![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | A synthentic oscillatory network of transcriptional regulators.pdf | 2009-05-04 20:27 | 728K | |
![[ ]](/icons/layout.gif) | A synthetic gene–metabolic oscillator.pdf | 2009-05-04 20:28 | 1.4M | |
![[ ]](/icons/layout.gif) | Construction of a genetic toggle switch in Escherichia coli.pdf | 2009-05-04 20:32 | 1.1M | |
![[ ]](/icons/layout.gif) | Design of artificial cell–cell communication using gene and metabolic networks.pdf | 2009-05-04 20:31 | 18K | |
![[ ]](/icons/layout.gif) | Engineering a mevalonate pathway in Escherichia coli for production of terpenoids.pdf | 2009-05-04 20:31 | 197K | |
![[ ]](/icons/layout.gif) | Environmentally Controlled Invasion of Cancer Cells by Engineered Bacteria.pdf | 2009-05-04 20:29 | 392K | |
![[ ]](/icons/layout.gif) | Molecular Basis of Mechanotransduction in Living Cells.pdf | 2009-05-04 20:29 | 1.0M | |
![[ ]](/icons/layout.gif) | Programmable ligand-controlled riboregulators of eukaryotic gene expression.pdf | 2009-05-04 20:31 | 314K | |
![[ ]](/icons/layout.gif) | Refactoring bacteriophage T7.pdf | 2009-05-04 20:30 | 325K | |
![[ ]](/icons/layout.gif) | Synchronizing genetic relaxation oscillators by intercell signaling.pdf | 2009-05-04 20:28 | 243K | |
![[ ]](/icons/layout.gif) | Synthetic protein-protein interatction domains created by shuffling Cys2His2 zinc-fingers.pdf | 2009-05-04 20:29 | 661K | |
![[ ]](/icons/layout.gif) | The design of intracellular oscillators that interact with metabolism.pdf | 2009-05-04 20:28 | 363K | |
![[ ]](/icons/layout.gif) | Ultrasensitivity and Nosie Propagation in a Synthetic Transcriptional Cascade.pdf | 2009-05-04 20:30 | 507K | |
|