![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | M&M 2015/ | 1969-12-31 16:00 | - | |
| oils_health/ | 2012-04-04 21:04 | - | |
![[ ]](/icons/layout.gif) | instability and decay of the primary structure of DNA.pdf | 2012-05-14 10:23 | 887K | |
| growth of black smoker bacteria at temperatures of at least 250 celsius.pdf | 2012-05-14 11:03 | 569K | |
| Hybrid error correction and de novo assembly of single-molecule sequencing reads.pdf | 2012-07-02 22:13 | 8.4M | |
| chemistry.gravitywaves.com/ | 2012-07-03 11:36 | - | |
| 2012-amphionDC-DifferentialPowerAnalysis.pdf | 2012-07-09 06:28 | 1.4M | |
| NanoCellBiology of Secretion.pdf | 2012-07-31 21:56 | 3.8M | |
| Genomic organization of the cadmium-inducible tandem repeat 25-kDa metallothionein of the oligochaete worm Enchytraeus buchholzi.pdf | 2012-08-08 01:47 | 1.5M | |
| 1-s2.0-0020737392900908-main.pdf | 2012-08-13 22:24 | 1.3M | |
| biological radio research/ | 2012-09-06 22:23 | - | |
| A plant based protective antigen [PA(dIV)] vaccine expressed in chloroplasts demonstrates protective immunity in mice against anthrax.pdf | 2012-09-07 00:53 | 793K | |
| stable plastid transformation in PEG-treated protoplasts of nicotiana tabacum.pdf | 2012-09-07 01:41 | 421K | |
| jmm9_3_037002.pdf | 2012-09-19 01:34 | 1.3M | |
| Characterization of Transferable Plasmids from Shigella flexneri 2a That Confer Resistance to Trimethoprim, Streptomycin, and Sulfonamides.pdf | 2012-09-26 08:08 | 1.2M | |
| HONEY, I SHRUNK THE CLUSTER! PARALLEL COMPUTING AND MONTE CARLO SIMULATIONS ON iPOD TOUCHES, iPHONES AND iPADS.pdf | 2012-09-26 10:58 | 52K | |
| Crystal structure of oxygen-evolving photosystem II at a resolution of 1.9 A.pdf | 2012-10-02 21:29 | 1.3M | |
| Skin shedding and tissue regeneration in African spiny mice (Acomys).pdf | 2012-10-02 21:29 | 3.3M | |
| Analysis of Lipid Classes and Lipofuscin Substances by High Performance Liquid Chromatography.pdf | 2012-11-13 09:59 | 487K | |
| microfluidics/ | 2012-11-21 12:09 | - | |
| The effect of cysteine and N-acetyl cysteine on rat liver glutathione (GSH).pdf | 2012-11-27 15:52 | 347K | |
| 1-s2.0-S0092867412014110-main__UMB.pdf | 2013-01-13 22:24 | 1.5M | |
| A foamy virus vector system for stable and efficient RNAi expression in mammalian cells__UMB.pdf | 2013-01-13 22:33 | 4.2M | |
| A foamy virus vector system for stable and efficient RNAi expression in mammalian cells__PDX.pdf | 2013-01-13 22:40 | 4.2M | |
| rit/ | 2013-03-28 06:14 | - | |
| Intestinal microbiota metabolism of l-carnitine__a nutrient in red meat__promotes atherosclerosis.pdf | 2013-04-09 13:38 | 1.4M | |
| High-power lithium ion microbatteries from interdigitated three-dimensional bicontinuous nanoporous electrodes.pdf | 2013-04-25 18:01 | 784K | |
| Chromospheric Sunspot Oscillations in Hα and Ca II 8542 Å.pdf | 2013-04-26 02:03 | 1.4M | |
| addpdf/ | 2013-05-26 01:22 | - | |
![[IMG]](/icons/image2.gif) | before_me.jpg | 2013-05-30 06:47 | 67K | |
| board_backside.jpg | 2013-05-30 07:02 | 1.6M | |
![[TXT]](/icons/text.gif) | robots.txt | 2013-06-15 11:37 | 0 | |
| spectrometer/ | 2013-06-15 11:38 | - | |
![[ ]](/icons/unknown.gif) | protein-shop_1.0_i386.deb | 2013-09-21 23:52 | 612 | |
![[ ]](/icons/compressed.gif) | g77_x64_debian_and_ubuntu.tar.gz | 2013-09-22 01:40 | 6.1M | |
| ProteinShop_3.1.1_ubuntu_debian.tar.gz | 2013-09-22 02:30 | 23M | |
| protein-shop_3.1.1-0ubuntu0_i386.deb | 2013-10-07 00:24 | 13K | |
![[ ]](/icons/tar.gif) | protein-shop_latest_3.1.1_i386.tar | 2013-10-17 17:34 | 74M | |
![[VID]](/icons/movie.gif) | how does an led work.mp4 | 2013-10-17 22:53 | 3.9M | |
| out.jpg | 2013-12-18 12:37 | 183K | |
| scope_i2c_lister_dvi.csv | 2013-12-24 23:57 | 1.4K | |
| scope_i2c_lister_hdmi.csv | 2013-12-24 23:57 | 11K | |
| nobots/ | 2014-01-29 13:07 | - | |
| CUFP-1530-Klophaus.mov | 2014-02-18 16:05 | 128M | |
| hidden/ | 2014-02-19 11:45 | - | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s1.mov | 2014-02-22 18:31 | 3.8M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s2.mov | 2014-02-22 18:31 | 5.3M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s3.mov | 2014-02-22 18:31 | 6.2M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s4.mov | 2014-02-22 18:32 | 2.6M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s5.mov | 2014-02-22 18:32 | 6.5M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s6.mov | 2014-02-22 18:32 | 8.3M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s7.mov | 2014-02-22 18:32 | 9.0M | |
| Artificial_Muscles_from_Fishing_Line_and_Sewing_Thread_s8.mov | 2014-02-22 18:32 | 3.1M | |
| pics/ | 2014-03-12 05:03 | - | |
| microfluidic_valves.gif | 2014-04-14 22:38 | 47K | |
| no0.png | 2014-09-02 21:46 | 372K | |
| fib_pattern1.pbm | 2014-09-04 19:40 | 490K | |
| LPC18XX_43XX_SCH.DSN | 2014-10-01 01:53 | 261K | |
| propellerPCB.dsn | 2014-10-01 01:54 | 66K | |
| propellerPCB_auto.dsn | 2014-10-01 01:54 | 322K | |
| hp_journal/ | 2014-12-16 23:14 | - | |
| 2 prisms.png | 2015-01-15 18:53 | 7.0K | |
| 2_prisms.png | 2015-01-15 18:53 | 7.0K | |
| bunny.3dm | 2015-02-28 17:35 | 32K | |
| mems/ | 2015-04-10 19:54 | - | |
| Xorg_log | 2017-09-01 16:58 | 44K | |
| abi391.htmle | 2018-01-08 19:11 | 4.1K | |
| abi391.html | 2018-01-08 19:12 | 4.2K | |
| fib/ | 2019-10-21 02:48 | - | |
| pipette_20200903_025118.avi | 2020-09-03 03:44 | 33M | |
| pipette_20200903_025316.avi | 2020-09-03 03:44 | 3.1M | |
| vacuum_hackers_chat_logs_dec_21_2020/ | 2021-01-17 15:46 | - | |
| pdf/ | 2022-01-18 08:49 | - | |
| STC_0034.JPG | 2022-06-10 01:04 | 894K | |
| STC_0035.JPG | 2022-06-10 01:04 | 899K | |
|
|---|
