfection of single neurons in deep brain structures - 2015.pdf | 2016-01-06 20:11 | 2.8M | |
![[ ]](/icons/layout.gif) | Reconstruction of natural scenes from ensemble responses in cat visual cortex - Stanley - 1999.pdf | 2009-12-25 12:52 | 550K | |
![[ ]](/icons/layout.gif) | Reconstruction of complete connectivity matrix for connectomics by sampling neural connectivity with fluorescent synaptic markers - Mishchenko - 2011.pdf | 2015-08-06 04:15 | 463K | |
![[ ]](/icons/layout.gif) | Reconstruction of Natural Scenes from Ensemble Responses in the Lateral Geniculate Nucleus.pdf | 2009-02-27 05:46 | 553K | |
![[ ]](/icons/layout.gif) | Reconstruction and simulation of neocortical microcircuitry.pdf | 2015-10-07 08:05 | 14M | |
![[ ]](/icons/layout.gif) | Reconstructing the evolutionary history of microcephalin, a gene controlling human brain size.pdf | 2009-08-07 19:31 | 140K | |
![[ ]](/icons/layout.gif) | Recently-derived variants of brain-size genes ASPM, MCPH1, CDK5RAP and BRCA1 not associated with general cognition, reading or language.pdf | 2009-08-07 20:04 | 119K | |
![[ ]](/icons/layout.gif) | Real-Time Imaging of Discrete Exocytic Events Mediating Surface Delivery of AMPA Receptors.pdf | 2009-04-22 10:36 | 574K | |
![[ ]](/icons/layout.gif) | Rate of evolution of brain-expressed genes.pdf | 2009-08-07 19:55 | 163K | |
![[ ]](/icons/layout.gif) | Ras and Rap control AMPA receptor trafficking during synaptic plasticity.pdf | 2009-04-22 10:34 | 767K | |
![[ ]](/icons/layout.gif) | Rapid Structural Changes in Nerve Fibers and Cells Associated with Their Excitation Processes.pdf | 2009-04-21 21:47 | 2.4M | |
![[ ]](/icons/layout.gif) | Radio-controlled cyborg beetles - a radio-frequency system for insect neural flight control - Sato - 2009.pdf | 2010-05-22 10:07 | 574K | |
![[ ]](/icons/layout.gif) | Quantifying mesoscale neuroanatomy using X-ray microtomography - 2016.pdf | 2016-07-26 17:44 | 8.3M | |
![[ ]](/icons/layout.gif) | Prospects for optogenetic augmentation of brain function - 2015.pdf | 2016-07-26 10:40 | 738K | |
![[ ]](/icons/layout.gif) | Pronuclear injection for the production of transgenic mice.pdf | 2009-08-10 18:06 | 521K | |
![[ ]](/icons/layout.gif) | Projections from neocortex mediate top-down control of memory retrieval - 2015.pdf | 2016-01-03 20:18 | 17M | |
![[ ]](/icons/layout.gif) | Prefrontal organization of cognitive control according to levels of abstraction.pdf | 2009-09-04 08:38 | 564K | |
![[ ]](/icons/layout.gif) | Prefrontal cortex asymmetry for memory encoding of words and abstract shapes - rTMS - verbal items in the left prefrontal cortex.pdf | 2009-08-04 19:50 | 299K | |
![[ ]](/icons/layout.gif) | Prefrontal and striatal dopaminergic genes predict individual differences in exploration and exploitation.pdf | 2009-12-31 11:19 | 742K | |
![[ ]](/icons/layout.gif) | Prefrontal Norepinephrine Determines Attribution of High Motivational Salience journal.pone.0003044.pdf | 2009-04-22 02:45 | 187K | |
![[ ]](/icons/layout.gif) | Prediction of human intelligence using morphometric characteristics of cerebral cortex.pdf | 2011-09-10 04:33 | 583K | |
![[ ]](/icons/layout.gif) | Possible existence of optical communication channels in the brain - 2016.pdf | 2016-07-11 17:30 | 2.2M | |
![[ ]](/icons/layout.gif) | Phytochemicals that regulate neurodegenerative disease by targeting neurotrophins: A comprehensive review.pdf | 2015-11-24 09:28 | 2.0M | |
![[ ]](/icons/layout.gif) | Physical principles for scalable neural recording - Marblestone.pdf | 2014-01-14 01:56 | 1.9M | |
![[ ]](/icons/layout.gif) | Photosensitivity of neurons enabled by cell-targeted gold nanoparticles - 2015.pdf | 2016-07-26 10:39 | 1.6M | |
![[ ]](/icons/layout.gif) | Photoinactivation of Native AMPA Receptors Reveals Their Real-Time Trafficking.pdf | 2009-04-22 10:31 | 448K | |
![[ ]](/icons/layout.gif) | Photoconductive stimulation of neurons cultured on silicon wafers.pdf | 2009-08-10 18:22 | 477K | |
![[ ]](/icons/layout.gif) | Photoactivation of an acid-sensitive ion channel associated with vision and pain - 2016.pdf | 2016-05-02 14:26 | 1.0M | |
![[ ]](/icons/layout.gif) | Personal space regulation by the human amygdala.pdf | 2009-12-31 11:17 | 217K | |
![[ ]](/icons/layout.gif) | Perirhinal input to neocortical layer 1 controls learning - 2019.pdf | 2019-12-30 13:16 | 2.2M | |
![[ ]](/icons/layout.gif) | Pax6 controls cerebral cortical cell number by regulating exit from the cell cycle and specifies cortical cell identity by a cell autonomous mechanism.pdf | 2009-08-08 07:19 | 3.9M | |
![[ ]](/icons/layout.gif) | Patterning centers, regulatory genes and extrinsic mechanisms controlling arealization of the neocortex - 2002.pdf | 2013-02-04 06:24 | 1.8M | |
![[ ]](/icons/layout.gif) | Parallel organization of functionally segregated circuits linking basal ganglia and cortex.pdf | 2014-12-01 17:48 | 627K | |
![[ ]](/icons/layout.gif) | Parallel network simulations with NEURON.pdf | 2010-03-27 11:27 | 2.5M | |
![[ ]](/icons/layout.gif) | PET quantification of cerebral oxygen metabolism in small animals.pdf | 2014-08-17 01:30 | 2.6M | |
![[ ]](/icons/layout.gif) | PDF-modulated visual inputs and cryptochrome define diurnal behavior in Drosophila.pdf | 2009-12-31 11:14 | 1.1M | |
![[ ]](/icons/layout.gif) | Oxytocin increases gaze to the eye region of human faces - 2008.pdf | 2013-05-02 06:55 | 83K | |
![[ ]](/icons/layout.gif) | Oxytocin Enhances Social Persuasion during Hypnosis_ Richard A Bryant_ Lynette Hung_ PONE 2013.pdf | 2010-07-07 05:07 | 253K | |
![[ ]](/icons/layout.gif) | Origins of the brain networks for advanced mathematics in expert mathematicians - 2016.pdf | 2016-04-29 00:58 | 2.1M | |
![[ ]](/icons/layout.gif) | Origins of numerical knowledge - 1995.pdf | 2017-12-22 14:19 | 633K | |
![[ ]](/icons/layout.gif) | Organization and evolution of brain lipidome revealed by large-scale analysis of human, chimpanzee, macaque, and mouse tissues.pdf | 2015-12-06 16:17 | 1.6M | |
![[ ]](/icons/layout.gif) | Organic electronics for precise delivery of neurotransmitters to modulate mammalian sensory function.pdf | 2010-02-20 14:40 | 542K | |
![[ ]](/icons/layout.gif) | Optogenetic stimulation of a hippocampal engram activates fear memory recall - 2012.pdf | 2012-03-24 18:11 | 1.2M | |
![[ ]](/icons/layout.gif) | Optogenetics: 10 years of microbial opsins in neuroscience - review - 2016.pdf | 2016-07-26 10:40 | 2.9M | |
![[ ]](/icons/layout.gif) | Optogenetic monitoring of synaptic activity with genetically encoded voltage indicators - 2016.pdf | 2016-11-12 05:14 | 2.1M | |
![[ ]](/icons/layout.gif) | Optical magnetic detection of single-neuron action potentials using quantum defects in diamond - 2016.pdf | 2016-02-02 17:13 | 5.7M | |
![[ ]](/icons/layout.gif) | Optical dissection of brain circuits with patterned illumination through the phase modulation of light - 2014.pdf | 2016-01-03 20:12 | 3.4M | |
![[ ]](/icons/layout.gif) | On the technology prospects and investment opportunities for scalable neuroscience - 2013.pdf | 2013-07-29 22:25 | 666K | |
![[ ]](/icons/layout.gif) | On the reversible abrupt structural changes in nerve fibers underlying their excitation and conduction processes.pdf | 2009-05-04 06:58 | 3.0M | |
![[ ]](/icons/layout.gif) | On the possible shapes of the brain.pdf | 2012-12-04 15:04 | 925K | |
![[ ]](/icons/layout.gif) | On the action potential as a propagating density pulse and the role of anesthetics.pdf | 2009-07-29 21:20 | 645K | |
![[ ]](/icons/layout.gif) | On the action potential as a propagating density.pdf | 2009-04-21 21:39 | 645K | |
![[ ]](/icons/layout.gif) | On optical detection of densely labeled synapses in neuropil and mapping connectivity with combinatorially multiplexed fluorescent synaptic markers - Mishchenko - 2010.pdf | 2014-03-26 00:39 | 1.7M | |
![[ ]](/icons/layout.gif) | Nonviral Approaches for Neuronal Delivery of Nucleic Acids.pdf | 2009-04-17 20:48 | 511K | |
![[ ]](/icons/layout.gif) | Noninvasive brain stimulation for the study of memory enhancement in aging - 2015.pdf | 2015-10-13 05:52 | 630K | |
![[ ]](/icons/layout.gif) | New insights into the classification and nomenclature of cortical GABAergic interneurons.pdf | 2013-09-14 00:15 | 1.1M | |
![[ ]](/icons/layout.gif) | Neurons in the orbitofrontal cortex encode economic value.pdf | 2009-05-04 20:49 | 502K | |
![[ ]](/icons/layout.gif) | Neurons in monkey visual area V2 encode combinations of orientations.pdf | 2009-12-31 11:06 | 942K | |
![[ ]](/icons/layout.gif) | Neurons go toward the light.pdf | 2009-04-21 21:38 | 180K | |
![[ ]](/icons/layout.gif) | Neuron anatomy structure reconstruction based on a sliding filter - 2015.pdf | 2016-03-26 07:27 | 2.4M | |
![[ ]](/icons/layout.gif) | Neuronal subtype specification in the cerebral cortex - 2007.pdf | 2012-04-30 09:06 | 624K | |
![[ ]](/icons/layout.gif) | Neuronal morphology of the visual and motor cortices in the giraffe (Giraffa cameloparadalis).pdf | 2015-12-06 16:12 | 4.8M | |
![[ ]](/icons/layout.gif) | Neuronal correlates of obsessions in the caudate nucleus.pdf | 2009-05-04 16:36 | 2.1M | |
![[ ]](/icons/layout.gif) | Neurometabolic coupling in cerebral cortex reflects synaptic more than spiking activity.pdf | 2009-12-31 11:07 | 328K | |
![[IMG]](/icons/image2.gif) | Neurokernel: An open source platform for emulating the fruit fly brain - 2016.pdf.fig1.jpg | 2016-03-26 06:54 | 74K | |
![[ ]](/icons/layout.gif) | Neurokernel: An open source platform for emulating the fruit fly brain - 2016.pdf | 2016-03-26 06:53 | 4.8M | |
![[ ]](/icons/layout.gif) | Neuroanatomy of the killer whale (Orcinus orca): a magnetic resonance imaging investigation of structure with insights on function and evolution - 2016.pdf | 2016-12-11 23:25 | 2.4M | |
![[IMG]](/icons/image2.gif) | Neuroanatomy goes viral - Summary of viruses of interest to neuroanatomists.png | 2017-01-15 13:50 | 212K | |
![[ ]](/icons/layout.gif) | Neuroanatomy goes viral - 2015.pdf | 2016-07-14 23:31 | 2.6M | |
![[ ]](/icons/layout.gif) | Neuroanatomical correlates of intelligence.pdf | 2009-08-08 07:12 | 401K | |
![[ ]](/icons/layout.gif) | Neuro-behavioral ontogeny: A synthesis of ethological and neurophysiological concepts.pdf | 2010-12-07 14:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Neural dust: an ultrasonic, low power solution for chronic brain-machine interfaces.pdf | 2013-07-22 12:27 | 1.8M | |
![[ ]](/icons/layout.gif) | Neural differentiation of mouse embryonic stem cells in chemically defined medium.pdf | 2009-08-07 20:54 | 953K | |
![[ ]](/icons/layout.gif) | Neural correlates underlying mental calculation in abacus experts: a functional magnetic resonance imaging study.pdf | 2010-07-03 10:19 | 720K | |
![[ ]](/icons/layout.gif) | Neural correlates of the psychedelic state as determined by fMRI studies with psilocybin.pdf | 2012-01-23 11:26 | 884K | |
![[ ]](/icons/layout.gif) | Neural activations at the junctions of the inferior frontal sulcus and the inferior precentral sulcus - interindividual variability, reliability and association with sulcal morphology.pdf | 2009-08-08 07:30 | 886K | |
![[ ]](/icons/layout.gif) | Network cloning using DNA barcodes - 2016.pdf | 2016-11-03 17:01 | 539K | |
![[ ]](/icons/layout.gif) | Native GABA beta receptors are heteromultimers with a family of auxiliary subunits.supplementary.pdf | 2010-04-26 10:35 | 5.6M | |
![[ ]](/icons/layout.gif) | Native GABA beta receptors are heteromultimers with a family of auxiliary subunits.pdf | 2010-04-26 10:35 | 871K | |
![[TXT]](/icons/text.gif) | NEURON_bibliography.html | 2009-05-26 06:26 | 191K | |
![[ ]](/icons/layout.gif) | Muscle and timing-specific functional connectivity between the dorsolateral prefrontal cortex and the primary motor cortex.pdf | 2016-01-02 20:45 | 377K | |
![[ ]](/icons/layout.gif) | Multiplexed neural recording along a single optical fiber via optical reflectometry - Boyden - 2016.pdf | 2016-05-18 19:43 | 769K | |
![[ ]](/icons/layout.gif) | Multiplexed confocal and super-resolution fluorescence imaging of cytoskeletal and neuronal synapse proteins - Boyden - 2017.pdf | 2017-03-11 18:35 | 17M | |
![[ ]](/icons/layout.gif) | Multiple-color optical activation, silencing, and desynchronization of neural activity, with single-spike temporal resolution - Boyden.pdf | 2009-05-27 15:14 | 525K | |
![[ ]](/icons/layout.gif) | Multidimensional heritability analysis of neuroanatomical shape - 2016.pdf | 2016-10-15 08:31 | 5.4M | |
![[ ]](/icons/layout.gif) | Multi-electrode array recording and data analysis methods for molluscan central nervous systems - Passaro - 2010.pdf | 2012-12-07 01:04 | 8.2M | |
![[ ]](/icons/layout.gif) | Mood state effects of chocolate.pdf | 2009-04-21 21:36 | 166K | |
![[ ]](/icons/layout.gif) | Monkey to human comparative anatomy of the frontal lobe association tracts.pdf | 2012-02-02 10:36 | 1.9M | |
![[ ]](/icons/layout.gif) | Molecular insights into human brain evolution.pdf | 2009-08-07 19:42 | 221K | |
![[ ]](/icons/layout.gif) | Molecular genetic determinants of human brain size.pdf | 2009-08-07 19:44 | 118K | |
![[ ]](/icons/layout.gif) | Molecular evolution of microcephalin, a gene determining human brain size.pdf | 2009-05-14 06:16 | 127K | |
![[ ]](/icons/layout.gif) | Modular structure facilitates mosaic evolution of the brain in chimpanzees and humans.pdf | 2015-12-06 16:22 | 955K | |
![[ ]](/icons/layout.gif) | Model validation of untethered, ultrasonic neural dust motes for cortical recording - 2015.pdf | 2015-04-03 14:16 | 2.0M | |
![[ ]](/icons/layout.gif) | Modeling the formation process of grouping stimuli sets through cortical columns and microcircuits to feature neurons.pdf | 2014-03-26 06:24 | 2.0M | |
![[ ]](/icons/layout.gif) | Mitotic spindle regulation by nde1 controls cerebral cortical size.pdf | 2009-08-08 06:38 | 1.0M | |
![[ ]](/icons/layout.gif) | Mitotic spindle regulation by Nde1 controls cerebral cortical size.pdf | 2009-08-12 07:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Mitigating cognitive bottlenecks via an augmented cognition adaptive system.pdf | 2006-03-27 19:59 | 630K | |
![[ ]](/icons/layout.gif) | Millisecond-timescale, genetically targeted optical control of neural activity - Boyden.pdf | 2009-05-27 15:09 | 656K | |
![[ ]](/icons/layout.gif) | Millisecond-scale differences in neural activity in auditory cortex can drive decisions.pdf | 2014-04-24 18:10 | 968K | |
![[ ]](/icons/layout.gif) | Microstructural maturation of the human brain from childhood to adulthood.pdf | 2008-09-24 08:28 | 1.7M | |
![[ ]](/icons/layout.gif) | Microstimulation of visual cortex affects the speed of perceptual decisions.pdf | 2009-05-04 20:52 | 364K | |
![[ ]](/icons/layout.gif) | Microfluidic culture platform for neuroscience research.pdf | 2009-08-10 18:17 | 476K | |
![[ ]](/icons/layout.gif) | Micro- and nanotechnologies for optical neural interfaces - review - 2016.pdf | 2016-07-15 14:02 | 3.6M | |
![[ ]](/icons/layout.gif) | Methylphenidate improves working memory and set‐shifting in ADHD: relationships to baseline memory capacity.pdf | 2012-01-24 07:07 | 262K | |
![[ ]](/icons/unknown.gif) | Methylphenidate enhances working memory by modulating discrete frontal and parietal lobe regions in the human brain | 2008-06-24 07:48 | 300K | |
![[ ]](/icons/layout.gif) | Metabolic constraint imposes tradeoff between body size and number of brain neurons in human evolution.pdf | 2013-05-27 13:03 | 456K | |
![[ ]](/icons/layout.gif) | Meta-analytic evidence for a superordinate cognitive control network subserving diverse executive functions.pdf | 2013-11-18 15:23 | 1.4M | |
![[ ]](/icons/layout.gif) | Meta-analysis of structural imaging findings in attention-deficit hyperactivity disorder.pdf | 2008-04-02 12:28 | 175K | |
![[ ]](/icons/layout.gif) | Mental imagery of faces and places activates corresponding stimulus-specific brain regions.pdf | 2014-04-24 19:57 | 368K | |
![[ ]](/icons/layout.gif) | Memory engram storage and retrieval - 2015.pdf | 2015-11-25 18:44 | 1.2M | |
![[ ]](/icons/layout.gif) | Memory Networks: Answering the Call of the Hippocampus.pdf | 2010-06-12 09:28 | 40K | |
![[ ]](/icons/layout.gif) | Membrane Tension Maintains Cell Polarity by Confining Signals to the Leading Edge during Neutrophil Migration_ A R Houk_ A Jilkine_ C o Mejean_ R Boltyanskiy_ E R Dufresne_ S B Angenet_ S J Altschuler_ L F Wu_ O D Weiner_ Cell 2012.pdf | 2012-01-25 14:24 | 1.7M | |
![[ ]](/icons/layout.gif) | Mechanisms of sensory transduction in the skin.pdf | 2011-06-11 17:03 | 452 | |
![[ ]](/icons/layout.gif) | Mechanical model of brain convolutional development.pdf | 2009-08-08 16:49 | 29K | |
![[ ]](/icons/layout.gif) | Maternal infection leads to abnormal gene regulation and brain atrophy in mouse offspring.pdf | 2009-08-07 20:21 | 1.3M | |
![[ ]](/icons/layout.gif) | Mapping the hierarchical layout of the structural network of the macaque prefrontal cortex.pdf | 2014-11-30 16:21 | 7.0M | |
![[ ]](/icons/layout.gif) | Mapping of the human visual cortex using image-guided transcranial magnetic stimulation.pdf | 2009-04-12 15:14 | 638K | |
![[ ]](/icons/layout.gif) | Manipulating the experienced onset of intention after action execution by TMS.pdf | 2010-01-03 08:04 | 693K | |
![[ ]](/icons/layout.gif) | Manipulating gene expressions by electroporation in the developing brain of mammalian embryos.pdf | 2009-08-08 15:40 | 141K | |
![[ ]](/icons/layout.gif) | Mania-like behavior induced by disruption of CLOCK.pdf | 2009-07-11 06:30 | 517K | |
![[ ]](/icons/layout.gif) | Magnetoelectric materials for miniature, wireless neural stimulation at therapeutic frequencies - 2018.pdf | 2018-11-06 10:38 | 8.1M | |
![[ ]](/icons/layout.gif) | Magnetic micro- and nanoparticle mediated activation of mechanosensitive ion channels.pdf | 2009-04-21 05:21 | 1.4K | |
![[ ]](/icons/layout.gif) | MRI Reporter Genes.pdf | 2011-06-11 17:00 | 30K | |
![[ ]](/icons/layout.gif) | Long-term memory: scaling of information to brain size - Donald R. Forsdyke.pdf | 2013-11-13 17:00 | 274K | |
![[ ]](/icons/layout.gif) | Long-term cultured human umbilical cord neural-like cells transplanted into the striatum of NOD SCID mice.pdf | 2009-08-07 20:56 | 2.8M | |
![[ ]](/icons/layout.gif) | Long-term, high-resolution imaging in the mouse neocortex through a chronic cranial window.pdf | 2009-08-10 17:55 | 1.8M | |
![[ ]](/icons/layout.gif) | Live imaging of synapse development and measuring protein dynamics using two-color fluorescence recovery after photo-bleaching at Drosophila synapses.pdf | 2009-08-10 18:00 | 552K | |
![[ ]](/icons/layout.gif) | Lipids make smooth brains gyrate.pdf | 2009-08-08 10:13 | 456K | |
![[ ]](/icons/layout.gif) | Limited memory can be beneficial for the evolution of cooperation.pdf | 2012-02-10 07:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Light-activated ion channels for remote control of neuronal firing.pdf | 2009-04-22 03:57 | 525K | |
![[ ]](/icons/layout.gif) | Leveraging grammar and reinforcement learning for neural program synthesis - 2018.pdf | 2018-05-22 18:03 | 456K | |
![[ ]](/icons/layout.gif) | Lesion mapping of cognitive control and value-based decision making in the prefrontal cortex - 2012.pdf | 2016-01-01 22:22 | 2.9M | |
![[ ]](/icons/layout.gif) | Learning induces long-term potentiation in the hippocampus.pdf | 2009-05-04 20:50 | 391K | |
![[ ]](/icons/layout.gif) | Language evolution and human development.pdf | 2015-05-25 10:50 | 401K | |
![[ ]](/icons/layout.gif) | Laminar and neurochemical organization of the dorsal cochlear nucleus of the human, monkey, cat, and rodents.pdf | 2015-12-06 16:19 | 2.3M | |
![[ ]](/icons/compressed.gif) | LILFU.tar.gz | 2011-06-07 16:39 | 13M | |
![[ ]](/icons/layout.gif) | Kinetics of M1 muscarinic receptor and G protein signaling to phospholipase C in living cells.pdf | 2010-02-25 08:09 | 4.7M | |
![[ ]](/icons/layout.gif) | Kilosort: realtime spike-sorting for extracellular electrophysiology with hundreds of channels - 2016.pdf | 2016-07-13 13:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Is yawning an arousal defense reflex.pdf | 2009-08-02 19:44 | 176K | |
![[ ]](/icons/layout.gif) | Isolation of skin-derived precursors (SKPs) and differentiation and enrichment of their Schwann cell progeny.pdf | 2009-08-10 18:12 | 2.4M | |
![[ ]](/icons/layout.gif) | Isolation, Characterization, and use of Stem Cells from the CNS.pdf | 2009-08-08 15:29 | 957K | |
![[ ]](/icons/layout.gif) | Irrational exuberance and neural crash warning signals during endogenous experimental market bubbles.pdf | 2014-07-09 04:26 | 889K | |
![[ ]](/icons/layout.gif) | Ion channels provide a cellular short-term memory of locomotion in the Drosophila larval motor circuit.pdf | 2009-12-31 11:08 | 444K | |
![[ ]](/icons/layout.gif) | In vivo single-cell electroporation for transfer of DNA and macromolecules.pdf | 2009-08-10 18:20 | 385K | |
![[ ]](/icons/layout.gif) | In vivo rapid gene delivery into postmitotic neocortical neurons using iontoporation - 2015.pdf | 2016-01-06 20:09 | 1.0M | |
![[ ]](/icons/layout.gif) | In vivo magnetic recording of neuronal activity - 2016.pdf | 2016-12-19 20:03 | 1.9M | |
![[ ]](/icons/layout.gif) | In vivo imaging of single axons in the mouse spinal cord.pdf | 2009-08-10 18:08 | 328K | |
![[ ]](/icons/layout.gif) | In vivo electroporation in the embryonic mouse central nervous system.pdf | 2009-08-10 18:18 | 501K | |
![[ ]](/icons/layout.gif) | In vivo SELEX for identification of brain-penetrating aptamers.pdf | 2013-04-10 11:34 | 2.1M | |
![[ ]](/icons/layout.gif) | Inverted-U dopamine D1 receptor actions on prefrontal neurons engaged in working memory.pdf | 2014-04-24 20:11 | 0 | |
![[ ]](/icons/layout.gif) | Intrinsic architecture underlying the relations among the default, dorsal attention, and frontoparietal control networks of the human brain.pdf | 1969-12-31 16:00 | 470K | |
![[ ]](/icons/layout.gif) | Intrathalamic sensory connections mediated by the thalamic reticular nucleus.pdf | 2009-08-09 13:48 | 461K | |
![[ ]](/icons/layout.gif) | Intranasal delivery of cells to the brain.pdf | 2009-08-13 18:37 | 4.3M | |
![[ ]](/icons/layout.gif) | Intergenerational transmission of self-regulation: A multidisciplinary review and integrative conceptual framework.pdf | 2016-03-17 07:56 | 1.1M | |
![[ ]](/icons/layout.gif) | Intense world syndrome - an alternative hypothesis for autism - Markram.pdf | 2012-07-09 10:27 | 527K | |
![[ ]](/icons/layout.gif) | Intellectual ability and cortical development in children and adolescents - 2006.pdf | 2016-05-06 21:17 | 360K | |
![[ ]](/icons/layout.gif) | Intact rapid detection of fearful faces in the absence of the amygdala .pdf | 2009-12-31 11:16 | 155K | |
![[ ]](/icons/layout.gif) | Instructive role of wnt and beta-catenin in sensory fate specification in neural crest stem cells.pdf | 2009-08-07 18:58 | 450K | |
![[ ]](/icons/layout.gif) | Insights into the gyrification of developing ferret brain by magnetic resonance imaging.pdf | 2009-08-08 16:51 | 384K | |
![[ ]](/icons/layout.gif) | Inferior Olive Oscillations as the Temporal Basis for Motricity and Oscillatory Reset as the Basis for Motor Error Correction_ R R LLinas_ nihms-195496_ 2009.pdf | 2012-02-02 10:00 | 2.0M | |
![[ ]](/icons/layout.gif) | Individual differences in verbal creative thinking are reflected in the precuneus.pdf | 2016-06-19 18:21 | 2.7M | |
![[ ]](/icons/layout.gif) | Individual differences in executive function are almost entirely genetic in origin.pdf | 2009-06-17 15:13 | 391K | |
![[ ]](/icons/layout.gif) | Increased neuronal production, enlarged forebrains and cytoarchitectural distortions in beta-catenin overexpressing transgenic mice.pdf | 2009-08-08 06:39 | 1.3M | |
![[ ]](/icons/layout.gif) | Incorporation of new information into prefrontal cortical activity after learning working memory tasks.pdf | 2012-04-09 14:01 | 1.0M | |
![[ ]](/icons/layout.gif) | Inactivating the activated - identifying functions of specific neural networks.pdf | 2009-08-03 17:52 | 213K | |
![[ ]](/icons/layout.gif) | Improved tools for the brainbow toolbox - 2013.pdf | 2016-07-15 13:37 | 5.3M | |
![[ ]](/icons/layout.gif) | Imaging human connectomes at the macroscale.pdf | 2013-06-21 00:57 | 2.2M | |
![[ ]](/icons/layout.gif) | Imaging GFP-based reporters in neurons with multiwavelength optogenetic control - 2014.pdf | 2015-02-12 06:13 | 874K | |
![[ ]](/icons/layout.gif) | If engrams are the answer, what is the question? - 2023.pdf | 2024-06-18 07:11 | 437K | |
![[ ]](/icons/layout.gif) | Identifying natural images from human brain activity.pdf | 2009-05-04 16:36 | 456K | |
![[ ]](/icons/layout.gif) | Identification of common variants associated with human hippocampal and intracranial volumes - 2012.pdf | 2017-01-07 12:23 | 2.1M | |
![[ ]](/icons/layout.gif) | Identification of a neural stem cell in the adult mammalian central nervous system.pdf | 2009-08-07 20:23 | 394K | |
![[ ]](/icons/layout.gif) | Identification and functional analysis of Trnp1 - a novel DNA associated protein with a key role in neurogenesis.pdf | 2013-07-08 03:20 | 8.5M | |
![[ ]](/icons/layout.gif) | Hyper-connectivity and hyper-plasticity in the medial prefrontal cortex in the valproic acid animal model of autism.pdf | 2009-08-08 17:44 | 1.0M | |
![[ ]](/icons/layout.gif) | Human neural stem cells improve sensorimotor deficits in the adult rat brain with experimental focal ischemia.pdf | 2009-08-08 15:32 | 578K | |
![[ ]](/icons/layout.gif) | Human iPSC-derived neurons and lymphoblastoid cells for personalized medicine research in neuropsychiatric disorders - 2016.pdf | 2016-11-12 06:37 | 3.1M | |
![[ ]](/icons/layout.gif) | Human face recognition ability is specific and highly heritable.pdf | 2010-03-02 09:54 | 212K | |
![[ ]](/icons/layout.gif) | Human cortex project - workflow from the Allen Institute.pdf | 2008-06-28 16:52 | 233K | |
![[ ]](/icons/layout.gif) | Human auditory system response to modulated electromagnetic energy.pdf | 2011-02-08 17:01 | 69K | |
![[ ]](/icons/layout.gif) | Human-specific transcriptional networks in the brain.pdf | 2014-02-04 12:28 | 2.4M | |
![[ ]](/icons/layout.gif) | Human-specific ARHGAP11B increases size and folding of primate neocortex in the fetal marmoset - 2020.pdf | 2020-11-15 08:46 | 2.3M | |
![[ ]](/icons/layout.gif) | Human-chimpanzee differences in a FZD8 enhancer alter cell cycle dynamics in the developing neocortex - 2016.pdf | 2020-01-04 10:37 | 907K | |
![[ ]](/icons/layout.gif) | How unrealistic optimism is maintained in the face of reality.pdf | 2011-10-17 13:50 | 678K | |
![[ ]](/icons/layout.gif) | How to increase serotonin in the human brain without drugs.pdf | 2010-03-02 09:47 | 85K | |
![[ ]](/icons/layout.gif) | How many variables can the human process.pdf | 2009-08-04 20:03 | 182K | |
![[ ]](/icons/layout.gif) | How humans evolved large brains: comparative evidence.pdf | 2014-08-06 08:47 | 554K | |
![[ ]](/icons/layout.gif) | Hippocampal interneurons express a novel form of synaptic plasticity - McMahonKauer.pdf | 2009-06-28 17:59 | 589K | |
![[ ]](/icons/layout.gif) | High-throughput mapping of single neuron projections by sequencing of barcoded RNA - 2016.pdf | 2016-07-13 14:35 | 3.8M | |
![[ ]](/icons/layout.gif) | High-efficiency transfection of mammalian neurons via nucleofection.pdf | 2009-08-10 18:05 | 349K | |
![[ ]](/icons/layout.gif) | Hierarchical cognitive control deficits following damage to the human frontal lobe.pdf | 2012-08-31 15:48 | 527K | |
![[ ]](/icons/layout.gif) | Hes genes regulate size, shape and histogenesis of the nervous system by control of the timing of neural stem cell differentiation .pdf | 2009-08-08 06:35 | 1.6M | |
![[ ]](/icons/layout.gif) | HBP_flagship.pdf | 2012-06-15 00:48 | 8.0M | |
![[ ]](/icons/layout.gif) | Guiding attention guides thought - eye movements and problem solving.pdf | 2009-08-02 20:27 | 110K | |
![[ ]](/icons/layout.gif) | Guiding attention by external control of the scanpath.pdf | 2009-08-02 21:13 | 687K | |
![[ ]](/icons/layout.gif) | Green Tea Polyphenols Rescue of Brain Defects Induced by Overexpression of DYRK1A.pdf | 2010-02-15 16:04 | 597K | |
![[ ]](/icons/layout.gif) | Gold-core nanoparticles for non-invasive tracking of neuroreceptor distributions - Russell Hanson.pdf | 2012-12-06 16:01 | 86K | |
![[ ]](/icons/layout.gif) | Goal-driven cognition in the brain: a computational framework.pdf | 2014-04-30 17:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Getting axons onto the right path - the role of transcription factors in axon guidance.pdf | 2009-08-07 21:07 | 395K | |
![[ ]](/icons/layout.gif) | Genome-wide association meta-analysis of 78,308 individuals identifies new loci and genes influencing human intelligence - 2017.pdf | 2017-05-26 18:28 | 13M | |
![[ ]](/icons/layout.gif) | Genetic variability of human brain size and nongenetic variability of cortical gyral patterns.pdf | 2009-08-07 19:33 | 384K | |
![[ ]](/icons/layout.gif) | Genetic links between brain development and brain evolution.pdf | 2009-08-07 19:25 | 615K | |
![[ ]](/icons/layout.gif) | Genetic influences on brain structure.pdf | 2009-08-07 19:37 | 1.1M | |
![[ ]](/icons/layout.gif) | Genetic foundations of human intelligence.pdf | 2014-12-30 14:09 | 397K | |
![[ ]](/icons/layout.gif) | Genetic enhancement of learning and memory in mice - doogie mice - 1999.pdf | 2019-02-22 06:55 | 386K | |
![[ ]](/icons/layout.gif) | Genetic enhancement of cognition in a kindred with cone-rod dystrophy due to RIMS1 mutation - 2007.pdf | 2017-04-22 15:16 | 2.1M | |
![[ ]](/icons/layout.gif) | Genetic control of cortical convolutions.pdf | 2009-08-08 16:57 | 144K | |
![[ ]](/icons/layout.gif) | Genetic contributions to human gyrification - sulcal morphometry in Williams syndrome.pdf | 2009-08-12 07:40 | 376K | |
![[ ]](/icons/layout.gif) | Genetic basis of human brain evolution.pdf | 2009-08-07 19:22 | 375K | |
![[ ]](/icons/layout.gif) | Genetic analysis of the mouse brain proteome.pdf | 2009-08-07 19:36 | 1.4M | |
![[ ]](/icons/layout.gif) | Genesis of neuronal and glial progenitors in the cerebellar cortex of peripuberal and adult rabbits.pdf | 2009-08-08 16:33 | 1.1M | |
![[ ]](/icons/layout.gif) | Genes contributing to subcortical volumes and intellectual ability implicate the thalamus - 2014.pdf | 2014-04-24 04:37 | 300K | |
![[ ]](/icons/layout.gif) | Genes and signaling pathways involved in memory enhancement in mutant mice - 2014.pdf | 2017-08-28 05:14 | 593K | |
![[ ]](/icons/layout.gif) | Generation of neurons and astrocytes from isolated cells of the adult mammalian central nervous system.pdf | 2009-08-08 16:36 | 1.9M | |
![[ ]](/icons/layout.gif) | Generation of dense statistical connectomes from sparse morphological data - Egger - 2014.pdf | 2016-03-18 07:54 | 11M | |
![[ ]](/icons/layout.gif) | Generation of dense statistical connectomes from sparse morphological data - 2014.pdf | 2016-03-18 07:53 | 29M | |
![[ ]](/icons/layout.gif) | Gene expression during zombie ant biting behavior reflects the complexity underlying fungal parasitic behavioral manipulation.pdf | 2015-10-16 20:47 | 1.2M | |
![[ ]](/icons/layout.gif) | Gene delivery into mouse retinal ganglion cells by in utero electroporation.pdf | 2009-08-07 21:11 | 1.3M | |
![[ ]](/icons/layout.gif) | Ganguli - Theoretical Neuroscience and Deep Learning.pdf | 2017-08-04 06:16 | 35M | |
![[ ]](/icons/layout.gif) | Fundamental limits on the consolidation of information in working memory - delayed working memory consolidation during the attentional blink.pdf | 2009-08-02 20:18 | 160K | |
![[ ]](/icons/layout.gif) | Functional specialization and flexibility in human association cortex - 2014.pdf | 2014-09-24 00:15 | 2.2M | |
![[ ]](/icons/layout.gif) | Functional neural anatomy of talent.pdf | 2009-08-04 20:10 | 329K | |
![[ ]](/icons/layout.gif) | Functional consequences of animal-to-animal variation in circuit parameters.pdf | 2009-12-31 11:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Frontal lobe volume is not enough to explain human novelties.pdf | 2009-08-12 07:54 | 316K | |
![[ ]](/icons/layout.gif) | Frontal activations associated with accessing and evaluating information in working memory: an fMRI study.pdf | 2007-01-25 08:50 | 294K | |
![[ ]](/icons/layout.gif) | From a meso-to micro-scale connectome: array tomography and mGRASP - 2015.pdf | 2016-10-22 06:48 | 3.3M | |
![[ ]](/icons/layout.gif) | Fractionally predictive spiking neurons.pdf | 2010-11-15 17:53 | 602K | |
![[ ]](/icons/layout.gif) | Foxd1 is required for proper formation of the optic chiasm.pdf | 2009-08-07 21:06 | 1.0M | |
![[ ]](/icons/layout.gif) | Fluorescent protein tagging of endogenous protein in brain neurons using CRISPR-Cas9-mediated knock-in and in utero electroporation techniques - 2016.pdf | 2016-11-12 05:41 | 2.3M | |
![[ ]](/icons/unknown.gif) | Fluorescence changes reveal kinetic steps of muscarinic receptor-mediated modulation of phosphoinositides and Kv7.2 and Kv7.3 K+ channels.pdf | 2010-02-25 08:10 | 3.7M | |
![[ ]](/icons/layout.gif) | Flexible communication and control protocol for injectable neuromuscular interfaces.pdf | 2009-07-24 07:54 | 2.6M | |
![[ ]](/icons/layout.gif) | Flavonoid fisetin promotes ERK-dependent long-term potentiation and enhances memory.pdf | 2010-02-15 16:04 | 967K | |
![[ ]](/icons/layout.gif) | Flash memory: photochemical imprinting of neuronal action potentials onto a microbial rhodopsin - 2014.pdf | 2014-01-31 12:16 | 2.7M | |
![[IMG]](/icons/image2.gif) | Fetal_Brain_1Trim_E8_1.jpg | 2009-08-08 16:00 | 161K | |
![[ ]](/icons/layout.gif) | Feasibility of whole brain emulation - Anders Sandberg.pdf | 2012-10-10 06:28 | 266K | |
![[ ]](/icons/layout.gif) | Feasibility of 3d reconstruction of neural morphology using extension microscopy and barcode-guided agglomeration - Marblestone - Boyden - 2017.pdf | 2017-10-23 03:26 | 3.7M | |
![[ ]](/icons/layout.gif) | Fast 3D imaging of spine, dendritic, and neuronal assemblies in behaving animals - 2016.pdf | 2017-02-13 05:28 | 6.7M | |
![[ ]](/icons/layout.gif) | Facilitation and restoration of cognitive function in primate prefrontal cortex by a neuroprosthesis that utilizes minicolumn-specific neural firing.pdf | 2014-04-24 20:34 | 2.9M | |
![[ ]](/icons/layout.gif) | FOXP2 as a molecular window into speech and language.pdf | 2015-05-25 10:09 | 946K | |
![[ ]](/icons/layout.gif) | Expression of the transcription factor, tailless, is required for formation of superficial cortical layers.pdf | 2009-08-12 17:34 | 756K | |
![[ ]](/icons/layout.gif) | Expansion microscopy - Boyden - 2015.pdf | 2015-03-23 04:56 | 3.6M | |
![[ ]](/icons/layout.gif) | Exceptional evolutionary divergence of human muscle and brain metabolomes parallels human cognitive and physical uniqueness.pdf | 2015-12-06 16:24 | 1.3M | |
![[ ]](/icons/layout.gif) | Evolution of the human brain: is bigger better?.pdf | 2013-08-29 17:20 | 569K | |
![[ ]](/icons/layout.gif) | Evolution of the human ASPM gene, a major determinant of brain size.pdf | 2009-08-07 19:28 | 102K | |
![[ ]](/icons/layout.gif) | Evolution of the cerebellar cortex: the selective expansion of prefrontal-projecting cerebellar lobules.pdf | 2012-04-10 12:21 | 627K | |
![[ ]](/icons/layout.gif) | Evolution of the brain and intelligence.pdf | 2007-10-02 17:41 | 513K | |
![[ ]](/icons/layout.gif) | Evolutionary divergence of gene and protein expression in the brains of humans and chimpanzees.pdf | 2015-12-06 16:13 | 1.6M | |
![[ ]](/icons/layout.gif) | Evidence for verbal memory enhancement with electrical brain stimulation in the lateral temporal cortex - 2018.pdf | 2018-02-09 12:29 | 530K | |
![[ ]](/icons/layout.gif) | Estimates of segregation and overlap of functional connectivity networks in the human cerebral cortex.pdf | 2014-02-13 17:40 | 3.3M | |
![[ ]](/icons/layout.gif) | Establishing cerebral organoids as models of human-specific brain evolution - 2018.pdf | 2020-01-04 10:39 | 6.6M | |
![[ ]](/icons/layout.gif) | Epigenetic landscape and AAV targeting of human neocortical cell classes - 2019.pdf | 2019-02-22 15:06 | 6.1M | |
![[ ]](/icons/layout.gif) | Epigenetic editing of Ascl1 gene in neural stem cells by optogenetics - 2017.pdf | 2017-02-14 15:17 | 1.4M | |
![[ ]](/icons/layout.gif) | Enhancement of planning ability by transcranial direct current stimulation.pdf | 2009-08-04 17:04 | 2.8K | |
![[ ]](/icons/layout.gif) | Enhanced long-term microcircuit plasticity in the valproic acid animal model of autism.pdf | 2009-08-08 17:41 | 2.4M | |
![[ ]](/icons/layout.gif) | Enhanced and impaired attentional performance after infusion of D1 dopaminergic receptor agents into rat prefrontal cortex.pdf | 2014-04-24 20:08 | 228K | |
![[ ]](/icons/layout.gif) | Engraftable human neural stem cells respond to developmental cues, replace neurons, and express foreign genes in newborn rat.pdf | 2009-08-08 15:28 | 402K | |
![[ ]](/icons/layout.gif) | Engineering prokaryotic channels for control of mammalian tissue excitability - 2016.pdf | 2016-11-12 06:20 | 3.7M | |
![[ ]](/icons/layout.gif) | Engineering microbial rhodopsins to expand the optogenetic toolkit - Venkatachalam - 2014.pdf | 2016-07-15 13:53 | 5.2M | |
![[ ]](/icons/layout.gif) | Energetics of gating at the apo-acetylcholine receptor transmitter binding site - 2010.pdf | 2010-04-14 10:15 | 5.0M | |
![[ ]](/icons/layout.gif) | Energetic costs and evolutionary implications of human brain development.pdf | 2015-12-06 16:20 | 796K | |
![[ ]](/icons/layout.gif) | Encoding of Tactile Stimulus Location by Somatosensory Thalamocortical Ensembles.pdf | 2009-05-04 20:52 | 691K | |
![[ ]](/icons/layout.gif) | Emotion enhances learning via norepinephrine regulation of AMPA-receptor trafficking.pdf | 2009-04-22 10:35 | 1.6M | |
![[ ]](/icons/layout.gif) | Emergence of novel color vision in mice engineered to express a human cone photopigment.pdf | 2011-06-11 16:34 | 216K | |
![[ ]](/icons/layout.gif) | Emergence of complex computational structures from chaotic neural networks through reward-modulated Hebbian learning.pdf | 2014-10-29 06:54 | 1.4M | |
![[ ]](/icons/layout.gif) | Electromagnetic limits to radiofrequency (RF) neuronal telemetry.pdf | 2014-11-28 14:41 | 405K | |
![[ ]](/icons/layout.gif) | Electrochemical polymerization of conducting polymers in living neural tissue.pdf | 2009-04-12 13:29 | 1.8M | |
![[ ]](/icons/layout.gif) | Electrical stimulation of the human brain: perceptual and behavioral phenomena reported in the old and new literature.pdf | 2013-04-10 18:26 | 353K | |
![[ ]](/icons/layout.gif) | Efficient transfection of DNA or shRNA vectors into neurons using magnetofection.pdf | 2009-08-10 18:02 | 852K | |
![[ ]](/icons/layout.gif) | Efficient gene delivery to the adult and fetal CNS using pseudotyped non-integrating lentiviral vectors.pdf | 2009-08-08 15:44 | 1.0M | |
![[ ]](/icons/layout.gif) | Efficient derivation of functional dopaminergic neurons from human embryonic stem cells on a large scale.pdf | 2009-08-10 17:57 | 535K | |
![[ ]](/icons/layout.gif) | Effects of strategy on visual working memory capacity.pdf | 2016-01-01 22:26 | 460K | |
![[ ]](/icons/layout.gif) | Effects of modafinil on working memory processes in humans.pdf | 2014-04-24 20:19 | 213K | |
![[ ]](/icons/layout.gif) | Effects of dextroamphetamine on cognitive performance and cortical activation.pdf | 2014-04-24 20:14 | 149K | |
![[ ]](/icons/layout.gif) | Effect of Pulsed 5.62 GHz Microwaves on Squirrel Monkeys (Saimiri sciureus) Performing a Repeated Acquisition Task.pdf | 2009-07-29 05:02 | 1.2M | |
![[ ]](/icons/layout.gif) | Ecological dominance, social competition, and coalitionary arms races: Why humans evolved extraordinary intelligence.pdf | 2011-03-23 14:21 | 345K | |
![[ ]](/icons/layout.gif) | Early steps in the development of the forebrain.pdf | 2009-08-08 06:45 | 498K | |
![[ ]](/icons/layout.gif) | Dynamics of population code for working memory in the prefrontal cortex.pdf | 2009-05-04 20:51 | 497K | |
![[ ]](/icons/layout.gif) | Dynamic gene expression in the human cerebral cortex distinguishes children from adults.pdf | 2015-10-08 10:53 | 2.7M | |
![[ ]](/icons/layout.gif) | Dynamic coding for cognitive control in prefrontal cortex.pdf | 2013-05-17 12:57 | 1.4M | |
![[ ]](/icons/layout.gif) | Double virus infection to the prefrontal network of the macaque brain.pdf | 2016-01-01 22:35 | 10M | |
![[ ]](/icons/layout.gif) | Does song complexity correlate with problem-solving performance in flocks of zebra finches?.pdf | 2014-06-06 02:02 | 567K | |
![[ ]](/icons/layout.gif) | Distinct neural correlates of washing, checking, and hoarding symptom dimensions in obsessive compulsive disorder.pdf | 2009-05-18 03:52 | 319K | |
![[ ]](/icons/layout.gif) | Dissociation between mental fatigue and motivational state during prolonged mental activity.pdf | 2016-01-02 20:48 | 1.8M | |
![[ ]](/icons/layout.gif) | Dissociable cost and benefit encoding of future rewards by mesolimbic dopamine'.pdf | 2009-12-31 11:09 | 352K | |
![[ ]](/icons/layout.gif) | Direct isolation of human central nervous system stem cells.pdf | 2009-08-07 20:39 | 577K | |
![[ ]](/icons/layout.gif) | Direction selectivity is computed by active dendritic integration in retinal ganglion cells_ Benjamin Sivyer_ Stephen R Williams_ Nature Neuroscience 2013.pdf | 2013-10-28 10:34 | 6.9M | |
![[ ]](/icons/layout.gif) | Directed differentiation of embryonic stem cells into motor neurons.pdf | 2009-08-07 20:44 | 3.0M | |
![[ ]](/icons/layout.gif) | Differentiation of insulin-producing cells from human neural progenitor cells.pdf | 2009-08-07 20:49 | 416K | |
![[ ]](/icons/layout.gif) | Development of neural stem cells.pdf | 2009-08-07 20:41 | 342K | |
![[ ]](/icons/layout.gif) | Designing scalable biological interfaces - Marblestone.pdf | 2014-06-07 00:45 | 14M | |
![[ ]](/icons/layout.gif) | Dendritic integration in mammalian neurons - a century after Cajal - review - 1996.pdf | 2009-06-28 18:00 | 369K | |
![[ ]](/icons/layout.gif) | Delegation to automaticity: the driving force for cognitive evolution?.pdf | 2014-12-01 16:34 | 630K | |
![[ ]](/icons/layout.gif) | Decoding the contents of visual short-term memory from human visual and parietal cortex - 2012.pdf | 2016-01-27 00:46 | 1.1M | |
![[IMG]](/icons/image2.gif) | Decision by division - making cortical maps - neurogenesis - embryology - good.pdf.png | 2009-08-08 06:59 | 166K | |
![[ ]](/icons/layout.gif) | Decision by division - making cortical maps - neurogenesis - embryology - good.pdf | 2009-08-08 06:57 | 686K | |
![[ ]](/icons/layout.gif) | DNA methylation in memory formation - emerging insights - 2015.pdf | 2015-05-17 12:34 | 1.9M | |
![[ ]](/icons/layout.gif) | Cytoskeletal genes regulating brain size.pdf | 2009-08-12 07:54 | 292K | |
![[ ]](/icons/layout.gif) | Curious monkeys have increased gray matter density in the precuneus.pdf | 2015-12-06 16:32 | 790K | |
![[ ]](/icons/layout.gif) | Culture of embryonic-like stem cells from human umbilical cord blood and onward differentiation to neural cells in vitro.pdf | 2009-08-10 17:59 | 503K | |
![[ ]](/icons/layout.gif) | Critical analysis of voxel based morphometry.pdf | 2009-08-05 10:46 | 161K | |
![[ ]](/icons/layout.gif) | Could a neuroscientist understand a microprocessor? - 2016.pdf | 2016-07-13 13:51 | 8.7M | |
![[ ]](/icons/layout.gif) | Cortical thinning in obsessive compulsive disorder.pdf | 2009-08-12 07:40 | 283K | |
![[ ]](/icons/layout.gif) | Converging intracranial markers of conscious access - 2009.pdf | 2009-03-16 21:06 | 1.7M | |
![[ ]](/icons/layout.gif) | Control without controllers: Towards a distributed neuroscience of executive control - 2016.pdf | 2016-10-15 08:26 | 2.3M | |
![[ ]](/icons/layout.gif) | Control of outer radial glial stem cell mitosis in the human brain.pdf | 2014-10-10 05:31 | 2.2M | |
![[ ]](/icons/layout.gif) | Control of cerebral size and thickness.pdf | 2014-08-12 09:37 | 1.9M | |
![[ ]](/icons/layout.gif) | Control of Cognitive Processes.pdf | 2010-11-28 14:25 | 5.1M | |
![[ ]](/icons/layout.gif) | Consensus - can transcranial direct current stimulation and transcranial magnetic stimulation enhance motor learning and memory formation.pdf | 2009-04-12 15:14 | 188K | |
![[ ]](/icons/layout.gif) | Connectomics-based analysis of information flow in the Drosophila brain - 2015.pdf | 2016-03-26 07:15 | 2.8M | |
![[ ]](/icons/layout.gif) | Conneconomics: The economics of large-scale neural connectomics - Marblestone.pdf | 2016-06-27 08:49 | 401K | |
![[ ]](/icons/layout.gif) | Computational perspectives on dopamine function in prefrontal cortex.pdf | 2003-11-18 14:06 | 82K | |
![[ ]](/icons/layout.gif) | Computational cognitive neuroscience: what is a good model of brain processes? - 2016.pdf | 2016-10-15 08:20 | 935K | |
![[ ]](/icons/layout.gif) | Composition of isolated synaptic boutons reveals the amounts of vesicle trafficking proteins.pdf | 2014-05-29 17:55 | 4.4M | |
![[ ]](/icons/layout.gif) | Complex events initiated by individual spikes in the human cerebral cortex.pdf | 2014-04-24 18:09 | 616K | |
![[ ]](/icons/layout.gif) | Comparative performance of a genetically-encoded voltage indicator and a blue voltage sensitive dye for large scale cortical voltage imaging - 2016.pdf | 2016-07-15 13:59 | 3.4M | |
![[ ]](/icons/layout.gif) | Comparative neuronal morphology of the cerebellar cortex in afrotherians, carnivores, cetartiodactyls, and primates.pdf | 2014-04-23 08:37 | 5.5M | |
![[ ]](/icons/layout.gif) | Comparative connectomics - 2016.pdf | 2016-05-04 08:32 | 4.3M | |
![[ ]](/icons/layout.gif) | Common neural substrates for visual memory working and attention.pdf | 2007-09-14 13:52 | 527K | |
![[ ]](/icons/layout.gif) | Common genetic variation and performance on standardized cognitive tests - 2010.pdf | 2017-01-07 12:26 | 273K | |
![[ ]](/icons/layout.gif) | Combined TMS-fMRI study of intensity-dependent TMS over motor cortex.pdf | 2009-08-09 14:25 | 576K | |
![[ ]](/icons/layout.gif) | Cognitive neuroepigenetics: the next evolution in our understanding of the molecular mechanisms underlying learning and memory? - 2016.pdf | 2016-09-09 18:55 | 636K | |
![[ ]](/icons/layout.gif) | Cognitive enhancement - methods, ethics, regulatory challenges.pdf | 2010-03-21 18:03 | 188K | |
![[ ]](/icons/layout.gif) | Cognitive consilience: Primate non-primary neuroanatomical circuits underlying cognition - 2011.pdf | 2014-12-01 18:05 | 2.0M | |
![[ ]](/icons/layout.gif) | Cognitive consequences of cooperative breeding? A critical appraisal.pdf | 2015-01-05 02:57 | 150K | |
![[ ]](/icons/layout.gif) | Closed-loop stimulation of temporal cortex rescues functional networks and improves memory - 2018.pdf | 2018-01-19 06:20 | 661K | |
![[IMG]](/icons/image2.gif) | CloseNeurons.jpg | 2009-04-21 21:21 | 95K | |
![[ ]](/icons/layout.gif) | Circuit and coil design for in vitro magnetic neural stimulation systems.pdf | 2010-06-26 01:24 | 783K | |
![[ ]](/icons/layout.gif) | Chronic electrical stimulation of cultured hippocampal networks increases spontaneous spike rates.pdf | 2009-08-28 08:15 | 769K | |
![[ ]](/icons/layout.gif) | Chlorophyll derivatives as visual pigments for super vision in the red.pdf | 2009-09-16 18:49 | 233K | |
![[ ]](/icons/layout.gif) | Chemical neuromodulation of frontal-executive functions in humans and other animals.pdf | 2005-10-24 08:43 | 71K | |
![[ ]](/icons/layout.gif) | Characterization of human cortical gene expression in relation to glucose utilization.pdf | 2013-06-25 10:29 | 469K | |
![[ ]](/icons/layout.gif) | Characterization of brain states during task-switching using a neural network classifier.pdf | 2009-04-11 10:52 | 478K | |
![[ ]](/icons/layout.gif) | Characteristics and neuronal correlates of superior memory performance.pdf | 2014-03-03 23:53 | 3.9M | |
![[ ]](/icons/layout.gif) | Changes in cortical dopamine D1 receptor binding associated with cognitive training.pdf | 2014-01-09 12:26 | 415K | |
![[ ]](/icons/layout.gif) | Challenges for brain emulation: Why is building a brain so difficult? - 2012.pdf | 2012-06-08 14:20 | 310K | |
![[ ]](/icons/layout.gif) | Cerebellar networks with the cerebral cortex and basal ganglia.pdf | 2016-01-02 21:05 | 4.5M | |
![[ ]](/icons/layout.gif) | Cerebellar networks with basal ganglia: feasibility for tracking cerebello-pallidal and subthalamo-cerebellar projections in the human brain - 2013.pdf | 2016-01-02 21:15 | 1.8M | |
![[ ]](/icons/layout.gif) | Categorization of behavioural sequences in the prefrontal cortex.pdf | 2009-05-04 20:47 | 878K | |
![[ ]](/icons/layout.gif) | Catechol O-methyltransferase val 158-met genotype and individual variation in the brain response to amphetamine.pdf | 2014-04-24 20:10 | 269K | |
![[ ]](/icons/layout.gif) | Canonical computations of cerebral cortex - 2016.pdf | 2016-02-11 10:15 | 632K | |
![[ ]](/icons/layout.gif) | CREB regulates excitability and the allocation of memory to subsets of neurons in the amygdala.pdf | 2009-12-31 11:14 | 597K | |
![[ ]](/icons/layout.gif) | CLARITY-compatible lipophilic dyes for electrode marking and neuronal tracing - aldehyde - 2016.pdf | 2016-07-14 23:34 | 14M | |
![[ ]](/icons/layout.gif) | CDH13 is associated with working memory performance in attention deficit hyperactivity disorder - 2011.pdf | 2017-04-23 19:05 | 783K | |
![[ ]](/icons/layout.gif) | CA3 size predicts the precision of memory recall - 2016.pdf | 2017-01-29 14:32 | 817K | |
![[ ]](/icons/layout.gif) | C3G regulates the size of the cerebral cortex neural precursor population.pdf | 2009-08-08 10:07 | 548K | |
![[ ]](/icons/layout.gif) | C.A.P.Linssen_Neurophilo_2011.pdf | 2011-10-17 15:33 | 2.4M | |
![[ ]](/icons/layout.gif) | Building complex brains - missing pieces in an evolutionary puzzle.pdf | 2009-08-07 19:46 | 170K | |
![[ ]](/icons/layout.gif) | Bringing bioelectricity to light: all-optical electrophysiology using microbial rhodopsins - 2014.pdf | 2016-07-15 13:52 | 17M | |
![[ ]](/icons/layout.gif) | Bright and fast multicoloured voltage reporters via electrochromic FRET - Adam E. Cohen - 2014.pdf | 2014-08-18 09:06 | 1.9M | |
![[ ]](/icons/layout.gif) | Brca1 is required for embryonic development of the mouse cerebral cortex to normal size by preventing apoptosis of early neural progenitors.pdf | 2009-08-07 20:02 | 2.7M | |
![[ ]](/icons/layout.gif) | Brains of verbal memory specialists show anatomical differences in language, memory and visual systems - 2015.pdf | 2016-10-04 18:15 | 1.2M | |
![[ ]](/icons/layout.gif) | Brain size and folding of the human cerebral cortex.pdf | 2009-08-07 19:48 | 551K | |
![[ ]](/icons/layout.gif) | Brain scaling in mammalian evolution as a consequence of concerted and mosaic changes in numbers of neurons and average neuronal cell size.pdf | 2014-12-08 21:52 | 5.6M | |
![[ ]](/icons/layout.gif) | Brain mechanisms of acoustic communication in humans and nonhuman primates: An evolutionary perspective.pdf | 2015-01-12 07:01 | 1.5M | |
![[ ]](/icons/layout.gif) | Brain factor-1 controls the proliferation and differentiation of neocortical progenitor cells through independent mechanisms.pdf | 2009-08-07 21:04 | 1.4M | |
![[ ]](/icons/layout.gif) | Brain evolution in Homo: The radiator theory.pdf | 2014-12-07 18:26 | 7.7M | |
![[ ]](/icons/layout.gif) | Brain Backups - Next generation brain hacking, security and interfaces - Russell Hanson - 2016-05-21.pdf | 2016-06-10 15:29 | 53M | |
![[ ]](/icons/layout.gif) | Blinking and thinking.pdf | 2011-08-31 15:07 | 168K | |
![[ ]](/icons/layout.gif) | BioSpaun: A large-scale behaving brain model with complex neurons - nengo - 2016.pdf | 2016-02-17 17:30 | 1.1M | |
![[ ]](/icons/layout.gif) | BigBrain: An Ultrahigh-Resolution 3D Human Brain Model.pdf | 2013-07-17 06:57 | 5.0M | |
![[ ]](/icons/layout.gif) | Behavioural report of single neuron stimulation in somatosensory cortex.pdf | 2009-05-04 16:36 | 360K | |
![[ ]](/icons/layout.gif) | Behavioral and neuroanatomical investigation of Highly Superior Autobiographical Memory (HSAM) - 2012.pdf | 2016-09-10 13:11 | 2.5M | |
![[ ]](/icons/layout.gif) | Basic operations in working memory: contributions from functional imaging studies.pdf | 2011-01-31 14:15 | 213K | |
![[ ]](/icons/layout.gif) | Basal ganglia pathways: Beyond the closed-loop circuits with the cerebral cortex - Andreea Bostan - 2013.pdf | 2013-08-15 13:27 | 2.1M | |
![[ ]](/icons/layout.gif) | Basal forebrain activation enhances cortical coding of natural scenes .pdf | 2009-12-31 11:15 | 1.1M | |
![[ ]](/icons/layout.gif) | Balanced Amplification: A New Mechanism of Selective Amplification of Neural Activity Patterns.pdf | 2009-05-04 20:43 | 1.1M | |
![[ ]](/icons/layout.gif) | A versatile clearing agent for multi-modal brain imaging - 2015.pdf | 2016-06-21 17:43 | 4.5M | |
![[ ]](/icons/layout.gif) | Automatic discovery of cell types and microcircuitry from neural connectomics - Kording - 2014.pdf | 2016-06-27 09:32 | 20M | |
![[ ]](/icons/layout.gif) | Automated Talairach atlas labels for functional brain mapping - 2000.pdf | 2012-06-23 15:20 | 651K | |
![[ ]](/icons/layout.gif) | Augmenting intelligence: Developmental limits to learning-based cognitive change - 2016.pdf | 2016-09-10 10:31 | 1.1M | |
![[ ]](/icons/layout.gif) | Attention improves performance primarily by reducing interneuronal correlations.pdf | 2009-12-31 11:12 | 577K | |
![[ ]](/icons/layout.gif) | Attentional modulation of thalamic reticular neurons.pdf | 2009-08-09 13:57 | 1.9M | |
![[ ]](/icons/layout.gif) | A tension-based theory of morphogenesis and compact wiring in the central nervous system.pdf | 2006-05-08 01:21 | 1.5M | |
![[ ]](/icons/layout.gif) | A tension-based theory of morphogenesis and compact wiring in the central nervous system - good.pdf | 2009-08-08 07:05 | 1.5M | |
![[ ]](/icons/layout.gif) | A surface-based approach to quantify local cortical gyrification.pdf | 2009-08-08 07:09 | 1.3M | |
![[ ]](/icons/layout.gif) | Astrocytic complexity distinguishes the human brain.pdf | 2013-02-07 07:39 | 1.9M | |
![[ ]](/icons/layout.gif) | Assisted movement with enhanced sensation (AMES) - coupling motor and sensory to remdiate motor deficits in chronic stroke patients.pdf | 2010-12-20 08:58 | 278K | |
![[ ]](/icons/layout.gif) | A small modulatory dsRNA specifies the fate of adult neural stem cells.pdf | 2009-08-08 10:24 | 2.7M | |
![[ ]](/icons/layout.gif) | Artificial selection on relative brain size in the guppy reveals costs and benefits of evolving a larger brain.pdf | 2013-12-11 13:23 | 150K | |
![[ ]](/icons/layout.gif) | Artificial selection on brain size leads to matching changes in overall number of neurons - 2019.pdf | 2019-12-22 17:29 | 0 | |
![[ ]](/icons/layout.gif) | A rosette-type, self-renewing human ES cell-derived neural stem cell with potential for in vitro instruction and synaptic integration.pdf | 2009-02-27 05:46 | 1.2M | |
![[ ]](/icons/layout.gif) | A review and synthesis of the first 20 years of PET and fMRI studies of heard speech, spoken language and reading - 2012.pdf | 2012-08-13 19:59 | 2.3M | |
![[ ]](/icons/layout.gif) | Are representations in working memory distinct from representations in long-term memory? Neural evidence in support of a single store.pdf | 2014-04-24 21:13 | 188 | |
![[ ]](/icons/layout.gif) | Architecture of the cerebral cortical association connectome underlying cognition.pdf | 2016-01-03 20:39 | 4.2M | |
![[ ]](/icons/layout.gif) | A rapid optical clearing protocol using 2,2-thiodiethanol for microscopic observation of fixed mouse brain - 2015.pdf | 2015-03-02 14:54 | 4.2M | |
![[ ]](/icons/layout.gif) | A predicted molecular model for development of human intelligence - 2018.pdf | 2018-12-25 16:00 | 1.1M | |
![[ ]](/icons/layout.gif) | A practical device for pinpoint delivery of molecules into multiple neurons in culture via needle puncture.pdf | 2009-12-27 11:34 | 550K | |
![[ ]](/icons/layout.gif) | A practical device for pinpoint delivery of molecules into multiple neurons in culture.pdf | 2009-04-18 09:57 | 550K | |
![[ ]](/icons/layout.gif) | Approaches to information-theoretic analysis of neural activity.pdf | 2009-06-28 18:00 | 165K | |
![[ ]](/icons/layout.gif) | Applications of CRISPR-Cas systems in neuroscience - 2016.pdf | 2016-07-26 10:36 | 1.1M | |
![[ ]](/icons/layout.gif) | A parametric study of prefrontal cortex involvement in human working memory - 1997.pdf | 2010-01-03 08:22 | 281K | |
![[ ]](/icons/layout.gif) | Anxiety selectively disrupts visuospatial working memory.pdf | 2010-02-11 14:29 | 665K | |
![[ ]](/icons/layout.gif) | A novel array-type transcranial direct current stimulation (tDCS) system for accurate focusing on targeted brain areas - 2011.pdf | 2012-03-14 17:20 | 506K | |
![[ ]](/icons/layout.gif) | An open-hardware platform for optogenetics and photobiology - 2016.pdf | 2016-09-10 09:04 | 1.5M | |
![[ ]](/icons/layout.gif) | Anodal transcranial direct current stimulation of prefrontal cortex enhances working memory.pdf | 2013-08-29 17:37 | 293K | |
![[ ]](/icons/layout.gif) | An in vivo biosensor for neurotransmitter release and in situ receptor activity.pdf | 2009-12-31 11:11 | 1.0M | |
![[ ]](/icons/layout.gif) | A neuron membrane mesh representation for visualization of electrophysiological simulations - Markram - 2012.pdf | 2011-12-27 15:47 | 4.0M | |
![[ ]](/icons/layout.gif) | An estimation of the absolute number of axons indicates that human cortical areas are sparsely connected - 2022.pdf | 2023-01-03 19:24 | 833K | |
![[ ]](/icons/layout.gif) | An electrostatic interaction between TEA and an introduced pore aromatic drives spring-in-the-door inactivation in Shaker potassium channels - 2009.pdf | 2010-02-01 08:04 | 1.0M | |
![[ ]](/icons/layout.gif) | An arms race between producers and scroungers can drive the evolution of cognitive abilities.pdf | 2013-10-23 01:04 | 4.7M | |
![[ ]](/icons/layout.gif) | An algorithm to predict the connectome of neural microcircuits - Markram - 2015.pdf | 2016-03-18 07:40 | 3.0M | |
![[ ]](/icons/layout.gif) | An adaptive coding model of neural function in prefrontal cortex.pdf | 2002-11-13 14:51 | 590K | |
![[ ]](/icons/layout.gif) | Amplification of progenitors in the mammalian telencephalon includes a new radial glial cell type.pdf | 2013-07-10 05:18 | 2.8M | |
![[IMG]](/icons/image2.gif) | A morphogenetic model for the development of cortical convolutions.pdf.png | 2009-08-08 07:03 | 195K | |
![[ ]](/icons/layout.gif) | A morphogenetic model for the development of cortical convolutions.pdf | 2009-08-08 06:52 | 904K | |
![[ ]](/icons/layout.gif) | A mesoscale connectome of the mouse brain.pdf | 2014-11-28 21:24 | 18M | |
![[ ]](/icons/layout.gif) | Alpha2A-adrenoceptors strengthen working memory networks by inhibiting cAMP-HCN channel signaling in prefrontal cortex.pdf | 2010-02-19 07:10 | 2.3M | |
![[ ]](/icons/layout.gif) | A large-scale model of the functioning brain - Eliasmith.pdf | 2012-12-03 13:57 | 1.9M | |
![[ ]](/icons/layout.gif) | A humanized version of foxp2 affects cortico-basal ganglia circuits in mice.pdf | 2009-08-07 19:50 | 704K | |
![[ ]](/icons/layout.gif) | A high density of X-linked genes for general cognitive ability: a run-away process shaping human evolution.pdf | 2014-01-31 06:35 | 190K | |
![[ ]](/icons/layout.gif) | Agile in-litero experiments: how can semi-automated information extraction from neuroscientific literature help neuroscience model building? - 2016.pdf | 2016-02-15 23:29 | 7.4M | |
![[ ]](/icons/layout.gif) | A genetic pathway composed of Sox14 and Mical governs severing of dendrites during pruning.pdf | 2009-12-31 11:12 | 1.6M | |
![[ ]](/icons/layout.gif) | A framework for investigating thalamocortical activity in multistage information processing - EEG+fMRI - Rowe.pdf | 2009-08-09 14:12 | 299K | |
![[ ]](/icons/layout.gif) | A feedback loop able to enlarge the brain for 2.4 myr without Darwin's selective survival - 2016.pdf | 2016-10-15 08:39 | 1.0M | |
![[ ]](/icons/layout.gif) | A family of photoswitchable NMDA receptors - 2016.pdf | 2016-07-15 14:09 | 4.2M | |
![[ ]](/icons/layout.gif) | Advantages of artificial intelligences, uploads, and digital minds - Kaj Sotala - 2012.pdf | 2012-01-22 01:31 | 217K | |
![[ ]](/icons/layout.gif) | Advances in understanding mechanisms of thalamic relays in cognition and behavior - 2014.pdf | 2016-01-02 09:14 | 229K | |
![[ ]](/icons/layout.gif) | Advanced biomaterial strategies to transplant preformed micro-tissue engineered neural networks into the brain - 2016.pdf | 2016-01-22 06:51 | 4.0M | |
![[ ]](/icons/layout.gif) | A dopaminergic gene cluster in the prefrontal cortex predicts performance indicative of general intelligence in genetically heterogeneous mice - 2010.pdf | 2014-03-26 01:00 | 384K | |
![[ ]](/icons/layout.gif) | A designer ligand specific for Kv1.3 channels from a scorpion neurotoxin-based library.pdf | 2010-01-25 13:39 | 1.0M | |
![[ ]](/icons/layout.gif) | Adaptive flight control with living neuronal networks on microelectrode arrays.pdf | 2010-10-27 10:29 | 671K | |
![[ ]](/icons/layout.gif) | A curvature-based approach to estimate local gyrification on the cortical surface.pdf | 2009-08-08 07:08 | 381K | |
![[ ]](/icons/layout.gif) | Active maintenance in prefrontal area 46 creates distractor-resistant memory.pdf | 2009-08-09 14:14 | 1.5M | |
![[ ]](/icons/layout.gif) | Activation of opposing muscle groups in the crayfish claw - Todd L. Stock.pdf | 2010-10-17 07:43 | 111K | |
![[ ]](/icons/layout.gif) | Actions, action sequences and habits: Evidence that goal-directed and habitual action control are hierarchically organized.pdf | 2014-11-30 19:27 | 368K | |
![[ ]](/icons/layout.gif) | Acoustically targeted chemogenics for noninvasive control of neural circuits - 2018.pdf | 2018-01-12 08:18 | 8.2M | |
![[ ]](/icons/layout.gif) | Acoustically targeted chemogenetics for noninvasive control of neural circuits - 2018.pdf | 2018-01-03 08:14 | 8.2M | |
![[ ]](/icons/layout.gif) | A competitive advantage by neonatally engrafted human glial progenitors yields mice whose brains are chimeric for human glia - 2014.pdf | 2014-11-25 08:23 | 5.2M | |
![[ ]](/icons/layout.gif) | Acetaminophen attenuates error evaluation in cortex - 2016.pdf | 2017-01-06 12:30 | 542K | |
![[ ]](/icons/layout.gif) | Acceleration of spiking neural networks in emerging multi-core and GPU architectures.pdf | 2012-12-08 18:51 | 272K | |
![[ ]](/icons/layout.gif) | Accelerated evolution of nervous system genes in the origin of Homo sapiens.pdf | 2009-08-07 19:52 | 462K | |
![[ ]](/icons/layout.gif) | Absolute brain size predicts dog breed differences in executive function - 2019.pdf | 2019-08-26 20:24 | 2.0M | |
![[ ]](/icons/layout.gif) | A bright and fast red fluorescent protein voltage indicator (FlicR1) that reports neuronal activity in organotypic brain slices - 2016.pdf | 2016-03-21 10:32 | 4.1M | |
![[ ]](/icons/layout.gif) | A biophysically detailed model of neocortical local field potentials predicts the critical role of active membrane currents.pdf | 2013-10-14 16:06 | 4.0M | |
![[ ]](/icons/layout.gif) | 2013-Nature-Methors-CLARITY-for-mapping-the-nervous-system.pdf | 2014-07-06 06:37 | 892K | |
|