![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | wiley-error.txt | 2015-08-14 12:33 | 3.0K | |
![[TXT]](/icons/text.gif) | temp.txt | 2015-08-06 19:52 | 62K | |
![[ ]](/icons/layout.gif) | Amoeba-inspired nanoarchitectonic computing implemented using electrical Brownian ratchets.pdf | 2015-06-01 10:33 | 813K | |
![[TXT]](/icons/text.gif) | temp-ugh.html | 2015-06-01 10:32 | 296K | |
![[ ]](/icons/layout.gif) | 57bac66ba6874a70b1ba9641931ff6cf.pdf | 2015-04-15 19:38 | 2.5M | |
![[TXT]](/icons/text.gif) | f5c6f77e1612ed842e20ad4d70cc516b.txt | 2015-04-15 05:25 | 44K | |
![[TXT]](/icons/text.gif) | 8b84fb688204aaab91acc1e7dfa9424c.txt | 2015-04-14 22:54 | 295 | |
![[TXT]](/icons/text.gif) | 529c77ff6efbc4daf1c1ad258c2c801d.txt | 2015-04-13 09:32 | 12K | |
![[ ]](/icons/layout.gif) | 6062d8ae911843d1978167384447d54a.pdf | 2015-04-12 19:19 | 10M | |
![[ ]](/icons/layout.gif) |
Microfluidic enzymatic biosensing systems: A review
.pdf | 2015-04-12 19:18 | 56K | |
![[TXT]](/icons/text.gif) | 825c1ef0c098892697e4bd594410ed76.txt | 2015-04-12 08:14 | 15K | |
![[ ]](/icons/layout.gif) | New insights into prebiotic chemistry from Stanley Miller's spark discharge experiments.pdf | 2015-04-12 08:06 | 3.2M | |
![[TXT]](/icons/text.gif) |
Cellular automata as an alternative to (rather than an approximation of) differential equations in modeling physics
.txt | 2015-04-09 16:59 | 24K | |
![[TXT]](/icons/text.gif) | 19916c727658b1a3d96771d1be3b1345.txt | 2015-04-09 10:06 | 53K | |
![[TXT]](/icons/text.gif) | c4979149927ab75f49ab500cf3dad507.txt | 2015-04-09 09:02 | 55K | |
![[TXT]](/icons/text.gif) | 36da754a19966c0312b200eb157e77c5.txt | 2015-04-08 07:46 | 48K | |
![[ ]](/icons/layout.gif) |
Effect of temperature variation on the visible and near infrared spectra of wine and the consequences on the partial least square calibrations developed to measure chemical composition
.pdf | 2015-04-08 04:38 | 56K | |
![[TXT]](/icons/text.gif) | 35b5fb29d543ba9ad6e6486272ac35cd.txt | 2015-04-07 17:16 | 4.4K | |
![[ ]](/icons/layout.gif) | c1715f9bdbec87547c5e9bba23e2a7c4.pdf | 2015-04-07 14:36 | 1.0M | |
![[TXT]](/icons/text.gif) | 8d30803499fc08c265dceb3b11f29855.txt | 2015-04-07 14:34 | 55K | |
![[TXT]](/icons/text.gif) | ae868316bb1236fbc54f6bbe4cf3c54b.txt | 2015-04-07 14:34 | 55K | |
![[TXT]](/icons/text.gif) | 4179f01fe344d47959ad3fa9486d9f2d.txt | 2015-04-07 13:27 | 16K | |
![[ ]](/icons/layout.gif) | 502d913eaa55d9fa85c7dd3f1367fd53.pdf | 2015-04-07 07:38 | 908K | |
![[ ]](/icons/layout.gif) | 782e58809cd0149e39bac12900a75869.pdf | 2015-04-06 13:49 | 2.6M | |
![[TXT]](/icons/text.gif) | 368f446b170270c73e48b37b8b050d0d.txt | 2015-04-06 13:47 | 123K | |
![[TXT]](/icons/text.gif) | a49a1afd9dd3a4466d270d27a86f1211.txt | 2015-04-05 23:22 | 185K | |
![[TXT]](/icons/text.gif) | 5170cd7bfd528b700ebd4ebf03c9d4ab.txt | 2015-04-05 23:21 | 74K | |
![[TXT]](/icons/text.gif) | 944e9d58d0465eabdfe08ff9fba59b96.txt | 2015-04-05 23:21 | 182 | |
![[TXT]](/icons/text.gif) | fcdbf9f2b3287710426e1802b5996b8e.txt | 2015-04-05 23:18 | 74K | |
![[TXT]](/icons/text.gif) | 9017e01b515acfbfc9e1ffe2d216796b.txt | 2015-04-05 23:16 | 46K | |
![[ ]](/icons/layout.gif) | c295751de68c1c2c58bfd83003b4c7fb.pdf | 2015-04-05 22:34 | 82K | |
![[ ]](/icons/layout.gif) | The Diagnostic Difficulties of Complex Glycerol Kinase Deficiency.pdf | 2015-04-05 22:33 | 84K | |
![[TXT]](/icons/text.gif) | 5b380376904ea29bb90245df2a21e55a.txt | 2015-04-05 21:44 | 52K | |
![[TXT]](/icons/text.gif) | ef4466ff527c46c576dff986f291a5a7.txt | 2015-04-05 21:42 | 64K | |
![[TXT]](/icons/text.gif) |
CONCORDANCE OF X-LINKED GLYCEROL KINASE DEFICIENCY WITH X-LINKED CONGENITAL ADRENAL HYPOPLASIA
.txt | 2015-04-05 21:41 | 24K | |
![[TXT]](/icons/text.gif) | 55d4fab86827e3fec9455e50e095e42e.txt | 2015-04-04 04:52 | 41K | |
![[ ]](/icons/layout.gif) | d4a58d8b66652ffb3794333f1ec9702d.pdf | 2015-04-04 04:13 | 2.8M | |
![[TXT]](/icons/text.gif) | 8d2263bd6b95790f3e12fc4e52f7df6.txt | 2015-04-03 19:19 | 12K | |
![[ ]](/icons/layout.gif) | 53a8bcc3d137e154870998493867df2.pdf | 2015-04-03 14:17 | 1.7M | |
![[ ]](/icons/layout.gif) | 2eb174b87517d592429087713401dda1.pdf | 2015-04-03 11:46 | 172K | |
![[ ]](/icons/layout.gif) | DNA-mediated engineering of multicomponent enzyme crystals.pdf | 2015-04-02 15:16 | 1.3M | |
![[ ]](/icons/layout.gif) | b879009ad0df99c7ec540504e787ed9f.pdf | 2015-04-01 17:03 | 705K | |
![[ ]](/icons/layout.gif) |
Phantom limbs and the concept of a neuromatrix
.pdf | 2015-04-01 16:40 | 53K | |
![[TXT]](/icons/text.gif) | 9d9c463bf71393c6e817b133414b1f38.txt | 2015-03-31 09:18 | 39K | |
![[ ]](/icons/layout.gif) | a2ae237f516644b3f7704c3fe9a8dcd6.pdf | 2015-03-30 10:01 | 223K | |
![[ ]](/icons/layout.gif) | 7ae4112d4d8eed62d53aeaeb8ec6a763.pdf | 2015-03-30 10:01 | 223K | |
![[ ]](/icons/layout.gif) | cbb95822e7192521ef81c045d49d4285.pdf | 2015-03-30 10:01 | 223K | |
![[TXT]](/icons/text.gif) | 7cd38a745c8de3f2459dc73dae607a57.txt | 2015-03-29 22:05 | 4.4K | |
![[TXT]](/icons/text.gif) | d2f63091c82e303d33e97b9356f12ac3.txt | 2015-03-29 22:04 | 11K | |
![[TXT]](/icons/text.gif) | b2f98ddd0b9c24c5a5528fe660670b32.txt | 2015-03-29 20:43 | 56K | |
![[ ]](/icons/layout.gif) | Hematopoietic Stem Cell Gene Therapy with a Lentiviral Vector in X-Linked Adrenoleukodystrophy.pdf | 2015-03-29 19:32 | 829K | |
![[TXT]](/icons/text.gif) | 952c5c05aa68b0065fcfa2d681bad700.txt | 2015-03-29 17:08 | 13K | |
![[TXT]](/icons/text.gif) | 4153005c741d4f711f445a1a45370b09.txt | 2015-03-29 17:07 | 244 | |
![[TXT]](/icons/text.gif) | 1236ceffe65c63713f1e0ec8ef68729c.txt | 2015-03-29 17:06 | 13K | |
![[TXT]](/icons/text.gif) | afd2fb9d816093c8e49aaf45ef2b9d66.txt | 2015-03-29 17:04 | 65K | |
![[ ]](/icons/layout.gif) | Direct analysis of melamine in complex matrices using a handheld mass spectrometer.pdf | 2015-03-29 10:36 | 317K | |
![[TXT]](/icons/text.gif) | cb7ed9066d112e87e719abc5666e27b9.txt | 2015-03-26 19:41 | 16K | |
![[TXT]](/icons/text.gif) | Neural Stimulation and Recording with Bidirectional, Soft Carbon Nanotube Fiber Microelectrodes.txt | 2015-03-26 06:55 | 94K | |
![[TXT]](/icons/text.gif) | 86bdaa2ae58458fe178a3fb85b9b438e.txt | 2015-03-25 17:46 | 49K | |
![[ ]](/icons/layout.gif) | 52397a0f42e49afe966698b165eb8ef7.pdf | 2015-03-23 04:56 | 3.6M | |
![[ ]](/icons/layout.gif) | New record of moss and thermophilic bacteria species and physico-chemical properties of geothermal soils on the northwest slope of Mt. Melbourne (Antarctica).pdf | 2015-03-22 21:36 | 332K | |
![[TXT]](/icons/text.gif) | 3f5b1b33d808324d1a2086a1d509a776.txt | 2015-03-21 12:23 | 52K | |
![[ ]](/icons/layout.gif) | fe850940806299559413b71a57c7d4c5.pdf | 2015-03-19 09:45 | 7.1M | |
![[ ]](/icons/layout.gif) | ae5186c2b554ac1925bfe7aff0f4b0b.pdf | 2015-03-18 15:53 | 1.5M | |
![[ ]](/icons/layout.gif) |
Efficiency at different levels of aggregation: public vs. private sector firms
.pdf | 2015-03-17 09:16 | 55K | |
![[TXT]](/icons/text.gif) | 4a13102992ae98fcdb33c724da585c26.txt | 2015-03-16 11:07 | 12K | |
![[ ]](/icons/layout.gif) | f62c5af72186f34aa099bba6af454863.pdf | 2015-03-15 13:39 | 2.1M | |
![[TXT]](/icons/text.gif) | 4a09822a6b61edc50b1f2654dfad4321.txt | 2015-03-15 13:32 | 15K | |
![[ ]](/icons/layout.gif) | 15b2b29992703c1485239b9772bc1396.pdf | 2015-03-13 17:48 | 4.6M | |
![[ ]](/icons/layout.gif) | Are Biological Systems Poised at Criticality?.pdf | 2015-03-07 11:04 | 2.4M | |
![[ ]](/icons/layout.gif) | 9ca4e1a016f19d9da1940dbbea3446f.pdf | 2015-03-05 13:04 | 8.9M | |
![[TXT]](/icons/text.gif) | f37579aace81db44b23b6ffd1e9e67b9.txt | 2015-03-04 13:46 | 15K | |
![[TXT]](/icons/text.gif) | ef57d9853983582077589b6729d57906.txt | 2015-03-04 13:44 | 4.5K | |
![[ ]](/icons/layout.gif) | 8dd5231b5c2aae2a4a29fe1ff32b78ea.pdf | 2015-03-04 13:42 | 1.1M | |
![[TXT]](/icons/text.gif) | 8d6cca98ca9df05a6ac4900be41801c3.txt | 2015-03-04 13:42 | 244K | |
![[TXT]](/icons/text.gif) | 25db9beca4b8e0638a55065abd401859.txt | 2015-03-04 13:40 | 214K | |
![[TXT]](/icons/text.gif) | db819c4a5ed64038c710bb7db2c3429f.txt | 2015-03-04 13:28 | 13K | |
![[TXT]](/icons/text.gif) | 2856ccdcf5f5c22422998211a45a7f0f.txt | 2015-03-04 12:58 | 12K | |
![[ ]](/icons/layout.gif) | PEDOTCNT coated electrodes stimulate retinal neurons at low voltage amplitudes and low charge densities.pdf | 2015-03-03 07:47 | 1.2M | |
![[ ]](/icons/layout.gif) | Triglycine sulfate (TGS) crystals for pyroelectric infrared detecting devices.pdf | 2015-02-27 07:23 | 258K | |
![[TXT]](/icons/text.gif) | 10c4f9b63dc8cdcb20e82d42278b881.txt | 2015-02-26 17:00 | 41K | |
![[ ]](/icons/layout.gif) | On-demand control of microfluidic flow via capillary-tuned solenoid microvalve suction.pdf | 2015-02-26 10:40 | 2.5M | |
![[TXT]](/icons/text.gif) | 789a13a9cadc4e483c5c49355a7aa4b3.txt | 2015-02-26 00:28 | 15K | |
![[TXT]](/icons/text.gif) | In-Silico Design of a DonorAntennaAcceptor Supramolecular Complex for Photoinduced Charge Separation.txt | 2015-02-26 00:07 | 96K | |
![[TXT]](/icons/text.gif) | 8dce97c79aeecc1839bf02257c9a7c11.txt | 2015-02-24 17:00 | 51K | |
![[TXT]](/icons/text.gif) | 41794778f2245512b1d0e43737fed3ad.txt | 2015-02-24 16:56 | 51K | |
![[TXT]](/icons/text.gif) | 58f71ac298819e9426d7d1d66baadba4.txt | 2015-02-23 15:39 | 13K | |
![[ ]](/icons/layout.gif) | Reprogramming the Methylome: Erasing Memory and Creating Diversity.pdf | 2015-02-21 08:09 | 1.4M | |
![[TXT]](/icons/text.gif) | 9f0e6f5d086ccbb5ff42b5a1a564c087.txt | 2015-02-20 14:47 | 24K | |
![[TXT]](/icons/text.gif) | e1855dab73a51d6e8da0a915ce4dfa0b.txt | 2015-02-20 14:46 | 54K | |
![[TXT]](/icons/text.gif) | 91dac1482c5d746ead63f5bc719ee8ed.txt | 2015-02-18 07:10 | 44K | |
![[TXT]](/icons/text.gif) | 6af2abd88c20a92b4530f077898ffe0.txt | 2015-02-17 00:56 | 16K | |
![[TXT]](/icons/text.gif) | b713c43dccea22340230b0b789ab74.txt | 2015-02-17 00:52 | 16K | |
![[TXT]](/icons/text.gif) | 9cf9458ee436b51eaa01114807065843.txt | 2015-02-16 17:30 | 153K | |
![[TXT]](/icons/text.gif) | Fabrication and Functionalization of Nanochannels by Electron-Beam-Induced Silicon Oxide Deposition.txt | 2015-02-16 15:17 | 119K | |
![[TXT]](/icons/text.gif) | dd72c1b47a2097743214b7fac2d6144c.txt | 2015-02-14 20:32 | 9.6K | |
![[TXT]](/icons/text.gif) | 6c579a386d1c7698a44d301006484b25.txt | 2015-02-14 20:31 | 9.6K | |
![[TXT]](/icons/text.gif) | 9819a5772c232c3357bde7642cdc21cb.txt | 2015-02-14 05:01 | 50K | |
![[TXT]](/icons/text.gif) | 5733c80532bbabdeddd2df250756151.txt | 2015-02-14 03:55 | 50K | |
![[TXT]](/icons/text.gif) | 77fb3af35c417361bc3140181bcb8550.txt | 2015-02-13 20:27 | 38K | |
![[ ]](/icons/layout.gif) | e2eeadf8dbaf1a207adaaac0659729e8.pdf | 2015-02-13 13:54 | 538K | |
![[TXT]](/icons/text.gif) | 3fe0ebcd79d48eac9bde9e1938d97a6b.txt | 2015-02-11 15:52 | 14K | |
![[TXT]](/icons/text.gif) | 54ada348e51a30613f92eb641ec58b0e.txt | 2015-02-11 15:49 | 0 | |
![[TXT]](/icons/text.gif) |
Functional survival of kidneys subjected to extracorporeal freezing and reimplantation
.txt | 2015-02-11 15:48 | 24K | |
![[TXT]](/icons/text.gif) | 9d69a2ae357e54bf62e5a6968454e11c.txt | 2015-02-10 18:15 | 48K | |
![[TXT]](/icons/text.gif) | ea9003f4177ce44f8c3e24d9faab37c0.txt | 2015-02-09 14:59 | 49K | |
![[TXT]](/icons/text.gif) | f13dac40818dc55be40d9b0ac607523e.txt | 2015-02-09 08:37 | 82K | |
![[ ]](/icons/layout.gif) | Synergistic Effects of Sodium Butyrate, a Histone Deacetylase Inhibitor, on Increase of Neurogenesis Induced by Pyridoxine and Increase of Neural Proliferation in the Mouse Dentate Gyrus.pdf | 2015-02-09 04:13 | 531K | |
![[ ]](/icons/layout.gif) | 7f1d1c94d17f24bebb90e4687c9e6283.pdf | 2015-02-08 07:12 | 1.8M | |
![[TXT]](/icons/text.gif) |
The Dynamics of the Human Infant Gut Microbiome in Development and in Progression toward Type 1 Diabetes
.txt | 2015-02-08 06:02 | 24K | |
![[TXT]](/icons/text.gif) | 24b6812961745221288c03b8091b6dad.txt | 2015-02-06 18:42 | 25K | |
![[ ]](/icons/layout.gif) |
Initiatives to promote commercialization of university knowledge
.pdf | 2015-02-06 17:56 | 55K | |
![[ ]](/icons/layout.gif) | HIV-1 Integration Landscape during Latent and Active Infection.pdf | 2015-02-06 17:14 | 1.3M | |
![[TXT]](/icons/text.gif) | 677bc809fb729b9f468852d4def81f7c.txt | 2015-02-06 17:09 | 39K | |
![[ ]](/icons/layout.gif) | Combined Mitigation of the Gastrointestinal and Hematopoietic Acute Radiation Syndromes by an LPA2 Receptor-Specific Nonlipid Agonist.pdf | 2015-02-06 17:06 | 2.9M | |
![[TXT]](/icons/text.gif) | 1bc67a4ba28006f63fda9c4ecd6ada47.txt | 2015-02-06 17:05 | 54K | |
![[TXT]](/icons/text.gif) | 57e36968f2616ce519d4d1a4ec184ee9.txt | 2015-02-06 16:32 | 48K | |
![[TXT]](/icons/text.gif) | e3a9d32b8b28b882768ed5a1aecd8f16.txt | 2015-02-06 16:31 | 48K | |
![[TXT]](/icons/text.gif) | 8a1611f8f45a75e82377bd6879c2b039.txt | 2015-02-06 15:29 | 34K | |
![[TXT]](/icons/text.gif) | ca593f47ae10f09cc6a22672d535bd7d.txt | 2015-02-06 15:28 | 34K | |
![[ ]](/icons/layout.gif) | f6fecafc72af15683e4dca6fedf68df3.pdf | 2015-02-06 09:56 | 23M | |
![[TXT]](/icons/text.gif) | dd49347cfea962c7f4f0324becb95126.txt | 2015-02-03 11:20 | 12K | |
![[TXT]](/icons/text.gif) | fcb02c4ed25d0ee6b1bcb9f50758579d.txt | 2015-02-02 13:03 | 14K | |
![[TXT]](/icons/text.gif) | 1463ab1c14e1d0c46ad6983aa6fdea8c.txt | 2015-02-02 12:57 | 12K | |
![[TXT]](/icons/text.gif) | d2e7676977546497b05439bbbe23b25f.txt | 2015-02-02 12:55 | 65K | |
![[TXT]](/icons/text.gif) | a2ab2faa404d38f4146d51e5baaa36b5.txt | 2015-02-02 12:50 | 65K | |
![[ ]](/icons/layout.gif) | 2bcaac171dd7bd0153ca8065d03fd03c.pdf | 2015-02-02 11:00 | 165K | |
![[ ]](/icons/layout.gif) |
Intra-Spike Crosslinking Overcomes Antibody Evasion by HIV-1
.pdf | 2015-02-02 03:13 | 56K | |
![[ ]](/icons/layout.gif) | 9c546b1afddfd6ba3cbd025a68b0dff.pdf | 2015-02-01 22:41 | 508K | |
![[TXT]](/icons/text.gif) | 69290bf5bd0795c175a60742ce83bb8e.txt | 2015-02-01 22:40 | 158K | |
![[ ]](/icons/layout.gif) |
The ribosome as a missing link in the evolution of life
.pdf | 2015-01-07 12:48 | 52K | |
![[TXT]](/icons/text.gif) | 14eebcd9bf4dce42212260ff54e61c40.txt | 2015-01-05 13:21 | 108K | |
![[ ]](/icons/layout.gif) |
The spontaneous generation of digital “Life”
.pdf | 2014-12-21 13:53 | 50K | |
![[ ]](/icons/layout.gif) |
Assessment of the health impact of GM plant diets in long-term and multigenerational animal feeding trials: A literature review
.pdf | 2014-12-11 20:30 | 52K | |
![[ ]](/icons/layout.gif) |
Biogenic halocarbons in young Arctic sea ice and frost flowers
.pdf | 2014-12-06 12:28 | 53K | |
![[ ]](/icons/layout.gif) |
Disruption of striatal-enriched protein tyrosine phosphatase (STEP) function in neuropsychiatric disorders
.pdf | 2014-12-06 01:34 | 53K | |
![[ ]](/icons/layout.gif) |
What primary microcephaly can tell us about brain growth
.pdf | 2014-12-02 14:28 | 54K | |
![[ ]](/icons/layout.gif) |
Sequences of numbers generated by addition in formal groups and new primality and factorization tests
.pdf | 2014-11-29 22:59 | 51K | |
![[ ]](/icons/layout.gif) |
A fully decompressed synthetic bacteriophage øX174 genome assembled and archived in yeast
.pdf | 2014-11-29 14:23 | 54K | |
![[ ]](/icons/layout.gif) |
Dielectric spectroscopy as a viable biosensing tool for cell and tissue characterization and analysis
.pdf | 2014-11-25 15:01 | 53K | |
![[ ]](/icons/layout.gif) |
Epitaxially grown metal-organic frameworks
.pdf | 2014-11-23 12:32 | 53K | |
![[ ]](/icons/layout.gif) |
Asynchronous automata versus asynchronous cellular automata
.pdf | 2014-11-21 10:04 | 51K | |
![[ ]](/icons/layout.gif) |
Age differences in fluid and crystallized intelligence
.pdf | 2014-11-20 12:24 | 51K | |
![[ ]](/icons/layout.gif) |
Drivers overtaking bicyclists: Objective data on the effects of riding position, helmet use, vehicle type and apparent gender
.pdf | 2014-11-18 14:17 | 53K | |
![[ ]](/icons/layout.gif) |
Should old dog trainers learn new tricks? The efficiency of the Do as I do method and shaping_clicker training method to train dogs
.pdf | 2014-11-18 13:40 | 53K | |
![[ ]](/icons/layout.gif) |
Automatic compensation for the temperature coefficient of a photodiode in short-circuit mode
.pdf | 2014-11-14 06:20 | 51K | |
![[ ]](/icons/layout.gif) |
Study of shrinkage strains in a stereolithography cured acrylic photopolymer resin
.pdf | 2014-11-12 07:01 | 52K | |
![[ ]](/icons/layout.gif) |
Enzymology of the carotenoid cleavage dioxygenases: Reaction mechanisms, inhibition and biochemical roles
.pdf | 2014-11-11 10:12 | 52K | |
![[ ]](/icons/layout.gif) |
Computer-aided design for metabolic engineering
.pdf | 2014-11-10 12:57 | 53K | |
![[ ]](/icons/layout.gif) |
Adverse selection and reputation in a world of cheap talk
.pdf | 2014-11-09 11:21 | 52K | |
![[ ]](/icons/layout.gif) |
Mitochondria-targeted antioxidant peptide SS31 attenuates high glucose-induced injury on human retinal endothelial cells
.pdf | 2014-10-27 19:46 | 52K | |
![[ ]](/icons/layout.gif) |
Emergence of fuzzy preferences for risk in a Birkhoff–von Neumann logics environment
.pdf | 2014-10-27 13:06 | 50K | |
![[TXT]](/icons/text.gif) |
On the Role of Monetary Policy in a Deflationary Economy: The Case of Japan
.txt | 2014-10-26 13:38 | 7.3K | |
![[ ]](/icons/layout.gif) |
On the Role of Monetary Policy in a Deflationary Economy: The Case of Japan
.pdf | 2014-10-26 13:36 | 50K | |
![[TXT]](/icons/text.gif) | 2095bba0fdf4eeb66b38abfe6916fa5b.txt | 2014-10-26 04:06 | 17K | |
![[TXT]](/icons/text.gif) | c76badb74167f42a494ae227d5f5d89c.txt | 2014-10-24 16:20 | 7.0K | |
![[TXT]](/icons/text.gif) | fc9d978dec3cddd1157a09bc6bbba1fc.txt | 2014-10-24 14:12 | 14K | |
![[TXT]](/icons/text.gif) | 206338e15e860f93156b5a1836ed5a02.txt | 2014-10-24 14:09 | 14K | |
![[TXT]](/icons/text.gif) | 9dac56417e2ec6e8716ed3a3ce945f8d.txt | 2014-10-22 20:10 | 7.0K | |
![[TXT]](/icons/text.gif) | f8a545c66f53888e6690517d9481af92.txt | 2014-10-22 20:10 | 7.0K | |
![[TXT]](/icons/text.gif) | 36b05a58c8a64e2ade7f33aff3c882b6.txt | 2014-10-22 13:25 | 244 | |
![[TXT]](/icons/text.gif) | 79ab9636eb86d0418073ba5810cee394.txt | 2014-10-22 13:23 | 13K | |
![[TXT]](/icons/text.gif) | cc2832407347eda545b7b9c1e9cc598f.txt | 2014-10-22 13:20 | 41K | |
![[TXT]](/icons/text.gif) | 8e2dc82d65c69cd716d80b3198a9a340.txt | 2014-10-22 13:19 | 13K | |
![[TXT]](/icons/text.gif) | 64a723ca996d95a9fef285cf027d695.txt | 2014-10-22 13:16 | 13K | |
![[TXT]](/icons/text.gif) | 430b0ce28ae82bd792044c3bfb8d300c.txt | 2014-10-22 11:01 | 7.0K | |
![[TXT]](/icons/text.gif) | c46c0940f219b98d8a17b0dbb2d45dba.txt | 2014-10-21 23:56 | 6.9K | |
![[TXT]](/icons/text.gif) | 2a79a7e5e63276fd7ce0c34dc9708cca.txt | 2014-10-21 16:28 | 7.0K | |
![[TXT]](/icons/text.gif) | a86e5f75f3951086e624028f1614ab3e.txt | 2014-10-21 15:00 | 6.7K | |
![[TXT]](/icons/text.gif) | c04a23a5121e337dac1160e17906c005.txt | 2014-10-21 14:55 | 6.7K | |
![[TXT]](/icons/text.gif) | 7d9ae6739de3f843d9cf0bbcc3e636f4.txt | 2014-10-21 14:54 | 6.7K | |
![[TXT]](/icons/text.gif) | Delivery Error.txt | 2014-10-20 13:55 | 28K | |
![[TXT]](/icons/text.gif) | Note: Repetitive operation of the capacitor bank of the low-voltage miniature plasma focus at 50 Hz.txt | 2014-10-20 13:53 | 76K | |
![[TXT]](/icons/text.gif) | 31a6d978d3624c46650a1bb45220713.txt | 2014-10-19 14:16 | 47K | |
![[ ]](/icons/layout.gif) | b4ae0591d2d678c35c9f0e20a2f7a371.pdf | 2014-10-17 11:19 | 1.1M | |
![[TXT]](/icons/text.gif) | faf8b2b3a9bee17e5611010ec6ea0c93.txt | 2014-10-17 08:45 | 56K | |
![[ ]](/icons/layout.gif) |
Towards the Artsutanov's dream of the space elevator: The ultimate design of a 35GPa strong tether thanks to graphene
.pdf | 2014-10-15 06:00 | 53K | |
![[TXT]](/icons/text.gif) | 61f4b56d1ce22dc5a916c08631fb5b07.txt | 2014-10-15 05:07 | 6.8K | |
![[TXT]](/icons/text.gif) | 28f36b2146d478bcae623ceaced43c2a.txt | 2014-10-15 04:43 | 7.1K | |
![[ ]](/icons/layout.gif) |
Synergistic effect of dual-frequency ultrasound irradiation in the one-pot synthesis of 3,5-disubstituted isoxazoles
.pdf | 2014-10-15 03:51 | 53K | |
![[TXT]](/icons/text.gif) | 9dcb25ef3021560ecec080d3acb11910.txt | 2014-10-14 19:22 | 6.8K | |
![[TXT]](/icons/text.gif) | 91c60fb7a55dea73d47fc4cdca7c2aaa.txt | 2014-10-14 06:35 | 118K | |
![[TXT]](/icons/text.gif) | 728cc919addc5cd553c2e65d6af1fd12.txt | 2014-10-14 05:09 | 7.0K | |
![[ ]](/icons/layout.gif) | Modulation of BDNF expression by repeated treatment with the novel antipsychotic lurasidone under basal condition and in response to acute stress.pdf | 2014-10-14 04:16 | 236K | |
![[ ]](/icons/layout.gif) | 367f2facd452a3606b7e3cdb108948a7.pdf | 2014-10-13 17:11 | 2.2M | |
![[TXT]](/icons/text.gif) | 8bb23bbdf1dc0e8d681b5c1156c65fa9.txt | 2014-10-13 01:14 | 7.0K | |
![[TXT]](/icons/text.gif) | 762c2b9cb472d3a0bbd7b55e69160b1e.txt | 2014-10-13 01:14 | 7.0K | |
![[TXT]](/icons/text.gif) | d8a956f28756bc81c01b0cb09bf88eb.txt | 2014-10-12 21:25 | 14K | |
![[ ]](/icons/layout.gif) |
Providing incentives in providerless networks
.pdf | 2014-10-12 18:17 | 53K | |
![[TXT]](/icons/text.gif) | 96b8775a611a8bb8efc9a618e679eac2.txt | 2014-10-10 20:05 | 6.7K | |
![[TXT]](/icons/text.gif) | 51175064d15dd9f46acb761aca9aeb90.txt | 2014-10-10 20:03 | 43K | |
![[ ]](/icons/layout.gif) | eb30b0ee488e6fbebfca679dff7147a0.pdf | 2014-10-10 18:44 | 29M | |
![[TXT]](/icons/text.gif) | 386069d429ba62b59045c2bb4dcb9b79.txt | 2014-10-10 18:23 | 19K | |
![[TXT]](/icons/text.gif) | 783b020157a961d2e5e1598f7f319970.txt | 2014-10-10 15:15 | 14K | |
![[TXT]](/icons/text.gif) | fbc029017f4b75144e529c51dac75fee.txt | 2014-10-10 04:41 | 6.8K | |
![[ ]](/icons/layout.gif) |
ICAN: A novel laser architecture for space debris removal
.pdf | 2014-10-10 02:09 | 53K | |
![[ ]](/icons/layout.gif) | Bloom of resident antibiotic-resistant bacteria in soil following manure fertilization.pdf | 2014-10-09 14:34 | 817K | |
![[ ]](/icons/layout.gif) |
Rapid antidepressant effects of sleep deprivation therapy correlates with serum BDNF changes in major depression
.pdf | 2014-10-09 14:23 | 52K | |
![[TXT]](/icons/text.gif) | f05966ea58e2176f1130f9e09a834713.txt | 2014-10-09 06:05 | 6.8K | |
![[TXT]](/icons/text.gif) | 2de7fdd9c4064958fd9f8703e644af48.txt | 2014-10-09 05:56 | 6.8K | |
![[ ]](/icons/layout.gif) | Solid-to-fluidlike DNA transition in viruses facilitates infection.pdf | 2014-10-08 22:18 | 1.1M | |
![[TXT]](/icons/text.gif) | 94d5044a7f388ebb564ccaf1ec588cc2.txt | 2014-10-07 03:45 | 6.8K | |
![[TXT]](/icons/text.gif) | 4bf5e84afe1c558a429246bf94835ae1.txt | 2014-10-06 21:28 | 72K | |
![[TXT]](/icons/text.gif) | Mycoplasma gallisepticum Vaccination: Effects on Egg Transmission and Egg production.txt | 2014-10-06 13:56 | 2.4K | |
![[TXT]](/icons/text.gif) | 661867f1e3b3129a934e1d7b7e47bd0d.txt | 2014-10-05 20:21 | 6.7K | |
![[TXT]](/icons/text.gif) | 1ea8d1c3f1c7ef59ae1d9270527b2a8d.txt | 2014-10-05 17:21 | 18K | |
![[TXT]](/icons/text.gif) | 90b50f05807ac1d7c84022fda32bd14d.txt | 2014-10-03 14:36 | 48K | |
![[TXT]](/icons/text.gif) |
Randomized prospective trial comparing ultrasonography and pelvic examination for preterm labor surveillance
.txt | 2014-10-03 14:34 | 49K | |
![[ ]](/icons/layout.gif) |
Improved vision and on-field performance in baseball through perceptual learning
.pdf | 2014-10-02 21:38 | 53K | |
![[TXT]](/icons/text.gif) | 125db7f72942c848cbccb8b68262cba.txt | 2014-10-02 21:35 | 6.8K | |
![[TXT]](/icons/text.gif) | 1bf67a83b0c6d1f84bbf7a1da8548302.txt | 2014-10-01 18:47 | 28K | |
![[TXT]](/icons/text.gif) | 6b27633aaf5443fbc09b366b154ce3e3.txt | 2014-09-30 16:06 | 52K | |
![[ ]](/icons/layout.gif) | 799eac404b6860d1fd71ae03116dcd16.pdf | 2014-09-30 16:06 | 403K | |
![[TXT]](/icons/text.gif) | a7c22cb2cc7c4a4433e2570c7a5c1947.txt | 2014-09-30 05:25 | 19K | |
![[TXT]](/icons/text.gif) | 14287d7b77d372d8b6a19572d9f74182.txt | 2014-09-29 23:48 | 19K | |
![[ ]](/icons/layout.gif) | b81e76865ca51310f8c133d21011f0a3.pdf | 2014-09-27 15:07 | 414K | |
![[TXT]](/icons/text.gif) | d8b992d59e1021978a5c934be273109c.txt | 2014-09-27 14:57 | 82K | |
![[TXT]](/icons/text.gif) |
Brain Machine Interface and Limb Reanimation Technologies: Restoring Function After Spinal Cord Injury Through Development of a Bypass System
.txt | 2014-09-27 10:50 | 50K | |
![[TXT]](/icons/text.gif) | 73a773c7576041570daf5aaeab57d593.txt | 2014-09-27 10:39 | 120K | |
![[ ]](/icons/layout.gif) | 6fea1adc36a7ec6002b6769d51a2c566.pdf | 2014-09-27 01:39 | 2.1M | |
![[TXT]](/icons/text.gif) | 1be9f5a4112f6b4b020190e919531891.txt | 2014-09-26 13:06 | 57K | |
![[TXT]](/icons/text.gif) | 66a664e782d7a581afcd0a00a9889b99.txt | 2014-09-25 17:23 | 3.3K | |
![[TXT]](/icons/text.gif) | b2ebad11ce1b6f58f263f9fc79ef56db.txt | 2014-09-24 06:34 | 6.8K | |
![[TXT]](/icons/text.gif) | 9ffa4026141ce1ebcb70f2e61722a487.txt | 2014-09-24 03:19 | 29K | |
![[ ]](/icons/layout.gif) | 912914ca35373676bf1c9a9d86919c72.pdf | 2014-09-23 14:29 | 722K | |
![[TXT]](/icons/text.gif) | db085ea924897b1120f7fcb7c583a462.txt | 2014-09-23 14:26 | 7.0K | |
![[TXT]](/icons/text.gif) | 5ba33296576cf638a6ecf346bf49715f.txt | 2014-09-23 13:37 | 7.0K | |
![[TXT]](/icons/text.gif) | 242def5d76804cd02f1c0113460989a7.txt | 2014-09-21 18:57 | 26K | |
![[TXT]](/icons/text.gif) | 1a0fbf25c849f2fdc99a06cc73f4c65b.txt | 2014-09-21 18:31 | 6.8K | |
![[TXT]](/icons/text.gif) | 8b049358c01dad61884364bbe454ba54.txt | 2014-09-21 10:07 | 42K | |
![[ ]](/icons/layout.gif) |
New quaternary ammonium camphor derivatives and their antiviral activity, genotoxic effects and cytotoxicity
.pdf | 2014-09-21 05:17 | 52K | |
![[TXT]](/icons/text.gif) | 3e3feb19fd241f346b750fdf8220b0.txt | 2014-09-18 16:31 | 11K | |
![[TXT]](/icons/text.gif) | f327266474e193db0183eeb119b0372c.txt | 2014-09-18 16:29 | 11K | |
![[TXT]](/icons/text.gif) | e4e00064138b7435297290b7e87b10bb.txt | 2014-09-18 15:04 | 6.9K | |
![[ ]](/icons/layout.gif) | b94991daae95ec88d1348457a6a1865e.pdf | 2014-09-16 12:45 | 736K | |
![[TXT]](/icons/text.gif) | 38a82de081ec2953c6860eb52b2153c3.txt | 2014-09-16 11:42 | 20K | |
![[TXT]](/icons/text.gif) |
Electric Organs
.txt | 2014-09-16 11:41 | 50K | |
![[TXT]](/icons/text.gif) | 485cef9a9ea5f6a52f522900b3b420e8.txt | 2014-09-15 23:44 | 7.0K | |
![[TXT]](/icons/text.gif) | c596917e90dd505fcab48404ebfc564d.txt | 2014-09-15 23:42 | 7.0K | |
![[TXT]](/icons/text.gif) | ccf259754ac4007ecde91a8962e353dc.txt | 2014-09-15 13:40 | 54K | |
![[TXT]](/icons/text.gif) | b8d56e449a6814f1529c27edc7833489.txt | 2014-09-15 10:44 | 7.0K | |
![[TXT]](/icons/text.gif) | 5f1c84622e23379bab47c940264db35f.txt | 2014-09-14 17:10 | 12K | |
![[TXT]](/icons/text.gif) | 864e4a59c70e820eb2e4c7d391c1e55.txt | 2014-09-14 17:02 | 12K | |
![[TXT]](/icons/text.gif) | e9cf586b675bf2ec8705041a3ab5ae0d.txt | 2014-09-14 02:53 | 7.2K | |
![[ ]](/icons/layout.gif) | fae92a2c0dbceb196c6168f5bdcf84f2.pdf | 2014-09-13 12:41 | 6.2M | |
![[TXT]](/icons/text.gif) | b3c64c410c37e82474843bea04244543.txt | 2014-09-12 14:33 | 6.9K | |
![[TXT]](/icons/text.gif) | 53471de93255b159949f75a7a83c6f49.txt | 2014-09-12 13:31 | 6.9K | |
![[TXT]](/icons/text.gif) | 6afe6dd8ae37218182042234456c2563.txt | 2014-09-12 05:08 | 7.0K | |
![[TXT]](/icons/text.gif) | 950fdd0d4f8610a7ad2c620f7f952e8a.txt | 2014-09-12 04:48 | 62K | |
![[TXT]](/icons/text.gif) | f095e8f69134c94af6a397d7d3cfe161.txt | 2014-09-12 04:47 | 62K | |
![[ ]](/icons/layout.gif) |
Superior nonverbal intelligence in children with high-functioning autism or Asperger's syndrome
.pdf | 2014-09-11 05:52 | 53K | |
![[TXT]](/icons/text.gif) | a47617dd8931c3d7324d124ee53e9c2e.txt | 2014-09-11 05:51 | 7.0K | |
![[TXT]](/icons/text.gif) | c1b61d21191d001345ad6f6aae4f8146.txt | 2014-09-11 04:42 | 18K | |
![[TXT]](/icons/text.gif) | cffdb6d94e3e88a63c892775b3f788ff.txt | 2014-09-10 07:16 | 6.8K | |
![[TXT]](/icons/text.gif) | 37d0b1495ca86276aabd372f52217def.txt | 2014-09-09 19:12 | 57K | |
![[ ]](/icons/layout.gif) |
Opsonization, biodistribution, and pharmacokinetics of polymeric nanoparticles
.pdf | 2014-09-09 17:41 | 52K | |
![[TXT]](/icons/text.gif) | 3d6984878d50fcf1cb57e1e9bbb392bd.txt | 2014-09-09 17:30 | 43K | |
![[TXT]](/icons/text.gif) | d3b8fe54397162316c000782e9dbd61.txt | 2014-09-09 16:02 | 14K | |
![[TXT]](/icons/text.gif) | 6e7039a1bd8005171d29bce813f51d17.txt | 2014-09-09 07:39 | 6.9K | |
![[TXT]](/icons/text.gif) |
Inhibition of M13 phage synthesis by rifampicin in some rifampicin-resistant Escherichia coli mutants
.txt | 2014-09-07 21:53 | 49K | |
![[TXT]](/icons/text.gif) | 64f582f9552bb6824c7b783a77d2447f.txt | 2014-09-07 21:47 | 7.0K | |
![[TXT]](/icons/text.gif) | 48441ea3d11428c0e7788519d18508bf.txt | 2014-09-07 21:46 | 6.8K | |
![[TXT]](/icons/text.gif) | a75934280fbd6f4f921c98f85b3f4f75.txt | 2014-09-07 07:58 | 6.7K | |
![[TXT]](/icons/text.gif) | a5544f6e1b2929fab91df655c082df63.txt | 2014-09-07 01:36 | 15K | |
![[TXT]](/icons/text.gif) | 2b8a6d53686238742416240e18e2802.txt | 2014-09-05 09:29 | 947 | |
![[ ]](/icons/layout.gif) |
High yield electroextraction of proteins from yeast by a flow process
.pdf | 2014-09-05 07:44 | 43K | |
![[TXT]](/icons/text.gif) | 9fc7eb27bbb3860cb2bc34b90ea80c69.txt | 2014-09-05 06:05 | 6.8K | |
![[TXT]](/icons/text.gif) | b085160f0789600ca6aa420076f92a9.txt | 2014-09-04 12:32 | 6.8K | |
![[ ]](/icons/layout.gif) |
Neuregulin-1-Mediated Autocrine Signaling Underlies Sensitivity to HER2 Kinase Inhibitors in a Subset of Human Cancers
.pdf | 2014-09-04 09:01 | 43K | |
![[ ]](/icons/layout.gif) |
Activity from skin mechanoreceptors recorded percutaneously in awake human subjects
.pdf | 2014-09-04 09:00 | 40K | |
![[TXT]](/icons/text.gif) | e808672a90ade07c42c1ae6be06a80c0.txt | 2014-09-04 04:15 | 6.8K | |
![[TXT]](/icons/text.gif) |
Activity from skin mechanoreceptors recorded percutaneously in awake human subjects
.txt | 2014-09-04 02:09 | 7.3K | |
![[TXT]](/icons/text.gif) | 77d3c3b21a4422b22fe02cbb076216b6.txt | 2014-09-03 02:07 | 45K | |
![[TXT]](/icons/text.gif) | 6f92acf4ff56363ff9039d6e0ccefbe7.txt | 2014-09-03 02:06 | 7.0K | |
![[ ]](/icons/layout.gif) |
Chronic inositol increases striatal D2 receptors but does not modify dexamphetamine-induced motor behavior: Relevance to obsessive–compulsive disorder
.pdf | 2014-09-03 01:57 | 43K | |
![[TXT]](/icons/text.gif) | e1655e961c26342082e0e329cc3e6cf6.txt | 2014-09-01 19:16 | 6.9K | |
![[TXT]](/icons/text.gif) | 26c876ba0b4c210fa501ccd64b3d20e8.txt | 2014-09-01 16:20 | 37K | |
![[TXT]](/icons/text.gif) | 603d4a449c9ccb7fd56e4bc350a88aa2.txt | 2014-09-01 14:32 | 27K | |
![[ ]](/icons/layout.gif) |
Real-time fMRI neurofeedback: Progress and challenges
.pdf | 2014-09-01 05:33 | 42K | |
![[TXT]](/icons/text.gif) | 8b091165e51e3d9616e0c9a31c60cde9.txt | 2014-09-01 05:30 | 6.9K | |
![[TXT]](/icons/text.gif) |
Spike timing and synaptic dynamics at the awake thalamocortical synapse
.txt | 2014-09-01 04:17 | 40K | |
![[TXT]](/icons/text.gif) | 191d5ee9d9b9eba58571f8aaed119ae.txt | 2014-08-31 16:10 | 34K | |
![[TXT]](/icons/text.gif) | d641a4dbf021aba69e680e1340afb445.txt | 2014-08-31 16:08 | 34K | |
![[TXT]](/icons/text.gif) | 7f7bb3e0de5d5ec97b979fbf7d4afd86.txt | 2014-08-31 14:45 | 6.8K | |
![[TXT]](/icons/text.gif) | 79b79cab0a4ed92fd4dc4d88960d20d5.txt | 2014-08-31 14:23 | 7.0K | |
![[TXT]](/icons/text.gif) | c5598043b479eebfe5a27a3800f6e0d4.txt | 2014-08-31 14:22 | 6.9K | |
![[TXT]](/icons/text.gif) | 39384fbe3133b99f837db54cb7699ede.txt | 2014-08-31 14:15 | 32K | |
![[TXT]](/icons/text.gif) | 954d48beab966f714ed837f6e2c57664.txt | 2014-08-31 06:23 | 7.0K | |
![[TXT]](/icons/text.gif) | 10e8f9de65da8490646bce1b1e61625c.txt | 2014-08-31 01:32 | 6.8K | |
![[TXT]](/icons/text.gif) | 696522c7e44d1c616d25672526b0676a.txt | 2014-08-29 14:02 | 15K | |
![[TXT]](/icons/text.gif) | 1732b067ffaa8df7fa5796eeec9b0e8f.txt | 2014-08-29 02:22 | 39K | |
![[ ]](/icons/layout.gif) | Genomic surveillance elucidates Ebola virus origin and transmission during the 2014 outbreak.pdf | 2014-08-28 21:19 | 622K | |
![[TXT]](/icons/text.gif) | 43d06ebe8fce5d84fd269ec9bd474418.txt | 2014-08-28 07:43 | 15K | |
![[TXT]](/icons/text.gif) | b1881f9b0ce3817b9a9762096e115dd3.txt | 2014-08-27 15:01 | 6.8K | |
![[TXT]](/icons/text.gif) | a5507937e0ede3db5fd60a80cf169011.txt | 2014-08-27 14:57 | 13K | |
![[TXT]](/icons/text.gif) | 55473e93ebcac896a836d6dc5fb648f5.txt | 2014-08-27 12:47 | 6.8K | |
![[TXT]](/icons/text.gif) | d37f5d6fd1ab5cfe338afba3f41fc413.txt | 2014-08-27 12:00 | 6.8K | |
![[TXT]](/icons/text.gif) | da9c15e3c50a98813bebee8e988ab497.txt | 2014-08-27 08:12 | 6.8K | |
![[ ]](/icons/layout.gif) |
The effects of hippocampal lesions upon spatial and non-spatial tests of working memory
.pdf | 2014-08-27 00:51 | 40K | |
![[TXT]](/icons/text.gif) | c538724c152db2f46149dfb0f1b89e3d.txt | 2014-08-27 00:41 | 35K | |
![[TXT]](/icons/text.gif) | f08768f0f73ec28187b61f7558aea0f5.txt | 2014-08-27 00:39 | 15K | |
![[TXT]](/icons/text.gif) | dfe5adee11d9930d0fd820c46bf1fd5f.txt | 2014-08-25 16:08 | 7.0K | |
![[TXT]](/icons/text.gif) | 9df8e04743100b40f2852d207b6681b0.txt | 2014-08-25 16:06 | 7.0K | |
![[ ]](/icons/layout.gif) |
Effective mutation rate for probabilistic evolutionary design of analogue electrical circuits
.pdf | 2014-08-25 02:13 | 43K | |
![[ ]](/icons/layout.gif) |
Biomolecule–nanoparticle hybrid systems for bioelectronic applications
.pdf | 2014-08-25 02:10 | 43K | |
![[ ]](/icons/layout.gif) |
3D face reconstructions from photometric stereo using near infrared and visible light
.pdf | 2014-08-25 01:54 | 42K | |
![[TXT]](/icons/text.gif) |
3D face reconstructions from photometric stereo using near infrared and visible light
.txt | 2014-08-25 01:49 | 42K | |
![[TXT]](/icons/text.gif) | TypeError: 'CaseInsensitiveDict' object is not callable __ Werkzeug Debugger.txt | 2014-08-25 00:57 | 7.6K | |
![[TXT]](/icons/text.gif) | IndexError: list index out of range __ Werkzeug Debugger.txt | 2014-08-25 00:49 | 8.2K | |
![[ ]](/icons/layout.gif) |
Measurements of discrete and continuous X-ray spectra with a photodiode at room temperature
.pdf | 2014-08-24 21:33 | 441K | |
![[TXT]](/icons/text.gif) |
Measurements of discrete and continuous X-ray spectra with a photodiode at room temperature
.txt | 2014-08-24 17:36 | 42K | |
![[TXT]](/icons/text.gif) | 431080b7acb1c649b0032ad29ec8e86d.txt | 2014-08-24 16:16 | 42K | |
![[TXT]](/icons/text.gif) | 21417f4c7bd7cadbdb14fe188da9fbf2.txt | 2014-08-24 16:14 | 42K | |
![[TXT]](/icons/text.gif) | ac082973029efdd139bf34d0be208e30.txt | 2014-08-24 16:12 | 42K | |
![[TXT]](/icons/text.gif) | 68980efcd77dbbfb1cc77cc8658e0770.txt | 2014-08-24 16:07 | 42K | |
![[TXT]](/icons/text.gif) | 668e2cc45e350d5343699e8444b2cbaa.txt | 2014-08-24 15:57 | 42K | |
![[TXT]](/icons/text.gif) | 6fd9217fba75943c1e7903d51412143c.txt | 2014-08-24 15:12 | 343 | |
![[TXT]](/icons/text.gif) | efc3fe3beb83448a08fea82d170ba906.txt | 2014-08-24 15:12 | 42K | |
![[TXT]](/icons/text.gif) | 7dcf9bfa96af3d42ae2759ab120561d7.txt | 2014-08-24 15:10 | 42K | |
![[TXT]](/icons/text.gif) | 24ae6bae689c8f98e0a0ca6ee2bb0d19.txt | 2014-08-24 15:09 | 42K | |
![[TXT]](/icons/text.gif) | 65a929edf68cb0edc86e159873f47c77.txt | 2014-08-24 14:57 | 42K | |
![[TXT]](/icons/text.gif) | 3ab0de366a9ad2a0d525867e38cdb2cd.txt | 2014-08-24 14:55 | 42K | |
![[TXT]](/icons/text.gif) | c81d045286ed764dcebb6acc20c4478f.txt | 2014-08-24 14:55 | 42K | |
![[TXT]](/icons/text.gif) | 1d9aeae4ae5447d7cfab6d210c475d3c.txt | 2014-08-24 14:54 | 42K | |
![[TXT]](/icons/text.gif) | 83d0aa1cb869a8dc17477f2139887db4.txt | 2014-08-24 14:52 | 42K | |
![[TXT]](/icons/text.gif) | f689f6a8dd6e109511826be5009ce82f.txt | 2014-08-24 14:51 | 42K | |
![[TXT]](/icons/text.gif) | 88f63bdcdc78a640eacffdfc0933bf7e.txt | 2014-08-24 14:46 | 42K | |
![[TXT]](/icons/text.gif) | 7c083f69992eb24b855b020e8cd12c49.txt | 2014-08-24 14:42 | 42K | |
![[TXT]](/icons/text.gif) | d71146ad6212da5f21232aef85cebbf.txt | 2014-08-24 14:39 | 42K | |
![[TXT]](/icons/text.gif) | de147e604895c8c46dcf172f37d619fd.txt | 2014-08-24 14:39 | 317 | |
![[TXT]](/icons/text.gif) | d9c2a58f335716eed98363117cb0c4e2.txt | 2014-08-24 14:38 | 42K | |
![[TXT]](/icons/text.gif) | 1b93cfc2338d1e77b75a511f34865889.txt | 2014-08-24 14:36 | 42K | |
![[TXT]](/icons/text.gif) | ca80740576d65cc4908de047d004ff29.txt | 2014-08-24 13:37 | 23K | |
![[TXT]](/icons/text.gif) | e6be5587dd4be229efb016b786c21680.txt | 2014-08-24 13:09 | 42K | |
![[ ]](/icons/layout.gif) | Ren Daumal and the pataphysics of liberation.pdf | 2014-08-24 07:37 | 594K | |
![[ ]](/icons/layout.gif) | 75e6714f449b3906c95620aa76848f42.pdf | 2014-08-24 01:44 | 35K | |
![[TXT]](/icons/text.gif) | 8af183b63698e909c84b816158831deb.txt | 2014-08-23 19:26 | 41K | |
![[TXT]](/icons/text.gif) | 53662cbd47d8822c90cf548181ad2810.txt | 2014-08-23 16:58 | 42K | |
![[TXT]](/icons/text.gif) | 8988e3727afbb40b32e0bc01c09db62f.txt | 2014-08-23 16:57 | 42K | |
![[TXT]](/icons/text.gif) | 55142a941f6134a935c07c65680c2660.txt | 2014-08-22 12:13 | 42K | |
![[TXT]](/icons/text.gif) | 5bcccf2c63b04af42aee69e6491910c9.txt | 2014-08-22 12:08 | 57K | |
![[ ]](/icons/layout.gif) | fb0805b9da2c63592860a676bbe2a23c.pdf | 2014-08-22 03:06 | 9.4M | |
![[ ]](/icons/layout.gif) | cd479d96ec4206f7aa701cda28c3c9fd.pdf | 2014-08-21 00:31 | 1.7M | |
![[TXT]](/icons/text.gif) | efb9dd5dcf72193643e43fae376aa9f6.txt | 2014-08-18 17:38 | 46K | |
![[TXT]](/icons/text.gif) | 8b8745c4907947ba48dcbb4691a37b32.txt | 2014-08-18 02:35 | 10K | |
![[TXT]](/icons/text.gif) | f2ad06475fa73983b8b2f2999e3b17cd.txt | 2014-08-17 23:23 | 43K | |
![[ ]](/icons/layout.gif) | 19392d8307a7d9012055639c45ff1768.pdf | 2014-08-17 09:02 | 461K | |
![[TXT]](/icons/text.gif) | 38d7f187a542a6fd43ff04f552b2055a.txt | 2014-08-17 08:58 | 41K | |
![[TXT]](/icons/text.gif) | 74a61b4ffd987d4f5a7ee8a140292d98.txt | 2014-08-16 00:00 | 28K | |
![[TXT]](/icons/text.gif) | d19a72d45c83da7e33ae97e33b3c9a15.txt | 2014-08-15 23:58 | 183K | |
![[TXT]](/icons/text.gif) | ca118a70a4960dcfbd220784b851cae2.txt | 2014-08-15 23:58 | 32K | |
![[TXT]](/icons/text.gif) | e9b97748cd893495ebaff80904b6edf9.txt | 2014-08-15 23:55 | 28K | |
![[TXT]](/icons/text.gif) | 9b0916168074cb9d2b419a1f42d9179c.txt | 2014-08-15 15:01 | 14K | |
![[TXT]](/icons/text.gif) | cfe72a384e8c49d83fd860eab1c8a950.txt | 2014-08-15 15:01 | 14K | |
![[TXT]](/icons/text.gif) | 222b8b38e62aae0bc62a0ad07b44d8ab.txt | 2014-08-14 07:31 | 42K | |
![[TXT]](/icons/text.gif) | 7be3258d070a948b89c5f505178c2b59.txt | 2014-08-13 04:20 | 14K | |
![[TXT]](/icons/text.gif) | c7e7781dd5e468317ca298424b23e881.txt | 2014-08-12 10:42 | 140K | |
![[ ]](/icons/layout.gif) | Dissolvable fluidic time delays for programming multi-step assays in instrument-free paper diagnostics.pdf | 2014-08-12 10:32 | 1.0M | |
![[TXT]](/icons/text.gif) | 96c418617d1807a0bfde4a953beab2fa.txt | 2014-08-12 09:39 | 12K | |
![[TXT]](/icons/text.gif) | e0a817078c5c3c4c088b7732192a5c8a.txt | 2014-08-12 09:34 | 12K | |
![[TXT]](/icons/text.gif) | f8be5de78d0078a95d999e5f9095f22.txt | 2014-08-11 16:58 | 14K | |
![[TXT]](/icons/text.gif) | 2a6f71702219b367087ce6a5974ff38.txt | 2014-08-11 07:31 | 39K | |
![[TXT]](/icons/text.gif) | An efficient, low profile, electrically small, three-dimensional, very high frequency magnetic EZ antenna.txt | 2014-08-11 03:34 | 78K | |
![[TXT]](/icons/text.gif) | cf5a4ba5c5159d1fb96c0b753c7c84d7.txt | 2014-08-10 13:06 | 50K | |
![[TXT]](/icons/text.gif) | f68b85d8404b29679d352876504abab6.txt | 2014-08-10 10:57 | 43K | |
![[TXT]](/icons/text.gif) | a64d08d68b04488e19d32090d347fb37.txt | 2014-08-10 08:08 | 13K | |
![[ ]](/icons/layout.gif) | A New Insight into Sangers Development of Sequencing: From Proteins to DNA, 19431977.pdf | 2014-08-10 02:45 | 937K | |
![[TXT]](/icons/text.gif) | 70319e776ddd25010374a4dbbc69d84f.txt | 2014-08-10 01:42 | 39K | |
![[TXT]](/icons/text.gif) | d1a31dad420dfe2b63d22bc489e0c236.txt | 2014-08-10 01:42 | 39K | |
![[TXT]](/icons/text.gif) | 9640cc19093d30bc2caba8a46a0dc421.txt | 2014-08-09 14:41 | 39K | |
![[TXT]](/icons/text.gif) | 8efdadeaf02c77b1157ffd961a8af5d9.txt | 2014-08-09 13:58 | 39K | |
![[TXT]](/icons/text.gif) | 1d51967ff2927f45400fd0f2c055ebd1.txt | 2014-08-09 12:41 | 42K | |
![[TXT]](/icons/text.gif) | 56427d01a42b59232f79f839d440e587.txt | 2014-08-09 12:37 | 66K | |
![[TXT]](/icons/text.gif) | d06eff404dd0fb94f6aa16018b4ceba6.txt | 2014-08-09 12:36 | 36K | |
![[TXT]](/icons/text.gif) | e0384ac6a7fa35f9c0fae6d99ef44bc0.txt | 2014-08-09 12:33 | 42K | |
![[TXT]](/icons/text.gif) | 8688d583313c30d41f3ba90c6a306aea.txt | 2014-08-09 12:29 | 42K | |
![[TXT]](/icons/text.gif) | e58cc6a89d5c839967353f9579771d22.txt | 2014-08-09 12:03 | 27K | |
![[TXT]](/icons/text.gif) | db1d7884f09daa5b8ed883f8efc55174.txt | 2014-08-09 11:30 | 229K | |
![[TXT]](/icons/text.gif) | a9c23acc090628425ad893f38c5f7618.txt | 2014-08-09 08:51 | 39K | |
![[ ]](/icons/layout.gif) | bdc53a04e56b2e2d7d5f2a26c68d35ea.pdf | 2014-08-08 18:55 | 1.9M | |
![[TXT]](/icons/text.gif) | 556302d2ba263ec942f88cb01ae8ac49.txt | 2014-08-08 15:00 | 22K | |
![[ ]](/icons/layout.gif) | Do fixed patent terms distort innovation? Evidence from cancer clinical trials.pdf | 2014-08-08 11:09 | 1.0M | |
![[ ]](/icons/layout.gif) | A million spiking-neuron integrated circuit with a scalable communication network and interface.pdf | 2014-08-07 12:54 | 2.9M | |
![[TXT]](/icons/text.gif) | d5c41fdb4d0ad618892d0a18ee9d64a2.txt | 2014-08-07 10:05 | 24K | |
![[TXT]](/icons/text.gif) | 883a2160f9b94a518420aab1c1c6c7cb.txt | 2014-08-07 10:05 | 46K | |
![[ ]](/icons/layout.gif) | faf2733f6d227f7cd984409ddac6790.pdf | 2014-08-07 07:11 | 1.7M | |
![[ ]](/icons/layout.gif) | 6199bb10b57628374af21b611d52dd10.pdf | 2014-08-07 07:10 | 2.3M | |
![[TXT]](/icons/text.gif) | 6204fe91cdbecffe7e33b06d43cc6708.txt | 2014-08-04 23:53 | 60K | |
![[TXT]](/icons/text.gif) | a7727987ea84dd795b72568381a9c90b.txt | 2014-08-04 20:54 | 27K | |
![[ ]](/icons/layout.gif) | A bioinformaticians guide to the forefront of suffix array construction algorithms.pdf | 2014-08-04 18:47 | 549K | |
![[ ]](/icons/layout.gif) | Acoustophoretic contactless transport and handling of matter in air.pdf | 2014-08-04 09:12 | 1.1M | |
![[ ]](/icons/layout.gif) | a7d0032bdc16036ec8a3010c2e790f33.pdf | 2014-08-03 08:22 | 206K | |
![[ ]](/icons/layout.gif) | Site-specific selfish genes as tools for the control and genetic engineering of natural populations..pdf | 2014-08-03 08:20 | 206K | |
![[ ]](/icons/layout.gif) | Real-Time Evolution of New Genes by Innovation, Amplification, and Divergence.pdf | 2014-08-03 05:23 | 336K | |
![[TXT]](/icons/text.gif) | c2b4bb60917d1a2c16e2fe007f38b6cf.txt | 2014-08-01 11:26 | 4.8K | |
![[TXT]](/icons/text.gif) | 74657b8fc57cb82dad7aabd559d92fd2.txt | 2014-08-01 11:17 | 24K | |
![[ ]](/icons/layout.gif) | Anomalous Thrust Production from an RF Test Device Measured on a Low-Thrust Torsion Pendulum.pdf | 2014-08-01 11:15 | 12K | |
![[TXT]](/icons/text.gif) | 591555d06e5150de0101d627044a4e8c.txt | 2014-07-31 22:51 | 11K | |
![[TXT]](/icons/text.gif) | 443b392b6da3cf80ef48b7555d2e0b46.txt | 2014-07-31 14:29 | 190K | |
![[TXT]](/icons/text.gif) | 11d4585d1ba42a1837642d1c3cc153b4.txt | 2014-07-31 09:26 | 11K | |
![[TXT]](/icons/text.gif) | 73bae0c65d46061b8c3a4875a5b1cb63.txt | 2014-07-31 09:19 | 11K | |
![[TXT]](/icons/text.gif) | 774a78c2eb0bc694956b0dcf32e507b2.txt | 2014-07-28 18:43 | 13K | |
![[TXT]](/icons/text.gif) | ac3867d871c6406f78015862252e1998.txt | 2014-07-28 12:39 | 61K | |
![[TXT]](/icons/text.gif) | c20874df331d47a35a40b24d06e83dbd.txt | 2014-07-28 12:38 | 61K | |
![[TXT]](/icons/text.gif) | 60b5178452ba0477b47b15131db0a5c.txt | 2014-07-28 09:50 | 82K | |
![[TXT]](/icons/text.gif) | 5205558733eeac3df2c0d2416d08b6e9.txt | 2014-07-27 18:12 | 26K | |
![[TXT]](/icons/text.gif) | 829941b7b68a253327e19e3a4d1b69dd.txt | 2014-07-27 16:35 | 3.9M | |
![[TXT]](/icons/text.gif) | 4a17c40a4e6db32730c523b6397526c3.txt | 2014-07-27 16:34 | 93K | |
![[TXT]](/icons/text.gif) | 10f411d63c859c1934f4324480f2f7ed.txt | 2014-07-27 15:50 | 71K | |
![[TXT]](/icons/text.gif) | a970c0e236f1df152bf1345c47d7ea9c.txt | 2014-07-27 15:42 | 19K | |
![[TXT]](/icons/text.gif) | 6d1dcf9a66e7830b6a284fbac4fa69f1.txt | 2014-07-27 04:57 | 15K | |
![[ ]](/icons/layout.gif) | Keywords and Co-Occurrence Patterns in the Voynich Manuscript: An Information-Theoretic Analysis.pdf | 2014-07-26 07:09 | 852K | |
![[ ]](/icons/layout.gif) | Probing the Statistical Properties of Unknown Texts: Application to the Voynich Manuscript.pdf | 2014-07-26 07:09 | 488K | |
![[TXT]](/icons/text.gif) | 9e3a69d79121fb49039859bc1f8853d5.txt | 2014-07-25 16:41 | 171K | |
![[TXT]](/icons/text.gif) | 840c4d55ef147dfa4d6698ef21006690.txt | 2014-07-17 17:18 | 27K | |
![[ ]](/icons/layout.gif) | cfb988ca0f13be498f174c0bda1e8ee4.pdf | 2014-07-16 23:35 | 1.5M | |
![[TXT]](/icons/text.gif) | ecdc90fba3221a6ff872302735cd4f10.txt | 2014-07-16 23:31 | 43K | |
![[ ]](/icons/layout.gif) | 1cf46ee893655d77267af0edd9eba9c4.pdf | 2014-07-16 04:04 | 2.6M | |
![[TXT]](/icons/text.gif) | 28fc671a673fefbf45752f4f29120715.txt | 2014-07-14 11:13 | 34K | |
![[TXT]](/icons/text.gif) | c7746e26fccde9708e185ae8b34ce608.txt | 2014-07-14 11:11 | 34K | |
![[TXT]](/icons/text.gif) | ffac3725b7c1233908f8b7d261e8513c.txt | 2014-07-12 00:23 | 37K | |
![[TXT]](/icons/text.gif) | 2207cd66b3974d7def59792ca1fa02f3.txt | 2014-07-12 00:22 | 28K | |
![[TXT]](/icons/text.gif) | 87bb93ae55ce2f04ddbd8a6e92683697.txt | 2014-07-11 23:38 | 143K | |
![[TXT]](/icons/text.gif) | ba9d7c7c2f76f434d1c4681ee5b9f07b.txt | 2014-07-10 22:41 | 42K | |
![[TXT]](/icons/text.gif) | d300c4da0a632602d75997f9ef0cca5a.txt | 2014-07-10 22:40 | 58K | |
![[TXT]](/icons/text.gif) | 508a75835e9556ec783777e31f1a0787.txt | 2014-07-10 21:37 | 43K | |
![[TXT]](/icons/text.gif) | c5c28fbb045e3753a24d15697cc8da62.txt | 2014-07-10 07:43 | 33K | |
![[TXT]](/icons/text.gif) | 77cfce1fffc25aa42050084cf1836c2d.txt | 2014-07-10 07:41 | 42K | |
![[TXT]](/icons/text.gif) | b8048474c62af1e7e30222afb30ff02b.txt | 2014-07-10 07:40 | 14K | |
![[ ]](/icons/layout.gif) | 23cd36bf4c7a583c63a71a5f528cc695.pdf | 2014-07-09 07:06 | 889K | |
![[ ]](/icons/layout.gif) | 7ed920fba038bb1336001d7738706ecd.pdf | 2014-07-08 18:35 | 1.3M | |
![[TXT]](/icons/text.gif) | 2707a3b0de656026cbf1ef8bc050af07.txt | 2014-07-06 07:47 | 2.4K | |
![[ ]](/icons/layout.gif) | The challenge of crafting policy for do-it-yourself brain stimulation.pdf | 2014-07-05 14:22 | 145K | |
![[TXT]](/icons/text.gif) | 9546d4bb527dba0f7f09ffe8970d41ad.txt | 2014-07-05 13:10 | 40K | |
![[ ]](/icons/layout.gif) | 79b3a714c4247152abf49bbd6e404295.pdf | 2014-07-04 19:09 | 1.0M | |
![[TXT]](/icons/text.gif) | 89a216dd93565846da9ee7d8517b5060.txt | 2014-07-04 19:08 | 12K | |
![[ ]](/icons/layout.gif) | The Action of Vaporized Formaldehyde and Vaporized Carbolic Acid as Gaseous Disinfectants.pdf | 2014-07-03 20:41 | 187K | |
![[ ]](/icons/layout.gif) | cb184c9748b3f08abec495537a4a6b68.pdf | 2014-07-03 14:37 | 751K | |
![[TXT]](/icons/text.gif) | 760c3fa9093a0faa3774c98dc9c485e1.txt | 2014-07-03 14:35 | 75K | |
![[TXT]](/icons/text.gif) | 5a590b5209f65d1f61ee4e424f2f2a51.txt | 2014-07-03 14:35 | 74K | |
![[ ]](/icons/layout.gif) | 8fe4e6135f9d7913e94bc5c6393c01e5.pdf | 2014-07-02 23:07 | 2.4M | |
![[TXT]](/icons/text.gif) | 3cfb924824f0d00200aa3f5a5dc6ff4b.txt | 2014-07-02 23:07 | 147K | |
![[TXT]](/icons/text.gif) | 5d8aecc87af06503d5adc3cccea93a0c.txt | 2014-07-02 10:56 | 1.3K | |
![[ ]](/icons/layout.gif) | Measurements of Energetic Particle Radiation in Transit to Mars on the Mars Science Laboratory.pdf | 2014-07-02 10:16 | 724K | |
![[ ]](/icons/layout.gif) | Leaks, Lumps, and Lines: Stigma and Women's Bodies.pdf | 2014-07-01 11:34 | 225K | |
![[TXT]](/icons/text.gif) | b21dc2045769622310ac49da6973852b.txt | 2014-07-01 11:33 | 24K | |
![[ ]](/icons/layout.gif) | Reversing Stealthy Dopant-Level Circuits.pdf | 2014-06-30 11:44 | 6.5M | |
![[TXT]](/icons/text.gif) | 9881e2f721563096a276e2e506a49c65.txt | 2014-06-30 11:14 | 14K | |
![[ ]](/icons/layout.gif) | f5bf56b9caae40a070723c1d0ae9c3ea.pdf | 2014-06-30 10:54 | 619K | |
![[TXT]](/icons/text.gif) | f19c1764d90d9b32a26da24e69a5561.txt | 2014-06-29 03:42 | 642K | |
![[ ]](/icons/layout.gif) | Qualia: The Geometry of Integrated Information.pdf | 2014-06-29 03:38 | 1.6M | |
![[TXT]](/icons/text.gif) | 390418066ed23e6dbb1c03bdfd22183d.txt | 2014-06-29 03:27 | 47K | |
![[ ]](/icons/layout.gif) | Integrated Information in Discrete Dynamical Systems: Motivation and Theoretical Framework.pdf | 2014-06-29 03:05 | 742K | |
![[ ]](/icons/layout.gif) | 438f8424d312b074a5adc845f16c538a.pdf | 2014-06-29 02:44 | 283K | |
![[TXT]](/icons/text.gif) | 1a0201b63be97d4827d78edd86bb05d7.txt | 2014-06-27 14:55 | 14K | |
![[TXT]](/icons/text.gif) | 1aff50d9d0ed1c6c0006e56bc71bb858.txt | 2014-06-27 14:54 | 14K | |
![[TXT]](/icons/text.gif) | 6af3d1247ab3e711097ffcda087d7ce9.txt | 2014-06-27 14:47 | 14K | |
![[TXT]](/icons/text.gif) | c313fca66e0539b740a301b5070ac1.txt | 2014-06-25 19:16 | 67K | |
![[TXT]](/icons/text.gif) | dd6c86efe12e1b6d4ab24e1a38dbb09.txt | 2014-06-24 10:56 | 26K | |
![[ ]](/icons/compressed.gif) | publisherhtml.zip | 2014-06-21 16:21 | 12M | |
![[DIR]](/icons/folder.gif) | publisherhtml/ | 2014-06-21 16:21 | - | |
![[TXT]](/icons/text.gif) | dc3634b8805ca546fadcae1fc60748d1.txt | 2014-06-21 12:45 | 44K | |
![[TXT]](/icons/text.gif) | c3ca72faf9b0ae99828ba41249baf6f9.txt | 2014-06-21 07:27 | 49K | |
![[ ]](/icons/layout.gif) | Patterned liquid permeation through the TiO2 nanotube array coated Ti mesh by photoelectric cooperation for liquid printing.pdf | 2014-06-20 18:49 | 1.0M | |
![[ ]](/icons/layout.gif) | State-of-the-art in design rules for drug delivery platforms: Lessons learned from FDA-approved nanomedicines.pdf | 2014-06-20 13:30 | 1.6M | |
![[ ]](/icons/layout.gif) | 52401e0920b0808eb19a147341ffaf97.pdf | 2014-06-20 08:36 | 243K | |
![[TXT]](/icons/text.gif) | 5426d8a03004c94623bf35f7b939f1bc.txt | 2014-06-19 22:21 | 29K | |
![[TXT]](/icons/text.gif) | 2048d088a483941d4398cbfbe226d883.txt | 2014-06-19 22:02 | 115K | |
![[TXT]](/icons/text.gif) | 588841dac2dc9487050294e016b6b61a.txt | 2014-06-19 21:34 | 44K | |
![[TXT]](/icons/text.gif) | 52b613cfcb8fb9744bf22452ed2828a1.txt | 2014-06-19 14:00 | 37K | |
![[ ]](/icons/layout.gif) | Multi-Input RNAi-Based Logic Circuit for Identification of Specific Cancer Cells.pdf | 2014-06-19 09:18 | 604K | |
![[ ]](/icons/layout.gif) | b1334cb8b50bfb771b7986074871256b.pdf | 2014-06-19 02:08 | 3.0M | |
![[TXT]](/icons/text.gif) | b56e00056b48a1fbf7d6e05b6b92d756.txt | 2014-06-19 00:15 | 190K | |
![[TXT]](/icons/text.gif) | 56253bfde47aa367ca29b872bc50577b.txt | 2014-06-18 14:03 | 43K | |
![[ ]](/icons/layout.gif) | A Few Prolific Liars Variation in the Prevalence of Lying.pdf | 2014-06-18 13:34 | 573K | |
![[ ]](/icons/layout.gif) | The Billion Cell Construct: Will Three-Dimensional Printing Get Us There?.pdf | 2014-06-17 17:57 | 6.2M | |
![[TXT]](/icons/text.gif) | 584b6e4a1faf949d769140d8292e211f.txt | 2014-06-17 15:40 | 20K | |
![[ ]](/icons/layout.gif) | Micromolding of solvent resistant microfluidic devices.pdf | 2014-06-17 13:29 | 164K | |
![[TXT]](/icons/text.gif) | 399ab308bed84d4c8e5fb731fb2d8d4d.txt | 2014-06-17 07:14 | 58K | |
![[TXT]](/icons/text.gif) | 105433bb2848a3997f7fee7fb28251dc.txt | 2014-06-16 10:21 | 42K | |
![[TXT]](/icons/text.gif) | Method To Incorporate Anisotropic Semiconductor Nanocrystals of All Shapes in an Ultrathin and Uniform Silica Shell.txt | 2014-06-15 01:24 | 92K | |
![[ ]](/icons/layout.gif) | New LIC vectors for production of proteins from genes containing rare codons.pdf | 2014-06-13 22:33 | 562K | |
![[TXT]](/icons/text.gif) | 85f259a729166e57af37d8a772d7b3f6.txt | 2014-06-12 23:19 | 43K | |
![[ ]](/icons/layout.gif) | dd6631102fd83eebe71e86b8c6655865.pdf | 2014-06-12 23:06 | 1.6M | |
![[TXT]](/icons/text.gif) | d43451012ba93e9f655c2f15004e2e91.txt | 2014-06-12 23:05 | 132K | |
![[ ]](/icons/layout.gif) | The sunny side of chemistry: green synthesis by solar light.pdf | 2014-06-12 18:15 | 562K | |
![[TXT]](/icons/text.gif) | 4757a15586aa4daeea2de89402459b55.txt | 2014-06-12 11:28 | 41K | |
![[ ]](/icons/layout.gif) | Phagotrophy by a flagellate selects for colonial prey: A possible origin of multicellularity.pdf | 2014-06-12 07:22 | 740K | |
![[TXT]](/icons/text.gif) | 1ccb361bd345e214afb5b3e021fa2b82.txt | 2014-06-11 19:19 | 40K | |
![[TXT]](/icons/text.gif) | bdeebffb8bdc4419d33d21e38d5ac3d4.txt | 2014-06-11 19:18 | 38K | |
![[ ]](/icons/layout.gif) | Deep Learning in Neural Networks: An Overview.pdf | 2014-06-11 17:23 | 598K | |
![[TXT]](/icons/text.gif) | 480a002e9c963de3a405322f278be14e.txt | 2014-06-11 05:16 | 32K | |
![[TXT]](/icons/text.gif) | 358920edfa35f8bdfecf8f41d0903c5e.txt | 2014-06-10 13:57 | 36K | |
![[TXT]](/icons/text.gif) | d74c517586961f34264004ff9090100b.txt | 2014-06-09 15:42 | 4.9K | |
![[TXT]](/icons/text.gif) | c9b419fbc93c9ba8efacbe4945544198.txt | 2014-06-09 15:30 | 673 | |
![[TXT]](/icons/text.gif) | aff4506887e8a885c32918ed41a9db18.txt | 2014-06-09 15:28 | 13K | |
![[TXT]](/icons/text.gif) | 66a508a2d8d2f3605dc2c622af4a2928.txt | 2014-06-09 15:26 | 14K | |
![[TXT]](/icons/text.gif) | 160722860a5b075f7845eaea12dd9137.txt | 2014-06-09 15:26 | 14K | |
![[ ]](/icons/layout.gif) | On micro-kernel construction.pdf | 2014-06-08 13:02 | 1.6M | |
![[ ]](/icons/layout.gif) | Design of pressure-driven microfluidic networks using electric circuit analogy.pdf | 2014-06-08 09:15 | 4.9M | |
![[TXT]](/icons/text.gif) | b8a3c423d4692dd80b4adfe6d7a43b16.txt | 2014-06-08 09:10 | 52K | |
![[ ]](/icons/layout.gif) | Fully Automatic Liquid Metal Printer towards Personal Electronics Manufacture.pdf | 2014-06-08 09:02 | 3.2M | |
![[ ]](/icons/layout.gif) | PDMS-based microfluidic device with multi-height structures fabricated by single-step photolithography using printed circuit board as masters.pdf | 2014-06-08 08:32 | 629K | |
![[TXT]](/icons/text.gif) | 599077ec3d69774b82754bcd428fd028.txt | 2014-06-08 02:07 | 10K | |
![[TXT]](/icons/text.gif) | Coherent diffraction lithography: Periodic patterns via mask-based interference lithography.txt | 2014-06-08 00:41 | 67K | |
![[TXT]](/icons/text.gif) | f024d388e256fd7c693e20ed489eff00.txt | 2014-06-07 19:34 | 2.4K | |
![[TXT]](/icons/text.gif) | b39cc0157e982af31cf36981516ade50.txt | 2014-06-07 19:33 | 2.4K | |
![[TXT]](/icons/text.gif) | becb9d366e6c4bd29727bf9b7ff5d06b.txt | 2014-06-07 19:33 | 2.4K | |
![[ ]](/icons/layout.gif) | Identifiable Images of Bystanders Extracted from Corneal Reflections.pdf | 2014-06-06 07:21 | 417K | |
![[TXT]](/icons/text.gif) | fdad577dc5542adfef5640671a909217.txt | 2014-06-05 18:34 | 15K | |
![[TXT]](/icons/text.gif) | abf3cf5a125b7c7cc7f1cad856e75d15.txt | 2014-06-05 03:18 | 57K | |
![[ ]](/icons/layout.gif) | The Graph Grammar Library - a generic framework for chemical graph rewrite systems.pdf | 2014-06-04 12:16 | 1.2M | |
![[ ]](/icons/layout.gif) | b2d710d98a9d3d35094b393ac7161a84.pdf | 2014-06-02 16:56 | 218K | |
![[ ]](/icons/layout.gif) | 141d3bf3c08a1cd0f424219ebc3e032d.pdf | 2014-06-02 13:54 | 1.0M | |
![[TXT]](/icons/text.gif) | 93514aa9aede1d8ae0a80250a240a40.txt | 2014-06-02 13:53 | 669 | |
![[TXT]](/icons/text.gif) | ed0346d10cdb475d53eff1327a9016c1.txt | 2014-06-02 03:39 | 275 | |
![[TXT]](/icons/text.gif) | 11b2fce3dfede6790e1d3e1b5b843299.txt | 2014-06-02 03:38 | 11K | |
![[TXT]](/icons/text.gif) | 479617625f547c822610788969f661fa.txt | 2014-06-02 03:35 | 11K | |
![[ ]](/icons/layout.gif) | Laser forward transfer based on a spatial light modulator.pdf | 2014-06-01 23:42 | 679K | |
![[TXT]](/icons/text.gif) | fca8eabbc88fb16dbdf2960c1a4df67.txt | 2014-06-01 23:18 | 28K | |
![[TXT]](/icons/text.gif) | 2bdd604f90a7ffd08777a1185426d68d.txt | 2014-06-01 14:04 | 11K | |
![[TXT]](/icons/text.gif) | bfb313ff6ba3b31586bce0a27252da09.txt | 2014-06-01 04:33 | 19K | |
![[TXT]](/icons/text.gif) | a05aa85e7c775fcaa96ed5c98de69c60.txt | 2014-06-01 04:32 | 19K | |
![[TXT]](/icons/text.gif) | 4945e5ead2315698f7c19a8979eba8cd.txt | 2014-05-31 17:51 | 39K | |
![[ ]](/icons/layout.gif) | 7e18337057b0b676d8de795cc05daaf1.pdf | 2014-05-31 05:29 | 718K | |
![[TXT]](/icons/text.gif) | be18ceea8551338f8f43778b8500ccdd.txt | 2014-05-30 19:57 | 12K | |
![[TXT]](/icons/text.gif) | b9e5e9e3e67dd9278dc9bc8554cb1e9c.txt | 2014-05-30 18:59 | 53K | |
![[TXT]](/icons/text.gif) | 899987ef8ae0557c3daeb6316ed6c056.txt | 2014-05-30 18:57 | 53K | |
![[ ]](/icons/layout.gif) | Brain Structure and Functional Connectivity Associated With Pornography Consumption: The Brain on Porn.pdf | 2014-05-30 15:32 | 355K | |
![[TXT]](/icons/text.gif) | Design and analysis of the SAFE-400 space fission reactor.txt | 2014-05-29 06:43 | 64K | |
![[TXT]](/icons/text.gif) | c28c50f41166d1ee6830314b0c07bb0e.txt | 2014-05-27 06:52 | 61K | |
![[ ]](/icons/layout.gif) | The Severn Sea Islands in the Anglo-Saxon Chronicle.pdf | 2014-05-27 06:47 | 99K | |
![[TXT]](/icons/text.gif) | 1f003ecec728727cd0bece4e06d3c3bd.txt | 2014-05-27 06:38 | 12K | |
![[TXT]](/icons/text.gif) | 9574031370aeacd38134319aeec2d4ca.txt | 2014-05-27 06:24 | 14K | |
![[TXT]](/icons/text.gif) | 2dd7fb4fb80510c0673ce53801fec360.txt | 2014-05-27 04:03 | 25K | |
![[ ]](/icons/layout.gif) | 15705fc69b1ccdd15b005334728e1486.pdf | 2014-05-27 03:17 | 87K | |
![[TXT]](/icons/text.gif) | 2f1d7227fb9ce79b37a06b3f8fce4aad.txt | 2014-05-27 03:14 | 133K | |
![[ ]](/icons/layout.gif) | aca4ba49fe7ebfb272f2c19bd78c4fd6.pdf | 2014-05-26 00:10 | 88K | |
![[TXT]](/icons/text.gif) | 714461f5883f507aef53984efb3eb007.txt | 2014-05-26 00:09 | 15K | |
![[TXT]](/icons/text.gif) | 515af2f67f38e8753e73499cfa0837d1.txt | 2014-05-25 18:33 | 50K | |
![[TXT]](/icons/text.gif) | cfc59d9a8d81b13267d84e1a1ba321c0.txt | 2014-05-25 17:46 | 15K | |
![[TXT]](/icons/text.gif) | 21cf405fbb2b2dcaa6cf2a2288aa59e0.txt | 2014-05-25 17:45 | 2.4K | |
![[TXT]](/icons/text.gif) | Unexpected Error.txt | 2014-05-23 09:28 | 30K | |
![[TXT]](/icons/text.gif) | 89e60dbd9a50cc28fe5dd4a469cf745d.txt | 2014-05-23 09:22 | 18K | |
![[TXT]](/icons/text.gif) | An aeroacoustically driven thermoacoustic heat pump.txt | 2014-05-23 09:19 | 76K | |
![[TXT]](/icons/text.gif) | 3ad9d77074e20ca011bb62e28b07c39a.txt | 2014-05-23 00:29 | 27K | |
![[TXT]](/icons/text.gif) | cd3a707234c9a634e140704dbdd87543.txt | 2014-05-23 00:29 | 27K | |
![[ ]](/icons/layout.gif) | 5923535000692f2883fb058ae620b447.pdf | 2014-05-22 07:09 | 2.9M | |
![[TXT]](/icons/text.gif) | 2889d92ca165cb6ac7240f37dee66c1b.txt | 2014-05-20 18:19 | 41K | |
![[TXT]](/icons/text.gif) | 2b272c5dc7ac4c992ad056be3840275e.txt | 2014-05-20 10:02 | 146K | |
![[ ]](/icons/layout.gif) | Wireless power transfer to deep-tissue microimplants.pdf | 2014-05-20 05:29 | 1.7M | |
![[TXT]](/icons/text.gif) | 64639adda66ae71b528c37d5359faa80.txt | 2014-05-19 12:32 | 60K | |
![[TXT]](/icons/text.gif) | 1db8a9d2058510f9bebe78421d9cc9c6.txt | 2014-05-19 12:30 | 60K | |
![[TXT]](/icons/text.gif) | d5cd1734b6b11681d86d52d087c99cf1.txt | 2014-05-19 12:30 | 60K | |
![[TXT]](/icons/text.gif) | 216d7272d888e7c06c5b6b91caa6f50f.txt | 2014-05-19 12:28 | 60K | |
![[TXT]](/icons/text.gif) | ee6cfb39238d73a27fdab690bcbd2cc8.txt | 2014-05-18 15:58 | 3.1K | |
![[TXT]](/icons/text.gif) | 7b84d77cfc0a658522f60e91dee43f82.txt | 2014-05-18 07:22 | 243K | |
![[ ]](/icons/layout.gif) | Transcriptome Profiling of Human Pre-Implantation Development.pdf | 2014-05-18 07:21 | 482K | |
![[TXT]](/icons/text.gif) | 6e44e0121ee6a630c2676119c11e6d36.txt | 2014-05-18 00:50 | 43K | |
![[ ]](/icons/layout.gif) | 58fa7e712da1811310eb51712757daad.pdf | 2014-05-17 13:35 | 839K | |
![[TXT]](/icons/text.gif) | 3d422f97f6832fa450e5b241a112d17f.txt | 2014-05-16 23:00 | 40K | |
![[TXT]](/icons/text.gif) | 8f15b0e4a14972dcfb795ce171b43adb.txt | 2014-05-16 17:52 | 4.6K | |
![[ ]](/icons/layout.gif) | Therblig-based energy demand modeling methodology of machining process to support intelligent manufacturing.pdf | 2014-05-16 15:18 | 2.8M | |
![[TXT]](/icons/text.gif) | f2225e609d6ee02922398b1187cd4a20.txt | 2014-05-08 22:54 | 41K | |
![[TXT]](/icons/text.gif) | 3717ed0d4ba12ee8cb269e7e72d496cf.txt | 2014-05-08 21:11 | 36K | |
![[TXT]](/icons/text.gif) | 55255a58ae13da725ef6062cedd6ec5c.txt | 2014-05-08 19:09 | 1.6K | |
![[ ]](/icons/layout.gif) | aa0e718b04e29c402df832c3faebb70d.pdf | 2014-05-08 19:05 | 518K | |
![[TXT]](/icons/text.gif) | ae6fcac583ff98b22137d54423fbbf4b.txt | 2014-05-08 19:02 | 43K | |
![[ ]](/icons/layout.gif) | 14dd0eefc5b8e398517f0b5c6adf6a38.pdf | 2014-05-08 08:44 | 756K | |
![[TXT]](/icons/text.gif) | 683b55a712728fffb3067cbd5b22a44f.txt | 2014-05-08 08:42 | 45K | |
![[TXT]](/icons/text.gif) | 119017d7992207b30d055f9cbf9254fc.txt | 2014-05-08 08:35 | 54K | |
![[TXT]](/icons/text.gif) | 63f7b3b32ccb40cc815121bc924f82b4.txt | 2014-05-08 07:37 | 54K | |
![[TXT]](/icons/text.gif) | f84791ea3c41091483e08cc9e6591b1a.txt | 2014-05-08 07:15 | 43K | |
![[ ]](/icons/layout.gif) | 1bec416a0a27662988cbd3364e0add53.pdf | 2014-05-08 05:00 | 803K | |
![[TXT]](/icons/text.gif) | 1c2da1f0f99c774b9f88619558cbde08.txt | 2014-05-07 21:20 | 15K | |
![[TXT]](/icons/text.gif) | 88da5544077f3a12aebc8d5b5f1a52cf.txt | 2014-05-07 21:19 | 15K | |
![[ ]](/icons/layout.gif) | How do mutated oncogenes and tumor suppressor genes cause cancer?.pdf | 2014-05-07 20:01 | 724K | |
![[TXT]](/icons/text.gif) | f391802da42b816a077871f75ca79dcb.txt | 2014-05-07 12:21 | 41K | |
![[TXT]](/icons/text.gif) | be628aab88afa24df71e3c0e8ab72282.txt | 2014-05-07 02:42 | 54K | |
![[ ]](/icons/layout.gif) | 1d602c89e3d710a5250cabd853dcdc29.pdf | 2014-05-06 15:21 | 162K | |
![[ ]](/icons/layout.gif) | fb2998da70dff3533b290188199dce30.pdf | 2014-05-05 22:46 | 217K | |
![[TXT]](/icons/text.gif) | f69c486ba7c495853aa973115fb2b614.txt | 2014-05-05 11:33 | 163K | |
![[ ]](/icons/layout.gif) | 4b3695f2deb7b687321167307334d211.pdf | 2014-05-05 07:52 | 4.4M | |
![[TXT]](/icons/text.gif) | 7b3fbb05fb59ac801103fe4ba3b105a9.txt | 2014-05-05 07:49 | 249 | |
![[TXT]](/icons/text.gif) | 8719f033bf6bea1bf00a0e3d0caf24b8.txt | 2014-05-05 07:48 | 13K | |
![[ ]](/icons/layout.gif) | 7704809f87510dcb8d4ace090d09dc44.pdf | 2014-05-04 13:55 | 4.4M | |
![[TXT]](/icons/text.gif) | Aiding Natures Organelles: Artificial Peroxisomes Play Their Role.txt | 2014-05-04 13:48 | 92K | |
![[ ]](/icons/layout.gif) | When does a physical system compute?.pdf | 2014-05-04 11:26 | 298K | |
![[TXT]](/icons/text.gif) | db1a4c95247a3c2edc13a65ecff02899.txt | 2014-05-03 23:20 | 3.2K | |
![[ ]](/icons/layout.gif) | Reproductive ectogenesis: The third era of human reproduction and some moral consequences.pdf | 2014-05-03 20:35 | 188K | |
![[ ]](/icons/layout.gif) | f5df4d5b6874238d52175867f096b841.pdf | 2014-05-03 20:26 | 133K | |
![[TXT]](/icons/text.gif) | 3b3af6c91a0ea61cdbd02ef04a693db6.txt | 2014-05-03 14:43 | 41K | |
![[TXT]](/icons/text.gif) | a2395502c641e365f61ff0dd81e0112b.txt | 2014-04-30 17:49 | 44K | |
![[TXT]](/icons/text.gif) | d76f2f3901a71757b24c55cedabc8186.txt | 2014-04-30 17:46 | 44K | |
![[TXT]](/icons/text.gif) | 2f5a0214040decddce8b3c104232be0b.txt | 2014-04-30 17:45 | 4.8K | |
![[TXT]](/icons/text.gif) | bf042c69f3a82d73af60e0b0023d1cd0.txt | 2014-04-29 22:17 | 18K | |
![[ ]](/icons/layout.gif) | Liquid Metal as Connecting or Functional Recovery Channel for the Transected Sciatic Nerve.pdf | 2014-04-29 15:44 | 865K | |
![[TXT]](/icons/text.gif) | 9ea45814a17e0a9bf28043677ff14ae5.txt | 2014-04-29 00:37 | 35K | |
![[TXT]](/icons/text.gif) | 9bfd8601a6f968bfad101d9d2bf9f27c.txt | 2014-04-29 00:15 | 99K | |
![[TXT]](/icons/text.gif) | 310441aaf5a7d5fc21ed80a2d64c7ad2.txt | 2014-04-27 19:28 | 41K | |
![[TXT]](/icons/text.gif) | 8061e3fe74ff724033fbaf92ed1e1488.txt | 2014-04-27 16:01 | 41K | |
![[TXT]](/icons/text.gif) | 1270ea227bc1060e1c2aa3fd703f7e37.txt | 2014-04-27 11:54 | 71K | |
![[TXT]](/icons/text.gif) | The laser‐generated ultrasonic phased array: Analysis and experiments.txt | 2014-04-27 09:41 | 61K | |
![[ ]](/icons/layout.gif) | 936bd8c1a8e542ad1d18c8853ba1a37.pdf | 2014-04-27 00:02 | 617K | |
![[TXT]](/icons/text.gif) | Direct observations of ultrasound microbubble contrast agent interaction with the microvessel wall.txt | 2014-04-26 15:57 | 170K | |
![[TXT]](/icons/text.gif) | fe221c9f37a55a7d313492a2c438ffa0.txt | 2014-04-26 14:35 | 43K | |
![[TXT]](/icons/text.gif) | bb89484d750ba85af30792f8a6f0a8c7.txt | 2014-04-26 14:34 | 43K | |
![[TXT]](/icons/text.gif) | 9f3c1f6bb5b02c96fd900e290172fd73.txt | 2014-04-26 09:00 | 4.8K | |
![[TXT]](/icons/text.gif) | d14902f261f0efb1e1afc4a533c7eb29.txt | 2014-04-26 08:58 | 4.8K | |
![[ ]](/icons/layout.gif) | A comparison of modified Howland circuits as current generators with current mirror type circuits.pdf | 2014-04-26 08:17 | 134K | |
![[ ]](/icons/layout.gif) | Using Friends as Sensors to Detect Global-Scale Contagious Outbreaks.pdf | 2014-04-26 07:04 | 1.2M | |
![[TXT]](/icons/text.gif) | f3e126481b8d3ade19941bd04ac72437.txt | 2014-04-25 00:04 | 60K | |
![[TXT]](/icons/text.gif) | d12af535ab4fd60def6fffb316dd1dc1.txt | 2014-04-24 22:23 | 28K | |
![[ ]](/icons/layout.gif) | bc5140bb89fbeebcbdd29cfa9ce0f314.pdf | 2014-04-24 21:48 | 1.7M | |
![[TXT]](/icons/text.gif) | 489cc733fdb25caeab637928a9c1024.txt | 2014-04-24 20:47 | 31K | |
![[TXT]](/icons/text.gif) | 257706dd3df7c9452c7ecdf6273824d1.txt | 2014-04-24 19:15 | 43K | |
![[TXT]](/icons/text.gif) | 60af9c1a673d78fe609e932525ac3ee5.txt | 2014-04-24 16:23 | 41K | |
![[TXT]](/icons/text.gif) | Influence of the pressure field distribution in transcranial ultrasonic neurostimulation.txt | 2014-04-24 16:20 | 93K | |
![[ ]](/icons/layout.gif) | Cross-talk between amino acid residues and flavonoid derivatives: insights into their chemical recognition.pdf | 2014-04-24 05:51 | 2.9M | |
![[TXT]](/icons/text.gif) | fd72b379e6676e13c477f45520c6534a.txt | 2014-04-23 22:26 | 41K | |
![[ ]](/icons/layout.gif) | Error correction of microchip synthesized genes using Surveyor nuclease.pdf | 2014-04-23 20:39 | 2.5M | |
![[TXT]](/icons/text.gif) | 5b9aea9f64767417d97210f5f97bf8a2.txt | 2014-04-23 19:54 | 13K | |
![[TXT]](/icons/text.gif) | bbdc9be894f39be6b87612761b47809c.txt | 2014-04-23 19:42 | 5.0K | |
![[TXT]](/icons/text.gif) | 99cb84d56d5df36e73c5ced10d36d30e.txt | 2014-04-23 19:41 | 5.0K | |
![[TXT]](/icons/text.gif) | 335a64ef75c98c46d28e301479744549.txt | 2014-04-23 19:39 | 41K | |
![[ ]](/icons/layout.gif) | 4bd972db526fcaca0c537123e04ffb78.pdf | 2014-04-23 17:48 | 1.0M | |
![[TXT]](/icons/text.gif) | 700d72474d9db8c0016026c3e8e922a1.txt | 2014-04-23 17:47 | 43K | |
![[ ]](/icons/layout.gif) | 7ba419edd532526e0b5359e818fcc72b.pdf | 2014-04-23 10:11 | 1.9M | |
![[TXT]](/icons/text.gif) | b7cc5d5fdf484e246df172676a9922e9.txt | 2014-04-23 09:43 | 36K | |
![[TXT]](/icons/text.gif) | 3a73de0d7d8f7aaac21d63537a91056a.txt | 2014-04-23 06:58 | 18K | |
![[TXT]](/icons/text.gif) | 2db8ec5f4524416ddc08562c59b3b358.txt | 2014-04-23 06:52 | 13K | |
![[TXT]](/icons/text.gif) | a61172a0bfd230e00134d62372fb488b.txt | 2014-04-23 06:50 | 13K | |
![[TXT]](/icons/text.gif) | 65eed9b74197844031fb7fb611ba259f.txt | 2014-04-23 06:49 | 13K | |
![[TXT]](/icons/text.gif) | d010a7e0119e15952a7d1e1d2777a7c.txt | 2014-04-23 06:47 | 13K | |
![[TXT]](/icons/text.gif) | ad2643a7c38c723359b9773d838f7b59.txt | 2014-04-23 06:47 | 43K | |
![[ ]](/icons/layout.gif) | a3166d720c2d175befa4fc95ae51fd82.pdf | 2014-04-23 03:20 | 1.3M | |
![[TXT]](/icons/text.gif) | 9542a0ea6c79693d3c44a08fd6ebbf97.txt | 2014-04-23 03:19 | 43K | |
![[ ]](/icons/layout.gif) | Strategies to overcome the barrier: use of nanoparticles as carriers and modulators of barrier properties.pdf | 2014-04-22 23:08 | 5.3M | |
![[TXT]](/icons/text.gif) | fc6ed9876dded579937cfcd9afd6d77f.txt | 2014-04-22 18:29 | 166K | |
![[ ]](/icons/layout.gif) | Nutritional Systems Biology Modeling: From Molecular Mechanisms to Physiology.pdf | 2014-04-22 18:25 | 440K | |
![[ ]](/icons/layout.gif) | Candidate Indistinguishability Obfuscation and Functional Encryption for all circuits.pdf | 2014-04-22 14:31 | 633K | |
![[TXT]](/icons/text.gif) | 77c2fe55ae949ec1c5d0b1757fcb1b99.txt | 2014-04-22 13:28 | 78K | |
![[ ]](/icons/layout.gif) | The real-time city? Big data and smart urbanism.pdf | 2014-04-22 02:36 | 604K | |
![[ ]](/icons/layout.gif) | e2c41050b767b21e671568de45bf8e31.pdf | 2014-04-21 11:32 | 1.1M | |
![[TXT]](/icons/text.gif) | ac73db52d5b0e94a56c5260a2f90f739.txt | 2014-04-20 20:35 | 44K | |
![[TXT]](/icons/text.gif) | c7024f152d5206fd0a213a15d65b2c4e.txt | 2014-04-20 15:32 | 122K | |
![[TXT]](/icons/text.gif) | 96efca4e09ee4d28e63b0c0e9575b22f.txt | 2014-04-19 22:10 | 68K | |
![[ ]](/icons/layout.gif) | A Whole-Cell Computational Model Predicts Phenotype from Genotype.pdf | 2014-04-19 13:03 | 5.0M | |
![[TXT]](/icons/text.gif) | 475108cbb2f5ec2d30bd470770be3dde.txt | 2014-04-18 16:09 | 31K | |
![[ ]](/icons/layout.gif) | 520b988bd4f53bace772caf6879c21ef.pdf | 2014-04-18 10:09 | 942K | |
![[TXT]](/icons/text.gif) | 5b8b88e46d715615386c67d9d4e4baa3.txt | 2014-04-18 01:40 | 52K | |
![[ ]](/icons/layout.gif) | Position Based Cryptography.pdf | 2014-04-17 20:40 | 255K | |
![[TXT]](/icons/text.gif) | 2165fbbd0371142b5576fec4d49135c9.txt | 2014-04-17 12:51 | 45K | |
![[ ]](/icons/layout.gif) | Whole-Brain Imaging with Single-Cell Resolution Using Chemical Cocktails and Computational Analysis.pdf | 2014-04-17 12:50 | 3.8M | |
![[TXT]](/icons/text.gif) | Compartmental Genomics in Living Cells Revealed by Single-Cell Nanobiopsy.txt | 2014-04-17 12:22 | 97K | |
![[TXT]](/icons/text.gif) | c2533ed4873bc55a62d9e6e354abbfb.txt | 2014-04-15 21:58 | 43K | |
![[ ]](/icons/layout.gif) | ZFN, TALEN, and CRISPR_Cas-based methods for genome engineering.pdf | 2014-04-15 18:29 | 1.1M | |
![[TXT]](/icons/text.gif) | b286fa78f3be674f713063a984c1b80.txt | 2014-04-15 18:27 | 12K | |
![[TXT]](/icons/text.gif) | 94873809e27bdcd6298293a22a33210f.txt | 2014-04-15 18:26 | 44K | |
![[ ]](/icons/layout.gif) | Optimized TAL effector nucleases (TALENs) for use in treatment of sickle cell disease.pdf | 2014-04-15 18:24 | 1.4M | |
![[TXT]](/icons/text.gif) | 4d3c26655646c0f7ea881aa485c5895d.txt | 2014-04-15 18:20 | 42K | |
![[ ]](/icons/layout.gif) | Amygdala Inputs to the Ventral Hippocampus Bidirectionally Modulate Social Behavior.pdf | 2014-04-15 02:27 | 3.6M | |
![[TXT]](/icons/text.gif) | 80d501fb62fab8f03b233d02e7b2eb19.txt | 2014-04-14 01:39 | 60K | |
![[TXT]](/icons/text.gif) | 9224876a1c3561692d4d94e296956d19.txt | 2014-04-14 00:00 | 28K | |
![[TXT]](/icons/text.gif) | d123f23eb4ad54bad9569db7ba3b793f.txt | 2014-04-13 03:10 | 6.3K | |
![[TXT]](/icons/text.gif) | 81944fbe0c899335db460b0e67b634de.txt | 2014-04-13 03:05 | 144K | |
![[TXT]](/icons/text.gif) | fa5309520efc793a1f7bb152c259b8a5.txt | 2014-04-13 03:02 | 144K | |
![[TXT]](/icons/text.gif) | 9e725f89f3ed285f73317d1fd359fb17.txt | 2014-04-13 02:54 | 6.3K | |
![[TXT]](/icons/text.gif) | c1053cf94632d7e333bc0fc2a149f6c1.txt | 2014-04-13 02:53 | 40K | |
![[ ]](/icons/layout.gif) | 23f1a77e162fef6d98753e70545338f6.pdf | 2014-04-13 02:17 | 148K | |
![[TXT]](/icons/text.gif) | e948307177530d0cf21bc041b84a351a.txt | 2014-04-13 02:16 | 40K | |
![[TXT]](/icons/text.gif) | f87c0229d560f2a3a93fcc4960efd4d2.txt | 2014-04-12 20:09 | 42K | |
![[TXT]](/icons/text.gif) | b336917aaf5a1fd3ff101627cc5bde78.txt | 2014-04-11 13:04 | 40K | |
![[TXT]](/icons/text.gif) | 8e34fd082848bd7075dd2192eaa155f4.txt | 2014-04-02 08:07 | 13K | |
![[TXT]](/icons/text.gif) | c46e6259bde5a9cd4abe23bba8d9c038.txt | 2014-04-02 08:07 | 13K | |
![[TXT]](/icons/text.gif) | 53fcc3af43dd9689aff5ba3c69768f14.txt | 2014-04-02 08:06 | 13K | |
![[TXT]](/icons/text.gif) | d4ca86badc30d6824ca1f5643d07bf12.txt | 2014-04-02 08:05 | 13K | |
![[ ]](/icons/layout.gif) | fcf7c44acfcb74a5f12a0cd17f34f296.pdf | 2014-04-01 22:46 | 660K | |
![[TXT]](/icons/text.gif) | fe78eb15dba3ca2c3088b458cf9726e3.txt | 2014-04-01 22:36 | 195K | |
![[TXT]](/icons/text.gif) | 550212e027642d4385200ab7cbf930ee.txt | 2014-04-01 22:24 | 47K | |
![[TXT]](/icons/text.gif) | b2c28d5ad9cf89945568529f6090a850.txt | 2014-04-01 22:22 | 47K | |
![[ ]](/icons/layout.gif) | Integrating Biological Redesign: Where Synthetic Biology Came From and Where It Needs to Go.pdf | 2014-04-01 14:19 | 1.0M | |
![[TXT]](/icons/text.gif) | 629577148d6e23c163fb276b38eb006a.txt | 2014-04-01 14:18 | 43K | |
![[ ]](/icons/layout.gif) | 3407742a4d5d94cab2d719e80953870a.pdf | 2014-03-31 19:09 | 485K | |
![[TXT]](/icons/text.gif) | ba96d404a12bbc31b80fd4dfb411506e.txt | 2014-03-31 14:31 | 16K | |
![[TXT]](/icons/text.gif) | d2f5dbcfc9dd8208738a12af7eb850f4.txt | 2014-03-31 14:31 | 16K | |
![[TXT]](/icons/text.gif) | df594e6ad6a4fa1dfd8bd9a02b3381aa.txt | 2014-03-31 14:30 | 3.3K | |
![[TXT]](/icons/text.gif) | e67ef1bc19fa5319fb076767f9d7f8bd.txt | 2014-03-31 14:29 | 16K | |
![[TXT]](/icons/text.gif) | The Chemical Composition of Maple Syrup.txt | 2014-03-30 08:22 | 97K | |
![[TXT]](/icons/text.gif) | dab20a0cf8458983a839470158237f0d.txt | 2014-03-29 14:08 | 12K | |
![[TXT]](/icons/text.gif) | 79921c5e0aeb4b09072ad0911ff66bd.txt | 2014-03-27 14:25 | 2.4K | |
![[TXT]](/icons/text.gif) | a66d25fdd9b673496ab22f26e9179092.txt | 2014-03-27 14:23 | 299 | |
![[TXT]](/icons/text.gif) | d5db411ea289d75b3f29985277196911.txt | 2014-03-27 14:23 | 2.4K | |
![[TXT]](/icons/text.gif) | 85ed3d8588648333ffb5eb2e1ce5bdb0.txt | 2014-03-27 13:45 | 44K | |
![[ ]](/icons/layout.gif) | 16cf7b9a611367fcd5fb002e0ec1d8ef.pdf | 2014-03-27 10:31 | 485K | |
![[ ]](/icons/layout.gif) | In Vivo Time-Resolved Microtomography Reveals the Mechanics of the Blowfly Flight Motor.pdf | 2014-03-26 09:06 | 3.7M | |
![[TXT]](/icons/text.gif) | cd491843be90522262be4357415fa806.txt | 2014-03-25 18:38 | 514 | |
![[TXT]](/icons/text.gif) | 8187f3bbb54f1bd212c6c3fd9d1e4a72.txt | 2014-03-25 18:36 | 8.0K | |
![[ ]](/icons/layout.gif) | 9e4c833a1607b723788b52bfdafd99a1.pdf | 2014-03-25 18:33 | 69K | |
![[TXT]](/icons/text.gif) | 90798e6f66ded0a4056b69323737b3b5.txt | 2014-03-25 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Attitudes to traffic-related issues in urban areas of the UK and the role of workplace parking charges.txt | 2014-03-25 18:05 | 45K | |
![[TXT]](/icons/text.gif) | 4a197fa90b0aebdf6ce3bdf0611a7675.txt | 2014-03-24 16:21 | 43K | |
![[ ]](/icons/layout.gif) | Microfluidics for Electronic Paper-like Displays.pdf | 2014-03-24 15:35 | 2.2M | |
![[ ]](/icons/layout.gif) | a804d2f94dd7ee259cdbdfd8c7bff4b0.pdf | 2014-03-24 08:43 | 1.8M | |
![[TXT]](/icons/text.gif) | a5cb4ff7b20743019e0942a1281f90c5.txt | 2014-03-21 16:37 | 146K | |
![[TXT]](/icons/text.gif) | b5950a62f14c46a636c4374ee88baa95.txt | 2014-03-21 16:33 | 146K | |
![[TXT]](/icons/text.gif) | Visibly Transparent Polymer Solar Cells Produced by Solution Processing.txt | 2014-03-18 08:10 | 110K | |
![[TXT]](/icons/text.gif) | c41ac1e4a918009ce8295bc93f16b35a.txt | 2014-03-17 17:43 | 1.4K | |
![[TXT]](/icons/text.gif) | 9aa537a707aa13c2739ccb927cdda980.txt | 2014-03-17 09:18 | 29K | |
![[ ]](/icons/layout.gif) | 2db97ab57df4b5e9fa16e7154b98435.pdf | 2014-03-15 15:36 | 1.1M | |
![[TXT]](/icons/text.gif) | 4b3c0d4ead286040f17319dfb0095a09.txt | 2014-03-14 10:33 | 70K | |
![[TXT]](/icons/text.gif) | a4649158a46436235e909fd732913e0b.txt | 2014-03-14 09:10 | 70K | |
![[TXT]](/icons/text.gif) | 8064819c0c669d241f4704f180ed9ad0.txt | 2014-03-14 09:09 | 70K | |
![[ ]](/icons/layout.gif) | A Survey on Wireless Grid Computing.pdf | 2014-03-14 01:56 | 139K | |
![[ ]](/icons/layout.gif) | Experimental tools to monitor the dynamics of endothelial barrier function: a survey of in vitro approaches.pdf | 2014-03-13 17:47 | 2.1M | |
![[TXT]](/icons/text.gif) | 64b900b55a16de253b8347d6da421969.txt | 2014-03-13 14:15 | 33K | |
![[ ]](/icons/layout.gif) | c7f2e7a11e785a36861de376b15fd8c3.pdf | 2014-03-13 08:56 | 451K | |
![[TXT]](/icons/text.gif) | de16e6325ac9ab99622480f7a4e0b304.txt | 2014-03-13 07:38 | 4.6K | |
![[ ]](/icons/layout.gif) | A Mathematical Model for the Determination of Total Area Under Glucose Tolerance and Other Metabolic Curves.pdf | 2014-03-11 09:48 | 251K | |
![[ ]](/icons/layout.gif) | ()-Menthol biosynthesis and molecular genetics.pdf | 2014-03-10 23:32 | 427K | |
![[TXT]](/icons/text.gif) | 14eca1c8485295542f35c23e8df257c6.txt | 2014-03-09 15:40 | 42K | |
![[ ]](/icons/layout.gif) | Actual insights into the clinical management of febrile seizures.pdf | 2014-03-09 13:40 | 229K | |
![[TXT]](/icons/text.gif) | cf958915c6f715d190b0811ec2737dc2.txt | 2014-03-07 23:58 | 43K | |
![[ ]](/icons/layout.gif) | Stress tolerance and growth physiology of yeast strains from the Brazilian fuel ethanol industry.pdf | 2014-03-06 23:01 | 761K | |
![[TXT]](/icons/text.gif) | b89e41db0aedb9156eccc408155105ef.txt | 2014-03-06 22:50 | 13K | |
![[TXT]](/icons/text.gif) | dde8ced86979768fe358cb1613db2560.txt | 2014-03-06 22:49 | 13K | |
![[TXT]](/icons/text.gif) | 60427884aae048512acb9d06542f4a4e.txt | 2014-03-06 22:49 | 13K | |
![[ ]](/icons/layout.gif) | Engineering yeasts for raw starch conversion.pdf | 2014-03-06 22:48 | 682K | |
![[ ]](/icons/layout.gif) | Tolerance and stress response to ethanol in the yeast Saccharomyces cerevisiae.pdf | 2014-03-06 22:46 | 230K | |
![[TXT]](/icons/text.gif) | e13a5b9535f3b5408940f739e7a8570c.txt | 2014-03-04 09:34 | 40K | |
![[ ]](/icons/layout.gif) | c130c44e6e4a2a4077abdab9e56a26bb.pdf | 2014-03-03 15:46 | 494K | |
![[TXT]](/icons/text.gif) | 976be73e408f48b4c846fa69409c6666.txt | 2014-03-03 15:21 | 44K | |
![[TXT]](/icons/text.gif) | c6dd8310e6f31efa39335c9064cddf31.txt | 2014-03-03 15:10 | 44K | |
![[TXT]](/icons/text.gif) | 54229d0ff1d93cdb0689580ef74c3a32.txt | 2014-03-03 15:09 | 45K | |
![[TXT]](/icons/text.gif) | 97ebd720d5bedc6b376a5d1cdff7fd8b.txt | 2014-03-02 19:07 | 34K | |
![[ ]](/icons/layout.gif) | fb461d5a30fbe040edbd0fbe99c7b452.pdf | 2014-03-02 17:29 | 1.8M | |
![[TXT]](/icons/text.gif) | 48b3c44ed08d64337090c8112b5a3bec.txt | 2014-03-02 15:27 | 42K | |
![[TXT]](/icons/text.gif) | 2a0e00d6455d343b13f1f562b977352d.txt | 2014-03-02 03:58 | 41K | |
![[TXT]](/icons/text.gif) | df632d5367a885dbd806da7663d4dc68.txt | 2014-02-28 19:02 | 71K | |
![[ ]](/icons/layout.gif) | BloodBrain Barrier Transport of Therapeutics via Receptor-Mediation.pdf | 2014-02-28 02:19 | 415K | |
![[ ]](/icons/layout.gif) | be7e132a2a6da878c16cec04c4573205.pdf | 2014-02-26 08:21 | 1.9M | |
![[TXT]](/icons/text.gif) | Cost-Effective Three-Dimensional Printing of Visibly Transparent Microchips within Minutes.txt | 2014-02-25 09:01 | 88K | |
![[ ]](/icons/layout.gif) | 1c521e4247bf6f0f148e3c6d76959d36.pdf | 2014-02-24 18:07 | 667K | |
![[TXT]](/icons/text.gif) | 9b1cf177821a76fc75ad435dae8f096b.txt | 2014-02-24 06:56 | 7.7K | |
![[TXT]](/icons/text.gif) | d188a1b683078f247d1dc1812d3e9ab3.txt | 2014-02-24 06:55 | 7.7K | |
![[ ]](/icons/layout.gif) | Dendritic Inhibition in the Hippocampus Supports Fear Learning.pdf | 2014-02-23 08:31 | 1.7M | |
![[TXT]](/icons/text.gif) | 74bddeea71ecbed58d5d20f2dde78e88.txt | 2014-02-22 01:34 | 23K | |
![[TXT]](/icons/text.gif) | 42e815a4b7ecdf5864aea00dc88da93a.txt | 2014-02-22 01:34 | 718 | |
![[TXT]](/icons/text.gif) | 5d2288c13ad3ea933241894a8c3e438a.txt | 2014-02-22 01:34 | 738 | |
![[ ]](/icons/layout.gif) | ce1a933ba5ff384c4d4258ed7d5ad364.pdf | 2014-02-21 22:25 | 3.2M | |
![[ ]](/icons/layout.gif) | e84dd28779b29200de6ec6817e36c336.pdf | 2014-02-21 22:15 | 326K | |
![[ ]](/icons/layout.gif) | Time, clocks, and the ordering of events in a distributed system.pdf | 2014-02-21 21:57 | 830K | |
![[TXT]](/icons/text.gif) | 849676f008fe0cf4a7f5fed42357066.txt | 2014-02-20 09:18 | 9.9K | |
![[ ]](/icons/layout.gif) | No Major Differences Found between the Effects of Microwave-Based and Conventional Heat Treatment Methods on Two Different Liquid Foods.pdf | 2014-02-19 14:50 | 2.1M | |
![[TXT]](/icons/text.gif) | 3edff6d50dce5b8b1111771345b81e69.txt | 2014-02-19 11:53 | 13K | |
![[TXT]](/icons/text.gif) | dc22586158fb3b76e6e8fbe5ac41e1e.txt | 2014-02-18 17:22 | 1.4K | |
![[TXT]](/icons/text.gif) | 922bd7f0eb382a52849067516a1cb387.txt | 2014-02-18 17:22 | 1.4K | |
![[ ]](/icons/layout.gif) | ab15eca51834198602075431cf8acb89.pdf | 2014-02-18 12:21 | 114K | |
![[ ]](/icons/layout.gif) | Epigenetic Modulation of Adult Hippocampal Neurogenesis by Extremely Low-Frequency Electromagnetic Fields.pdf | 2014-02-18 10:09 | 774K | |
![[ ]](/icons/layout.gif) | Integrated proteomic and metabolomic analysis reveals the NADH-mediated TCA cycle and energy metabolism disorders based on a new model of chronic progressive heart failure.pdf | 2014-02-17 20:24 | 3.5M | |
![[TXT]](/icons/text.gif) | Cytosolic Delivery of Membrane-Impermeable Molecules in Dendritic Cells Using pH-Responsive CoreShell Nanoparticles.txt | 2014-02-17 17:41 | 107K | |
![[TXT]](/icons/text.gif) | 93a9b3258ff60d92e81e061c25889825.txt | 2014-02-14 18:24 | 49K | |
![[TXT]](/icons/text.gif) | c7588a396fa518a142f463b14d3d6763.txt | 2014-02-14 18:23 | 49K | |
![[TXT]](/icons/text.gif) | fd3a30b4c7128fed80c20539da31d7a1.txt | 2014-02-14 04:58 | 41K | |
![[ ]](/icons/layout.gif) | df1edcbb1bea63a7ac03b9f0f8d00d93.pdf | 2014-02-12 13:29 | 5.6M | |
![[ ]](/icons/layout.gif) | bcd1dfcf9b0f439efc64f7d43389c29a.pdf | 2014-02-11 18:05 | 2.4M | |
![[TXT]](/icons/text.gif) | 114e5296316490350510958115b62e76.txt | 2014-02-11 15:57 | 48K | |
![[ ]](/icons/layout.gif) | d4cf1b23a03292aa3898ace3a165e7fb.pdf | 2014-02-11 09:05 | 2.4M | |
![[TXT]](/icons/text.gif) | bef775146bc3b1f1e038fae2c8541d44.txt | 2014-02-10 15:10 | 28K | |
![[TXT]](/icons/text.gif) | cfa679fb92f5c346fb5fb0f6e75083c1.txt | 2014-02-10 15:09 | 41K | |
![[TXT]](/icons/text.gif) | a00ffe5158428ca19328733d9b6aa4d8.txt | 2014-02-07 16:01 | 18K | |
![[TXT]](/icons/text.gif) | 54177b1184092d17c7ba5e00cda228d.txt | 2014-02-07 12:54 | 38K | |
![[TXT]](/icons/text.gif) | 8ae79a95c77f19aae9d7fcd5f812aed1.txt | 2014-02-07 01:55 | 26K | |
![[TXT]](/icons/text.gif) | 84748c6dc66b2a0aafcdecdf00628e13.txt | 2014-02-06 09:45 | 40K | |
![[ ]](/icons/layout.gif) | 2f9b159771f44dd6c06d4d158883c35e.pdf | 2014-02-06 07:26 | 519K | |
![[TXT]](/icons/text.gif) | 8dfd170fa14d798667c4679a7256a79d.txt | 2014-02-06 02:21 | 18K | |
![[TXT]](/icons/text.gif) | Molecular Logic Gates on DNA Origami Nanostructures for MicroRNA Diagnostics.txt | 2014-02-05 17:48 | 90K | |
![[TXT]](/icons/text.gif) | a9ef962b737f00c29b08aa5a1f41018f.txt | 2014-02-05 17:40 | 40K | |
![[ ]](/icons/layout.gif) | A Data Structure for Arc Insertion and Regular Path Finding.pdf | 2014-01-31 23:09 | 1.0M | |
![[TXT]](/icons/text.gif) | 847d7503f11b8b5f658a4e36513d6019.txt | 2014-01-31 20:00 | 55K | |
![[TXT]](/icons/text.gif) | 3a013805bf8baab9c54e8e22de0bdf64.txt | 2014-01-31 19:10 | 35K | |
![[TXT]](/icons/text.gif) | 4f94fe2c4f1c06ec4740960c64e88e81.txt | 2014-01-30 13:18 | 40K | |
![[TXT]](/icons/text.gif) | 362deaa299d9f69f3ba8dd8089f1a9bc.txt | 2014-01-30 13:18 | 40K | |
![[TXT]](/icons/text.gif) | c993cf83890cd4de2ca55a6294264fd1.txt | 2014-01-30 10:00 | 42K | |
![[ ]](/icons/layout.gif) | 2555e9178fafa24612d7f4decae7b267.pdf | 2014-01-29 05:10 | 1.5M | |
![[TXT]](/icons/text.gif) | c16f20f8434e22791bd885d256af832a.txt | 2014-01-28 20:49 | 22K | |
![[TXT]](/icons/text.gif) | 28fcc186a3f84b70d288a4f37553b900.txt | 2014-01-28 20:48 | 38K | |
![[TXT]](/icons/text.gif) | 2c459dfdd6351b04292dc4f415e1de96.txt | 2014-01-28 01:26 | 141K | |
![[TXT]](/icons/text.gif) | 356178317a89a5b6aaaf38618420f8a1.txt | 2014-01-27 17:53 | 37K | |
![[TXT]](/icons/text.gif) | 55902a08ae97c937fd107acdabc7adfc.txt | 2014-01-27 12:06 | 12K | |
![[TXT]](/icons/text.gif) | 29abf78d465b8b2b0958da5cdf8339d3.txt | 2014-01-27 08:12 | 38K | |
![[TXT]](/icons/text.gif) | 5b4999dedd64819391d902852280357b.txt | 2014-01-27 08:12 | 738 | |
![[TXT]](/icons/text.gif) | 808dbbe8793126a6f3d94df0b8c044ab.txt | 2014-01-26 10:13 | 31K | |
![[TXT]](/icons/text.gif) | b8d71579ad14b3d5dcee299e7fc063b3.txt | 2014-01-26 10:13 | 7.8K | |
![[ ]](/icons/layout.gif) | 8e9b2edb50e899b3cc6e636db308360b.pdf | 2014-01-22 18:29 | 95K | |
![[TXT]](/icons/text.gif) | 47919135c8b99cbe002af5740d5242fc.txt | 2014-01-22 18:28 | 41K | |
![[ ]](/icons/layout.gif) | 1281125a1be812017d57f07ddc2da431.pdf | 2014-01-22 07:47 | 652K | |
![[TXT]](/icons/text.gif) | 4f23c4bf6b113544236d6f0223d63e55.txt | 2014-01-21 01:17 | 15K | |
![[TXT]](/icons/text.gif) | 3f1bbcded0fe9c5a7611c70e11c8483e.txt | 2014-01-20 02:55 | 32K | |
![[TXT]](/icons/text.gif) | 4c76753ca21823913ae7324759ee6d88.txt | 2014-01-20 02:33 | 39K | |
![[TXT]](/icons/text.gif) | 205ea40f3d58637a241c2101a51df726.txt | 2014-01-20 02:32 | 738 | |
![[ ]](/icons/layout.gif) | 73d8ce5983f039734dad561356faf0bc.pdf | 2014-01-20 01:42 | 1.6M | |
![[TXT]](/icons/text.gif) | 3ac99d6d8ba13f6374bb9fb449b3be82.txt | 2014-01-19 21:50 | 51K | |
![[ ]](/icons/layout.gif) | 2df69781d09aad454f6f1554e4ea7ba4.pdf | 2014-01-18 08:43 | 184K | |
![[ ]](/icons/layout.gif) | 89a4af7859d6de039cf945e3067c548.pdf | 2014-01-18 07:14 | 2.8M | |
![[ ]](/icons/layout.gif) | Cioran's Insomnia.pdf | 2014-01-16 13:47 | 212K | |
![[ ]](/icons/layout.gif) | 537c4cb93e3047f7a1c9884bf68df195.pdf | 2014-01-14 10:42 | 534K | |
![[TXT]](/icons/text.gif) | a3649d73c5531070104821435811e1c3.txt | 2014-01-13 11:41 | 16K | |
![[TXT]](/icons/text.gif) | 6873e95094066aa2f09bc9563d183f6.txt | 2014-01-12 20:58 | 64K | |
![[TXT]](/icons/text.gif) | 6cf80c3337e57bdf585d4a4ed275d26f.txt | 2014-01-12 20:57 | 64K | |
![[TXT]](/icons/text.gif) | 3bc498e987c87545622aa3958af5f617.txt | 2014-01-12 20:56 | 64K | |
![[ ]](/icons/layout.gif) | 17f58a1875ab83dda5d822defc3728b8.pdf | 2014-01-10 13:58 | 716K | |
![[TXT]](/icons/text.gif) | dd87e40b144acc22fda21a4902a11ee.txt | 2014-01-09 13:36 | 40K | |
![[TXT]](/icons/text.gif) | bbff576c0c7bf7202db58953750656a2.txt | 2014-01-08 21:13 | 44K | |
![[ ]](/icons/layout.gif) | Commercialization of microfluidic point-of-care diagnostic devices.pdf | 2014-01-08 14:47 | 1.3M | |
![[ ]](/icons/layout.gif) | Earliest evidence for caries and exploitation of starchy plant foods in Pleistocene hunter-gatherers from Morocco.pdf | 2014-01-08 12:50 | 943K | |
![[TXT]](/icons/text.gif) | 30a02728635795606d844d1a174f9265.txt | 2014-01-08 09:01 | 16K | |
![[TXT]](/icons/text.gif) | c04ef03fa25e5fa5d58aa6b0a4260441.txt | 2014-01-08 08:51 | 32K | |
![[TXT]](/icons/text.gif) | c305048d14792dc5a1e6b866c851b1f3.txt | 2014-01-07 13:09 | 29K | |
![[TXT]](/icons/text.gif) | d95fd3d93d7a82102f8863b1d693f052.txt | 2014-01-07 13:08 | 29K | |
![[TXT]](/icons/text.gif) | f1823cab64a0c6ef4bff09e2303baaf.txt | 2014-01-07 12:51 | 83K | |
![[TXT]](/icons/text.gif) | 901e1d81c7c0811290ae796fd8d9e10e.txt | 2014-01-07 10:14 | 39K | |
![[TXT]](/icons/text.gif) | fd10d4a790643b878b130ccb78e954e2.txt | 2014-01-07 08:52 | 53K | |
![[TXT]](/icons/text.gif) | 7435c32576de0efb97c15924bde300b1.txt | 2014-01-05 15:36 | 51K | |
![[ ]](/icons/layout.gif) | Pregnenolone Can Protect the Brain from Cannabis Intoxication.pdf | 2014-01-05 01:32 | 1.9M | |
![[ ]](/icons/layout.gif) | 6db31cc127ec1d0d85eabf725ac19e5a.pdf | 2014-01-03 13:28 | 894K | |
![[TXT]](/icons/text.gif) | 368b4b2b263eda204151cd1aebf2a490.txt | 2014-01-03 13:28 | 41K | |
![[ ]](/icons/layout.gif) | Photoscopy: Spectroscopic Information from Camera Snapshots?.pdf | 2014-01-03 13:19 | 390K | |
![[ ]](/icons/layout.gif) | Skin and hair on-a-chip: in vitro skin models versus ex vivo tissue maintenance with dynamic perfusion.pdf | 2014-01-02 15:09 | 1.3M | |
![[ ]](/icons/layout.gif) | Searching the Internet for evidence of time travelers.pdf | 2014-01-02 08:46 | 78K | |
![[ ]](/icons/layout.gif) | Dogs are sensitive to small variations of the Earth's magnetic field.pdf | 2014-01-01 21:10 | 2.9M | |
![[TXT]](/icons/text.gif) | f4a149ef272ef6af0c24cbe749f9c800.txt | 2014-01-01 15:09 | 42K | |
![[TXT]](/icons/text.gif) | 4f20077d9649badb4007f993caec7515.txt | 2014-01-01 15:06 | 14K | |
![[TXT]](/icons/text.gif) | Scitation: Experimental demonstration of noninvasive transskull adaptive focusing based on prior computed tomography scans.txt | 2013-12-31 14:00 | 97K | |
![[ ]](/icons/layout.gif) | The Wow signal of the terrestrial genetic code.pdf | 2013-12-30 17:12 | 4.7M | |
![[TXT]](/icons/text.gif) | 9215a4849c511e4540f053754368b5bf.txt | 2013-12-30 14:35 | 13K | |
![[TXT]](/icons/text.gif) | ddc1fc7e6b7fb240aad93b8af545233b.txt | 2013-12-30 14:35 | 13K | |
![[TXT]](/icons/text.gif) | 5e64ec53aed2dd9f997bae4163bc3849.txt | 2013-12-30 03:56 | 37K | |
![[TXT]](/icons/text.gif) | 32b5fb896bccfd31da071140a6499eae.txt | 2013-12-28 16:35 | 131K | |
![[TXT]](/icons/text.gif) | 8be8fda79400cb30db502c2c9a14f150.txt | 2013-12-28 00:24 | 24K | |
![[TXT]](/icons/text.gif) | 840570d1a8b14e5d16bd5493af21255b.txt | 2013-12-27 20:03 | 24K | |
![[TXT]](/icons/text.gif) | b265f42b38f2055cb38c372bec8cacf9.txt | 2013-12-27 16:00 | 54K | |
![[TXT]](/icons/text.gif) | 39d1a2efa300ab03ed61e507955393d3.txt | 2013-12-26 15:00 | 255K | |
![[TXT]](/icons/text.gif) | 7f3f798eb89e887e40f399fd6ab4d0a1.txt | 2013-12-26 14:58 | 255K | |
![[ ]](/icons/layout.gif) | Unexpected Stable Stoichiometries of Sodium Chlorides.pdf | 2013-12-24 10:50 | 1.7M | |
![[TXT]](/icons/text.gif) | d03295c4e5f2509c1e4cb0d545fbc44.txt | 2013-12-23 23:04 | 175K | |
![[TXT]](/icons/text.gif) | f3a2fde770f593a2931b4880adfad6e1.txt | 2013-12-23 17:14 | 22K | |
![[ ]](/icons/layout.gif) | e9aa818dd46350faeb5569946e507e5b.pdf | 2013-12-23 14:28 | 289K | |
![[ ]](/icons/layout.gif) | c83163d00dc714290bff2478f26556f6.pdf | 2013-12-23 14:28 | 289K | |
![[ ]](/icons/layout.gif) | 8a19ad680d4cd4157a73e08a4a08d90a.pdf | 2013-12-23 12:30 | 563K | |
![[TXT]](/icons/text.gif) | a4f917d2814d6034545953773e4c008c.txt | 2013-12-23 10:21 | 12K | |
![[ ]](/icons/layout.gif) | 8c9414de43e9f6ad5ae2230228972e78.pdf | 2013-12-23 10:10 | 1.5M | |
![[TXT]](/icons/text.gif) | 21fd84b66660bf99defe99dbb7b2de77.txt | 2013-12-23 02:23 | 12K | |
![[TXT]](/icons/text.gif) | 93ac60eef821b60b92f9cc09682b7084.txt | 2013-12-23 02:22 | 40K | |
![[TXT]](/icons/text.gif) | 43a6f3cf67537d439b240f5b4941d52d.txt | 2013-12-22 17:08 | 41K | |
![[ ]](/icons/layout.gif) | 1a7e18fd4682d40599ec240339ffd1c.pdf | 2013-12-19 16:55 | 1.3M | |
![[TXT]](/icons/text.gif) | 79dbc1613049b98569999cf658f9e36b.txt | 2013-12-19 16:54 | 41K | |
![[TXT]](/icons/text.gif) | Handheld Miniature Ion Trap Mass Spectrometers.txt | 2013-12-17 15:27 | 182K | |
![[ ]](/icons/layout.gif) | e62aa5244ac02851f6f0e174e386f78f.pdf | 2013-12-17 11:37 | 525K | |
![[TXT]](/icons/text.gif) | 7cd8498d104ffef3084bb5eba2ba8c12.txt | 2013-12-17 07:57 | 9.6K | |
![[TXT]](/icons/text.gif) | 1c5cc6212598e2821b290675ae930382.txt | 2013-12-17 07:55 | 11K | |
![[TXT]](/icons/text.gif) | 3b2d7cc1794bc846435910036b92c590.txt | 2013-12-16 18:18 | 33K | |
![[ ]](/icons/layout.gif) | A Preliminary Investigation of ADHD Symptoms in Persons With Celiac Disease.pdf | 2013-12-16 17:51 | 83K | |
![[TXT]](/icons/text.gif) | d6d8752aec12dc968eac7a6bbcd82b8e.txt | 2013-12-16 17:47 | 45K | |
![[ ]](/icons/layout.gif) | 2db5631db573db1f22f00fe373ccb810.pdf | 2013-12-16 15:49 | 337K | |
![[TXT]](/icons/text.gif) | c7c12c52de7354cd79dba99f6b506302.txt | 2013-12-16 15:49 | 6.9K | |
![[TXT]](/icons/text.gif) | 12df90ce4f59a7e51f08118eff4ddac1.txt | 2013-12-16 15:49 | 37K | |
![[ ]](/icons/layout.gif) | 8b9a4f0d72317a73065d3b6240a28e1a.pdf | 2013-12-14 01:04 | 346K | |
![[TXT]](/icons/text.gif) | 7cbcadb11ea057a8c1f3f3901428d78e.txt | 2013-12-14 01:04 | 41K | |
![[TXT]](/icons/text.gif) | eb007cd93d74feae2d47619c00a53bc5.txt | 2013-12-13 02:40 | 8.7K | |
![[ ]](/icons/layout.gif) | Exonic Transcription Factor Binding Directs Codon Choice and Affects Protein Evolution.pdf | 2013-12-12 21:38 | 3.5M | |
![[ ]](/icons/layout.gif) | f82414c03d18738584f1414b6d953e3e.pdf | 2013-12-11 12:59 | 1.9M | |
![[TXT]](/icons/text.gif) | Profiling Deacetylase Activities in Cell Lysates with Peptide Arrays and SAMDI Mass Spectrometry.txt | 2013-12-11 12:56 | 90K | |
![[TXT]](/icons/text.gif) | 2604a165c5a8ea9c820147343e995f17.txt | 2013-12-11 10:55 | 17K | |
![[ ]](/icons/layout.gif) | 757c725cf35acbd902e338532d8d9c49.pdf | 2013-12-10 11:29 | 3.4M | |
![[ ]](/icons/layout.gif) | 2e1a062d8b3cd5dd7e87d5e3b2ea1f8c.pdf | 2013-12-09 03:15 | 4.6M | |
![[TXT]](/icons/text.gif) | 599c235bf2222901b53e88e25bd458f0.txt | 2013-12-07 19:38 | 14K | |
![[TXT]](/icons/text.gif) | fabffc9a1812d275ca0f9df3a4b6f0d3.txt | 2013-12-06 18:07 | 14K | |
![[TXT]](/icons/text.gif) | f379f5df6cb84128a7d85d77da399b74.txt | 2013-12-06 18:03 | 14K | |
![[ ]](/icons/layout.gif) | Memoir, Social History and Commitment: Eric Hobsbawm's "Interesting Times".pdf | 2013-12-06 17:45 | 2.2M | |
![[TXT]](/icons/text.gif) | 772c7e9a60e3b4f3be9c3066bab43e1d.txt | 2013-12-05 02:52 | 93K | |
![[TXT]](/icons/text.gif) | fca026ccb01979ee62c93b7698126334.txt | 2013-12-03 11:30 | 14K | |
![[ ]](/icons/layout.gif) | New Evidence of Genetic Factors Influencing Sexual Orientation in Men: Female Fecundity Increase in the Maternal Line.pdf | 2013-12-02 14:26 | 185K | |
![[TXT]](/icons/text.gif) | 5cc17cb2962ca00ebdf96b7943b38d1a.txt | 2013-12-02 10:57 | 230K | |
![[ ]](/icons/layout.gif) | Knocking Out Pain in Livestock: Can Technology Succeed Where Morality has Stalled?.pdf | 2013-12-02 10:41 | 152K | |
![[ ]](/icons/layout.gif) | d249bd9fbca5bed3d1a1bcb4a69e87f2.pdf | 2013-12-02 10:05 | 113K | |
![[TXT]](/icons/text.gif) | 171d46a65977d02aa11e03d8d70ab762.txt | 2013-12-02 03:49 | 17K | |
![[TXT]](/icons/text.gif) | 343d4a28e874ac8b04f8b6417ae8e8e8.txt | 2013-11-30 17:04 | 14K | |
![[TXT]](/icons/text.gif) | ee8517112d27d2f447f7e93607a72c6c.txt | 2013-11-30 17:00 | 14K | |
![[TXT]](/icons/text.gif) | caf06033ad8ad0e70817a6d8f0ee4873.txt | 2013-11-29 15:17 | 3.1K | |
![[TXT]](/icons/text.gif) | 4184e87b6bc2f82329cc773ab9082937.txt | 2013-11-29 15:16 | 206 | |
![[TXT]](/icons/text.gif) | 6f01a0640ac7b3b472eab54785dca9e.txt | 2013-11-28 14:38 | 15K | |
![[ ]](/icons/layout.gif) | 898da9ac0d4b97b8cfcaa1543885bd4e.pdf | 2013-11-28 04:18 | 206K | |
![[TXT]](/icons/text.gif) | 870d03a312fcec6f80eac7e4f86bbea9.txt | 2013-11-28 03:20 | 28K | |
![[TXT]](/icons/text.gif) | 4099a92d8833c30ee2d0510f990e1e9e.txt | 2013-11-28 03:13 | 19K | |
![[TXT]](/icons/text.gif) | 85f20ac4e8293d95fb4717eb77855e68.txt | 2013-11-26 19:26 | 67K | |
![[TXT]](/icons/text.gif) | Poly(dimethylsiloxane) as a Material for Fabricating Microfluidic Devices.txt | 2013-11-26 13:39 | 102K | |
![[TXT]](/icons/text.gif) | a9d2d2e597f7421d7db5174f71d92e.txt | 2013-11-25 16:05 | 44K | |
![[ ]](/icons/layout.gif) | 189a00c1410fe13ec8b73af478d5a54b.pdf | 2013-11-25 16:04 | 180K | |
![[TXT]](/icons/text.gif) | ab74071a217eeec562baff8970be1822.txt | 2013-11-24 19:23 | 112K | |
![[ ]](/icons/layout.gif) | Tough, Bio-Inspired Hybrid Materials.pdf | 2013-11-24 18:38 | 471K | |
![[TXT]](/icons/text.gif) | 94d40441124dc73d9e4a402f026d87ca.txt | 2013-11-24 14:36 | 170K | |
![[ ]](/icons/layout.gif) | Characterization of Low-Temperature Silicon Nitride LPCVD from Bis(tertiary-butylamino)silane and Ammonia.pdf | 2013-11-23 23:22 | 251K | |
![[ ]](/icons/layout.gif) | Low Temperature Deposition of Metal Nitrides by Thermal Decomposition of Organometallic Compounds.pdf | 2013-11-23 23:08 | 943K | |
![[TXT]](/icons/text.gif) | 802f994a34e1f3cf0d0263e380232f74.txt | 2013-11-22 17:02 | 21K | |
![[ ]](/icons/layout.gif) | 1eb9a1ba1b00faa5b134c25ecf0c527d.pdf | 2013-11-21 13:46 | 2.6M | |
![[TXT]](/icons/text.gif) | 1e48aabe5b37c65037380b72f45bd07f.txt | 2013-11-21 13:45 | 40K | |
![[TXT]](/icons/text.gif) | eaa8588c6fd0cf54dc0a4bc3a85ce4d1.txt | 2013-11-21 13:44 | 718 | |
![[TXT]](/icons/text.gif) | ab06cfd9608f1aaa768ff8a9c583b0ff.txt | 2013-11-21 13:06 | 19K | |
![[TXT]](/icons/text.gif) | 3ef9e4f0d2e739d69575ae60748d3b57.txt | 2013-11-21 12:20 | 40K | |
![[TXT]](/icons/text.gif) | afbf5d08fbab9d23e41ac1ecdcb3c61a.txt | 2013-11-21 00:08 | 37K | |
![[TXT]](/icons/text.gif) | 82adb2ba7c021cb2a5699fd8ef85e5d0.txt | 2013-11-20 10:31 | 13K | |
![[TXT]](/icons/text.gif) | 54da7ab4d51b7314d4a1e2f377b676f3.txt | 2013-11-18 07:31 | 72K | |
![[TXT]](/icons/text.gif) | 75d3dd1e6ed0618e0746c03d74b2a745.txt | 2013-11-18 07:29 | 72K | |
![[ ]](/icons/layout.gif) | a38bafdfd38ca571cdfc0b421c2abb34.pdf | 2013-11-15 19:09 | 166K | |
![[TXT]](/icons/text.gif) | 89867735ac800047de4a857e9187cf98.txt | 2013-11-15 19:09 | 41K | |
![[ ]](/icons/layout.gif) | b6ce9783a008e1b6eb8baf6341dcd7d2.pdf | 2013-11-15 19:04 | 1.7M | |
![[TXT]](/icons/text.gif) | 6d48b5c2760d5a1994f978f93c23d0e9.txt | 2013-11-15 19:03 | 41K | |
![[ ]](/icons/layout.gif) | 86da1ff7b31ef264f9a323257a9febad.pdf | 2013-11-15 19:01 | 18M | |
![[ ]](/icons/layout.gif) | 2812960ac88f5e3f3edb23f013495964.pdf | 2013-11-15 19:00 | 459K | |
![[TXT]](/icons/text.gif) | d70210fa9a98a30fdc7b20ffe8856d91.txt | 2013-11-15 18:40 | 11K | |
![[TXT]](/icons/text.gif) | 4e7c8f650920a65cb9f5aef1a9faf896.txt | 2013-11-15 12:58 | 38K | |
![[ ]](/icons/layout.gif) | Analogies and Metaphors to Explain Godel's Theorem.pdf | 2013-11-15 10:45 | 1.4M | |
![[TXT]](/icons/text.gif) | 7f92b807da17bf7e689c483390933981.txt | 2013-11-14 16:26 | 71K | |
![[ ]](/icons/layout.gif) | 2ab115be13e52bbb9fbd78ecddd0bd19.pdf | 2013-11-14 08:10 | 2.2M | |
![[ ]](/icons/layout.gif) | After-birth abortion: why should the baby live?.pdf | 2013-11-13 04:47 | 94K | |
![[ ]](/icons/layout.gif) | Physical and biological aspects of renal vitrification.pdf | 2013-11-12 14:01 | 1.4M | |
![[ ]](/icons/layout.gif) | a6f5e2bc7a49c5425e4673a9734b2b69.pdf | 2013-11-12 09:37 | 321K | |
![[TXT]](/icons/text.gif) | 52abc80407aa2a1078bf34fb9110a4ef.txt | 2013-11-12 09:36 | 40K | |
![[TXT]](/icons/text.gif) | ae39cb7dc9052f4718a94e75c7399263.txt | 2013-11-11 22:06 | 36K | |
![[TXT]](/icons/text.gif) | Theory of Multiple Exciton Effects in the Photosynthetic Antenna Complex LHC-II.txt | 2013-11-11 21:57 | 101K | |
![[ ]](/icons/layout.gif) | The Lucky Number Theorem.pdf | 2013-11-11 07:36 | 276K | |
![[ ]](/icons/layout.gif) | The Random Sieve.pdf | 2013-11-11 03:36 | 200K | |
![[ ]](/icons/layout.gif) | Urban Scaling and Its Deviations: Revealing the Structure of Wealth, Innovation and Crime across Cities.pdf | 2013-11-10 19:25 | 2.5M | |
![[TXT]](/icons/text.gif) | 9d6824416ad63ef9b490cd6d77e7ee19.txt | 2013-11-10 17:04 | 36K | |
![[TXT]](/icons/text.gif) | b96ee54650e7bc3c1c8e982a81b8132d.txt | 2013-11-10 17:04 | 36K | |
![[TXT]](/icons/text.gif) | a6603fa512ff207244760034f423b237.txt | 2013-11-10 12:06 | 40K | |
![[TXT]](/icons/text.gif) | 414f76e33171be44c5b8b74b478207a2.txt | 2013-11-10 10:15 | 84K | |
![[TXT]](/icons/text.gif) | 257f7d34ff88a15b773aa495c55a1b6c.txt | 2013-11-10 10:12 | 52K | |
![[TXT]](/icons/text.gif) | b259b2baff921b04e28f962bf3f07a20.txt | 2013-11-10 10:08 | 64K | |
![[TXT]](/icons/text.gif) | b5cf0bdc67a4250990aa99383ab4aad7.txt | 2013-11-10 10:08 | 66K | |
![[TXT]](/icons/text.gif) | a9e52e5fe4c230a6befc405bd9dedbc4.txt | 2013-11-10 10:07 | 66K | |
![[ ]](/icons/layout.gif) | Combinatorial Analysis in Infinite Sets and Some Physical Theories.pdf | 2013-11-10 10:04 | 1.2M | |
![[ ]](/icons/layout.gif) | On Certain Sequences of Integers Defined by Sieves.pdf | 2013-11-10 09:39 | 382K | |
![[ ]](/icons/layout.gif) | A Visual Display of Some Properties of the Distribution of Primes.pdf | 2013-11-10 09:24 | 594K | |
![[TXT]](/icons/text.gif) | 465bbf1f2864dc03a635d28621b33621.txt | 2013-11-10 06:41 | 62K | |
![[TXT]](/icons/text.gif) | 6df88de8f11bd8fd98a0ce60ecb952e6.txt | 2013-11-10 05:04 | 42K | |
![[TXT]](/icons/text.gif) | 20d9736a232091749fb3a42ea097c1ef.txt | 2013-11-10 05:04 | 21K | |
![[TXT]](/icons/text.gif) | b77020c55f1e6befefa20cf91b00e2c7.txt | 2013-11-10 03:49 | 51K | |
![[TXT]](/icons/text.gif) | 6aeee7cf4eee7648a0d5c8b4fbd24e7d.txt | 2013-11-09 23:43 | 14K | |
![[TXT]](/icons/text.gif) | d721f8c88c2c52f47142f71c9402af5c.txt | 2013-11-08 16:40 | 61K | |
![[ ]](/icons/layout.gif) | Signal transduction by focal adhesion kinase in cancer.pdf | 2013-11-08 12:38 | 333K | |
![[TXT]](/icons/text.gif) | acd25e2abf9c0421ab0e20b0ac8b357d.txt | 2013-11-06 20:23 | 38K | |
![[ ]](/icons/layout.gif) | Instant inkjet circuits: lab-based inkjet printing to support rapid prototyping of UbiComp devices.pdf | 2013-11-06 17:38 | 7.7M | |
![[TXT]](/icons/text.gif) | 5d6c3d0ca6775c84ea24e85129ab2321.txt | 2013-11-06 16:13 | 67K | |
![[TXT]](/icons/text.gif) | Scitation: A Comparison Between a Geiger‐Mueller Counter, a Secondary Electron Multiplier Tube, and Photographic Film for Detecting Weak X‐Rays.txt | 2013-11-06 16:12 | 67K | |
![[TXT]](/icons/text.gif) | 8ae0656b339ff08d8e509681fca145d7.txt | 2013-11-04 12:35 | 38K | |
![[TXT]](/icons/text.gif) | 14eebcd9bf4dce42212260ff54e61c39.txt | 2013-11-04 12:34 | 38K | |
![[ ]](/icons/layout.gif) | Structural and Functional Brain Networks: From Connections to Cognition.pdf | 2013-11-04 11:18 | 1.5M | |
![[ ]](/icons/layout.gif) | Functional Interactions as Big Data in the Human Brain.pdf | 2013-11-04 11:15 | 1.8M | |
![[ ]](/icons/layout.gif) | Majority is not Enough: Bitcoin Mining is Vulnerable.pdf | 2013-11-04 08:46 | 775K | |
![[TXT]](/icons/text.gif) | af109ce0a09e8d8889bbb01e4d035026.txt | 2013-11-03 15:45 | 247 | |
![[TXT]](/icons/text.gif) | fc7427252439b23fe0431769446001d9.txt | 2013-11-03 15:45 | 247 | |
![[TXT]](/icons/text.gif) | b0aa95e6cbdfefa0f98a06641787b49b.txt | 2013-11-03 15:44 | 36K | |
![[TXT]](/icons/text.gif) | be540d434dffc4b4f587139ca1e38f4.txt | 2013-11-03 15:41 | 12K | |
![[TXT]](/icons/text.gif) | aa94eae0494799bfcacdd16d8d5b4ad1.txt | 2013-11-03 15:28 | 40K | |
![[TXT]](/icons/text.gif) | 90440843f7c0aeae3869c082cc92fa8c.txt | 2013-11-03 15:26 | 126K | |
![[TXT]](/icons/text.gif) | 5e8b9378ad75f6608555d22f4b28f701.txt | 2013-11-03 15:23 | 38K | |
![[TXT]](/icons/text.gif) | 83150d24e14d54f6c805ccd4ae15548e.txt | 2013-11-03 15:16 | 37K | |
![[TXT]](/icons/text.gif) | 5adf7e27f89b82d283ec4d8154dbf62.txt | 2013-11-03 14:08 | 37K | |
![[ ]](/icons/layout.gif) | Making long-term memories in minutes: a spaced learning pattern from memory research in education.pdf | 2013-11-03 02:03 | 533K | |
![[TXT]](/icons/text.gif) | 6db389203d55501c96f90f21dad9c2e.txt | 2013-11-02 14:41 | 115K | |
![[ ]](/icons/layout.gif) | 58904a1a02b79b77f297d34098063f2c.pdf | 2013-11-02 14:41 | 147K | |
![[ ]](/icons/layout.gif) | The New England Origins of Mormonism.pdf | 2013-11-02 12:15 | 2.1M | |
![[TXT]](/icons/text.gif) | d6ffc91ed1dae20e8a6f3e8d575e8f75.txt | 2013-11-02 05:43 | 443 | |
![[TXT]](/icons/text.gif) | 8e240502b44eed4afefc5c55ee24b3e3.txt | 2013-11-02 04:54 | 29K | |
![[ ]](/icons/layout.gif) | Evolutionary attempts at 4 eyes in vertebrates..pdf | 2013-11-02 04:43 | 557K | |
![[ ]](/icons/layout.gif) | Parameter Space Compression Underlies Emergent Theories and Predictive Models.pdf | 2013-11-01 18:04 | 494K | |
![[ ]](/icons/layout.gif) | Mersenne twister: a 623-dimensionally equidistributed uniform pseudo-random number generator.pdf | 2013-11-01 15:11 | 242K | |
![[TXT]](/icons/text.gif) | 9f63b1bad2a3f8b5256ab8b2129e2829.txt | 2013-10-31 04:26 | 13K | |
![[TXT]](/icons/text.gif) | 93d0d7492b15c3afb47321f84e42e044.txt | 2013-10-30 13:25 | 43K | |
![[TXT]](/icons/text.gif) | 39dab094a3a516c03246d5134f12ee85.txt | 2013-10-30 13:24 | 35K | |
![[TXT]](/icons/text.gif) | c2fa9ad30d974131cdbc82bdbfc2ae19.txt | 2013-10-29 17:56 | 91K | |
![[ ]](/icons/layout.gif) | The Chicxulub Asteroid Impact and Mass Extinction at the Cretaceous-Paleogene Boundary.pdf | 2013-10-29 16:47 | 510K | |
![[ ]](/icons/layout.gif) | a190057f763b6cd9a3ad5cefd0f441cb.pdf | 2013-10-28 17:17 | 904K | |
![[TXT]](/icons/text.gif) | Total Synthesis of (+)-Lysergic Acid.txt | 2013-10-28 17:16 | 84K | |
![[TXT]](/icons/text.gif) | fda4e11ed90cb3df120872388e00c976.txt | 2013-10-28 14:41 | 19K | |
![[ ]](/icons/layout.gif) | b30362fc3d33a089a20a45ce15565166.pdf | 2013-10-27 18:21 | 476K | |
![[ ]](/icons/layout.gif) | af6181ad599a3a566355f304c95c46eb.pdf | 2013-10-27 18:20 | 1.1M | |
![[TXT]](/icons/text.gif) | Error 404 Invalid path _fulltext_aip_journal_jap_66_11_@APPLICATION.BASE.URL@_error_authentication was requested.txt | 2013-10-27 18:19 | 1.5K | |
![[TXT]](/icons/text.gif) | Scitation: Spin coating: One‐dimensional model.txt | 2013-10-27 18:18 | 69K | |
![[TXT]](/icons/text.gif) | cd1208ddeccf65a26da04aef47a69be4.txt | 2013-10-27 18:10 | 65K | |
![[TXT]](/icons/text.gif) | d6b51bb512e104d63b17cc846baae992.txt | 2013-10-27 18:10 | 77K | |
![[TXT]](/icons/text.gif) | 5e4545b786032e6e95e2e0dd9263709d.txt | 2013-10-27 16:37 | 11K | |
![[ ]](/icons/layout.gif) | The rate of spreading in spin coating.pdf | 2013-10-27 16:37 | 1.1M | |
![[TXT]](/icons/text.gif) | 64e31cf3d89a2b18c848e6bd71ecb0c9.txt | 2013-10-27 16:37 | 97K | |
![[TXT]](/icons/text.gif) | 49b29299de4d31ddaf1b60668a971695.txt | 2013-10-27 16:32 | 143K | |
![[TXT]](/icons/text.gif) | 1e56d3a95dbe6422388b718425c09c7d.txt | 2013-10-27 15:39 | 612 | |
![[TXT]](/icons/text.gif) | 3c32671e92a6bc8fc8b88d5e678c7905.txt | 2013-10-27 15:39 | 610 | |
![[TXT]](/icons/text.gif) | f4fb3336daaacfb834cceeed44b5fafc.txt | 2013-10-27 15:38 | 12K | |
![[TXT]](/icons/text.gif) | e6e15d723b85ea2200222f271d59890c.txt | 2013-10-27 15:36 | 12K | |
![[TXT]](/icons/text.gif) | 6c60ba37081c43959626d7a6c402da6a.txt | 2013-10-27 11:47 | 14K | |
![[ ]](/icons/layout.gif) | 6735419b05d9bbf11ae554a5b142319.pdf | 2013-10-27 11:22 | 592K | |
![[TXT]](/icons/text.gif) | 799677276cb16a94edc3c7d56405b83d.txt | 2013-10-27 11:17 | 40K | |
![[TXT]](/icons/text.gif) | 9b1a919b4d9ef597248fe3e910704bb4.txt | 2013-10-25 11:24 | 328K | |
![[ ]](/icons/layout.gif) | Cellular organization of cortical barrel columns is whisker-specific.pdf | 2013-10-25 10:13 | 1.6M | |
![[TXT]](/icons/text.gif) | 3ed6f834d8b84dedf73c2df55a66a923.txt | 2013-10-24 08:49 | 54K | |
![[TXT]](/icons/text.gif) | b536bcd25ddb6a96d1953801c58d43ca.txt | 2013-10-24 07:53 | 205K | |
![[TXT]](/icons/text.gif) | 80701230e1a8e775046a1dd85151b7fb.txt | 2013-10-23 21:46 | 11K | |
![[TXT]](/icons/text.gif) | b1e991ae485463d00cce3658dcdbbc6f.txt | 2013-10-23 15:25 | 35K | |
![[TXT]](/icons/text.gif) | 36030a064cd078248c69229ba876b345.txt | 2013-10-23 13:36 | 40K | |
![[TXT]](/icons/text.gif) | 88e9f5cb752ae41476977630d410eed0.txt | 2013-10-23 13:36 | 40K | |
![[TXT]](/icons/text.gif) | 618df73b3b3555876b01f22c29091344.txt | 2013-10-23 13:35 | 40K | |
![[TXT]](/icons/text.gif) | 9c57eb69b933d3ce9861f0ea063a21bb.txt | 2013-10-23 13:35 | 40K | |
![[TXT]](/icons/text.gif) | ec86d2402a99724039817009248f15eb.txt | 2013-10-23 01:20 | 22K | |
![[TXT]](/icons/text.gif) | e1c1dbba7e6b132777f556482fc579fc.txt | 2013-10-22 11:27 | 40K | |
![[TXT]](/icons/text.gif) | eeeb2f8c9f7c16c2ab4d6f95063b9718.txt | 2013-10-22 11:26 | 40K | |
![[TXT]](/icons/text.gif) | a5ce28934c2ea864fe09818fc3f0f9d6.txt | 2013-10-22 11:26 | 40K | |
![[TXT]](/icons/text.gif) | b36ed24e2a2903e85964ae1b01cf74f3.txt | 2013-10-22 11:26 | 40K | |
![[TXT]](/icons/text.gif) | 4f33de8f56d6c1c48605c394f40e4f15.txt | 2013-10-21 15:33 | 15K | |
![[TXT]](/icons/text.gif) | 1e8067214147340693c4a3baa0614aec.txt | 2013-10-21 07:05 | 13K | |
![[TXT]](/icons/text.gif) | 2b9e64398cb60c6645d5e8a6a8f63a54.txt | 2013-10-21 07:05 | 13K | |
![[TXT]](/icons/text.gif) | a5f0d2ec77d9d14546dbff60304ff5.txt | 2013-10-21 05:43 | 15K | |
![[TXT]](/icons/text.gif) | a731f64fb2ea612d18c7ba90c120f52.txt | 2013-10-21 05:42 | 15K | |
![[TXT]](/icons/text.gif) | Ellipsometry Studies of the Self-Assembly of Nonionic Surfactants at the Silica-Water Interface: Equilibrium Aspects.txt | 2013-10-20 19:09 | 93K | |
![[TXT]](/icons/text.gif) | d6a59a13ddf5fc7c8d0828c24f0f611.txt | 2013-10-20 18:32 | 12K | |
![[TXT]](/icons/text.gif) | 9fe3e00ba574b95672e4f888cc9cd511.txt | 2013-10-20 18:18 | 11K | |
![[TXT]](/icons/text.gif) | 3e61d45bd8f55b286fc0e7eb5f426009.txt | 2013-10-20 17:55 | 12K | |
![[TXT]](/icons/text.gif) | Scitation: The magnetospheric clock of Saturn—A self-organized plasma dynamo.txt | 2013-10-20 17:07 | 101K | |
![[TXT]](/icons/text.gif) | d94c9092db88a76d1044e6fc8f74ebfc.txt | 2013-10-20 11:16 | 19K | |
![[TXT]](/icons/text.gif) | acf8fc8ac4969cc26f9c879986b5c2fe.txt | 2013-10-19 23:10 | 74K | |
![[TXT]](/icons/text.gif) | 367604475540aa4d76d52485dc24705d.txt | 2013-10-19 23:09 | 8.8K | |
![[TXT]](/icons/text.gif) | 30e3de4fa60fc8c76a59b97420d0e020.txt | 2013-10-19 22:58 | 31K | |
![[TXT]](/icons/text.gif) | 9c93a881f5350ed8f6b3b83a02d077a4.txt | 2013-10-19 15:12 | 51K | |
![[TXT]](/icons/text.gif) | bad9f850a897cb93586cf6851ab2d76e.txt | 2013-10-19 12:58 | 64K | |
![[TXT]](/icons/text.gif) | 7691c12104f5ad18775f7ec9c5294d4f.txt | 2013-10-19 12:26 | 14K | |
![[TXT]](/icons/text.gif) | 95e840308dd86ef17427e1055a420012.txt | 2013-10-19 12:11 | 79K | |
![[TXT]](/icons/text.gif) | 7523fcd1c654653d942e5ce79b63e5e1.txt | 2013-10-19 10:26 | 37K | |
![[ ]](/icons/layout.gif) | Properties of yeast grown anaerobically in media limiting in potassium.pdf | 2013-10-19 10:20 | 1.0M | |
![[TXT]](/icons/text.gif) | 23c53e79d6840cd5f83f26d57e81f65b.txt | 2013-10-19 10:13 | 37K | |
![[TXT]](/icons/text.gif) | 1ffd96e3580ac70099b1593e530a8bda.txt | 2013-10-19 09:49 | 12K | |
![[TXT]](/icons/text.gif) | e5ef59d0dc4d7d067a4e3e410d13af34.txt | 2013-10-19 09:13 | 18K | |
![[TXT]](/icons/text.gif) | eda63c396788b57b0434e1553b076b89.txt | 2013-10-19 09:04 | 39K | |
![[TXT]](/icons/text.gif) | 3fb5ac90d2c147c7853e1ddb20410554.txt | 2013-10-18 13:49 | 37K | |
![[TXT]](/icons/text.gif) | bbaba34357ab39d2bb98f20be8ac31cb.txt | 2013-10-17 21:41 | 45K | |
![[TXT]](/icons/text.gif) | e479bd27e9052dbf68f8ca95f1fa4d13.txt | 2013-10-17 21:29 | 44K | |
![[TXT]](/icons/text.gif) | 6957c7102e536bedcccc1f23cc975fb4.txt | 2013-10-16 22:27 | 54K | |
![[TXT]](/icons/text.gif) | d1197d6a60319b94d28bb59bedda3b23.txt | 2013-10-15 14:20 | 20K | |
![[TXT]](/icons/text.gif) | 41147d7d12c43d85c40993f9e8a861d7.txt | 2013-10-15 13:42 | 45K | |
![[TXT]](/icons/text.gif) | 2de90c9bddd5ce51ccbbe5a6003a7d32.txt | 2013-10-15 13:42 | 45K | |
![[TXT]](/icons/text.gif) | b8cea0297710f6a0258cd1e3f4dae62a.txt | 2013-10-14 09:25 | 39K | |
![[TXT]](/icons/text.gif) | fcb804002da04565e5f278117a3623d8.txt | 2013-10-14 05:55 | 39K | |
![[TXT]](/icons/text.gif) | 7ebf7381db4d8ab9aef6ef5656d66298.txt | 2013-10-14 05:54 | 39K | |
![[TXT]](/icons/text.gif) | aace503a875f84178ad411e24bd933d7.txt | 2013-10-14 05:54 | 39K | |
![[TXT]](/icons/text.gif) | 421187e4d34068b9d57dda6e17f71a9f.txt | 2013-10-13 11:55 | 13K | |
![[TXT]](/icons/text.gif) | b5d4c553781fce4f63a5ec3a3ac523d0.txt | 2013-10-12 21:43 | 14K | |
![[TXT]](/icons/text.gif) | 6945981946832cb08a2febbd01aa8d91.txt | 2013-10-12 21:41 | 24K | |
![[TXT]](/icons/text.gif) | 6456e20913b7765d921667588f19ac.txt | 2013-10-10 17:11 | 15K | |
![[TXT]](/icons/text.gif) | 7464726e927cd112d73e07723d443f7.txt | 2013-10-07 23:14 | 50K | |
![[ ]](/icons/layout.gif) | b6eabfa5ade7adcce6bb3b323441628b.pdf | 2013-10-07 17:03 | 492K | |
![[TXT]](/icons/text.gif) | ff88993ddbd99f822bdd135c4cc7d0fb.txt | 2013-10-07 17:01 | 49K | |
![[TXT]](/icons/text.gif) | ef2d85cd954946ea8adea7002376d05d.txt | 2013-10-07 16:57 | 34K | |
![[TXT]](/icons/text.gif) | 3fdc07c35f81345c2b70571f3ed5f154.txt | 2013-10-07 16:48 | 12K | |
![[TXT]](/icons/text.gif) | 19619269de8577d9ccd407028e8e9b66.txt | 2013-10-07 16:47 | 37K | |
![[TXT]](/icons/text.gif) | a30bff382ab37e58483627739c4d6ff4.txt | 2013-10-07 14:26 | 41K | |
![[TXT]](/icons/text.gif) | 4614a012833f2a329e8250b112f5dc0f.txt | 2013-10-06 23:08 | 19K | |
![[TXT]](/icons/text.gif) | 57bbbd58bb2a2065757d4312c7945060.txt | 2013-10-06 11:50 | 69K | |
![[ ]](/icons/layout.gif) | Mind-blanking: when the mind goes away.pdf | 2013-10-06 05:39 | 633K | |
![[TXT]](/icons/text.gif) | a7904c1a2283ca43f1d142a13199c21c.txt | 2013-10-06 02:01 | 53K | |
![[TXT]](/icons/text.gif) | bc2774f25d75606e032069688f66b72b.txt | 2013-10-06 01:52 | 36K | |
![[TXT]](/icons/text.gif) | 41061f55f12eba8d63a1cf3a35eddd5.txt | 2013-10-06 01:51 | 32K | |
![[ ]](/icons/layout.gif) | Enhanced Liquid Metal Micro Droplet Generation by Pneumatic Actuation Based on the StarJet Method.pdf | 2013-10-05 14:29 | 1.9M | |
![[ ]](/icons/layout.gif) | A fully automatic problem solver with human-style output.pdf | 2013-10-04 20:29 | 354K | |
![[ ]](/icons/layout.gif) | aad8413d543d2ef7cf874f5a5e1264bf.pdf | 2013-10-04 04:56 | 5.0M | |
![[ ]](/icons/layout.gif) | Support-vector networks.pdf | 2013-10-03 15:25 | 1.4M | |
![[TXT]](/icons/text.gif) | e4ff0e57ddfe2b2feecfc64d8119f1a.txt | 2013-10-02 13:04 | 5.1K | |
![[TXT]](/icons/text.gif) | 46c28289e194faad29617b004e978b8f.txt | 2013-10-02 09:28 | 5.0K | |
![[TXT]](/icons/text.gif) | 6ab96ffe5c394d9ee8e1a2be9d34e46b.txt | 2013-10-02 09:28 | 64K | |
![[TXT]](/icons/text.gif) | ec02cb4d76d8c198672d48e5a888409f.txt | 2013-10-02 02:23 | 32K | |
![[TXT]](/icons/text.gif) | 71d84c02682fce4662ad1e5e1e24eed2.txt | 2013-09-28 14:04 | 36K | |
![[ ]](/icons/layout.gif) | A Systemic Analysis of Affirmative Action in American Law Schools.pdf | 2013-09-26 22:19 | 19M | |
![[TXT]](/icons/text.gif) | 8efcc835108119abed7eda8d3af58762.txt | 2013-09-26 21:59 | 13K | |
![[ ]](/icons/layout.gif) | 536d852c1ca395f5a51529a3f680fd08.pdf | 2013-09-26 16:07 | 1.4M | |
![[ ]](/icons/layout.gif) | 20b57d2e1189e5288e5011135b2d97dc.pdf | 2013-09-26 16:06 | 1.2M | |
![[ ]](/icons/layout.gif) | f3b81b8f396bb5f871aa6fcca71fda68.pdf | 2013-09-26 16:05 | 775K | |
![[ ]](/icons/layout.gif) | ec751adaa3a1a2080d1d43f105d2d0fe.pdf | 2013-09-26 16:03 | 631K | |
![[ ]](/icons/layout.gif) | c629044fa8cdd208133b4ab704d7be.pdf | 2013-09-26 16:01 | 5.1M | |
![[TXT]](/icons/text.gif) | Agrarian Reforms in Cuba, 1959-1963.txt | 2013-09-25 19:20 | 21K | |
![[TXT]](/icons/text.gif) | e2a5385f5f99d565eb5426f6048b05b8.txt | 2013-09-25 17:31 | 4.5K | |
![[ ]](/icons/layout.gif) | Distortion products otoacoustic emissions in diagnosis of hearing loss in Down syndrome.pdf | 2013-09-25 17:30 | 173K | |
![[TXT]](/icons/text.gif) | 4c1b7a9f6a7d22cfd3cf946004891f2e.txt | 2013-09-25 17:30 | 54K | |
![[TXT]](/icons/text.gif) | f138ce939ffc6d0410dab991e12f0556.txt | 2013-09-25 15:45 | 4.7K | |
![[TXT]](/icons/text.gif) | b556e2a8350de26c68ba375e34ec1ff0.txt | 2013-09-25 15:45 | 15K | |
![[ ]](/icons/layout.gif) | Race, Class, and Family Structure: The Case of Family Income.pdf | 2013-09-25 09:49 | 1.4M | |
![[TXT]](/icons/text.gif) | 21424cb8a44e7bc2b1327114976bb85.txt | 2013-09-24 12:59 | 45K | |
![[TXT]](/icons/text.gif) | 83336d7b1a3b9f65c324b064d33a57a.txt | 2013-09-24 12:59 | 45K | |
![[TXT]](/icons/text.gif) | c9a2ccc718237b16e5b3fe0623aa0151.txt | 2013-09-24 07:09 | 738 | |
![[TXT]](/icons/text.gif) | eabfd8a5b5c0098202446ac39b3ca466.txt | 2013-09-23 22:08 | 2.4K | |
![[ ]](/icons/layout.gif) | 282ae2885a99a8bc7117e8b64e082537.pdf | 2013-09-23 17:50 | 1.6M | |
![[ ]](/icons/layout.gif) | Causal Relationship between Obesity and Vitamin D Status: Bi-Directional Mendelian Randomization Analysis of Multiple Cohorts.pdf | 2013-09-23 17:30 | 864K | |
![[TXT]](/icons/text.gif) | d2e4a7405f18edac2025588ef7fbdc20.txt | 2013-09-23 15:36 | 10K | |
![[ ]](/icons/layout.gif) | Molecular Threading: Mechanical Extraction, Stretching and Placement of DNA Molecules from a Liquid-Air Interface.pdf | 2013-09-23 13:03 | 2.2M | |
![[ ]](/icons/layout.gif) | 4699e49cf4f070eacbc04fd3341d96d8.pdf | 2013-09-20 20:16 | 408K | |
![[TXT]](/icons/text.gif) | 5099429d2dd08a2dbbcd85c3e618c377.txt | 2013-09-20 05:36 | 25K | |
![[TXT]](/icons/text.gif) | 2106da9b94c6547fb71465ccc2238717.txt | 2013-09-20 05:35 | 25K | |
![[TXT]](/icons/text.gif) | e29f30eaa017f35f52e4fa64831b6d65.txt | 2013-09-19 22:32 | 4.1K | |
![[ ]](/icons/layout.gif) | f47861de20ad9d0671d42fefad6367fc.pdf | 2013-09-19 14:20 | 708K | |
![[TXT]](/icons/text.gif) | Thick galactic cosmic radiation shielding using atmospheric data.txt | 2013-09-19 14:19 | 54K | |
![[ ]](/icons/layout.gif) | Metabolic rate and body size are linked with perception of temporal information .pdf | 2013-09-19 01:39 | 917K | |
![[ ]](/icons/layout.gif) | bf49990e17829815d3546392e321c769.pdf | 2013-09-17 11:47 | 973K | |
![[TXT]](/icons/text.gif) | 601fca0556ee72dd6ab1e27fcd9292a8.txt | 2013-09-17 11:30 | 1.5K | |
![[TXT]](/icons/text.gif) | 554773dc1608d215f9289fe06d475ab8.txt | 2013-09-17 05:39 | 40K | |
![[TXT]](/icons/text.gif) | 3065da076c985b8586bb6ebe52ddd711.txt | 2013-09-16 21:29 | 61K | |
![[ ]](/icons/layout.gif) | Psychedelics and Mental Health: A Population Study.pdf | 2013-09-16 19:44 | 292K | |
![[TXT]](/icons/text.gif) | 22aa1614fbb0fcc051618b4e108acb85.txt | 2013-09-16 15:32 | 153K | |
![[TXT]](/icons/text.gif) | ff5d92cfa8d5e5852379024cbf26df6d.txt | 2013-09-16 08:15 | 38K | |
![[TXT]](/icons/text.gif) | 699b9c9cf5c2110afb8509892134d452.txt | 2013-09-16 08:04 | 38K | |
![[TXT]](/icons/text.gif) | c2fd5868030a615ecfb0fc7ef809788.txt | 2013-09-16 08:01 | 38K | |
![[TXT]](/icons/text.gif) | 9edb68a3451340a3226ea21e2121adb.txt | 2013-09-15 11:16 | 9.9K | |
![[TXT]](/icons/text.gif) | c89e2dc1f9bb32b9a09ad22f0d77fcd5.txt | 2013-09-15 10:50 | 61K | |
![[TXT]](/icons/text.gif) | c8e9917c2a79b911c865d04f6d9abfc2.txt | 2013-09-15 10:50 | 61K | |
![[TXT]](/icons/text.gif) | 507530c3464706f7805fad02050ee960.txt | 2013-09-15 10:50 | 61K | |
![[TXT]](/icons/text.gif) | 4586ba155eb539cb720ededde269756e.txt | 2013-09-14 23:30 | 12K | |
![[ ]](/icons/layout.gif) | d5216c629f7ef8d110ab4cbfc5cb7035.pdf | 2013-09-13 18:32 | 433K | |
![[TXT]](/icons/text.gif) | fd1831948cfeb087d5288933f2dffe1a.txt | 2013-09-13 15:49 | 11K | |
![[ ]](/icons/layout.gif) | 7df3ac05e6ce922184807272d6c02682.pdf | 2013-09-12 09:55 | 300K | |
![[TXT]](/icons/text.gif) | cced9b2a9865a61a6f42f3f58d10a06a.txt | 2013-09-12 09:47 | 14K | |
![[TXT]](/icons/text.gif) |
The Origin of Life on Earth .txt | 2013-09-12 09:46 | 525K | |
![[ ]](/icons/layout.gif) | c37f47663a722d9091bb6597452831a.pdf | 2013-09-12 09:35 | 504K | |
![[ ]](/icons/layout.gif) | 82bb5c63c6f6e4cef83dd18ec73d7316.pdf | 2013-09-11 09:40 | 753K | |
![[ ]](/icons/layout.gif) | Evaluating Graduated Response.pdf | 2013-09-10 05:15 | 41K | |
![[ ]](/icons/layout.gif) | The evolution of Lisp.pdf | 2013-09-10 04:52 | 6.7M | |
![[ ]](/icons/layout.gif) | Design of a LISP-based microprocessor.pdf | 2013-09-10 04:42 | 1.8M | |
![[ ]](/icons/layout.gif) | Debunking the expensive procedure call myth or, procedure call implementations considered harmful or, LAMBDA: The Ultimate GOTO.pdf | 2013-09-10 04:39 | 941K | |
![[TXT]](/icons/text.gif) | Drivers and modulators from push-pull and balanced synaptic input.txt | 2013-09-09 05:45 | 54K | |
![[ ]](/icons/layout.gif) | Recovery of a top predator mediates negative eutrophic effects on seagrass.pdf | 2013-09-07 08:03 | 1.0M | |
![[TXT]](/icons/text.gif) | 3c80bac07dccb64841df22d6a09743fd.txt | 2013-09-07 06:33 | 958 | |
![[ ]](/icons/layout.gif) | Decades-Long Changes of the Interstellar Wind Through Our Solar System.pdf | 2013-09-06 10:50 | 222K | |
![[TXT]](/icons/text.gif) | d042a7f6c6e15934bdbb005fe278f5aa.txt | 2013-09-05 14:30 | 40K | |
![[TXT]](/icons/text.gif) | dcd45e5fe06a8e07c964a8407b4a6597.txt | 2013-09-02 23:51 | 59K | |
![[ ]](/icons/layout.gif) | 2ef4f61fa8cfe2d2944e55c739f12965.pdf | 2013-09-01 03:59 | 388K | |
![[TXT]](/icons/text.gif) | 1 – Overview of Plant Polymers.txt | 2013-08-30 10:25 | 40K | |
![[TXT]](/icons/text.gif) | b17f1b7cf31e93f3c5f279ab719b0edc.txt | 2013-08-30 10:15 | 28K | |
![[ ]](/icons/layout.gif) | Flavonol-rich dark cocoa significantly decreases plasma endothelin-1 and improves cognition in urban children.pdf | 2013-08-30 07:24 | 2.6M | |
![[TXT]](/icons/text.gif) | f88a92ab884051777238f981e4deb91c.txt | 2013-08-30 06:53 | 17K | |
![[TXT]](/icons/text.gif) | 474b090480289a057bd84418f25764ff.txt | 2013-08-30 06:53 | 17K | |
![[ ]](/icons/layout.gif) | Poverty Impedes Cognitive Function.pdf | 2013-08-30 06:52 | 304K | |
![[ ]](/icons/layout.gif) | c6b57c7665d7322429ea01ad63f6444e.pdf | 2013-08-30 06:18 | 1.3M | |
![[ ]](/icons/layout.gif) | Paleofluvial Mega-Canyon Beneath the Central Greenland Ice Sheet.pdf | 2013-08-29 18:58 | 1.6M | |
![[ ]](/icons/layout.gif) | Ethnopharmacological .pdf | 2013-08-29 14:58 | 874K | |
![[TXT]](/icons/text.gif) | 7e7f3e40d0da02e38dbc79f020270629.txt | 2013-08-29 14:01 | 49K | |
![[ ]](/icons/layout.gif) | Nutritional Quality and Tannin Astringency of Browse in Clear-Cuts and Old-Growth Forests.pdf | 2013-08-29 13:46 | 1.7M | |
![[ ]](/icons/layout.gif) | Treating Progress Functions as a Managerial Opportunity.pdf | 2013-08-29 10:31 | 506K | |
![[TXT]](/icons/text.gif) | e2eafb5201fdc5bc4aedadc085586d0d.txt | 2013-08-29 04:45 | 215 | |
![[TXT]](/icons/text.gif) | cded36253002272ef58dc0dc69f1bb45.txt | 2013-08-29 04:18 | 145K | |
![[ ]](/icons/layout.gif) | Sustainable grazing systems for the Central Tablelands, New South Wales.pdf | 2013-08-29 04:17 | 40K | |
![[ ]](/icons/layout.gif) | Seasonal variations in the herbage mass, crude protein and in-vitro digestibility of native perennial grasses on the north-west slopes of New South Wales..pdf | 2013-08-29 04:15 | 40K | |
![[TXT]](/icons/text.gif) | b5289bb4eaaef6f2e96bd53130c9fbb2.txt | 2013-08-29 02:19 | 90K | |
![[TXT]](/icons/text.gif) | 1ecc4dfd1a9ea207e10d54637928063e.txt | 2013-08-29 02:18 | 49K | |
![[TXT]](/icons/text.gif) | c7188d9be1b4e6e86d7a8868bb314d3c.txt | 2013-08-29 02:16 | 49K | |
![[TXT]](/icons/text.gif) | ddfadc432a6ca8b1fe01cce109f53690.txt | 2013-08-29 02:15 | 15K | |
![[TXT]](/icons/text.gif) | 60ffd2af3ff29bece44b9f5b7751b711.txt | 2013-08-29 02:13 | 49K | |
![[ ]](/icons/layout.gif) | Beef Cattle Industry in Oregon, 1890 -- 1938.pdf | 2013-08-29 02:10 | 2.6M | |
![[ ]](/icons/layout.gif) | Habitat Use by Roosevelt Elk in Unmanaged Forests of the Hoh Valley, Washington.pdf | 2013-08-29 02:07 | 769K | |
![[ ]](/icons/layout.gif) | Fecal Indices to Dietary Quality of Cervids in Old-Growth Forests.pdf | 2013-08-29 01:57 | 729K | |
![[TXT]](/icons/text.gif) | 21155f9df2c45cd8ca20e0c49c983ef5.txt | 2013-08-28 11:38 | 11K | |
![[TXT]](/icons/text.gif) | 8d92c6bd4a347788b23ee8f4cdfafce8.txt | 2013-08-27 18:01 | 14K | |
![[ ]](/icons/layout.gif) | 998e9aa0ffd29d896a770f22f96d0214.pdf | 2013-08-27 17:02 | 410K | |
![[TXT]](/icons/text.gif) | 5f51844dc1f2819d4e8b2219922fe7fa.txt | 2013-08-27 17:01 | 12K | |
![[TXT]](/icons/text.gif) | 6560713f2401a332ceda08e661ff3852.txt | 2013-08-27 14:34 | 1.4K | |
![[ ]](/icons/layout.gif) | 880d514c976f11db250445e29f3d3021.pdf | 2013-08-27 14:01 | 552K | |
![[TXT]](/icons/text.gif) | 94856254518d72535740fd62a725024c.txt | 2013-08-27 13:00 | 1.4K | |
![[ ]](/icons/layout.gif) | Light Propagation with Phase Discontinuities: Generalized Laws of Reflection and Refraction.pdf | 2013-08-26 23:50 | 1.3M | |
![[TXT]](/icons/text.gif) | e646bb9410a7187b5ef400f91861175a.txt | 2013-08-26 12:41 | 42K | |
![[ ]](/icons/layout.gif) | Near optimum estimation of local fractal dimension for image segmentation.pdf | 2013-08-26 10:09 | 537K | |
![[TXT]](/icons/text.gif) | 1aa3d5177939173ac8b41eb633445948.txt | 2013-08-22 15:02 | 127K | |
![[TXT]](/icons/text.gif) | 4231da6e404a71559cbb74ad5d2cd50d.txt | 2013-08-22 14:59 | 70K | |
![[TXT]](/icons/text.gif) | 2a7bc625eedfee265a24f0001b246ea.txt | 2013-08-21 05:13 | 13K | |
![[TXT]](/icons/text.gif) | 85010ba608c109e9849645c6976ce2a1.txt | 2013-08-21 05:12 | 13K | |
![[ ]](/icons/layout.gif) | 4edd9b4ae19439c871528dadeeb9703f.pdf | 2013-08-20 17:15 | 549K | |
![[ ]](/icons/layout.gif) | 10a98ca9e12599d056889aa6d33dec6f.pdf | 2013-08-20 16:42 | 549K | |
![[TXT]](/icons/text.gif) | 6cc536eae8e07f73e2ffdf20eba20d24.txt | 2013-08-20 16:40 | 14K | |
![[TXT]](/icons/text.gif) | 119ffc3a6434fb83027ad422e9323121.txt | 2013-08-20 16:39 | 14K | |
![[TXT]](/icons/text.gif) | db9ef762b96ababefd01d3cfd887a20e.txt | 2013-08-20 15:43 | 106K | |
![[ ]](/icons/layout.gif) | f3b4dd5831c36f8f7c9339a55e80d6fb.pdf | 2013-08-20 15:43 | 393K | |
![[TXT]](/icons/text.gif) | b6992e85449a5833f624916a626f5189.txt | 2013-08-19 22:52 | 13K | |
![[TXT]](/icons/text.gif) | 62ba20a8c57650680be4c04d777466e3.txt | 2013-08-19 22:41 | 14K | |
![[TXT]](/icons/text.gif) | 5e27c1cf3b05333b88cd70e598d8f382.txt | 2013-08-18 13:34 | 45K | |
![[TXT]](/icons/text.gif) | 26c76aba93650f6a8ca86d61bb5aa9d.txt | 2013-08-18 09:50 | 3.5K | |
![[ ]](/icons/layout.gif) | Substitution of porphyropsin for rhodopsin in mouse retina.pdf | 2013-08-18 05:00 | 705K | |
![[TXT]](/icons/text.gif) | bf48745225d7b9fe5de2174a659481b2.txt | 2013-08-17 03:29 | 42K | |
![[ ]](/icons/layout.gif) | Non-Invasive Brain-to-Brain Interface (BBI): Establishing Functional Links between Two Brains.pdf | 2013-08-16 21:32 | 678K | |
![[TXT]](/icons/text.gif) | 4d2dd1be515117ad531a5578f7d89def.txt | 2013-08-16 06:24 | 150K | |
![[ ]](/icons/layout.gif) | A Dramatic Increase of C1q Protein in the CNS during Normal Aging.pdf | 2013-08-15 20:07 | 9.1M | |
![[TXT]](/icons/text.gif) | 58fae0ec0f07e9e5d94489cc2a7d85bc.txt | 2013-08-15 14:09 | 63K | |
![[TXT]](/icons/text.gif) | cf654a3963a99a20edafa84f414a36bf.txt | 2013-08-15 14:09 | 63K | |
![[TXT]](/icons/text.gif) | 9ed2cdf6d5cc0ab6fe73fc477ced8de.txt | 2013-08-15 14:08 | 63K | |
![[ ]](/icons/layout.gif) | Curcumin binds tubulin, induces mitotic catastrophe, and impedes normal endothelial cell proliferation .pdf | 2013-08-15 13:39 | 535K | |
![[TXT]](/icons/text.gif) | b7aa58d3138099ec2a0cd9c2a43c39ad.txt | 2013-08-14 12:09 | 13K | |
![[ ]](/icons/layout.gif) | Bandit Market Makers.pdf | 2013-08-13 15:31 | 592K | |
![[TXT]](/icons/text.gif) | 53b07754fa8ee02f9d7abec3d1a1500d.txt | 2013-08-13 12:48 | 38K | |
![[TXT]](/icons/text.gif) | 47b51d0cf6dc61db8d53ec59b454c018.txt | 2013-08-12 16:56 | 60K | |
![[TXT]](/icons/text.gif) | 30179fb2e80c73d3fac99149050146bd.txt | 2013-08-12 16:56 | 60K | |
![[ ]](/icons/layout.gif) | Synthesis of DNA block copolymers with extended nucleic acid segments by enzymatic ligation: cut and paste large hybrid architectures.pdf | 2013-08-12 15:56 | 2.4M | |
![[TXT]](/icons/text.gif) | b6bedf5808ef2df82964d97aa34d456a.txt | 2013-08-12 02:45 | 242K | |
![[TXT]](/icons/text.gif) | f450b3be56ec8bf4a89e83d1c50d5d5a.txt | 2013-08-12 02:26 | 15K | |
![[TXT]](/icons/text.gif) | 1f7526be7b04806a4f1a40958b2a858e.txt | 2013-08-12 02:23 | 124K | |
![[TXT]](/icons/text.gif) | bdf80d948010ba7b55c10161abf8726f.txt | 2013-08-12 02:22 | 14K | |
![[ ]](/icons/layout.gif) | 94f35994e8521e858760fff49fcf925d.pdf | 2013-08-09 16:28 | 849K | |
![[ ]](/icons/layout.gif) | 7923b3a1efd5c07d3830d4a844850c75.pdf | 2013-08-08 09:11 | 152K | |
![[ ]](/icons/layout.gif) | 9c9eeacbe850042d120452c5348dab19.pdf | 2013-08-08 09:10 | 1.7M | |
![[TXT]](/icons/text.gif) | Social Composition of Workers' Councils in Yugoslavia.txt | 2013-08-07 16:35 | 22K | |
![[ ]](/icons/layout.gif) | Economic Growth and the Environment in Yugoslavia: An Overview.pdf | 2013-08-07 14:58 | 1.6M | |
![[TXT]](/icons/text.gif) | Financial Mechanism of Workers' Health Insurance in Yugoslavia.txt | 2013-08-07 10:44 | 22K | |
![[TXT]](/icons/text.gif) | ebe08ce0383c962fdc0cb67b060febcc.txt | 2013-08-07 10:43 | 2.4K | |
![[TXT]](/icons/text.gif) | 5825bbf758f555353c6f246e0a15b98c.txt | 2013-08-07 08:32 | 1.4K | |
![[TXT]](/icons/text.gif) | 3389688efed025a60657600e88ba567.txt | 2013-08-06 14:39 | 27K | |
![[TXT]](/icons/text.gif) | 79e32ccbfb4a62674cd9396fc7e6ac61.txt | 2013-08-06 14:38 | 25K | |
![[ ]](/icons/layout.gif) | 44c12c90f608fde59b5c777c75f8a160.pdf | 2013-08-06 14:34 | 2.4M | |
![[TXT]](/icons/text.gif) | 5f0d29aff3dd6e90628a3bae0da6ee2a.txt | 2013-08-06 04:35 | 37K | |
![[TXT]](/icons/text.gif) | dff05cc86554a2dd3b4e9277f7319f36.txt | 2013-08-05 10:09 | 44K | |
![[TXT]](/icons/text.gif) | 5219a56a9bf86b0cb968ee9a1446fb3c.txt | 2013-08-04 20:35 | 30K | |
![[TXT]](/icons/text.gif) | de98b98ecf345e151708f5ff2acf665f.txt | 2013-08-04 20:05 | 30K | |
![[TXT]](/icons/text.gif) | aacc7cccb6391222ad44a0211683f702.txt | 2013-08-04 20:05 | 30K | |
![[ ]](/icons/layout.gif) | 4ab0990b1ffac0aa64927ad6c6726c7a.pdf | 2013-08-02 22:35 | 593K | |
![[ ]](/icons/layout.gif) | Cell-free protein synthesis from a single copy of DNA in a glass microchamber.pdf | 2013-08-02 15:18 | 2.0M | |
![[TXT]](/icons/text.gif) | 7369fbc40db2a3116e7662a232a7e7f2.txt | 2013-08-01 12:09 | 45K | |
![[TXT]](/icons/text.gif) | 3112c1a5149c838317f628c07a9f4a65.txt | 2013-08-01 12:08 | 3.7K | |
![[ ]](/icons/layout.gif) | 850265422ac5c48f2211d2cd30824e56.pdf | 2013-08-01 11:51 | 2.2M | |
![[TXT]](/icons/text.gif) | f23d29abff1a2a4e8fa6e9ac62cf0b52.txt | 2013-08-01 11:37 | 16K | |
![[ ]](/icons/layout.gif) | 571b33936490a4151ef357dad522bd70.pdf | 2013-08-01 08:35 | 2.1M | |
![[ ]](/icons/layout.gif) | ff57e0b7c61bc365f27c3b3152e2c474.pdf | 2013-08-01 02:28 | 2.1M | |
![[TXT]](/icons/text.gif) | Life-cycle economic analysis of distributed manufacturing with open-source 3-D printers.txt | 2013-08-01 00:15 | 18K | |
![[TXT]](/icons/text.gif) | c0c998c8aa37db694f645fe45d279eb5.txt | 2013-07-31 13:46 | 312K | |
![[TXT]](/icons/text.gif) | 40afa26e37bd4c84832b39081d77f3.txt | 2013-07-31 13:40 | 68K | |
![[ ]](/icons/layout.gif) | Wind driven capillary-gravity waves on Titan’s lakes: Hard to detect or non-existent?.pdf | 2013-07-31 12:44 | 729K | |
![[ ]](/icons/layout.gif) | 9acd94ee51b80b9976d2f2b2b628ddbb.pdf | 2013-07-31 09:09 | 3.2M | |
![[TXT]](/icons/text.gif) | bb54f17b677390c0d88957494619ec07.txt | 2013-07-31 09:09 | 39K | |
![[TXT]](/icons/text.gif) | e45c56d52597576c01faacf2b4547f9a.txt | 2013-07-31 09:08 | 39K | |
![[TXT]](/icons/text.gif) | e9eb5d37c5f27d3bad573d501275a8ff.txt | 2013-07-30 18:45 | 34K | |
![[TXT]](/icons/text.gif) | a6e07d0cd2ae0c2631f550be1445771d.txt | 2013-07-30 18:43 | 33K | |
![[TXT]](/icons/text.gif) | Deoxynucleoside phosphoramidites—A new class of key intermediates for deoxypolynucleotide synthesis.txt | 2013-07-30 17:47 | 18K | |
![[TXT]](/icons/text.gif) | Synthesis of deoxyoligonucleotides on a polymer support.txt | 2013-07-30 17:47 | 99K | |
![[TXT]](/icons/text.gif) | 3351595cb30b257969233e8becdac3f4.txt | 2013-07-30 15:19 | 3.7K | |
![[ ]](/icons/layout.gif) | 5b45d6cc5d53f6f01e05b87b10d085cd.pdf | 2013-07-30 14:52 | 1.0M | |
![[ ]](/icons/layout.gif) | 1bd2eb0f722ac5d52a9403c857c1a1e5.pdf | 2013-07-30 12:39 | 546K | |
![[ ]](/icons/layout.gif) | ccde309e4a2a34c5d30049b7cd60e03f.pdf | 2013-07-29 06:30 | 661K | |
![[TXT]](/icons/text.gif) | 86fd8fcb7361838d697d99c37257034d.txt | 2013-07-27 19:21 | 62K | |
![[TXT]](/icons/text.gif) | db47ddaaa23624e5597bac82b6622864.txt | 2013-07-27 19:21 | 62K | |
![[TXT]](/icons/text.gif) | 11c3dd4254ada964207578912fc880a6.txt | 2013-07-27 18:36 | 37K | |
![[TXT]](/icons/text.gif) | bd3371bca2ab3881b095dce21ed0794b.txt | 2013-07-27 18:36 | 37K | |
![[TXT]](/icons/text.gif) | a72203bcdcfbae285b9e6316ddb120ee.txt | 2013-07-27 18:31 | 121K | |
![[TXT]](/icons/text.gif) | 9ee9e7be4b5301c1a8dcd7278c551fa6.txt | 2013-07-27 18:31 | 21K | |
![[TXT]](/icons/text.gif) | f7a011ead01c19dec33799ddb9e426fb.txt | 2013-07-27 18:31 | 21K | |
![[TXT]](/icons/text.gif) | f8e1177cfc25ba4bfe6666e3be072db5.txt | 2013-07-27 18:02 | 78K | |
![[TXT]](/icons/text.gif) | b4e9e617692a66181f0cd843c92205b7.txt | 2013-07-27 18:02 | 78K | |
![[TXT]](/icons/text.gif) | bc6bd8b32d7f862b97b8e3e593c49fdc.txt | 2013-07-27 18:02 | 78K | |
![[TXT]](/icons/text.gif) | 5a2c996c5b6c05812cfc0b6b14b058b0.txt | 2013-07-27 18:01 | 78K | |
![[ ]](/icons/layout.gif) | Bottlenose dolphins can use learned vocal labels to address each other.pdf | 2013-07-26 23:22 | 425K | |
![[TXT]](/icons/text.gif) | 2b2d685ea38ccdc07891392ddc92a3b1.txt | 2013-07-25 08:35 | 17K | |
![[TXT]](/icons/text.gif) | d667ac15470bf17b143ddce669e51698.txt | 2013-07-24 15:10 | 62K | |
![[TXT]](/icons/text.gif) | 8784c833035947f3016aac79783723c8.txt | 2013-07-24 15:06 | 2.4K | |
![[TXT]](/icons/text.gif) | c906603e2d65db4a9e1a924b573ba038.txt | 2013-07-24 15:06 | 2.4K | |
![[ ]](/icons/layout.gif) | The Effect of HCl Hydrolysis on the Retention of Thymidine in DNA.pdf | 2013-07-23 00:57 | 734K | |
![[ ]](/icons/layout.gif) | eee14f15f8adb3169ae849f914dcf.pdf | 2013-07-21 18:50 | 346K | |
![[TXT]](/icons/text.gif) | a80db069720d9af9e1b1b7d69a51afe3.txt | 2013-07-21 08:14 | 189K | |
![[TXT]](/icons/text.gif) | e67c19d754fdfa76ea0777cb3d1ec7f1.txt | 2013-07-21 08:13 | 189K | |
![[TXT]](/icons/text.gif) | 81205fbbdff207991348b0e05b0357ce.txt | 2013-07-19 21:23 | 22K | |
![[ ]](/icons/layout.gif) | a26cc1696b8a05dcf05d1e2216c83c28.pdf | 2013-07-19 17:25 | 4.4M | |
![[TXT]](/icons/text.gif) | 662aa437bf333815052cc62297572b70.txt | 2013-07-19 17:21 | 61K | |
![[TXT]](/icons/text.gif) | High cell density cultivation of .txt | 2013-07-19 15:13 | 18K | |
![[TXT]](/icons/text.gif) | 77e98345598b982e4d235dc998dfd331.txt | 2013-07-18 08:45 | 48K | |
![[ ]](/icons/layout.gif) | bf8c3ca85d1c480e0b9538335daff5cf.pdf | 2013-07-17 19:05 | 1.3M | |
![[ ]](/icons/layout.gif) | 25aa007a093cd69bbf070e6db9603c3a.pdf | 2013-07-17 19:04 | 1.7M | |
![[ ]](/icons/layout.gif) | A generative, probabilistic model of local protein structure.pdf | 2013-07-17 13:53 | 5.3M | |
![[TXT]](/icons/text.gif) | 6f9d24e003e5ef78c94eaf05a1337f32.txt | 2013-07-17 08:33 | 39K | |
![[TXT]](/icons/text.gif) | 3c5d1933de56e1afea6f9029ce2ab2b.txt | 2013-07-17 08:32 | 14K | |
![[TXT]](/icons/text.gif) | Chapter 3 – Myosin Regulation and Assembly.txt | 2013-07-17 08:32 | 18K | |
![[TXT]](/icons/text.gif) | b269e17b46c3123f97a1cf376c3b834f.txt | 2013-07-17 08:28 | 14K | |
![[TXT]](/icons/text.gif) | cd84c869a565df43ea8b81968106f4aa.txt | 2013-07-17 08:28 | 14K | |
![[TXT]](/icons/text.gif) | c8e2c51bf64243723d6e791d9ad3bc82.txt | 2013-07-17 08:28 | 14K | |
![[TXT]](/icons/text.gif) | c407d13ce7bbbe0a8bb2e0879bde389f.txt | 2013-07-17 08:27 | 14K | |
![[TXT]](/icons/text.gif) | 7a2e8303fa0d454c35b975aa009d2af5.txt | 2013-07-17 08:26 | 14K | |
![[TXT]](/icons/text.gif) | 181df9e30698e491b1e2f24cc14d8a03.txt | 2013-07-17 08:26 | 14K | |
![[TXT]](/icons/text.gif) | fa155783aeb54a334c4e43f2bbeb02c.txt | 2013-07-17 08:24 | 4.2K | |
![[TXT]](/icons/text.gif) | 71758aa9e5ead1a6c1e16e8193fe6018.txt | 2013-07-17 08:24 | 4.5K | |
![[TXT]](/icons/text.gif) | 61801a88718052a1bd278f4446ed3f51.txt | 2013-07-17 08:24 | 35K | |
![[ ]](/icons/layout.gif) | BigBrain: An Ultrahigh-Resolution 3D Human Brain Model.pdf | 2013-07-17 06:57 | 5.0M | |
![[TXT]](/icons/text.gif) | 547eb71fe202382044cedd701310228c.txt | 2013-07-16 19:50 | 2.4K | |
![[TXT]](/icons/text.gif) | 50a86f92583e8128b3d9361e58b1608b.txt | 2013-07-16 06:53 | 435K | |
![[TXT]](/icons/text.gif) | 5d8ef27e47939e2d102bc60dd2fa5cfa.txt | 2013-07-16 00:51 | 26K | |
![[TXT]](/icons/text.gif) | d22631341873c7fcd9c1452db2edda78.txt | 2013-07-15 12:58 | 34K | |
![[TXT]](/icons/text.gif) | 7263f4371672b3a00ea4c498291f2b06.txt | 2013-07-15 12:55 | 96K | |
![[TXT]](/icons/text.gif) | a55a124e9cfb087851e9e6583812a7e5.txt | 2013-07-15 12:50 | 96K | |
![[TXT]](/icons/text.gif) | Failure of limb segments in the blue crab, .txt | 2013-07-15 11:20 | 18K | |
![[TXT]](/icons/text.gif) | ACCREDITATION OF FORENSIC SCIENCE LABORATORIES.txt | 2013-07-15 11:20 | 18K | |
![[ ]](/icons/layout.gif) | Testing the Core Empirical Implications of Gottfredson and Hirschi's General Theory of Crime.pdf | 2013-07-15 11:17 | 2.4M | |
![[ ]](/icons/layout.gif) | b134631849c979b1dc4826cdcc566a3.pdf | 2013-07-15 08:38 | 823K | |
![[ ]](/icons/layout.gif) | 9bcce475f227e82595e8d4ab184a2721.pdf | 2013-07-15 07:48 | 487K | |
![[ ]](/icons/layout.gif) | Neural Dust: An Ultrasonic, Low Power Solution for Chronic Brain-Machine Interfaces.pdf | 2013-07-15 07:06 | 1.8M | |
![[TXT]](/icons/text.gif) | Rare-earth beta-diketonates.txt | 2013-07-15 06:38 | 18K | |
![[ ]](/icons/layout.gif) | Late Cenozoic paleoclimates of the Gaap Escarpment, Kalahari margin, South Africa.pdf | 2013-07-15 06:37 | 2.7M | |
![[ ]](/icons/layout.gif) | Doublet state of resonantly coupled AlGaAs_GaAs quantum wells grown by metalorganic chemical vapor deposition.pdf | 2013-07-15 06:37 | 853K | |
![[TXT]](/icons/text.gif) | d7c73213d998ae83d4ec598f25a6b60d.txt | 2013-07-15 06:37 | 100K | |
![[TXT]](/icons/text.gif) | b039af4b25f009e70646573e493a34a.txt | 2013-07-15 06:37 | 100K | |
![[TXT]](/icons/text.gif) | 5b49117786dc7c97711b63a7ca5e1d13.txt | 2013-07-15 06:36 | 42K | |
![[TXT]](/icons/text.gif) | Formulation, identification and use of interface models in the numerical analysis of composite delamination.txt | 2013-07-15 06:36 | 18K | |
![[TXT]](/icons/text.gif) | f9c07cd7ca5c64f0427213b0c016141b.txt | 2013-07-15 06:36 | 42K | |
![[TXT]](/icons/text.gif) | 6438fd5937c800179649a0603621de6.txt | 2013-07-15 06:36 | 11K | |
![[TXT]](/icons/text.gif) | c369e2a445960ddace6fabeef1e49ed5.txt | 2013-07-15 06:36 | 11K | |
![[TXT]](/icons/text.gif) | 7023abfbfe69d40f0ba891fcd1e170f6.txt | 2013-07-14 11:36 | 128K | |
![[TXT]](/icons/text.gif) | 9577ce6ed7d8dff5835e7f6a975316cf.txt | 2013-07-14 08:57 | 27K | |
![[TXT]](/icons/text.gif) | fe5068f311d1bbccecc2230529341fc8.txt | 2013-07-14 08:55 | 27K | |
![[TXT]](/icons/text.gif) | ed2dfe3acb9a53a87407e07acccdea94.txt | 2013-07-14 07:52 | 18K | |
![[TXT]](/icons/text.gif) | 35584d400a5c25fa2c2f06b408bfc0b9.txt | 2013-07-14 07:30 | 45K | |
![[TXT]](/icons/text.gif) | 80f9a0c85c940bd1127d310c0842b746.txt | 2013-07-14 07:30 | 45K | |
![[TXT]](/icons/text.gif) | 50eac73c80e1259454ee2634861f6c9a.txt | 2013-07-13 20:41 | 30K | |
![[TXT]](/icons/text.gif) | 64c116e86d32475a84a10645dda155ae.txt | 2013-07-13 20:39 | 29K | |
![[TXT]](/icons/text.gif) | c747dbac02ab016cd4fe6e35ec1bef98.txt | 2013-07-13 10:45 | 12K | |
![[TXT]](/icons/text.gif) | 220fd1b6261faca24c59ab6fcf9d854c.txt | 2013-07-13 10:10 | 37K | |
![[TXT]](/icons/text.gif) | 420f792127d0be503c8ceb0080dc360.txt | 2013-07-13 09:07 | 37K | |
![[TXT]](/icons/text.gif) | 54ff06d9605b38fd96866cbc4a574aeb.txt | 2013-07-13 09:07 | 12K | |
![[TXT]](/icons/text.gif) | fee769f3dcf37c7a2be9131e7d4f91db.txt | 2013-07-12 18:01 | 26K | |
![[TXT]](/icons/text.gif) | 7a11707fd4ad805a650a612361f620dc.txt | 2013-07-12 18:00 | 102K | |
![[TXT]](/icons/text.gif) | 91f85af898636a16f12a15d58ac04a26.txt | 2013-07-12 16:17 | 37K | |
![[TXT]](/icons/text.gif) | 601b9de2f7e4047219847a408a84762a.txt | 2013-07-12 14:40 | 23K | |
![[TXT]](/icons/text.gif) | f9a0b645319b4621cad075a384aecfa4.txt | 2013-07-12 14:16 | 90K | |
![[TXT]](/icons/text.gif) | 7f2119dc93922d83f295caacd29bc94f.txt | 2013-07-12 14:16 | 90K | |
![[TXT]](/icons/text.gif) | 973c4afbd63f38dad1cb87710aea9fd9.txt | 2013-07-12 14:15 | 45K | |
![[TXT]](/icons/text.gif) | 9dab12d846cc5a0f412ccaef0dcf373b.txt | 2013-07-12 14:15 | 12K | |
![[TXT]](/icons/text.gif) | 8bc77532aae03fb23968fdcd63501610.txt | 2013-07-12 14:15 | 12K | |
![[TXT]](/icons/text.gif) | b4f50cb1251594b60526750b355e4110.txt | 2013-07-12 14:14 | 12K | |
![[TXT]](/icons/text.gif) | 3a56d7561c0811c420a0959a6f9ba50a.txt | 2013-07-12 14:14 | 12K | |
![[ ]](/icons/layout.gif) | Enhanced Remote Earthquake Triggering at Fluid-Injection Sites in the Midwestern United States.pdf | 2013-07-12 14:13 | 2.9M | |
![[TXT]](/icons/text.gif) | 662050d9b43ee92e35082719a3d044f2.txt | 2013-07-12 14:06 | 42K | |
![[TXT]](/icons/text.gif) | 51d59857dc6500e4db2188ea11a0626.txt | 2013-07-12 14:06 | 42K | |
![[TXT]](/icons/text.gif) | 15b6ae23a9a83e994db836f1f417357.txt | 2013-07-12 14:06 | 42K | |
![[ ]](/icons/layout.gif) | Risk of Internal Cancers from Arsenic in Drinking Water.pdf | 2013-07-12 13:46 | 1.1M | |
![[ ]](/icons/layout.gif) | Beer spoilage bacteria and hop resistance.pdf | 2013-07-12 13:28 | 369K | |
![[TXT]](/icons/text.gif) | 630ec17dc65527fe79416dbdeb36da74.txt | 2013-07-12 13:25 | 32K | |
![[TXT]](/icons/text.gif) | 3a9841561deeb22c1daa4aa80b88da90.txt | 2013-07-12 11:09 | 27K | |
![[TXT]](/icons/text.gif) | 8d8721f8a749306c7cdc9e628d350c0a.txt | 2013-07-12 07:20 | 14K | |
![[TXT]](/icons/text.gif) | b3b4b248a7009002ebf8149f547f887a.txt | 2013-07-12 07:20 | 14K | |
![[TXT]](/icons/text.gif) | 8d2df248cfffe3d6dce75e5dcf100653.txt | 2013-07-12 07:19 | 14K | |
![[TXT]](/icons/text.gif) | 4f637cc4ac1e609cc5a95a01bc34c4cb.txt | 2013-07-12 07:19 | 14K | |
![[TXT]](/icons/text.gif) | abb58bae2b32555245938a0b8f1460d0.txt | 2013-07-12 07:19 | 14K | |
![[TXT]](/icons/text.gif) | 34b012c536ece07b6f97d21f30e6162c.txt | 2013-07-12 07:19 | 83K | |
![[TXT]](/icons/text.gif) | 16c39918b0c36200966852a4a35fdac2.txt | 2013-07-11 22:27 | 4.2K | |
![[TXT]](/icons/text.gif) | 1629c7f6cdbe4c1d8c0c890b9b7fb121.txt | 2013-07-11 22:27 | 1.1K | |
![[TXT]](/icons/text.gif) | 20db1f425d0a3501d8202f6a26274389.txt | 2013-07-11 22:27 | 4.5K | |
![[TXT]](/icons/text.gif) | 343b540955ffaeec0c715a159c752fc4.txt | 2013-07-11 22:27 | 4.5K | |
![[TXT]](/icons/text.gif) | cbe27105a8280c6494640eb92dd382d2.txt | 2013-07-11 19:15 | 43K | |
![[TXT]](/icons/text.gif) | 6cc74119989a3b2eba38d74d29a6c426.txt | 2013-07-11 19:15 | 43K | |
![[TXT]](/icons/text.gif) | Use of Water-Soluble Ligands in Homogeneous Catalysis.txt | 2013-07-11 19:14 | 18K | |
![[TXT]](/icons/text.gif) | 667389e286be290b18368ad5596f0058.txt | 2013-07-11 19:13 | 43K | |
![[TXT]](/icons/text.gif) | a75c6d3e93bb7c59d9057fadfdfc4d07.txt | 2013-07-11 19:13 | 43K | |
![[TXT]](/icons/text.gif) | 3d0462e45b2cbad5e1f1be69eb528c64.txt | 2013-07-11 19:13 | 43K | |
![[TXT]](/icons/text.gif) | 9366a4cee010d70c5da545f3ea7411f4.txt | 2013-07-11 19:11 | 28K | |
![[TXT]](/icons/text.gif) | a7a9a12e7fe167c34cf561065802cf77.txt | 2013-07-11 12:14 | 18K | |
![[TXT]](/icons/text.gif) | [8] Electrophoresis in agarose and acrylamide gels.txt | 2013-07-11 12:12 | 18K | |
![[ ]](/icons/layout.gif) | 6caca47e4bd220d5e36c036f15ac5556.pdf | 2013-07-11 11:35 | 442K | |
![[TXT]](/icons/text.gif) | Producing more with less: Strategies and novel technologies for plant-based food biofortification.txt | 2013-07-11 11:33 | 18K | |
![[ ]](/icons/layout.gif) | 5555ba56a955075b676993cf3ce11a15.pdf | 2013-07-11 11:22 | 275K | |
![[TXT]](/icons/text.gif) | 1603dc53c317a0dfdb3047676bfc286b.txt | 2013-07-11 10:43 | 47K | |
![[TXT]](/icons/text.gif) | 91c3d129316ffd9de2d4dbb294c0a2c.txt | 2013-07-11 10:39 | 43K | |
![[TXT]](/icons/text.gif) | 9ccd2c72c9d14f1d5c2bb77c709c7643.txt | 2013-07-11 10:34 | 43K | |
![[TXT]](/icons/text.gif) | b3a4ec8720e192717fb041858ea4f204.txt | 2013-07-11 10:33 | 14K | |
![[TXT]](/icons/text.gif) | d20d19987d3616217e88d6d91d54c218.txt | 2013-07-11 10:33 | 43K | |
![[ ]](/icons/layout.gif) | Sample preparation: a challenge in the development of point-of-care nucleic acid-based assays for resource-limited settings.pdf | 2013-07-11 10:25 | 327K | |
![[TXT]](/icons/text.gif) | 4657f48907dd927155ae6bf4e7bb88ad.txt | 2013-07-11 10:24 | 47K | |
![[TXT]](/icons/text.gif) | bcdd8ca4ab618cefd9bd371ce9559447.txt | 2013-07-11 07:43 | 2.4K | |
![[TXT]](/icons/text.gif) | 63df65bc8b071e3615dd3c68c2bd5e9d.txt | 2013-07-11 07:42 | 15K | |
![[TXT]](/icons/text.gif) | 1c8ebe97ddcf509c9f875d6542225d73.txt | 2013-07-11 07:42 | 15K | |
![[TXT]](/icons/text.gif) | ea7aa42f55876d5810a99af4235da37a.txt | 2013-07-10 23:05 | 38K | |
![[TXT]](/icons/text.gif) | 86a141120eaa05db8b4a1bcec246e91.txt | 2013-07-10 23:04 | 43K | |
![[TXT]](/icons/text.gif) | 35d966e146810b6d68ddd927e6d7b78b.txt | 2013-07-10 23:03 | 11K | |
![[TXT]](/icons/text.gif) | 14707697ffbeaedfc1623ac2a251c9ab.txt | 2013-07-10 23:03 | 11K | |
![[ ]](/icons/layout.gif) | Differential expression of endocannabinoid system in normal and preeclamptic placentas: Effects on nitric oxide synthesis.pdf | 2013-07-10 21:43 | 672K | |
![[ ]](/icons/layout.gif) | dfa11cf8c8ce1ec0a7a20a959de09bbb.pdf | 2013-07-10 20:21 | 49K | |
![[ ]](/icons/layout.gif) | 9ee85113c9581d6590808d8dcb4422b7.pdf | 2013-07-10 17:34 | 49K | |
![[ ]](/icons/layout.gif) | Sex matters: Neural correlates of voice gender perception.pdf | 2013-07-10 15:46 | 1.3M | |
![[TXT]](/icons/text.gif) | DNA transfer: Review and implications for casework.txt | 2013-07-10 15:25 | 18K | |
![[TXT]](/icons/text.gif) | 69d841a68a4b688479e9db43fa14ee94.txt | 2013-07-10 08:44 | 15K | |
![[TXT]](/icons/text.gif) | d2789840d310b125a6bbb8d28d17c44e.txt | 2013-07-10 08:43 | 15K | |
![[TXT]](/icons/text.gif) | Molecular Simplification of 1,4-Diazabicyclo[4.3.0]nonan-9-ones Gives Piperazine Derivatives That Maintain High Nootropic Activity.txt | 2013-07-10 08:41 | 99K | |
![[TXT]](/icons/text.gif) | 3565711630325e18289711374fa63dd9.txt | 2013-07-10 08:24 | 12K | |
![[TXT]](/icons/text.gif) | b85ccd2540a838cabdc8ab73f2ccc8e.txt | 2013-07-10 06:40 | 43K | |
![[TXT]](/icons/text.gif) | ef3f85837a395ba866df1dcb280a7aa7.txt | 2013-07-10 06:38 | 12K | |
![[TXT]](/icons/text.gif) | 8147222a77134da9cd5e76037fb0ada5.txt | 2013-07-10 06:38 | 27K | |
![[TXT]](/icons/text.gif) | 1ae94f327cd458102e73b95b9d029f20.txt | 2013-07-10 06:36 | 136K | |
![[TXT]](/icons/text.gif) | 82fc3aa0099ad8ca49b1ec0cf01f0e32.txt | 2013-07-10 06:32 | 51K | |
![[TXT]](/icons/text.gif) | ae29bade48b53c0eabc12372785f62f3.txt | 2013-07-10 06:32 | 51K | |
![[TXT]](/icons/text.gif) | afd2c875ea0651247a22e965d71e8bdb.txt | 2013-07-10 06:31 | 51K | |
![[TXT]](/icons/text.gif) | 2224a68a4be9fc70841a972b286e0efb.txt | 2013-07-10 06:31 | 51K | |
![[TXT]](/icons/text.gif) | f089abf1a839f8ac13066207a9c6c72f.txt | 2013-07-10 06:31 | 51K | |
![[TXT]](/icons/text.gif) | 268ae2e0d4beb7f97f0beff2341674a2.txt | 2013-07-10 06:31 | 51K | |
![[TXT]](/icons/text.gif) | f6505b87d228c64fe1a6d77e93ea7d48.txt | 2013-07-10 06:29 | 15K | |
![[TXT]](/icons/text.gif) | 8ea2036d2439216c12c231604baaccbf.txt | 2013-07-10 06:29 | 15K | |
![[TXT]](/icons/text.gif) | 58d7ec46fc214f6875dec952b6aea8a7.txt | 2013-07-10 06:27 | 18K | |
![[TXT]](/icons/text.gif) | 9bcf1527a0a347e83d968f891c46f95e.txt | 2013-07-10 06:25 | 43K | |
![[TXT]](/icons/text.gif) | 2c1fe54ca61bcdafddf62d4da1ee260e.txt | 2013-07-10 06:25 | 43K | |
![[TXT]](/icons/text.gif) | Hepatoprotective properties of kombucha tea against TBHP-induced oxidative stress via suppression of mitochondria dependent apoptosis.txt | 2013-07-09 23:33 | 18K | |
![[TXT]](/icons/text.gif) | 12b8b3cca768bdf1603614e98ea63c89.txt | 2013-07-09 22:00 | 34K | |
![[TXT]](/icons/text.gif) | 95bce4b5c55e6300b0c0ad704d7595b2.txt | 2013-07-09 19:52 | 211 | |
![[ ]](/icons/layout.gif) | A transparent hybrid of nanocrystalline cellulose and amorphous calcium carbonate nanoparticles.pdf | 2013-07-09 17:16 | 261K | |
![[TXT]](/icons/text.gif) | c0555f26f83ecd8917d5bba5033c2573.txt | 2013-07-09 17:03 | 26K | |
![[TXT]](/icons/text.gif) | 4d9136b2bb2f26c4a18548c10b5eb038.txt | 2013-07-09 17:02 | 26K | |
![[TXT]](/icons/text.gif) | 86044337be1e5e9bce00721efadb37f.txt | 2013-07-09 16:57 | 26K | |
![[TXT]](/icons/text.gif) | 94ce282a770daf9b4e35f102e59ee9fc.txt | 2013-07-09 16:50 | 26K | |
![[TXT]](/icons/text.gif) | 3ce4a16a38e90ef279226e3891e60b6c.txt | 2013-07-09 16:30 | 28K | |
![[TXT]](/icons/text.gif) | TCDD induces the expression of insulin-like growth factor binding protein 4 in 5L rat hepatoma cells: A cautionary tale of the use of this cell line in studies on dioxin toxicity.txt | 2013-07-09 16:28 | 18K | |
![[TXT]](/icons/text.gif) | c8328aa2523227ef12dd4a705e2c4181.txt | 2013-07-09 16:27 | 189 | |
![[TXT]](/icons/text.gif) | 441a1cb67c6dcd6ac02b9ccb856b747.txt | 2013-07-09 16:27 | 33K | |
![[ ]](/icons/layout.gif) | c4463f189a9e378a9042287dc41f38a9.pdf | 2013-07-09 16:14 | 158K | |
![[ ]](/icons/layout.gif) | edf35ef128ca6b53d7191e959fea670a.pdf | 2013-07-09 15:24 | 158K | |
![[TXT]](/icons/text.gif) | 1cb0fc2d0e0b9a87193ff88dc987079e.txt | 2013-07-09 15:24 | 47K | |
![[TXT]](/icons/text.gif) | 482c641fd330c095efcb51bde92c6b86.txt | 2013-07-09 15:23 | 47K | |
![[TXT]](/icons/text.gif) | 1ca2a8362b5011d6f7992944b57c5ec0.txt | 2013-07-09 12:06 | 2.4K | |
![[TXT]](/icons/text.gif) | cf0889c6cc3ec17c25711ea125ab59d7.txt | 2013-07-09 12:05 | 175K | |
![[TXT]](/icons/text.gif) | b88609e2ad39320d93487862071ae39f.txt | 2013-07-09 12:03 | 51K | |
![[TXT]](/icons/text.gif) | a746904ff8641c01eae81f7433aa3f49.txt | 2013-07-09 12:03 | 36K | |
![[TXT]](/icons/text.gif) | a328583c309d9858578c8040bf287969.txt | 2013-07-09 12:02 | 36K | |
![[TXT]](/icons/text.gif) | 7560bff5c58cfef009801dae0ff975c3.txt | 2013-07-09 11:59 | 55K | |
![[TXT]](/icons/text.gif) | 5051120e676346aa345107ba1bd61662.txt | 2013-07-09 11:56 | 13K | |
![[TXT]](/icons/text.gif) | 9a5d38d92897ccabee2aeec893171cf3.txt | 2013-07-09 11:55 | 13K | |
![[ ]](/icons/layout.gif) | Patents as Signals for Startup Financing.pdf | 2013-07-09 11:51 | 400K | |
![[TXT]](/icons/text.gif) | 4c3e252766668330bd2fc39c43e74864.txt | 2013-07-09 11:50 | 25K | |
![[ ]](/icons/layout.gif) | 9fb2113d9b2f8019cd51d3daa0c6df07.pdf | 2013-07-09 10:40 | 357K | |
![[ ]](/icons/layout.gif) | c617fec2dede5dd9353df5dc12e465d9.pdf | 2013-07-09 10:40 | 357K | |
![[ ]](/icons/layout.gif) | 49cc12e04f93a5e3e5b020a175917847.pdf | 2013-07-09 10:40 | 357K | |
![[ ]](/icons/layout.gif) | 8f5cf5a1508a21d04cd69e6d70dac8be.pdf | 2013-07-09 10:28 | 357K | |
![[ ]](/icons/layout.gif) | 87e0ca2973c247fad735f2f21578e8e9.pdf | 2013-07-09 10:27 | 357K | |
![[TXT]](/icons/text.gif) | b8f5510ef7aee90286cf607942ec950b.txt | 2013-07-09 10:27 | 242 | |
![[TXT]](/icons/text.gif) | 4d3d343b685188ce50520c7f0474d807.txt | 2013-07-09 10:26 | 13K | |
![[TXT]](/icons/text.gif) | 393162fb4336f452025551ddd52de274.txt | 2013-07-09 08:17 | 5.6K | |
![[TXT]](/icons/text.gif) | 218baa64633d8a2030d1caac8014b8e6.txt | 2013-07-09 08:17 | 71K | |
![[TXT]](/icons/text.gif) | 4e1df72e21065d4cc71da3f92e05091d.txt | 2013-07-09 03:38 | 60K | |
![[TXT]](/icons/text.gif) | 8f928cf10937be452a341f7291a7ccf9.txt | 2013-07-09 00:01 | 5.7K | |
![[TXT]](/icons/text.gif) | a9d0939622a81088a01e6bc4dfef1bb3.txt | 2013-07-09 00:00 | 5.7K | |
![[TXT]](/icons/text.gif) | 3d0730e07f5b3cff3547f72e2f6ef286.txt | 2013-07-08 23:53 | 5.8K | |
![[ ]](/icons/layout.gif) | Vitamin B12 Sources and Bioavailability.pdf | 2013-07-08 20:29 | 153K | |
![[ ]](/icons/layout.gif) | Two new species of swallowerfishes of the genera Chiasmodon and Kali (Chiasmodontidae).pdf | 2013-07-08 11:07 | 926K | |
![[TXT]](/icons/text.gif) | d5b703d8944cd1231724cc18771eb4f9.txt | 2013-07-08 11:07 | 14K | |
![[ ]](/icons/layout.gif) | Biclustering in data mining.pdf | 2013-07-08 11:06 | 777K | |
![[TXT]](/icons/text.gif) | e62d9d3407a1ff8d3dbd7843b0c3a414.txt | 2013-07-08 11:06 | 37K | |
![[TXT]](/icons/text.gif) | 5d642e6c5f0cd6daa587e939abf95f60.txt | 2013-07-08 11:06 | 18K | |
![[TXT]](/icons/text.gif) | 68437e312173c7ebc476acc1997b7b5c.txt | 2013-07-08 11:05 | 30K | |
![[ ]](/icons/layout.gif) | Not All Sequence Tags Are Created Equal: Designing and Validating Sequence Identification Tags Robust to Indels.pdf | 2013-07-08 11:01 | 669K | |
![[TXT]](/icons/text.gif) | 21dcbce8ae4bc78b90edde5e1d595fd2.txt | 2013-07-08 11:00 | 18K | |
![[ ]](/icons/layout.gif) | c97f79cd31d2c5d35e094413133b4b55.pdf | 2013-07-07 17:20 | 783K | |
![[ ]](/icons/layout.gif) | Successful Serial Recloning in the Mouse over Multiple Generations.pdf | 2013-07-07 13:21 | 57K | |
![[TXT]](/icons/text.gif) | 83363ace6f598ab159ceb582a1bb113f.txt | 2013-07-07 13:09 | 9.4K | |
![[TXT]](/icons/text.gif) | d82a313f7160131094aeb0c5523a25b2.txt | 2013-07-07 13:08 | 9.4K | |
![[TXT]](/icons/text.gif) | 3ef38066405d1c72ff6cd8f06b2de351.txt | 2013-07-07 13:08 | 8.1K | |
![[TXT]](/icons/text.gif) | fe23b0d0f665e754800254aa84ba16e4.txt | 2013-07-07 13:08 | 5.3K | |
![[TXT]](/icons/text.gif) | a8970eb43736a26b720fc798690925d9.txt | 2013-07-07 13:08 | 5.4K | |
![[TXT]](/icons/text.gif) | 291ab05fc61b1d1dc512f6438b20d8bd.txt | 2013-07-07 13:08 | 5.6K | |
![[TXT]](/icons/text.gif) | 760b2c0f0058b8ffe27c8e80a9539635.txt | 2013-07-07 13:08 | 6.7K | |
![[TXT]](/icons/text.gif) | 5c292952c781674a5fd387d4412eb640.txt | 2013-07-07 13:07 | 738 | |
![[TXT]](/icons/text.gif) | 6c7cc49964f6e79205cbef94d7420c51.txt | 2013-07-07 10:28 | 68K | |
![[TXT]](/icons/text.gif) | 899a13056137959f9a2264f72f617c86.txt | 2013-07-07 10:07 | 68K | |
![[TXT]](/icons/text.gif) | 189b1380d6aa46f29b630a7196ae0357.txt | 2013-07-06 11:22 | 19K | |
![[TXT]](/icons/text.gif) | d95dac9d40a304758f99f367735bf1c3.txt | 2013-07-06 11:09 | 4.8K | |
![[TXT]](/icons/text.gif) | 51663d713b71dffeed05b77c6f17e1f6.txt | 2013-07-06 10:50 | 80K | |
![[ ]](/icons/layout.gif) | c6821dc147936475bd1572efa30f5f81.pdf | 2013-07-06 10:30 | 454K | |
![[TXT]](/icons/text.gif) | a156fbffba257d05f61c01773ec0db5e.txt | 2013-07-06 10:29 | 104K | |
![[TXT]](/icons/text.gif) | ce6bb6e1bebd4f7cb33d0232f525d76b.txt | 2013-07-06 10:28 | 104K | |
![[TXT]](/icons/text.gif) | 6303c7e4b164f359ae7adce4642858a6.txt | 2013-07-06 09:41 | 106K | |
![[TXT]](/icons/text.gif) | 934ea7423765719dddd0e84c7c2aa862.txt | 2013-07-05 20:19 | 66K | |
![[TXT]](/icons/text.gif) | 6df237bb499cb3acf77295a63572148.txt | 2013-07-05 20:18 | 66K | |
![[ ]](/icons/layout.gif) | 4a3de4bdd42249c195a96c58c82367a5.pdf | 2013-07-05 20:15 | 2.5M | |
![[TXT]](/icons/text.gif) | Complex Archimedean Tiling Self-Assembled from DNA Nanostructures.txt | 2013-07-05 19:45 | 87K | |
![[ ]](/icons/layout.gif) | The effect of dust accumulation on line-focus parabolic trough solar collector performance.pdf | 2013-07-05 14:52 | 564K | |
![[TXT]](/icons/text.gif) | 5759d158dbcc62baf0d97638a820a7dd.txt | 2013-07-05 14:03 | 773 | |
![[TXT]](/icons/text.gif) | b734138e8dc743f1660b89eaf5a7a9e7.txt | 2013-07-05 14:02 | 13K | |
![[TXT]](/icons/text.gif) | A Novel Fluorescent Probe: Europium Complex Hybridized T7 Phage.txt | 2013-07-05 13:37 | 93K | |
![[TXT]](/icons/text.gif) | Ethidium bromide: Destruction and decontamination of solutions .txt | 2013-07-05 09:14 | 18K | |
![[ ]](/icons/layout.gif) | In Vitro Effects of Dichloroacetate and CO2 on Hypoxic HeLa Cells.pdf | 2013-07-05 08:51 | 252K | |
![[TXT]](/icons/text.gif) | Bacterial Cell Division: The Mechanism and Its Precison.txt | 2013-07-05 01:13 | 18K | |
![[TXT]](/icons/text.gif) | 8a3b99087469cb09af4a269a5c7e6ba1.txt | 2013-07-04 19:26 | 30K | |
![[TXT]](/icons/text.gif) | An economic “power supply” using a diode for agarose and polyacrylamide gel electrophoresis .txt | 2013-07-04 16:05 | 18K | |
![[TXT]](/icons/text.gif) | ecc51d4c287f60c5facbe4210422b62f.txt | 2013-07-04 16:04 | 69K | |
![[TXT]](/icons/text.gif) | ARTHUR H. THOMAS COMPANY.txt | 2013-07-04 15:50 | 83K | |
![[TXT]](/icons/text.gif) | ca53351db64a6a6c67478f665e69e875.txt | 2013-07-04 15:42 | 51K | |
![[ ]](/icons/layout.gif) | Cell therapy fights leukaemia.pdf | 2013-07-04 03:03 | 0 | |
![[ ]](/icons/layout.gif) | a7edf499d3f3551e519904d5c2561d9.pdf | 2013-07-03 17:25 | 1.2M | |
![[ ]](/icons/layout.gif) | Converting steady laminar flow to oscillatory flow through a hydroelasticity approach at microscales.pdf | 2013-07-03 16:37 | 295K | |
![[ ]](/icons/layout.gif) | Nuclear energy: Thorium fuel has risks.pdf | 2013-07-03 09:19 | 1.1M | |
![[ ]](/icons/layout.gif) | b15aa335bb7be028b24757b21d4efe33.pdf | 2013-07-02 23:26 | 1.2M | |
![[TXT]](/icons/text.gif) | d6bf4314aa10356701bbc9d4def39774.txt | 2013-07-02 23:23 | 35K | |
![[TXT]](/icons/text.gif) | 8a72c68cef5e51ac07e4bcffccce4b44.txt | 2013-07-02 23:22 | 39K | |
![[ ]](/icons/layout.gif) | a5e9fa2a7db16690a87bfcfcca66db31.pdf | 2013-07-02 23:07 | 364K | |
![[TXT]](/icons/text.gif) | b8435a6877fa587c45d8c700aa10b471.txt | 2013-07-02 23:01 | 30K | |
![[TXT]](/icons/text.gif) | User Authentication.txt | 2013-07-02 17:48 | 14K | |
![[TXT]](/icons/text.gif) | Ablative Laser Propulsion: A Study of Specific Impulse, Thrust and Efficiency.txt | 2013-07-02 17:48 | 14K | |
![[TXT]](/icons/text.gif) | dfa8eec7860d311a26224758562e0d10.txt | 2013-07-02 04:15 | 44K | |
![[TXT]](/icons/text.gif) | 9a4cf4bf851a85a22d956075bbb6c77c.txt | 2013-07-02 02:33 | 71K | |
![[ ]](/icons/layout.gif) | f2c5005dd99d30dd7f38e07214cb91b0.pdf | 2013-07-02 01:19 | 3.4M | |
![[ ]](/icons/layout.gif) | The .pdf | 2013-07-01 17:22 | 2.4M | |
![[ ]](/icons/layout.gif) | Intentional Self-Poisoning with Glyphosate-Containing Herbicides.pdf | 2013-07-01 16:47 | 369K | |
![[ ]](/icons/layout.gif) | Gut–brain axis: how the microbiome influences anxiety and depression.pdf | 2013-07-01 16:02 | 527K | |
![[TXT]](/icons/text.gif) | a7dddcea53e23525cd9dbc091e148b25.txt | 2013-07-01 15:59 | 436K | |
![[ ]](/icons/layout.gif) | 415590bdbe6e0de7597c822dd8cd7b89.pdf | 2013-07-01 15:10 | 1.8M | |
![[ ]](/icons/layout.gif) | 1caece4454fe9e92bb8c76ea2280488e.pdf | 2013-07-01 13:29 | 574K | |
![[TXT]](/icons/text.gif) | 4f8ebfa1429339ab106f10a9a559ad75.txt | 2013-07-01 12:27 | 14K | |
![[TXT]](/icons/text.gif) | MUSIC AND MATHEMATICS.txt | 2013-07-01 09:39 | 20K | |
![[TXT]](/icons/text.gif) | Complementary and alternative medicine in inflammatory bowel disease patients: Frequency and risk factors.txt | 2013-07-01 07:34 | 18K | |
![[ ]](/icons/layout.gif) | Therapy with the Opioid Antagonist Naltrexone Promotes Mucosal Healing in Active Crohns Disease: A Randomized Placebo-Controlled Trial.pdf | 2013-07-01 05:45 | 449K | |
![[TXT]](/icons/text.gif) | a3ecd1f90c3cf1e12d6bb3a7b97c987a.txt | 2013-06-30 14:26 | 11K | |
![[TXT]](/icons/text.gif) | b9c1e8988f4aba79fe3092d4145375ef.txt | 2013-06-30 14:22 | 19K | |
![[ ]](/icons/layout.gif) | Finding the Key to Happy Aging: A Day Reconstruction Study of Happiness.pdf | 2013-06-29 22:20 | 468K | |
![[ ]](/icons/layout.gif) | Hedonism and Happiness.pdf | 2013-06-29 22:12 | 107K | |
![[ ]](/icons/layout.gif) | Notions of Art-of-Living.pdf | 2013-06-29 22:10 | 51K | |
![[ ]](/icons/layout.gif) | Genetic and Environmental Influences on Optimism and its Relationship to Mental and Self-Rated Health: A Study of Aging Twins.pdf | 2013-06-29 21:53 | 239K | |
![[ ]](/icons/layout.gif) | Is life getting better? : how long and happy people live in modern society.pdf | 2013-06-29 21:45 | 511K | |
![[ ]](/icons/layout.gif) | Is happiness a trait?.pdf | 2013-06-29 21:34 | 3.2M | |
![[ ]](/icons/layout.gif) | The Four Qualities of Life.pdf | 2013-06-29 21:27 | 156K | |
![[ ]](/icons/layout.gif) | New publications.pdf | 2013-06-29 21:26 | 65K | |
![[ ]](/icons/layout.gif) | Is happiness relative?.pdf | 2013-06-29 21:25 | 1.5M | |
![[TXT]](/icons/text.gif) | c1d2d35cdd9e46bf6a4cb41e7ce6490f.txt | 2013-06-29 10:15 | 342 | |
![[TXT]](/icons/text.gif) | 5d24f834be2583ff6d8f5e2ff4bd1df3.txt | 2013-06-29 10:14 | 18K | |
![[TXT]](/icons/text.gif) | A call for institutional policies on postmortem sperm retrieval .txt | 2013-06-29 10:12 | 18K | |
![[TXT]](/icons/text.gif) | ba55cc39331d3d37d36c135ba23acef9.txt | 2013-06-29 10:12 | 2.5K | |
![[TXT]](/icons/text.gif) | addfea1ade7b8115e367f1ee01c15f2f.txt | 2013-06-29 10:10 | 83K | |
![[ ]](/icons/layout.gif) | 4691c9a16b557e8070591f7bbb645423.pdf | 2013-06-29 10:08 | 107K | |
![[ ]](/icons/layout.gif) | Elastic energy storage in the shoulder and the evolution of high-speed throwing in Homo.pdf | 2013-06-28 10:49 | 586K | |
![[TXT]](/icons/text.gif) | 50697f433151597b8cdd2d1db6371a8c.txt | 2013-06-27 09:53 | 35K | |
![[ ]](/icons/layout.gif) | Recalibrating Equus evolution using the genome sequence of an early Middle Pleistocene horse.pdf | 2013-06-26 22:31 | 5.2M | |
![[ ]](/icons/layout.gif) | Metagenomics, biotechnology with non-culturable microbes.pdf | 2013-06-26 21:51 | 218K | |
![[ ]](/icons/layout.gif) | The role of behaviour in adaptive morphological evolution of African proboscideans.pdf | 2013-06-26 21:15 | 352K | |
![[TXT]](/icons/text.gif) | d5c0de2fd5fb19c23713c6bd6b4ec6.txt | 2013-06-24 22:05 | 99K | |
![[ ]](/icons/layout.gif) | Failure of Calibration is Typical.pdf | 2013-06-24 12:31 | 91K | |
![[TXT]](/icons/text.gif) | a375dff30f61d2121895cc04e927557a.txt | 2013-06-24 00:47 | 14K | |
![[ ]](/icons/layout.gif) | The Interpretation of Quantum Mechanics: Many Worlds or Many Words?.pdf | 2013-06-23 22:42 | 136K | |
![[TXT]](/icons/text.gif) | 3bb91dd25db172ec9a27c4a9b9a686d1.txt | 2013-06-23 16:19 | 18K | |
![[TXT]](/icons/text.gif) | b17102207821e55eeebd09a54261226e.txt | 2013-06-20 19:37 | 11K | |
![[TXT]](/icons/text.gif) | 77f43e891631c290a1edf24a2a86d70f.txt | 2013-06-20 19:37 | 11K | |
![[TXT]](/icons/text.gif) | Attachment of drugs to polyethylene glycols.txt | 2013-06-20 19:36 | 18K | |
![[ ]](/icons/layout.gif) | Three-dimensional deep sub-diffraction optical beam lithography with 9 nm feature size.pdf | 2013-06-20 19:32 | 1.3M | |
![[ ]](/icons/layout.gif) | Gait Speed and Survival in Older Adults.pdf | 2013-06-20 08:04 | 302K | |
![[ ]](/icons/layout.gif) | Synthesis of MSnO.pdf | 2013-06-20 02:02 | 842K | |
![[TXT]](/icons/text.gif) | abfeed02f31e7a738087597e6ae06b25.txt | 2013-06-20 02:01 | 66K | |
![[TXT]](/icons/text.gif) | ed910b743a09a492c799d3bc8675bf06.txt | 2013-06-19 23:24 | 34K | |
![[ ]](/icons/layout.gif) | The Role of Emotions in Contributors Activity: A Case Study on the GENTOO Community.pdf | 2013-06-19 03:52 | 1.7M | |
![[TXT]](/icons/text.gif) | Evidence of decreasing mineral density in wheat grain over the last 160 years.txt | 2013-06-18 22:38 | 18K | |
![[TXT]](/icons/text.gif) | 14609985a8e47b51ad6463e4dd510edc.txt | 2013-06-18 14:32 | 8.1K | |
![[TXT]](/icons/text.gif) | 5260481073ab2879b68a57df3179f613.txt | 2013-06-17 17:59 | 16K | |
![[TXT]](/icons/text.gif) | d61afbed64d1576f1f25573bc9d0357a.txt | 2013-06-17 06:04 | 83K | |
![[TXT]](/icons/text.gif) | b3066898f6843a13b194f29b054d383a.txt | 2013-06-17 06:03 | 89K | |
![[ ]](/icons/layout.gif) | dd97fe11501cbc6357c4229d0492a2a7.pdf | 2013-06-17 03:28 | 1.4M | |
![[TXT]](/icons/text.gif) | c7b04c8793242b588c6c4ad4d53dbc38.txt | 2013-06-17 03:28 | 486 | |
![[TXT]](/icons/text.gif) | e74ab8b00feb039a27543a24dc480a60.txt | 2013-06-17 03:27 | 486 | |
![[TXT]](/icons/text.gif) | 615d317f05652067eabcc818dd3f75df.txt | 2013-06-17 03:27 | 1.2K | |
![[TXT]](/icons/text.gif) | dda1c1348af6922da098b5058477daf2.txt | 2013-06-17 03:26 | 1.2K | |
![[TXT]](/icons/text.gif) | 4dcd6cdcf64c6226d843a8023a4d6d01.txt | 2013-06-17 03:24 | 73K | |
![[ ]](/icons/layout.gif) | Spirituality and health: Whats the evidence and whats needed?.pdf | 2013-06-16 10:21 | 133K | |
![[TXT]](/icons/text.gif) | e56ed0d654564c5c5be68aeef35e65a5.txt | 2013-06-15 14:04 | 87K | |
![[TXT]](/icons/text.gif) | 1034a008836d1192473c3d543f177bd3.txt | 2013-06-15 00:09 | 10K | |
![[ ]](/icons/layout.gif) | Electrode Positioning and Montage in Transcranial Direct Current Stimulation.pdf | 2013-06-14 12:57 | 617K | |
![[ ]](/icons/layout.gif) | Locomotion dynamics of hunting in wild cheetahs.pdf | 2013-06-13 09:05 | 3.4M | |
![[TXT]](/icons/text.gif) | 16063060f3cd759b8eefa62b4f1070cd.txt | 2013-06-13 05:36 | 75K | |
![[ ]](/icons/layout.gif) | Laser Scribing of High-Performance and Flexible Graphene-Based Electrochemical Capacitors.pdf | 2013-06-13 03:15 | 1.1M | |
![[ ]](/icons/layout.gif) | Distributed cortical adaptation during learning of a braincomputer interface task.pdf | 2013-06-13 00:19 | 1.6M | |
![[TXT]](/icons/text.gif) | 2b7afd156a222050d24ce7c78c4ac99d.txt | 2013-06-12 22:46 | 31K | |
![[TXT]](/icons/text.gif) | 377f0d751e0677a2617feb81634761c9.txt | 2013-06-12 22:24 | 31K | |
![[ ]](/icons/layout.gif) | 6d1aa7e3c9b88dc6d21b90f224eaf56e.pdf | 2013-06-12 21:34 | 489K | |
![[ ]](/icons/layout.gif) | Evaluation of a dual-function pH and PCO2 in vivo sensor.pdf | 2013-06-12 20:51 | 1.0M | |
![[ ]](/icons/layout.gif) | c80af75a4035b9369c125f0de55b79d5.pdf | 2013-06-12 20:24 | 246K | |
![[ ]](/icons/layout.gif) | fe0510020677c70373614e5d9dff578d.pdf | 2013-06-12 20:20 | 1.6M | |
![[ ]](/icons/layout.gif) | f6d49c0a2cbbfeb2453e4f18167ccd2b.pdf | 2013-06-12 20:17 | 334K | |
![[TXT]](/icons/text.gif) | 60a38732843c270b2c4bbfc66fb19786.txt | 2013-06-12 20:17 | 16K | |
![[ ]](/icons/layout.gif) | 30956717a0905340fc5b6eef91b16ef8.pdf | 2013-06-12 19:45 | 1.1M | |
![[ ]](/icons/layout.gif) | 85a08be525e8efda417d4d88353501e2.pdf | 2013-06-12 19:44 | 3.0M | |
![[TXT]](/icons/text.gif) | Potassium ion-sensitive field effect transistor.txt | 2013-06-12 19:42 | 94K | |
![[ ]](/icons/layout.gif) | A field effect transistor as a solid-state reference electrode.pdf | 2013-06-12 19:37 | 379K | |
![[TXT]](/icons/text.gif) | 2792d4d5cd33c6ab03931ae9fda4876d.txt | 2013-06-12 19:35 | 74K | |
![[TXT]](/icons/text.gif) | 29c7e0edddcb235036ff0bfe00cc23f3.txt | 2013-06-12 19:33 | 45K | |
![[ ]](/icons/layout.gif) | Effects of psilocybin on hippocampal neurogenesis and extinction of trace fear conditioning.pdf | 2013-06-12 16:22 | 619K | |
![[TXT]](/icons/text.gif) | c513bacfb2b7dcb3c62d40682f403bf1.txt | 2013-06-12 06:55 | 41K | |
![[TXT]](/icons/text.gif) | 7c9a4acf9b33a83f800bb74265b25ed.txt | 2013-06-12 04:08 | 14K | |
![[TXT]](/icons/text.gif) | 17b9420eb18ac96c8a8f2cc645c1cef5.txt | 2013-06-12 04:07 | 14K | |
![[TXT]](/icons/text.gif) | New evidence of meteoritic origin of the Tunguska cosmic body.txt | 2013-06-11 15:17 | 18K | |
![[TXT]](/icons/text.gif) | 850f405784584e2f0807ac1bf79c2691.txt | 2013-06-10 23:38 | 66K | |
![[TXT]](/icons/text.gif) | ecbc45c4cb22514bc4d1a876c4f252ed.txt | 2013-06-10 14:15 | 66K | |
![[TXT]](/icons/text.gif) | 999cc70814ee7967bc9548ac29de9ab8.txt | 2013-06-10 13:10 | 25K | |
![[TXT]](/icons/text.gif) | 86b8c4ab3edbafb2ef52bf2eb0db2b58.txt | 2013-06-10 10:10 | 11K | |
![[TXT]](/icons/text.gif) | b1ea7bc1ffc323f4c06d75c393e06f7f.txt | 2013-06-10 10:10 | 11K | |
![[TXT]](/icons/text.gif) | 263e3c39832e603d1c9446bfb6274645.txt | 2013-06-10 05:01 | 40K | |
![[TXT]](/icons/text.gif) | a80a6fb98dc9e7c3b689b9ef630d14a1.txt | 2013-06-10 04:06 | 61K | |
![[TXT]](/icons/text.gif) | 83261adbba9ce74e8e887e93954aafdb.txt | 2013-06-09 20:29 | 15K | |
![[TXT]](/icons/text.gif) | 794ba68d3f0fceba837b9ea221851933.txt | 2013-06-09 20:29 | 15K | |
![[ ]](/icons/layout.gif) | Measuring impact in online resources with the CInumber (the CitedIn Number for online impact).pdf | 2013-06-09 09:55 | 679K | |
![[ ]](/icons/layout.gif) | a80c6f4e0b5c600b46f8a30fffebae6f.pdf | 2013-06-09 03:02 | 1.1M | |
![[TXT]](/icons/text.gif) | 5be86980d0af7339e7a3576e8f902596.txt | 2013-06-07 19:52 | 73K | |
![[TXT]](/icons/text.gif) | 6f1b93fddcff074ab0066d09d243a23d.txt | 2013-06-07 18:31 | 89K | |
![[TXT]](/icons/text.gif) | e7314f05b9847aaa3bbe305580ffa10d.txt | 2013-06-07 14:39 | 72K | |
![[ ]](/icons/layout.gif) | Identification of embedded mathematical formulas in PDF documents using SVM.pdf | 2013-06-07 14:34 | 393K | |
![[ ]](/icons/layout.gif) | Breastfeeding and early white matter development: A cross-sectional study.pdf | 2013-06-07 10:57 | 2.0M | |
![[ ]](/icons/layout.gif) | Repetitive locomotor training and physiotherapy improve walking and basic activities of daily living after stroke: a single-blind, randomized multicentre trial (DEutsche GAngtrainerStudie, DEGAS).pdf | 2013-06-07 04:28 | 189K | |
![[TXT]](/icons/text.gif) | adfd64026d9cf7deb80c5d28895aeb96.txt | 2013-06-06 14:28 | 67K | |
![[ ]](/icons/layout.gif) | 1efd1920760b882bd4ca5e3b544f3ed3.pdf | 2013-06-06 12:51 | 914K | |
![[TXT]](/icons/text.gif) | 418dc93847ee3f9486445cbbdb259a95.txt | 2013-06-06 12:41 | 13K | |
![[ ]](/icons/layout.gif) | A Vertical, Vacuum, Split‐Tube, Graphite‐Resistance Furnace.pdf | 2013-06-06 03:03 | 866K | |
![[TXT]](/icons/text.gif) | 2efd916f6bc56e67d729ed08f6dded40.txt | 2013-06-05 15:18 | 14K | |
![[ ]](/icons/layout.gif) | f387d046990d549e67d0a92975890a87.pdf | 2013-06-05 13:35 | 430K | |
![[ ]](/icons/layout.gif) | Chapter 5.2 Five-membered ring systems: pyrroles and benzo analogs.pdf | 2013-06-05 11:28 | 577K | |
![[ ]](/icons/layout.gif) | 784b3cacbabb7e57ece2b1f2877d3182.pdf | 2013-06-05 05:27 | 901K | |
![[TXT]](/icons/text.gif) | Light-Controlled Graphene-Elastin Composite Hydrogel Actuators.txt | 2013-06-05 05:26 | 87K | |
![[TXT]](/icons/text.gif) | c175886789ecd63300c8d5f08bdbac7c.txt | 2013-06-05 05:05 | 13K | |
![[TXT]](/icons/text.gif) | 25eb4cabc45a966e09b3e5ecb9f4b205.txt | 2013-06-03 10:41 | 16K | |
![[ ]](/icons/layout.gif) | X-ray analysis on the nanogram to microgram scale using porous complexes.pdf | 2013-06-02 19:03 | 1.7M | |
![[TXT]](/icons/text.gif) | Development of a Low-Resource RNA Extraction Cassette Based on Surface Tension Valves.txt | 2013-06-02 12:51 | 114K | |
![[TXT]](/icons/text.gif) | 8101caea0ba386577715f8ff444104f1.txt | 2013-06-02 11:30 | 75K | |
![[ ]](/icons/layout.gif) | Modulation of Nrf2_ARE Pathway by Food Polyphenols: A Nutritional Neuroprotective Strategy for Cognitive and Neurodegenerative Disorders.pdf | 2013-06-01 14:33 | 223K | |
![[TXT]](/icons/text.gif) | 9019f5eb23c8f84038553db06fcdc991.txt | 2013-05-31 21:33 | 244 | |
![[TXT]](/icons/text.gif) | e13b1415a1c1a9d07f69584d7aa04a25.txt | 2013-05-31 16:28 | 11K | |
![[TXT]](/icons/text.gif) | fe53c41fbff0e825b41ba267c62f142f.txt | 2013-05-31 16:23 | 3.3K | |
![[TXT]](/icons/text.gif) | c6413094ebe8008fb398707f5693f844.txt | 2013-05-31 16:23 | 250 | |
![[TXT]](/icons/text.gif) | 1c1bd049a5d4cc32ec5fbdb8dc664f28.txt | 2013-05-31 11:59 | 11K | |
![[ ]](/icons/layout.gif) | Reconstituting Organ-Level Lung Functions on a Chip.pdf | 2013-05-31 06:07 | 3.6M | |
![[TXT]](/icons/text.gif) | The Balance Between Excitation And Inhibition And Functional Sensory Processing In The Somatosensory Cortex.txt | 2013-05-30 10:44 | 18K | |
![[ ]](/icons/layout.gif) | Molecularly self-assembled nucleic acid nanoparticles for targeted in vivo siRNA delivery.pdf | 2013-05-29 21:25 | 1.4M | |
![[TXT]](/icons/text.gif) | Single-Molecule Kinetics and Super-Resolution Microscopy by Fluorescence Imaging of Transient Binding on DNA Origami.txt | 2013-05-29 21:13 | 120K | |
![[TXT]](/icons/text.gif) | 1a2e3b414c2e1a6242e6cdc924196d6e.txt | 2013-05-29 20:43 | 89K | |
![[TXT]](/icons/text.gif) | 3011fd5d1349d902d74ab0ecd92576d7.txt | 2013-05-29 19:53 | 15K | |
![[TXT]](/icons/text.gif) | 67ee5fb646ad3d800a9cbb08bea1c5b3.txt | 2013-05-29 17:20 | 96K | |
![[ ]](/icons/layout.gif) | 67845a4fb5b009259c389f90ab02c1c0.pdf | 2013-05-29 11:56 | 1.9M | |
![[ ]](/icons/layout.gif) | 7a01e5a892a6d7a9f408df01905f9359.pdf | 2013-05-29 11:54 | 646K | |
![[ ]](/icons/layout.gif) | Looking into the Future: A Match between Self-View and Temporal Distance.pdf | 2013-05-28 13:50 | 464K | |
![[ ]](/icons/layout.gif) | Development of rapid mask fabrication technology for micro-abrasive jet machining.pdf | 2013-05-28 04:45 | 630K | |
![[TXT]](/icons/text.gif) | 285c31e7a03bcb08c13d2f206166765.txt | 2013-05-27 22:26 | 52K | |
![[TXT]](/icons/text.gif) | 48cdc46b1a935de62f72b95bb02ebdd7.txt | 2013-05-27 08:44 | 11K | |
![[TXT]](/icons/text.gif) | 533f464eb21beb97fb5ba4c85230073f.txt | 2013-05-27 03:21 | 54K | |
![[TXT]](/icons/text.gif) | 2963801b326ce6b0e40f7b9a3eaa309a.txt | 2013-05-27 03:20 | 74K | |
![[TXT]](/icons/text.gif) | 9ce0fab3b69c944b8f3b9ce5309630f.txt | 2013-05-27 00:18 | 49K | |
![[TXT]](/icons/text.gif) | deb9cce47cfeacee9cc9815ca03fc8fd.txt | 2013-05-27 00:17 | 49K | |
![[ ]](/icons/layout.gif) | A plug and play microfluidic device.pdf | 2013-05-25 18:45 | 950K | |
![[ ]](/icons/layout.gif) | Label-free biodetection using a smartphone.pdf | 2013-05-25 16:53 | 1.0M | |
![[ ]](/icons/layout.gif) | Fabrication of micro pneumatic valves with double-layer elastic poly(dimethylsiloxane) membranes in rigid poly(methyl methacrylate) microfluidic chips.pdf | 2013-05-25 05:09 | 657K | |
![[ ]](/icons/layout.gif) | Rain events influence short-term feeding preferences in the snail Cepaea nemoralis.pdf | 2013-05-24 16:10 | 242K | |
![[TXT]](/icons/text.gif) | A Strong Interactive Link between Sensory Discriminations and Intelligence.txt | 2013-05-24 12:32 | 18K | |
![[TXT]](/icons/text.gif) | ba7aa4c72efe70424981c3b718686b20.txt | 2013-05-24 12:23 | 738 | |
![[ ]](/icons/layout.gif) | Perfusion-decellularized matrix: using nature's platform to engineer a bioartificial heart.pdf | 2013-05-24 09:09 | 1.3M | |
![[TXT]](/icons/text.gif) | 5fd6302fe3e4a50fb475e3f685743e6b.txt | 2013-05-24 08:35 | 13K | |
![[TXT]](/icons/text.gif) | e1ef2054be6aa3ff0bc024769dc08ffd.txt | 2013-05-24 08:32 | 46K | |
![[TXT]](/icons/text.gif) | 336436c505a231358c3301269003f5b8.txt | 2013-05-23 21:40 | 15K | |
![[TXT]](/icons/text.gif) | 8ef3d318c57dc900e7273574a6c046a6.txt | 2013-05-23 21:40 | 59K | |
![[TXT]](/icons/text.gif) | Mapping the Thermal Behavior of DNA Origami Nanostructures.txt | 2013-05-23 21:39 | 101K | |
![[TXT]](/icons/text.gif) | d9ee2b59418d61290bb39775be92d9c.txt | 2013-05-23 21:36 | 13K | |
![[TXT]](/icons/text.gif) | d3297679a71a6f9b339588b83bef0945.txt | 2013-05-23 21:33 | 13K | |
![[TXT]](/icons/text.gif) | 3c8371c11bf6f7cbd53fdde519667571.txt | 2013-05-23 21:33 | 14K | |
![[TXT]](/icons/text.gif) | Toward Reliable Gold Nanoparticle Patterning On Self-Assembled DNA Nanoscaffold.txt | 2013-05-23 21:32 | 114K | |
![[TXT]](/icons/text.gif) | 8a7087aacfdd363539a0c1cac26f5ff.txt | 2013-05-23 21:15 | 13K | |
![[TXT]](/icons/text.gif) | a4636beb31367517aebe869a9f68f3a5.txt | 2013-05-23 21:15 | 14K | |
![[ ]](/icons/layout.gif) | In vivo cloning of artificial DNA nanostructures.pdf | 2013-05-23 21:15 | 766K | |
![[ ]](/icons/layout.gif) | Photonic interaction between quantum dots and gold nanoparticles in discrete nanostructures through DNA directed self-assembly.pdf | 2013-05-23 21:14 | 1.1M | |
![[TXT]](/icons/text.gif) | 7cb65e43a1217d6ba9389497c60daa7f.txt | 2013-05-23 21:14 | 12K | |
![[ ]](/icons/layout.gif) | DNA Self-assembly for Nanomedicine .pdf | 2013-05-23 21:13 | 7.7M | |
![[TXT]](/icons/text.gif) | accd7070fda875afc9298c9c3d2aa15f.txt | 2013-05-23 21:13 | 13K | |
![[ ]](/icons/layout.gif) | Molecular robots guided by prescriptive landscapes.pdf | 2013-05-23 21:13 | 898K | |
![[TXT]](/icons/text.gif) | Immobilization and One-Dimensional Arrangement of Virus Capsids with Nanoscale Precision Using DNA Origami.txt | 2013-05-23 21:13 | 118K | |
![[ ]](/icons/layout.gif) | DNA origami: a history and current perspective.pdf | 2013-05-23 21:12 | 599K | |
![[TXT]](/icons/text.gif) | Molecular Behavior of DNA Origami in Higher-Order Self-Assembly.txt | 2013-05-23 21:12 | 117K | |
![[TXT]](/icons/text.gif) | DNA-Directed Artificial Light-Harvesting Antenna.txt | 2013-05-23 21:11 | 119K | |
![[ ]](/icons/layout.gif) | Nanomaterials: DNA brings quantum dots to order.pdf | 2013-05-23 21:11 | 326K | |
![[TXT]](/icons/text.gif) | DNA Directed Self-Assembly of Anisotropic Plasmonic Nanostructures.txt | 2013-05-23 21:11 | 115K | |
![[TXT]](/icons/text.gif) | Interenzyme Substrate Diffusion for an Enzyme Cascade Organized on Spatially Addressable DNA Nanostructures.txt | 2013-05-23 21:10 | 118K | |
![[TXT]](/icons/text.gif) | Steric Crowding and the Kinetics of DNA Hybridization within a DNA Nanostructure System.txt | 2013-05-23 21:10 | 106K | |
![[TXT]](/icons/text.gif) | Reconfigurable DNA Origami to Generate Quasifractal Patterns.txt | 2013-05-23 21:10 | 106K | |
![[TXT]](/icons/text.gif) | Spatially-Interactive Biomolecular Networks Organized by Nucleic Acid Nanostructures.txt | 2013-05-23 21:10 | 114K | |
![[TXT]](/icons/text.gif) | DNA Origami with Double-Stranded DNA As a Unified Scaffold.txt | 2013-05-23 21:10 | 105K | |
![[TXT]](/icons/text.gif) | Robust DNA-Functionalized Core_Shell Quantum Dots with Fluorescent Emission Spanning from UVvis to Near-IR and Compatible with DNA-Directed Self-Assembly.txt | 2013-05-23 21:10 | 110K | |
![[ ]](/icons/layout.gif) | DNA origami templated self-assembly of discrete length single wall carbon nanotubes.pdf | 2013-05-23 21:09 | 924K | |
![[TXT]](/icons/text.gif) | Self-Assembly of DNA Rings from Scaffold-Free DNA Tiles.txt | 2013-05-23 21:09 | 101K | |
![[TXT]](/icons/text.gif) | PNA-Peptide Assembly in a 3D DNA Nanocage at Room Temperature.txt | 2013-05-23 21:09 | 103K | |
![[ ]](/icons/layout.gif) | Self-assembly of DNA into nanoscale three-dimensional shapes.pdf | 2013-05-23 21:09 | 2.5M | |
![[ ]](/icons/layout.gif) | Rapid prototyping of 3D DNA-origami shapes with caDNAno.pdf | 2013-05-23 21:08 | 4.1M | |
![[TXT]](/icons/text.gif) | Folding DNA Origami from a Double-Stranded Source of Scaffold.txt | 2013-05-23 21:08 | 112K | |
![[TXT]](/icons/text.gif) | Multilayer DNA Origami Packed on a Square Lattice.txt | 2013-05-23 21:08 | 117K | |
![[ ]](/icons/layout.gif) | Knitting complex weaves with DNA origami.pdf | 2013-05-23 21:07 | 580K | |
![[ ]](/icons/layout.gif) | Challenges and opportunities for structural DNA nanotechnology.pdf | 2013-05-23 21:07 | 1.9M | |
![[TXT]](/icons/text.gif) | e05ec534adadf89ee2b9348013f00d68.txt | 2013-05-23 21:06 | 52K | |
![[TXT]](/icons/text.gif) | Multilayer DNA Origami Packed on Hexagonal and Hybrid Lattices.txt | 2013-05-23 21:06 | 107K | |
![[ ]](/icons/layout.gif) | Two design strategies for enhancement of multilayerDNA-origami folding: underwinding for specific intercalator rescue and staple-break positioning.pdf | 2013-05-23 21:06 | 1.1M | |
![[TXT]](/icons/text.gif) | 4ff996ad03b58fce9465c0f4642971b2.txt | 2013-05-23 21:05 | 13K | |
![[TXT]](/icons/text.gif) | Programmed Two-Dimensional Self-Assembly of Multiple DNA Origami Jigsaw Pieces.txt | 2013-05-23 21:05 | 119K | |
![[ ]](/icons/layout.gif) | Two-dimensional DNA origami assemblies using a four-way connector.pdf | 2013-05-23 21:05 | 1.8M | |
![[ ]](/icons/layout.gif) | Direct observation of stepwise movement of a synthetic molecular transporter.pdf | 2013-05-23 21:05 | 1.5M | |
![[ ]](/icons/layout.gif) | Self-assembly of carbon nanotubes into two-dimensional geometries using DNA origami templates.pdf | 2013-05-23 21:04 | 846K | |
![[TXT]](/icons/text.gif) | 7712f2a684d05c188651713bc0f059b2.txt | 2013-05-23 21:04 | 14K | |
![[TXT]](/icons/text.gif) | e39e249d60a91ace9250c1e08488cb3.txt | 2013-05-23 21:04 | 13K | |
![[ ]](/icons/layout.gif) | Intramolecular folding in three tandem guanine repeats of human telomeric DNA.pdf | 2013-05-23 21:04 | 1.5M | |
![[TXT]](/icons/text.gif) | Transcription Regulation System Mediated by Mechanical Operation of a DNA Nanostructure.txt | 2013-05-23 21:03 | 108K | |
![[TXT]](/icons/text.gif) | 7b3f87e4f3ecf199991acb40025dd3a6.txt | 2013-05-23 21:03 | 15K | |
![[ ]](/icons/layout.gif) | A DNA-based molecular motor that can navigate a network of tracks.pdf | 2013-05-23 21:02 | 932K | |
![[TXT]](/icons/text.gif) | 885f12620a1c4fc7213d8078efd9dbe0.txt | 2013-05-23 21:02 | 4.7K | |
![[TXT]](/icons/text.gif) | 27f1c391550d294a583e55b969ec8ff5.txt | 2013-05-23 21:02 | 15K | |
![[TXT]](/icons/text.gif) | Photo-Controllable DNA Origami Nanostructures Assembling into Predesigned Multiorientational Patterns.txt | 2013-05-23 21:02 | 113K | |
![[TXT]](/icons/text.gif) | Direct and Real-Time Observation of Rotary Movement of a DNA Nanomechanical Device.txt | 2013-05-23 21:02 | 105K | |
![[ ]](/icons/layout.gif) | DNA origami technology for biomaterials applications.pdf | 2013-05-23 21:02 | 6.5M | |
![[ ]](/icons/layout.gif) | DNA mediated assembly of single walled carbon nanotubes: role of DNA linkers and annealing.pdf | 2013-05-23 21:01 | 2.5M | |
![[ ]](/icons/layout.gif) | Recent advances in DNA-based directed assembly on surfaces.pdf | 2013-05-23 21:01 | 516K | |
![[ ]](/icons/layout.gif) | RNA-templated DNA origami structures.pdf | 2013-05-23 21:00 | 2.1M | |
![[TXT]](/icons/text.gif) | 2a711aeec0c9f2eaf4852f766fab4d82.txt | 2013-05-23 21:00 | 15K | |
![[TXT]](/icons/text.gif) | fbf6c1b1f2260cd22914a35efc9bc8d.txt | 2013-05-23 20:59 | 59K | |
![[TXT]](/icons/text.gif) | 697d42b9fc913fd0bc8a3f0163473e5b.txt | 2013-05-23 20:14 | 96K | |
![[ ]](/icons/layout.gif) | Detoxification of wood hydrolysates with laccase and peroxidase from the white-rot fungus Trametes versicolor.pdf | 2013-05-22 02:52 | 297K | |
![[ ]](/icons/layout.gif) | Enhanced resistance of .pdf | 2013-05-22 02:52 | 402K | |
![[TXT]](/icons/text.gif) | Vanillin: Synthetic Flavoring from Spent Sulfite Liquor.txt | 2013-05-22 00:12 | 111K | |
![[ ]](/icons/layout.gif) | Regulation of Food Intake, Energy Balance, and Body Fat Mass: Implications for the Pathogenesis and Treatment of Obesity.pdf | 2013-05-21 20:34 | 495K | |
![[TXT]](/icons/text.gif) | Feed-forward mechanisms: Addiction-like behavioral and molecular adaptations in overeating.txt | 2013-05-21 20:33 | 17K | |
![[TXT]](/icons/text.gif) | 6db54961be0db629cf79fb4cc2abdd0a.txt | 2013-05-21 20:27 | 125K | |
![[ ]](/icons/layout.gif) | Multiple isoforms of .pdf | 2013-05-21 20:24 | 693K | |
![[TXT]](/icons/text.gif) | 75b736657bb9caa0bbbb55d67ad07ab.txt | 2013-05-21 20:23 | 63K | |
![[ ]](/icons/layout.gif) | Hox Genes Regulate Digit Patterning by Controlling the Wavelength of a Turing-Type Mechanism.pdf | 2013-05-21 12:50 | 4.7M | |
![[ ]](/icons/layout.gif) | 60c3b860aa4bc71fa274f7afd7ff66b2.pdf | 2013-05-21 10:55 | 1.5M | |
![[TXT]](/icons/text.gif) | b04c418d67db99df5aecd89b0299ebdb.txt | 2013-05-20 10:29 | 65K | |
![[TXT]](/icons/text.gif) | 99ecfee2e69401f616cb1373b7755806.txt | 2013-05-20 10:25 | 70K | |
![[ ]](/icons/layout.gif) | The Ancestral Logic of Politics Upper-Body Strength Regulates Mens Assertion of Self-Interest Over Economic Redistribution.pdf | 2013-05-18 17:41 | 386K | |
![[ ]](/icons/layout.gif) | Increasing Human Brain Excitability by Transcranial High-Frequency Random Noise Stimulation.pdf | 2013-05-17 11:27 | 634K | |
![[ ]](/icons/layout.gif) | 32393c31dd47bf5a1477c001933dddc9.pdf | 2013-05-16 18:51 | 912K | |
![[ ]](/icons/layout.gif) | Hypothalamic programming of systemic ageing involving IKK-, NF-B and GnRH.pdf | 2013-05-16 18:15 | 1.4M | |
![[ ]](/icons/layout.gif) | A Visit to the Serpukhov 76-GeV Synchrotron.pdf | 2013-05-16 15:07 | 69K | |
![[TXT]](/icons/text.gif) | Estimates of Carrington-class solar particle event radiation exposures as a function of altitude in the atmosphere of Mars.txt | 2013-05-15 19:49 | 18K | |
![[TXT]](/icons/text.gif) | 406cec0211ca961a7c7455cf6dc00c64.txt | 2013-05-15 11:50 | 9.0K | |
![[TXT]](/icons/text.gif) | 37497c98e2d087e6df45ae92009f4e1f.txt | 2013-05-15 11:48 | 67K | |
![[TXT]](/icons/text.gif) | c00a70e579a0acb7b6a2005fff7ab882.txt | 2013-05-15 11:47 | 28K | |
![[ ]](/icons/layout.gif) | Minor arcs for Goldbach's problem.pdf | 2013-05-14 21:40 | 699K | |
![[TXT]](/icons/text.gif) | Large-Scale Roll-to-Roll Fabrication of Vertically Oriented Block Copolymer Thin Films.txt | 2013-05-14 00:03 | 102K | |
![[TXT]](/icons/text.gif) | 644c7c0242be0cf6154a67d70cc14dea.txt | 2013-05-13 17:45 | 14K | |
![[TXT]](/icons/text.gif) | 4de40a18c8e3f735a77d2edc6a876be2.txt | 2013-05-13 13:11 | 511 | |
![[ ]](/icons/layout.gif) | Use of haematoxylin in the spectrophotometric determination of alkaloids in pharmaceuticals, galenicals and powdered plants.pdf | 2013-05-13 11:38 | 738K | |
![[ ]](/icons/layout.gif) | Capturing the Naturally Occurring Superior Performance of Experts in the Laboratory Toward a Science of Expert and Exceptional Performance.pdf | 2013-05-13 06:12 | 139K | |
![[TXT]](/icons/text.gif) | dc4dde4585084ca80ae808734e8f2d1a.txt | 2013-05-13 06:00 | 16K | |
![[ ]](/icons/layout.gif) | Water-Heated Pool Boiling of Different Refrigerants on the Outside Surface of a Horizontal Smooth Tube.pdf | 2013-05-12 19:03 | 1.0M | |
![[TXT]](/icons/text.gif) | a06dadafd3ae391a6c2b49761edc562a.txt | 2013-05-12 19:01 | 15K | |
![[ ]](/icons/layout.gif) | Coding-Sequence Determinants of Gene Expression in Escherichia coli.pdf | 2013-05-12 16:08 | 1.2M | |
![[ ]](/icons/layout.gif) | Ribosome Collisions and Translation Efficiency: Optimization by Codon Usage and mRNA Destabilization.pdf | 2013-05-12 15:58 | 867K | |
![[TXT]](/icons/text.gif) | 55b302baaca6ff29c5f68aebb5ccdaa.txt | 2013-05-12 15:16 | 16K | |
![[TXT]](/icons/text.gif) | f7907f865e118a6fffc8b5f1076e2f2f.txt | 2013-05-12 14:16 | 41K | |
![[TXT]](/icons/text.gif) | Chapter three – Designing Genes for Successful Protein Expression.txt | 2013-05-12 14:12 | 18K | |
![[ ]](/icons/layout.gif) | Cooperative effects by the initiation codon and its flanking regions on translation initiation.pdf | 2013-05-12 13:57 | 491K | |
![[ ]](/icons/layout.gif) | Willingness to Share Research Data Is Related to the Strength of the Evidence and the Quality of Reporting of Statistical Results.pdf | 2013-05-11 09:05 | 358K | |
![[ ]](/icons/layout.gif) | Political ideology affects energy-efficiency attitudes and choices.pdf | 2013-05-10 21:53 | 646K | |
![[TXT]](/icons/text.gif) | Towards more expressive ontology languages: The query answering problem .txt | 2013-05-10 16:19 | 18K | |
![[TXT]](/icons/text.gif) | Role of angiogenesis in tumor growth and metastasis .txt | 2013-05-10 08:57 | 18K | |
![[ ]](/icons/layout.gif) | Small RNA populations for two unrelated viruses exhibit different biases in strand polarity and proximity to terminal sequences in the insect host .pdf | 2013-05-09 14:48 | 3.3M | |
![[ ]](/icons/layout.gif) | Drug development: Raise standards for preclinical cancer research.pdf | 2013-05-09 10:02 | 757K | |
![[ ]](/icons/layout.gif) | Editorial note.pdf | 2013-05-09 10:01 | 208K | |
![[TXT]](/icons/text.gif) | f89618126a0b44f2116d90403e300ddc.txt | 2013-05-08 20:05 | 14K | |
![[ ]](/icons/layout.gif) | Ash from the Toba supereruption in Lake Malawi shows no volcanic winter in East Africa at 75 ka.pdf | 2013-05-08 18:06 | 594K | |
![[TXT]](/icons/text.gif) | 50bdf6f975a24991460e893c1c6c25ba.txt | 2013-05-08 14:32 | 58K | |
![[ ]](/icons/layout.gif) | Water Planets in the Habitable Zone: Atmospheric Chemistry, Observable Features, and the case of Kepler-62e and -62f.pdf | 2013-05-07 12:53 | 1.8M | |
![[TXT]](/icons/text.gif) | ec706c053ed38db77d6b9962cd7d84f9.txt | 2013-05-07 05:09 | 25K | |
![[ ]](/icons/layout.gif) | A strategy to capture and characterize the synaptic transcriptome.pdf | 2013-05-06 13:18 | 1.2M | |
![[ ]](/icons/layout.gif) | The Ventral Hippocampus Is the Embryonic Origin for Adult Neural Stem Cells in the Dentate Gyrus.pdf | 2013-05-03 18:46 | 58K | |
![[TXT]](/icons/text.gif) | The Ventral Hippocampus Is the Embryonic Origin for Adult Neural Stem Cells in the Dentate Gyrus.txt | 2013-05-03 18:45 | 17K | |
![[TXT]](/icons/text.gif) | be07bbc932d415cd5a1ab481db85c70e.txt | 2013-05-03 11:29 | 65K | |
![[TXT]](/icons/text.gif) | cfd93e3cbda637b896b7be2cb329e3a9.txt | 2013-05-03 03:09 | 18K | |
![[TXT]](/icons/text.gif) | c0091b11fec76a81da1ee0eb65cc9b2c.txt | 2013-05-02 16:15 | 17K | |
![[TXT]](/icons/text.gif) | 82ee57c6013289b2b2e749a29c27fce1.txt | 2013-05-02 16:14 | 17K | |
![[ ]](/icons/layout.gif) | Actin, Spectrin, and Associated Proteins Form a Periodic Cytoskeletal Structure in Axons.pdf | 2013-05-02 13:56 | 1.8M | |
![[ ]](/icons/layout.gif) | Neurotransmitter Switching in the Adult Brain Regulates Behavior.pdf | 2013-05-01 17:47 | 2.5M | |
![[ ]](/icons/layout.gif) | Increases in cAMP, MAPK Activity, and CREB Phosphorylation during REM Sleep: Implications for REM Sleep and Memory Consolidation.pdf | 2013-05-01 17:11 | 2.0M | |
![[ ]](/icons/layout.gif) | Keyboard acoustic emanations revisited.pdf | 2013-04-30 20:27 | 194K | |
![[TXT]](/icons/text.gif) | 9d3080eab3f432f6547e1db27c63f877.txt | 2013-04-29 19:21 | 124K | |
![[TXT]](/icons/text.gif) | cd65a8004c3cafa5150e4167cab74f65.txt | 2013-04-29 09:42 | 12K | |
![[TXT]](/icons/text.gif) | 25bc973598b7d995a7e818a435dded5c.txt | 2013-04-29 09:42 | 45K | |
![[TXT]](/icons/text.gif) | Effect of topical application of raspberry ketone on dermal production of insulin-like growth factor-I in mice and on hair growth and skin elasticity in humans.txt | 2013-04-27 12:54 | 17K | |
![[TXT]](/icons/text.gif) | d342b279e3522a3ac91e3fa3820813f.txt | 2013-04-26 15:35 | 16K | |
![[TXT]](/icons/text.gif) | a53e1a93963beb41463895c6561ac517.txt | 2013-04-26 02:03 | 64K | |
![[TXT]](/icons/text.gif) | 441897c27f230ab55b0c48bc94fb1ab.txt | 2013-04-26 01:44 | 64K | |
![[ ]](/icons/layout.gif) | Practices in source code sharing in astrophysics.pdf | 2013-04-26 00:04 | 149K | |
![[TXT]](/icons/text.gif) | 7ed2f4f47eae18a301ac0a6c73944675.txt | 2013-04-24 22:28 | 32K | |
![[TXT]](/icons/text.gif) | 7b3e93b22179038ecf06b073c42a1c6b.txt | 2013-04-24 22:28 | 12K | |
![[ ]](/icons/layout.gif) | d569853ecbe85c4c1d3e702510051ca3.pdf | 2013-04-24 17:21 | 654K | |
![[TXT]](/icons/text.gif) | b964e6067d5da990a883d76175c9697e.txt | 2013-04-24 11:01 | 31K | |
![[TXT]](/icons/text.gif) | 40c73dabaefed3a7b54f113f6be8b725.txt | 2013-04-24 10:59 | 13K | |
![[ ]](/icons/layout.gif) | 3187ece783c7f7e64ff2605c0ff0b6a9.pdf | 2013-04-24 09:40 | 158K | |
![[TXT]](/icons/text.gif) | 64a36b49a3af772cbb9f0cd6a3d44a80.txt | 2013-04-24 03:50 | 16K | |
![[TXT]](/icons/text.gif) | 83a6b2bf8e8daea69d5b92a8abb00812.txt | 2013-04-24 03:50 | 11K | |
![[TXT]](/icons/text.gif) | Exogenous glutathione increases endurance to muscle effort in mice.txt | 2013-04-22 07:43 | 17K | |
![[ ]](/icons/layout.gif) | Representation of Three-Dimensional Space in the Hippocampus of Flying Bats.pdf | 2013-04-21 03:45 | 2.5M | |
![[ ]](/icons/layout.gif) | dd7b77e62cac0937f822bb4a7e8c53ef.pdf | 2013-04-20 08:57 | 2.4M | |
![[TXT]](/icons/text.gif) | 397d1b054f27c51cc9fd89fcb0f9a712.txt | 2013-04-20 02:44 | 53K | |
![[ ]](/icons/layout.gif) | New Analgesics Synthetically Derived from the Paracetamol Metabolite .pdf | 2013-04-20 02:43 | 433K | |
![[ ]](/icons/layout.gif) | Ectopic eyes outside the head in Xenopus tadpoles provide sensory data for light-mediated learning.pdf | 2013-04-19 06:20 | 1.9M | |
![[TXT]](/icons/text.gif) | a855e2d1066d82614ea19dadf38c1b62.txt | 2013-04-18 12:27 | 41K | |
![[TXT]](/icons/text.gif) | 986d5e0dae6e84b1a1e27e78b39cb239.txt | 2013-04-18 08:23 | 13K | |
![[TXT]](/icons/text.gif) | 42652faac621e44e71b8f6bee0586439.txt | 2013-04-18 01:49 | 17K | |
![[ ]](/icons/layout.gif) | Functional geometry.pdf | 2013-04-17 17:26 | 487K | |
![[ ]](/icons/layout.gif) | Molecular mechanics of mineralized collagen fibrils in bone.pdf | 2013-04-17 16:11 | 1.3M | |
![[TXT]](/icons/text.gif) | d02e5c640682f111df7d975f8c5e3b3b.txt | 2013-04-16 13:22 | 50K | |
![[TXT]](/icons/text.gif) | 6d2622ea15d9de2c9543ea88cc95cb17.txt | 2013-04-16 13:22 | 50K | |
![[TXT]](/icons/text.gif) | 896d267118bd63eea6e7a1a371222805.txt | 2013-04-16 11:57 | 108K | |
![[TXT]](/icons/text.gif) | 92891174b826ecf71b12bcbad4ae9090.txt | 2013-04-16 09:54 | 78K | |
![[TXT]](/icons/text.gif) | 4ccedcae07582dec6309205affd7e388.txt | 2013-04-16 02:04 | 28K | |
![[TXT]](/icons/text.gif) | 946842bab95dda489be03472ce18e143.txt | 2013-04-15 06:52 | 11K | |
![[TXT]](/icons/text.gif) | 52764fbf96222888e1e1e8196e53415e.txt | 2013-04-15 06:51 | 42K | |
![[ ]](/icons/layout.gif) | L-acetylcarnitine causes rapid antidepressant effects through the epigenetic induction of mGlu2 receptors.pdf | 2013-04-15 06:39 | 762K | |
![[ ]](/icons/layout.gif) | 64dba33b988c86d39a2ca24a544a0423.pdf | 2013-04-14 23:17 | 1.2M | |
![[TXT]](/icons/text.gif) | f1b729e38d30678c013f07903c25ddd1.txt | 2013-04-14 23:12 | 88K | |
![[TXT]](/icons/text.gif) | Direct synthesis of liquid-phase dioxygen difluoride.txt | 2013-04-14 21:55 | 17K | |
![[ ]](/icons/layout.gif) | Ice slurry production using supercooling phenomenon.pdf | 2013-04-14 17:24 | 1.0M | |
![[TXT]](/icons/text.gif) | a91d6e207e04d7c45bca29dcd274fbb2.txt | 2013-04-13 05:43 | 16K | |
![[ ]](/icons/layout.gif) | N2 Fixation by Streptomyces thermoautotrophicus Involves a Molybdenum-Dinitrogenase and a Manganese-Superoxide Oxidoreductase That Couple N2Reduction to the Oxidation of Superoxide Produced from O2by a Molybdenum-CO Dehydrogenase.pdf | 2013-04-12 23:39 | 273K | |
![[ ]](/icons/layout.gif) | Injectable, Cellular-Scale Optoelectronics with Applications for Wireless Optogenetics.pdf | 2013-04-12 18:50 | 5.9M | |
![[TXT]](/icons/text.gif) | 16fa585bb1ec67fec704da356a620bee.txt | 2013-04-12 13:17 | 50K | |
![[ ]](/icons/layout.gif) | Energy Balance of the Global Photovoltaic (PV) Industry - Is the PV Industry a Net Electricity Producer?.pdf | 2013-04-11 11:20 | 2.2M | |
![[TXT]](/icons/text.gif) | a34d03931f76a63e025177baee7c3f40.txt | 2013-04-11 10:56 | 6.6K | |
![[TXT]](/icons/text.gif) | 867c36c22fd0c844bf00113fe405f204.txt | 2013-04-11 06:59 | 177 | |
![[ ]](/icons/layout.gif) | 664a7fef7c56221148ab75759d29f431.pdf | 2013-04-10 18:26 | 353K | |
![[ ]](/icons/layout.gif) | 5fa9ec9581d35afa85ad3e0616996c8c.pdf | 2013-04-10 18:25 | 353K | |
![[TXT]](/icons/text.gif) | d21951753692ae9e834f953c6c93209a.txt | 2013-04-10 18:25 | 144K | |
![[TXT]](/icons/text.gif) | ba2fb92fb7a057a2b15a6d6a6a943a.txt | 2013-04-10 18:25 | 214K | |
![[ ]](/icons/layout.gif) | Recollection of vivid memories after perirhinal region stimulations: synchronization in the theta range of spatially distributed brain areas.pdf | 2013-04-10 18:19 | 438K | |
![[TXT]](/icons/text.gif) | c1b05cd17fa2d19df818f571fc7fdd83.txt | 2013-04-10 18:19 | 140K | |
![[TXT]](/icons/text.gif) | Vervet Monkeys Solve a Multiplayer “Forbidden Circle Game” by Queuing to Learn Restraint.txt | 2013-04-10 14:26 | 16K | |
![[ ]](/icons/layout.gif) | Vervet Monkeys Solve a Multiplayer Forbidden Circle Game by Queuing to Learn Restraint.pdf | 2013-04-10 14:22 | 53K | |
![[ ]](/icons/layout.gif) | Firefly Toxicosis in Lizards.pdf | 2013-04-10 13:20 | 296K | |
![[ ]](/icons/layout.gif) | 7b0c273e70ca41c9d5e28f4efef62ada.pdf | 2013-04-10 13:15 | 7.3M | |
![[ ]](/icons/layout.gif) | Structural and molecular interrogation of intact biological systems.pdf | 2013-04-10 13:14 | 3.4M | |
![[ ]](/icons/layout.gif) | Lucibufagins. 2. Esters of 12-oxo-2.beta.,5.beta.,11.alpha.-trihydroxybufalin, the major defensive steroids of the firefly Photinus pyralis (Coleoptera: Lampyridae).pdf | 2013-04-10 13:05 | 725K | |
![[ ]](/icons/layout.gif) | 9f8b68dc4be22767edb312a56f3c0a36.pdf | 2013-04-09 21:40 | 1.6M | |
![[ ]](/icons/layout.gif) | A robust Hotelling test.pdf | 2013-04-09 13:45 | 143K | |
![[TXT]](/icons/text.gif) | e5d4d3ee61fd39e40d413d31d5265c38.txt | 2013-04-09 13:36 | 3.7K | |
![[ ]](/icons/layout.gif) | GUT FLORA METABOLITE TRIMETHYLAMINE N-OXIDE PREDICTS INCIDENT CARDIOVASCULAR RISKS IN BOTH STABLE NON-DIABETICS AND DIABETIC SUBJECTS.pdf | 2013-04-09 13:30 | 241K | |
![[TXT]](/icons/text.gif) | 4c901ab6d80145abf87b0854e2c88f13.txt | 2013-04-09 03:26 | 68K | |
![[ ]](/icons/layout.gif) | Printing colour at the optical diffraction limit.pdf | 2013-04-08 18:39 | 1.8M | |
![[ ]](/icons/layout.gif) | Infrared receptors in pyrophilous (fire loving) insects as model for new un-cooled infrared sensors.pdf | 2013-04-08 16:58 | 3.7M | |
![[TXT]](/icons/text.gif) | 5e80e242c2ff32625d203fcbbe647dcb.txt | 2013-04-08 12:42 | 28K | |
![[ ]](/icons/layout.gif) | High resolution, low cost laser lithography using a Blu-ray optical head assembly.pdf | 2013-04-08 02:13 | 620K | |
![[ ]](/icons/layout.gif) | Revising the human mutation rate: implications for understanding human evolution.pdf | 2013-04-07 20:01 | 811K | |
![[ ]](/icons/layout.gif) | Optical tweezers directed one-bead one-sequence synthesis of oligonucleotides.pdf | 2013-04-06 23:05 | 640K | |
![[ ]](/icons/layout.gif) | A new DNA chip detection mechanism using optical pick-up actuators.pdf | 2013-04-06 23:03 | 540K | |
![[TXT]](/icons/text.gif) | fcd8bef2d335baa2c57599bacdaf2c49.txt | 2013-04-06 22:55 | 266 | |
![[TXT]](/icons/text.gif) | 5c1d93f8a531d09f81923f84a7abdc56.txt | 2013-04-06 22:50 | 681 | |
![[ ]](/icons/layout.gif) | c162878fe64919687fc5b56b7b3553e4.pdf | 2013-04-06 22:17 | 1.0M | |
![[TXT]](/icons/text.gif) | f6398794044dc24e9a357ea9f9611625.txt | 2013-04-06 20:10 | 16K | |
![[ ]](/icons/layout.gif) | Identification of seven loci affecting mean telomere length and their association with disease.pdf | 2013-04-06 11:40 | 750K | |
![[ ]](/icons/layout.gif) | A Tissue-Like Printed Material.pdf | 2013-04-05 06:18 | 1.9M | |
![[TXT]](/icons/text.gif) | 692c1c6079fc17d0fe2821c2d513bfe3.txt | 2013-04-05 04:05 | 11K | |
![[ ]](/icons/layout.gif) | 3589bf649f8bb019bd97be9880627b7c.pdf | 2013-04-04 16:13 | 58K | |
![[TXT]](/icons/text.gif) | 300927b4a91356d3f6e25a5ff30bcef8.txt | 2013-04-04 12:13 | 17K | |
![[ ]](/icons/layout.gif) | The Perfect Hypnotic?.pdf | 2013-04-04 12:07 | 966K | |
![[TXT]](/icons/text.gif) | b3cd8682035736eff8f27abe2616b02e.txt | 2013-04-04 11:50 | 79K | |
![[ ]](/icons/layout.gif) | d5e199a9d95a3a8a78036ef930af18cc.pdf | 2013-04-04 04:21 | 2.0M | |
![[TXT]](/icons/text.gif) | 7780a42bb48e5fc233274a50b8d7e821.txt | 2013-04-03 09:37 | 12K | |
![[TXT]](/icons/text.gif) | 203bcb3403d6c4a911e781f1e54cdf24.txt | 2013-04-03 09:33 | 12K | |
![[ ]](/icons/layout.gif) | Reversal of scopolamine-induced spatial and recognition memory deficits in mice by novel multifunctional dimers bis-cognitins.pdf | 2013-04-02 16:22 | 826K | |
![[ ]](/icons/layout.gif) | Inhibition of phoshodiesterase type 2 or type 10 reverses object memory deficits induced by scopolamine or MK-801.pdf | 2013-04-02 16:20 | 373K | |
![[ ]](/icons/layout.gif) | A dictionary of behavioral motifs reveals clusters of genes affecting Caenorhabditis elegans locomotion.pdf | 2013-04-02 14:02 | 1.3M | |
![[TXT]](/icons/text.gif) | 3db4bc4aab55cf050620ccad80708b54.txt | 2013-04-02 11:13 | 16K | |
![[ ]](/icons/layout.gif) | Adsorption cold storage system with zeolite–water working pair used for locomotive air conditioning.pdf | 2013-04-02 10:22 | 157K | |
![[TXT]](/icons/text.gif) | aa8efefd54a1701701b8a09f1528064a.txt | 2013-04-02 10:13 | 15K | |
![[TXT]](/icons/text.gif) | 8367947f7add9fdc696124eb25d753d8.txt | 2013-04-02 10:12 | 153K | |
![[TXT]](/icons/text.gif) | The Roy–Sherrington hypothesis: facts and surmises.txt | 2013-04-02 10:06 | 16K | |
![[TXT]](/icons/text.gif) | c8f9aebf96e384d7b1e273e8cf4bb35.txt | 2013-04-02 07:45 | 14K | |
![[ ]](/icons/layout.gif) | Method to design optimal scheme for cold storage air conditioning system.pdf | 2013-04-01 21:45 | 94K | |
![[ ]](/icons/layout.gif) | e15bb28f0dc692c053f64bb48b879ab3.pdf | 2013-04-01 21:04 | 204K | |
![[ ]](/icons/layout.gif) | Mfold web server for nucleic acid folding and hybridization prediction.pdf | 2013-04-01 08:37 | 330K | |
![[ ]](/icons/layout.gif) | 4695a76a6b1f46900ad0296c7baa5349.pdf | 2013-03-31 21:42 | 1.0M | |
![[ ]](/icons/layout.gif) | 5444e8be19844220cc800724599570d8.pdf | 2013-03-31 21:40 | 405K | |
![[ ]](/icons/layout.gif) | Unique in the Crowd: The privacy bounds of human mobility.pdf | 2013-03-31 20:59 | 698K | |
![[ ]](/icons/layout.gif) | Statistical Basis for Predicting Technological Progress.pdf | 2013-03-31 12:10 | 494K | |
![[ ]](/icons/layout.gif) | Generation of induced neurons via direct conversion in vivo.pdf | 2013-03-31 11:44 | 1.4M | |
![[ ]](/icons/layout.gif) | Global Network of Optical Magnetometers for Exotic Physics Novel scheme for exotic physics searches.pdf | 2013-03-31 11:42 | 868K | |
![[TXT]](/icons/text.gif) | b338ae4cf461d9f14ef9a560cd24be9a.txt | 2013-03-31 09:21 | 24K | |
![[TXT]](/icons/text.gif) | 6a80940ddcb11a55fd057cbb0f504e1e.txt | 2013-03-31 06:42 | 13K | |
![[ ]](/icons/layout.gif) | Chaste: An Open Source C++ Library for Computational Physiology and Biology.pdf | 2013-03-30 23:17 | 1.7M | |
![[ ]](/icons/layout.gif) | BioBlender: Fast and Efficient All Atom Morphing of Proteins Using Blender Game Engine.pdf | 2013-03-30 17:07 | 571K | |
![[ ]](/icons/layout.gif) | Thermodynamic Parameters for an Expanded Nearest-Neighbor Model for Formation of RNA Duplexes with WatsonCrick Base Pairs.pdf | 2013-03-29 22:56 | 152K | |
![[ ]](/icons/layout.gif) | a9f3ea4589dd25f36747e17595426dff.pdf | 2013-03-29 22:54 | 1.8M | |
![[TXT]](/icons/text.gif) | c454f1892540970f61c251f27d2e5c1a.txt | 2013-03-29 22:27 | 35K | |
![[TXT]](/icons/text.gif) | d1033e87cf00119c59ec698d23a2eac3.txt | 2013-03-29 22:05 | 17K | |
![[TXT]](/icons/text.gif) | e35c98abc8251f971cb1952d115c656b.txt | 2013-03-29 22:05 | 17K | |
![[TXT]](/icons/text.gif) | 5410060ec40498202e740811830a8aa7.txt | 2013-03-29 22:04 | 17K | |
![[TXT]](/icons/text.gif) | 504b78d1cbfeb4754df9758ef3d99aa3.txt | 2013-03-29 22:04 | 40K | |
![[TXT]](/icons/text.gif) | 9eeb0dfaf790e08cc2bcd8433b656816.txt | 2013-03-29 18:21 | 18K | |
![[TXT]](/icons/text.gif) | 96286a67a3ade429ef9d1804eadab404.txt | 2013-03-29 17:31 | 31K | |
![[ ]](/icons/layout.gif) | Predicting Stability of DNA Duplexes in Solutions Containing Magnesium and Monovalent Cations.pdf | 2013-03-29 13:31 | 1.3M | |
![[ ]](/icons/layout.gif) | Thermodynamics and NMR of Internal GT Mismatches in DNA.pdf | 2013-03-29 11:56 | 1.7M | |
![[ ]](/icons/layout.gif) | Effects of Sodium Ions on DNA Duplex Oligomers: Improved Predictions of Melting Temperatures.pdf | 2013-03-29 11:03 | 253K | |
![[ ]](/icons/layout.gif) | 7bcc57d4c29ce24a4b3d856414ae0089.pdf | 2013-03-29 09:45 | 147K | |
![[TXT]](/icons/text.gif) | b5f68ff1cd1f5306a7f3a0aab50f9fa3.txt | 2013-03-29 09:45 | 201K | |
![[ ]](/icons/layout.gif) | Large-Pore Apertures in a Series of Metal-Organic Frameworks.pdf | 2013-03-29 09:39 | 2.6M | |
![[TXT]](/icons/text.gif) | 788fffaa32f2b8b8118aa1d28c521831.txt | 2013-03-29 09:18 | 51K | |
![[ ]](/icons/layout.gif) | CASK and CaMKII function in the mushroom body _ neurons during Drosophila memory formation.pdf | 2013-03-28 23:37 | 4.2M | |
![[ ]](/icons/layout.gif) | On a Correct Measure of Inflation.pdf | 2013-03-28 15:25 | 448K | |
![[ ]](/icons/layout.gif) | 7a7ce44c21d597f927734b21124b9ad9.pdf | 2013-03-28 14:44 | 46K | |
![[ ]](/icons/layout.gif) | Neonicotinoid Pesticide Reduces Bumble Bee Colony Growth and Queen Production.pdf | 2013-03-28 12:51 | 187K | |
![[ ]](/icons/layout.gif) | Iridovirus and Microsporidian Linked to Honey Bee Colony Decline.pdf | 2013-03-28 12:30 | 499K | |
![[ ]](/icons/layout.gif) | Exposure to multiple cholinergic pesticides impairs olfactory learning and memory in honeybees.pdf | 2013-03-28 12:19 | 1.1M | |
![[TXT]](/icons/text.gif) | fe646e4a82cd869e7804b48af566310e.txt | 2013-03-28 11:33 | 14K | |
![[ ]](/icons/layout.gif) | CASE REPORT: Intestinal Malabsorption as a Manifestation of Obstructive Sleep Apnea.pdf | 2013-03-28 09:47 | 30K | |
![[ ]](/icons/layout.gif) | Direct Biological Conversion of Electrical Current into Methane by Electromethanogenesis.pdf | 2013-03-27 12:15 | 4.4M | |
![[ ]](/icons/layout.gif) | c983410f7dd648a984dbf3e58e19bc94.pdf | 2013-03-27 12:09 | 554K | |
![[ ]](/icons/layout.gif) | Molecular Networks of Human Muscle Adaptation to Exercise and Age.pdf | 2013-03-27 11:23 | 1.9M | |
![[ ]](/icons/layout.gif) | f4ddf8f1941ef88ddc59a5fc305f3e2b.pdf | 2013-03-27 10:46 | 659K | |
![[TXT]](/icons/text.gif) | b14f88282a48bbe4ff893b30820633a0.txt | 2013-03-27 10:45 | 11K | |
![[ ]](/icons/layout.gif) | Tesla coil discharges guided by femtosecond laser filaments in air.pdf | 2013-03-26 23:19 | 883K | |
![[ ]](/icons/layout.gif) | 820efc6e1b24bacba0d9e978ecac95f8.pdf | 2013-03-26 23:18 | 558K | |
![[TXT]](/icons/text.gif) | da724a6706fccb9e9614774e795be47c.txt | 2013-03-26 23:16 | 1.2K | |
![[TXT]](/icons/text.gif) | b49fabc978a97b632983dbb59c6c5850.txt | 2013-03-26 23:14 | 15K | |
![[ ]](/icons/layout.gif) | CRISPR RNA maturation by trans-encoded small RNA and host factor RNase III.pdf | 2013-03-26 08:18 | 772K | |
![[ ]](/icons/layout.gif) | A Programmable Dual-RNAGuided DNA Endonuclease in Adaptive Bacterial Immunity.pdf | 2013-03-26 08:18 | 2.4M | |
![[ ]](/icons/layout.gif) | d7833ae4c612df9102a65bfa694c67a4.pdf | 2013-03-26 08:17 | 4.0M | |
![[ ]](/icons/layout.gif) | Multiplex Genome Engineering Using CRISPR_Cas Systems.pdf | 2013-03-26 08:17 | 1.1M | |
![[ ]](/icons/layout.gif) | RNA-Guided Human Genome Engineering via Cas9.pdf | 2013-03-26 08:17 | 1.0M | |
![[TXT]](/icons/text.gif) | 2cd5f7306a88bc8fa0b85ada68431f6a.txt | 2013-03-26 06:19 | 13K | |
![[ ]](/icons/layout.gif) | LTP requires a reserve pool of glutamate receptors independent of subunit type.pdf | 2013-03-26 02:36 | 1.3M | |
![[ ]](/icons/layout.gif) | 6611c402eb354ee63d5a192e354d8ee6.pdf | 2013-03-26 02:07 | 425K | |
![[TXT]](/icons/text.gif) | 9cfd924647c123abd9ee79a7bf562db9.txt | 2013-03-25 21:23 | 75K | |
![[TXT]](/icons/text.gif) | 3e22c7ceee8ab858e8bc064ab07e9e0a.txt | 2013-03-25 21:22 | 5.8K | |
![[TXT]](/icons/text.gif) | The gel electrophoresis of DNA.txt | 2013-03-25 18:41 | 16K | |
![[ ]](/icons/layout.gif) | 57aab5cad8625c8b413baa3d39c069b6.pdf | 2013-03-25 18:38 | 381K | |
![[TXT]](/icons/text.gif) | b16020afcae6e58b52694b70b3d627b8.txt | 2013-03-25 18:35 | 15K | |
![[TXT]](/icons/text.gif) | c12baf5c5c7658c41c0110599eff8095.txt | 2013-03-25 18:34 | 15K | |
![[TXT]](/icons/text.gif) | eb539b0a9f0223d3a7514f5f5e394599.txt | 2013-03-25 18:26 | 28K | |
![[TXT]](/icons/text.gif) | bae2146a588663bdcbc033f0758f14c1.txt | 2013-03-25 18:26 | 28K | |
![[ ]](/icons/layout.gif) | Crystal structure of the human 2 adrenergic G-protein-coupled receptor.pdf | 2013-03-25 18:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Contribution of the MTHFR gene to the causal pathway for depression, anxiety and cognitive impairment in later life.pdf | 2013-03-25 13:21 | 181K | |
![[ ]](/icons/layout.gif) | 73d9a3b4c7bf9c8f525712ac66c0e46d.pdf | 2013-03-25 03:09 | 7.2M | |
![[ ]](/icons/layout.gif) | 5328bb92cefa879e87a1f55ccb3667c9.pdf | 2013-03-25 01:00 | 1.7M | |
![[ ]](/icons/layout.gif) | Trajectory generation and control for precise aggressive maneuvers with quadrotors.pdf | 2013-03-24 23:51 | 1.2M | |
![[ ]](/icons/layout.gif) | 56dc111cbf4502d5666c7f3dab6647fc.pdf | 2013-03-24 23:26 | 558K | |
![[ ]](/icons/layout.gif) | bd5390c058ee5a7a3ca4f80865eeafaf.pdf | 2013-03-24 23:26 | 558K | |
![[ ]](/icons/layout.gif) | Isolation, partial characterization, and antinutritional activity of a factor (pentosans) in rye grain.pdf | 2013-03-24 13:57 | 1.0M | |
![[ ]](/icons/layout.gif) | Incremental Sampling-based Algorithms for Optimal Motion Planning.pdf | 2013-03-24 13:22 | 9.0M | |
![[TXT]](/icons/text.gif) | da6a9693d3ff2079df0d35944f87db3e.txt | 2013-03-24 11:52 | 45K | |
![[ ]](/icons/layout.gif) | AMPA-receptor activation is involved in the antiamnesic effect of DM232 (unifiram) and DM235 (sunifiram).pdf | 2013-03-23 06:20 | 351K | |
![[TXT]](/icons/text.gif) | 3a12c61781a059c3f1e2e82de62e4a33.txt | 2013-03-23 06:06 | 12K | |
![[ ]](/icons/layout.gif) | DM235 (sunifiram): a novel nootropic with potential as a cognitive enhancer.pdf | 2013-03-23 06:05 | 121K | |
![[ ]](/icons/layout.gif) | Nanomaterials: Solid carbon, springy and light.pdf | 2013-03-23 06:05 | 245K | |
![[ ]](/icons/layout.gif) | Sodium chloride drives autoimmune disease by the induction of pathogenic TH17 cells.pdf | 2013-03-23 00:21 | 728K | |
![[ ]](/icons/layout.gif) | Bovid mortality profiles in paleoecological context falsify hypotheses of endurance running–hunting and passive scavenging by early Pleistocene hominins.pdf | 2013-03-22 15:20 | 858K | |
![[ ]](/icons/layout.gif) | 141e86946374cd8003d363f4f376b08c.pdf | 2013-03-22 01:37 | 4.9M | |
![[ ]](/icons/layout.gif) | Ron was wrong, Whit is right.pdf | 2013-03-22 00:05 | 464K | |
![[ ]](/icons/layout.gif) | DNA Gridiron Nanostructures Based on Four-Arm Junctions.pdf | 2013-03-21 21:52 | 6.2M | |
![[ ]](/icons/layout.gif) | 7d61543fe98c416d944b169a5363efad.pdf | 2013-03-21 14:34 | 1.2M | |
![[TXT]](/icons/text.gif) | 127d635bb54509cbe57f9da99ce45370.txt | 2013-03-21 14:32 | 14K | |
![[ ]](/icons/layout.gif) | Neuroplasticity Exercise-Induced Response of Peripheral Brain-Derived Neurotrophic Factor.pdf | 2013-03-21 12:46 | 330K | |
![[ ]](/icons/layout.gif) | Endurance running and the evolution of Homo.pdf | 2013-03-21 10:23 | 370K | |
![[ ]](/icons/layout.gif) | Effects of acute bouts of exercise on cognition.pdf | 2013-03-21 10:19 | 180K | |
![[TXT]](/icons/text.gif) | 90fa36f28a8c23b1aa62a8f6047e5d1f.txt | 2013-03-21 07:44 | 65K | |
![[TXT]](/icons/text.gif) | d5d0dbbe28675b253dbcf463989b4df7.txt | 2013-03-20 20:13 | 8.6K | |
![[TXT]](/icons/text.gif) | Generating Waves in Corticothalamocortical Networks.txt | 2013-03-20 20:12 | 16K | |
![[TXT]](/icons/text.gif) | Nav1.7 Voltage - Gated Sodium Channel.txt | 2013-03-20 19:47 | 16K | |
![[TXT]](/icons/text.gif) | 3aa9fdcfb5cf2caa308ece4020b2e48f.txt | 2013-03-20 14:33 | 14K | |
![[TXT]](/icons/text.gif) | c63bb4a0ba01f3d87954c5aaf92b8f99.txt | 2013-03-20 12:20 | 91K | |
![[TXT]](/icons/text.gif) | 2a7c31a26f6a1b12c34bde1578d73d0.txt | 2013-03-20 11:47 | 85K | |
![[ ]](/icons/layout.gif) | Accelerating compartmental modeling on a graphical processing unit.pdf | 2013-03-20 10:54 | 1.6M | |
![[ ]](/icons/layout.gif) | A Brain-to-Brain Interface for Real-Time Sharing of Sensorimotor Information.pdf | 2013-03-20 00:44 | 1.5M | |
![[ ]](/icons/layout.gif) | Whole-brain functional imaging at cellular resolution using light-sheet microscopy.pdf | 2013-03-20 00:44 | 3.3M | |
![[ ]](/icons/layout.gif) | Forebrain Engraftment by Human Glial Progenitor Cells Enhances Synaptic Plasticity and Learning in Adult Mice.pdf | 2013-03-20 00:44 | 2.6M | |
![[ ]](/icons/layout.gif) | 3bdb7aab10c90ff193445bc6e6a420bc.pdf | 2013-03-19 14:55 | 755K | |
![[TXT]](/icons/text.gif) | ac03b9acab835f37708c415c43a8ba51.txt | 2013-03-19 14:54 | 54K | |
![[ ]](/icons/layout.gif) | Neurobiological Effects of Transcranial Direct Current Stimulation: A Review.pdf | 2013-03-19 11:48 | 427K | |
![[ ]](/icons/layout.gif) | The discovery of a natural whale fall in the Antarctic deep sea.pdf | 2013-03-19 01:45 | 1.2M | |
![[ ]](/icons/layout.gif) | Induced Pluripotent Stem Cell-Derived Neural Cells Survive and Mature in the Nonhuman Primate Brain.pdf | 2013-03-19 01:43 | 1.1M | |
![[TXT]](/icons/text.gif) | Calcium-dependent bacteriophage DNA infection .txt | 2013-03-18 19:01 | 16K | |
![[ ]](/icons/layout.gif) | Combining two genomes in one cell: Stable cloning of the Synechocystis PCC6803 genome in the Bacillus subtilis 168 genome.pdf | 2013-03-18 16:54 | 736K | |
![[ ]](/icons/layout.gif) | ce42bf72b4663ee4ed53ddcbd4217381.pdf | 2013-03-18 15:57 | 351K | |
![[TXT]](/icons/text.gif) | d745145920b6fd18d81c4a8f3972e796.txt | 2013-03-18 15:01 | 83K | |
![[ ]](/icons/layout.gif) | First Distance-of-Flight Instrument: Opening a New Paradigm in Mass Spectrometry.pdf | 2013-03-18 11:00 | 537K | |
![[TXT]](/icons/text.gif) | 55c408a3035c83977e5c82d441cedb48.txt | 2013-03-17 18:54 | 40K | |
![[TXT]](/icons/text.gif) | b9e35454792711b1fe281cd91bc45067.txt | 2013-03-17 18:54 | 81K | |
![[ ]](/icons/layout.gif) | Postsynaptic protein phosphorylation and LTP.pdf | 2013-03-17 10:12 | 143K | |
![[ ]](/icons/layout.gif) | Genetic enhancement of learning and memory in mice.pdf | 2013-03-17 07:46 | 386K | |
![[TXT]](/icons/text.gif) | 7a06f6e42b39177e4a8eac3e4a866eeb.txt | 2013-03-17 06:34 | 45K | |
![[TXT]](/icons/text.gif) | 54cb45326c06325816aae24b19fa6f2e.txt | 2013-03-17 06:32 | 45K | |
![[ ]](/icons/layout.gif) | 7c29fa14004c46324e006c29507698e9.pdf | 2013-03-16 22:01 | 493K | |
![[TXT]](/icons/text.gif) | 6823b3f280a850d80f66cadf78472d32.txt | 2013-03-16 21:50 | 101K | |
![[TXT]](/icons/text.gif) | 33062adeb9b8d2e358c32fa088d962ff.txt | 2013-03-16 17:33 | 38K | |
![[ ]](/icons/layout.gif) | The use of pKZ1 mouse chromosomal inversion assay to study biological effects of environmental background radiation.pdf | 2013-03-16 17:11 | 759K | |
![[ ]](/icons/layout.gif) | 529af73d2514ef330dbb745d3a84eb89.pdf | 2013-03-16 00:28 | 1.4M | |
![[TXT]](/icons/text.gif) | 685c877b083bd7aeaf3f86ac28b8afd7.txt | 2013-03-16 00:28 | 612 | |
![[ ]](/icons/layout.gif) | Engineering microbes to sense and eradicate Pseudomonas aeruginosa, a human pathogen.pdf | 2013-03-15 00:40 | 4.2M | |
![[ ]](/icons/layout.gif) | Evolutionary biology: Twisting the tale of human evolution.pdf | 2013-03-14 21:58 | 412K | |
![[TXT]](/icons/text.gif) | 1cf3a02ddf1a80c6cfbbc35e9613d7e1.txt | 2013-03-14 12:48 | 38K | |
![[ ]](/icons/layout.gif) | Dihalocarbene insertions into carbon-hydrogen bonds of hydrocarbons and ethers.pdf | 2013-03-14 12:46 | 38K | |
![[TXT]](/icons/text.gif) | 44c132bff647d85bf12149c4566a19d3.txt | 2013-03-14 12:44 | 50K | |
![[TXT]](/icons/text.gif) | 59167d1f8c694956bd64d35e49247512.txt | 2013-03-14 12:44 | 13K | |
![[TXT]](/icons/text.gif) | 962685d182ca60ec44aa09a0b38565fc.txt | 2013-03-14 12:18 | 14K | |
![[TXT]](/icons/text.gif) | 8689e3f4b9a647d22b903e9c5fc1a2ed.txt | 2013-03-14 07:37 | 78K | |
![[ ]](/icons/layout.gif) | Cryopreservation of human brain tissue.pdf | 2013-03-14 06:37 | 1.7M | |
![[TXT]](/icons/text.gif) | 8d73d70ac33566f54258bc938e4c87a3.txt | 2013-03-13 22:17 | 16K | |
![[TXT]](/icons/text.gif) | 5e4111f00d28802ac70d954649063c61.txt | 2013-03-13 22:15 | 11K | |
![[TXT]](/icons/text.gif) | 5b94e4d93a9edcd913090e30bc3c3e1.txt | 2013-03-13 22:14 | 16K | |
![[ ]](/icons/layout.gif) | pdfparanoiasucks.pdf | 2013-03-12 19:40 | 1.3M | |
![[ ]](/icons/layout.gif) | Macroscale refrigeration by nanoscale electron transport.pdf | 2013-03-12 18:34 | 1.3M | |
![[ ]](/icons/layout.gif) | Atherosclerosis across 4000 years of human history: the Horus study of four ancient populations.pdf | 2013-03-12 16:26 | 1.3M | |
![[ ]](/icons/layout.gif) | 94d7961328aae9d579722c4e1859b4dd.pdf | 2013-03-12 16:24 | 1.3M | |
![[TXT]](/icons/text.gif) | e0e949c5101d667085a67e6267db31b8.txt | 2013-03-12 13:38 | 36K | |
![[ ]](/icons/layout.gif) | af96bd839f3a7057171014f33c07e1f1.pdf | 2013-03-12 13:27 | 110K | |
![[TXT]](/icons/text.gif) | 2621d84075498767606cf78265907fb4.txt | 2013-03-12 10:21 | 6.5K | |
![[TXT]](/icons/text.gif) | Atherosclerosis across 4000 years of human history: the Horus study of four ancient populations.txt | 2013-03-12 10:20 | 6.5K | |
![[TXT]](/icons/text.gif) | 299e2458fea8c4c675b2152eff0efe67.txt | 2013-03-11 14:01 | 15K | |
![[TXT]](/icons/text.gif) | A data path approach for testing microprocessors with a fault bound: the MC68000 case.txt | 2013-03-11 14:00 | 16K | |
![[TXT]](/icons/text.gif) | 92af9436c556aedb43a37e3737857d84.txt | 2013-03-11 06:16 | 51K | |
![[ ]](/icons/layout.gif) | c8dc6374720b60824a3b0e4a66835c52.pdf | 2013-03-11 01:38 | 18M | |
![[ ]](/icons/layout.gif) | 2032a896e6378c1bcd4d00c623a59627.pdf | 2013-03-10 15:10 | 102K | |
![[ ]](/icons/layout.gif) | Hypnotic effects and binding studies for GABA.pdf | 2013-03-10 14:08 | 463K | |
![[TXT]](/icons/text.gif) | 967fa34cae433f3befde7cf831de8462.txt | 2013-03-10 00:50 | 52K | |
![[TXT]](/icons/text.gif) | 451bd7b93489ca402babb4da7939f3d9.txt | 2013-03-09 23:01 | 34K | |
![[ ]](/icons/layout.gif) | Evaluation of the neurotoxicity of .pdf | 2013-03-09 14:47 | 541K | |
![[TXT]](/icons/text.gif) | 1d1e4a69ea0bc26d6f994875f0b430ac.txt | 2013-03-09 14:46 | 6.6K | |
![[TXT]](/icons/text.gif) | 9276ddd0a17ed29e7300db40eafe1b9e.txt | 2013-03-09 14:46 | 16K | |
![[ ]](/icons/layout.gif) | Inhibition of plasma membrane monoamine transporters by β-ketoamphetamines.pdf | 2013-03-09 14:42 | 108K | |
![[ ]](/icons/layout.gif) | Radiosynthesis and in vivo evaluation of a series of substituted 11C-phenethylamines as 5-HT2A agonist PET tracers.pdf | 2013-03-09 14:30 | 722K | |
![[ ]](/icons/layout.gif) | Three Classes of Newtonian Three-Body Planar Periodic Orbits.pdf | 2013-03-09 13:16 | 603K | |
![[TXT]](/icons/text.gif) | New hope for type 2 diabetics: Targeting insulin resistance through the immune modulation of stem cells.txt | 2013-03-09 12:26 | 16K | |
![[ ]](/icons/layout.gif) | Caffeine in Floral Nectar Enhances a Pollinator's Memory of Reward.pdf | 2013-03-09 11:17 | 949K | |
![[TXT]](/icons/text.gif) | 63c1bd5b31c57ed764ec5495539062a9.txt | 2013-03-08 11:20 | 12K | |
![[TXT]](/icons/text.gif) | 1251a83dae59ee7768398ff7ad26739.txt | 2013-03-08 11:19 | 12K | |
![[TXT]](/icons/text.gif) | ca8a08388f9584fd29acc68f4814d1b3.txt | 2013-03-08 11:15 | 78 | |
![[ ]](/icons/layout.gif) | f5f364bbf593ae2415e9e15cc432d6.pdf | 2013-03-08 08:56 | 1.4M | |
![[TXT]](/icons/text.gif) | The human metabolic response to chronic ketosis without caloric restriction: Preservation of submaximal exercise capability with reduced carbohydrate oxidation .txt | 2013-03-08 01:41 | 16K | |
![[ ]](/icons/layout.gif) | Ketogenic diet does not affect strength performance in elite artistic gymnasts.pdf | 2013-03-08 01:39 | 235K | |
![[TXT]](/icons/text.gif) | 8ce6781d307149c5375f0c769673e1cc.txt | 2013-03-08 01:23 | 206 | |
![[TXT]](/icons/text.gif) | 2b6a92b18c3987b21078f982a8f33164.txt | 2013-03-07 20:37 | 30K | |
![[TXT]](/icons/text.gif) | 64f4f85846d33a20dfd117b4dd21fef0.txt | 2013-03-07 20:33 | 41K | |
![[TXT]](/icons/text.gif) | 4e4ada23e15163aa2dfa46552b687012.txt | 2013-03-07 20:33 | 41K | |
![[ ]](/icons/layout.gif) | Closed-Loop, Multichannel Experimentation Using the Open-Source NeuroRighter Electrophysiology Platform.pdf | 2013-03-07 12:59 | 3.8M | |
![[TXT]](/icons/text.gif) | 6aa77bdb491c654dcd7be4299d7130fd.txt | 2013-03-07 10:51 | 35K | |
![[TXT]](/icons/text.gif) | 5bb6d471cb30b557cce1be9eaee09c50.txt | 2013-03-07 02:31 | 15K | |
![[TXT]](/icons/text.gif) | 1.2 Cantor and Schimmel – 30 Years Later.txt | 2013-03-07 02:31 | 16K | |
![[TXT]](/icons/text.gif) | 1e7cf138b3f168d44509d1f9ea705447.txt | 2013-03-07 02:30 | 161K | |
![[TXT]](/icons/text.gif) | 6ad79d7c014b31806034e158b2a990b2.txt | 2013-03-07 02:30 | 161K | |
![[ ]](/icons/layout.gif) | Patch-Clamp Recordings from Lateral Line Neuromast Hair Cells of the Living Zebrafish.pdf | 2013-03-07 00:25 | 1.0M | |
![[ ]](/icons/layout.gif) | b594add7ad6f4c3c819df96e9ade9e3d.pdf | 2013-03-06 14:36 | 371K | |
![[ ]](/icons/layout.gif) | Monitoring local synaptic activity with astrocytic patch pipettes.pdf | 2013-03-06 14:31 | 1.0M | |
![[TXT]](/icons/text.gif) | e09e043e8f91a13687790044a07f10a4.txt | 2013-03-06 14:30 | 1.6K | |
![[TXT]](/icons/text.gif) | Electro-insertion of xeno-glycophorin into the red blood cell membrane.txt | 2013-03-06 14:30 | 16K | |
![[TXT]](/icons/text.gif) | 8fe835de5c5f862b01b0d0b3bab503c6.txt | 2013-03-06 10:01 | 17K | |
![[TXT]](/icons/text.gif) | 180b7d891488ac700cc1eaa612403ecc.txt | 2013-03-06 09:56 | 16K | |
![[TXT]](/icons/text.gif) | 564803165a1022465883245b2a81ba01.txt | 2013-03-05 20:23 | 15K | |
![[TXT]](/icons/text.gif) | An analysis of solar radio burst events on December 1, 2004.txt | 2013-03-05 20:21 | 16K | |
![[ ]](/icons/layout.gif) | Erratum to “An analysis of solar radio burst events on December 1, 2004” [Adv. Space Res. 39 (2007) 1441–1446].pdf | 2013-03-05 20:17 | 55K | |
![[ ]](/icons/layout.gif) | Shared genetics among major psychiatric disorders.pdf | 2013-03-05 16:58 | 160K | |
![[TXT]](/icons/text.gif) | 1cd76839b98dc52d0bb6093296532c78.txt | 2013-03-05 16:54 | 35K | |
![[TXT]](/icons/text.gif) | 7a416085c610db7b6e798d0828c8594a.txt | 2013-03-05 16:54 | 35K | |
![[ ]](/icons/layout.gif) | Modeling Electroporation in a Single Cell.pdf | 2013-03-05 14:09 | 233K | |
![[ ]](/icons/layout.gif) | A practical assessment of transdermal drug delivery by skin electroporation.pdf | 2013-03-05 14:09 | 386K | |
![[ ]](/icons/layout.gif) | Sonoporation: Mechanical DNA Delivery by Ultrasonic Cavitation.pdf | 2013-03-05 14:08 | 300K | |
![[ ]](/icons/layout.gif) | cc034c0366e6e89c3196dbba680d66e4.pdf | 2013-03-05 09:38 | 193K | |
![[TXT]](/icons/text.gif) | 9f22e0d16dd80a5bbef3c48314bd324c.txt | 2013-03-05 09:36 | 16K | |
![[TXT]](/icons/text.gif) | The Intestinal Microbiome: Relationship to Type 1 Diabetes.txt | 2013-03-05 09:36 | 16K | |
![[TXT]](/icons/text.gif) | 9d2b31452893eed081194d289f512f2b.txt | 2013-03-05 09:32 | 34K | |
![[ ]](/icons/layout.gif) | b98d53cca276840555c03898d48b4fd4.pdf | 2013-03-05 08:51 | 1.3M | |
![[ ]](/icons/layout.gif) | On-chip analysis of C. elegans muscular forces and locomotion patterns in microstructured environments.pdf | 2013-03-05 08:44 | 1.3M | |
![[ ]](/icons/layout.gif) | A community-driven global reconstruction of human metabolism.pdf | 2013-03-04 16:40 | 1.7M | |
![[ ]](/icons/layout.gif) | Bifunctional cis-Abienol Synthase from Abies balsamea Discovered by Transcriptome Sequencing and Its Implications for Diterpenoid Fragrance Production.pdf | 2013-03-04 02:38 | 2.3M | |
![[ ]](/icons/layout.gif) | Sixty-five years of solar radioastronomy: flares, coronal mass ejections and SunEarth connection.pdf | 2013-03-03 16:15 | 8.4M | |
![[ ]](/icons/layout.gif) | Sex-specific, male-line transgenerational responses in humans.pdf | 2013-03-02 13:59 | 112K | |
![[TXT]](/icons/text.gif) | 596d7dbd5f7503984c699e48b69ce92c.txt | 2013-03-01 04:35 | 45K | |
![[TXT]](/icons/text.gif) | The circulatory systemic environment as a modulator of neurogenesis and brain aging.txt | 2013-02-28 19:38 | 16K | |
![[TXT]](/icons/text.gif) | fa27220329e2cbaa9e95fe9a375eaef7.txt | 2013-02-28 18:33 | 78K | |
![[ ]](/icons/layout.gif) | Lifespan of neurons is uncoupled from organismal lifespan.pdf | 2013-02-28 18:26 | 1.6M | |
![[ ]](/icons/layout.gif) | The Relationship of Sugar to Population-Level Diabetes Prevalence: An Econometric Analysis of Repeated Cross-Sectional Data.pdf | 2013-02-28 17:11 | 294K | |
![[ ]](/icons/layout.gif) | f995605864ba0775c7236566ca2a8b2a.pdf | 2013-02-28 15:00 | 1.0M | |
![[TXT]](/icons/text.gif) | d93db375cdaf05e23287d3685dbc697e.txt | 2013-02-28 15:00 | 12K | |
![[TXT]](/icons/text.gif) | f711681d70717b350c59ab267ab0fba.txt | 2013-02-28 03:02 | 43K | |
![[TXT]](/icons/text.gif) | eefa538f3257afae3f936582476eac2c.txt | 2013-02-28 03:00 | 41K | |
![[ ]](/icons/layout.gif) | 933574fadfa06a221516c32df2654d1a.pdf | 2013-02-27 21:43 | 54K | |
![[ ]](/icons/layout.gif) | Low Cost UV Laser Direct Write Photolithography System for Rapid Prototyping of Microsystems.pdf | 2013-02-27 21:40 | 54K | |
![[ ]](/icons/layout.gif) | Metabolic Factors Limiting Performance in Marathon Runners.pdf | 2013-02-26 16:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Phenomenological Model for Predicting the Catabolic Potential of an Arbitrary Nutrient.pdf | 2013-02-26 16:23 | 1.5M | |
![[ ]](/icons/layout.gif) | Estimating the Continuous-Time Dynamics of Energy and Fat Metabolism in Mice.pdf | 2013-02-26 15:53 | 315K | |
![[TXT]](/icons/text.gif) | acc471c9c4e01cb8350ef81ccb306d32.txt | 2013-02-26 11:59 | 61K | |
![[TXT]](/icons/text.gif) | 45580c4306964a8c255a849acfe3cfe1.txt | 2013-02-26 09:45 | 62K | |
![[TXT]](/icons/text.gif) | 5d3f11f54d6c85a2c479fe9e8bacb281.txt | 2013-02-26 09:45 | 66K | |
![[ ]](/icons/layout.gif) | Modeling Metabolic Adaptations and Energy Regulation in Humans*.pdf | 2013-02-26 03:19 | 499K | |
![[TXT]](/icons/text.gif) | e6bc0806e6d56ec1a99b2517160b971a.txt | 2013-02-26 03:17 | 1.2K | |
![[TXT]](/icons/text.gif) | 1a7d281d4f42e0977653a14c160faf26.txt | 2013-02-26 03:17 | 1.2K | |
![[TXT]](/icons/text.gif) | 4cf577b8dc864739140abaae58de92e8.txt | 2013-02-26 03:16 | 54K | |
![[TXT]](/icons/text.gif) | 929b8c28f7f6144de6d1822b00161e95.txt | 2013-02-26 02:34 | 38K | |
![[ ]](/icons/layout.gif) | The Effect of Dietary Fat on LDL Size Is Influenced by Apolipoprotein E Genotype in Healthy Subjects.pdf | 2013-02-26 01:38 | 126K | |
![[ ]](/icons/layout.gif) | Protection of LDL from oxidation by olive oil polyphenols is associated with a downregulation of CD40-ligand expression and its downstream products in vivo in humans.pdf | 2013-02-25 22:48 | 308K | |
![[TXT]](/icons/text.gif) | bbcaf06ae8c579b591a35716bb40f247.txt | 2013-02-25 02:07 | 11K | |
![[ ]](/icons/layout.gif) | Economic and Health Consequences of Selling a Kidney in India.pdf | 2013-02-24 20:59 | 89K | |
![[ ]](/icons/layout.gif) | Rapid casting of patterned vascular networks for perfusable engineered three-dimensional tissues.pdf | 2013-02-24 18:21 | 3.1M | |
![[TXT]](/icons/text.gif) | c99afd5c8f20e34f56a0df4dd0e73119.txt | 2013-02-24 16:30 | 1.7K | |
![[TXT]](/icons/text.gif) | a634958d080b65fee66276a49f0da37a.txt | 2013-02-24 16:26 | 5.3K | |
![[ ]](/icons/layout.gif) | Recreational Use of Mephedrone (4-Methylmethcathinone, 4-MMC) with Associated Sympathomimetic Toxicity.pdf | 2013-02-23 18:33 | 101K | |
![[TXT]](/icons/text.gif) | 6e8c955d5051307fa4c4d588ffd87014.txt | 2013-02-23 18:29 | 16K | |
![[TXT]](/icons/text.gif) | 79fc70c77db476349ea6a47e892335a1.txt | 2013-02-23 18:29 | 16K | |
![[TXT]](/icons/text.gif) | 799549f98745afcfa432442402c4b881.txt | 2013-02-23 18:29 | 16K | |
![[ ]](/icons/layout.gif) | myescience.pdf | 2013-02-23 14:12 | 83K | |
![[TXT]](/icons/text.gif) | 395b02db5127aa6cf2fe78ae28a7d2d4.txt | 2013-02-23 11:04 | 40K | |
![[ ]](/icons/layout.gif) | Atmospheric oxygen level and the evolution of insect body size.pdf | 2013-02-23 10:54 | 441K | |
![[TXT]](/icons/text.gif) | 74213320c17fd8e69ae059968badcfa4.txt | 2013-02-22 01:00 | 18K | |
![[TXT]](/icons/text.gif) | fe3aa24f8edff771949659ac903ac68c.txt | 2013-02-21 16:15 | 81K | |
![[ ]](/icons/layout.gif) | Observational Learning of Food Aversions in Red-Winged Blackbirds (Agelaius phoeniceus).pdf | 2013-02-21 15:34 | 286K | |
![[ ]](/icons/layout.gif) | 5cfd5c545d6e94e96350a9e2703c6c25.pdf | 2013-02-21 15:21 | 286K | |
![[TXT]](/icons/text.gif) | b60a207b21fbe7243351064f594d9208.txt | 2013-02-21 15:20 | 22K | |
![[TXT]](/icons/text.gif) | bdaff5ccb86d10ad6db9eb48c526c02d.txt | 2013-02-21 15:19 | 22K | |
![[TXT]](/icons/text.gif) | 553773a845dfd0117ada0d07b3fa0f6f.txt | 2013-02-21 15:18 | 22K | |
![[TXT]](/icons/text.gif) | 4225f8c66fce51e7a7febf76118f4224.txt | 2013-02-21 15:17 | 22K | |
![[TXT]](/icons/text.gif) | be66594e50123898daf0f5ccecea34e2.txt | 2013-02-21 15:14 | 22K | |
![[ ]](/icons/layout.gif) | 6a52f7902bb94906f57738a8832f0466.pdf | 2013-02-21 14:57 | 646K | |
![[ ]](/icons/layout.gif) | bb81064ac338e9fc34f276d52b9a47a8.pdf | 2013-02-21 14:54 | 286K | |
![[TXT]](/icons/text.gif) | 624f5c93df2e88011aea8a6ee4ac992e.txt | 2013-02-21 14:54 | 2.3K | |
![[TXT]](/icons/text.gif) | 876c34be905386d845d3b781e554a23b.txt | 2013-02-21 14:53 | 22K | |
![[ ]](/icons/layout.gif) | Searching for simplicity in the analysis of neurons and behavior.pdf | 2013-02-21 10:58 | 1.2M | |
![[ ]](/icons/layout.gif) | a03a62027ef4dda448b459a96669cd36.pdf | 2013-02-21 08:17 | 434K | |
![[ ]](/icons/layout.gif) | b2b845ef432ceccbb177eaeddd6cfbd4.pdf | 2013-02-21 03:14 | 742K | |
![[TXT]](/icons/text.gif) | f1f6e913fe7608fb49f1e124084ea348.txt | 2013-02-20 18:17 | 15K | |
![[TXT]](/icons/text.gif) | 14202c1cfed49bfcbe1aab9f20b35d14.txt | 2013-02-20 18:15 | 55K | |
![[TXT]](/icons/text.gif) | e1562540b2561c03ad6ecce85535e92.txt | 2013-02-20 18:15 | 87K | |
![[ ]](/icons/layout.gif) | Dietary Impact on Biliary Lipids and Gallstones.pdf | 2013-02-20 17:51 | 622K | |
![[TXT]](/icons/text.gif) | 12ebace9a225e88bc802c763eecde267.txt | 2013-02-20 17:46 | 87K | |
![[ ]](/icons/layout.gif) | d93585683a455c8ea6a6b92f8b3e40c6.pdf | 2013-02-20 13:25 | 544K | |
![[ ]](/icons/layout.gif) | Optogenetic stimulation of a hippocampal engram activates fear memory recall.pdf | 2013-02-20 13:23 | 1.2M | |
![[TXT]](/icons/text.gif) | d2582afa8af58f5393d36be2fd52a896.txt | 2013-02-20 13:23 | 12K | |
![[ ]](/icons/layout.gif) | A fractional programming approach to efficient DNA melting temperature calculation.pdf | 2013-02-20 12:46 | 109K | |
![[ ]](/icons/layout.gif) | 88410233f8614b91408740954a4cf9fc.pdf | 2013-02-20 11:45 | 202K | |
![[ ]](/icons/layout.gif) | Kinetics of RNA Degradation by Specific Base Catalysis of Transesterification Involving the 2-Hydroxyl Group.pdf | 2013-02-20 08:37 | 110K | |
![[TXT]](/icons/text.gif) | a556846176f5ce3c2a07bb72805ee252.txt | 2013-02-20 06:53 | 16K | |
![[ ]](/icons/layout.gif) | Isothermal reactions for the amplification of oligonucleotides.pdf | 2013-02-19 21:33 | 265K | |
![[TXT]](/icons/text.gif) | b8635e4f29b73e81d6cf03102abaaa60.txt | 2013-02-19 02:32 | 15K | |
![[TXT]](/icons/text.gif) | f7d6a932a654ce2ba6be65dedda30af2.txt | 2013-02-19 02:32 | 16K | |
![[TXT]](/icons/text.gif) | How to prevent losses of protein by adsorption to glass and plastic .txt | 2013-02-19 02:30 | 16K | |
![[ ]](/icons/layout.gif) | Autologous olfactory mucosal cell transplants in clinical spinal cord injury: a randomized double-blinded trial in a canine translational model.pdf | 2013-02-18 18:30 | 756K | |
![[ ]](/icons/layout.gif) | A Hydrodynamic Model for Electroosmosis.pdf | 2013-02-18 15:37 | 1.3M | |
![[TXT]](/icons/text.gif) | a22020a489c72436dd55d05902b65362.txt | 2013-02-18 15:36 | 14K | |
![[TXT]](/icons/text.gif) | c0e81dc4432fb4e931db7e00929ea275.txt | 2013-02-18 15:36 | 14K | |
![[ ]](/icons/layout.gif) | Cellular complexity captured in durable silica biocomposites.pdf | 2013-02-18 12:04 | 2.5M | |
![[ ]](/icons/layout.gif) | The Brain Activity Map Project and the Challenge of Functional Connectomics.pdf | 2013-02-18 07:35 | 51K | |
![[TXT]](/icons/text.gif) | 93ba4fc915f86b2dd4904dc85f489508.txt | 2013-02-18 03:17 | 54K | |
![[TXT]](/icons/text.gif) | e4bc3efcad19ccaf66f824c9ce2c8b39.txt | 2013-02-18 03:16 | 54K | |
![[ ]](/icons/layout.gif) | 2620346323c13aaf83cc73b966566db9.pdf | 2013-02-17 17:09 | 639K | |
![[TXT]](/icons/text.gif) | 3d7cac650a712c41120400d26312370.txt | 2013-02-17 17:08 | 14K | |
![[TXT]](/icons/text.gif) | 721ed37cc117a618449baf5f2d95ca81.txt | 2013-02-17 17:07 | 275 | |
![[TXT]](/icons/text.gif) | 7ad9bd3dc682321c87cd5b29380b33cb.txt | 2013-02-17 17:06 | 275 | |
![[TXT]](/icons/text.gif) | 2a0a8b3e6bce337720cd856bf49fac38.txt | 2013-02-17 17:06 | 14K | |
![[TXT]](/icons/text.gif) | 3bc6cb6df74e0e38c987b68f027b3850.txt | 2013-02-17 17:05 | 14K | |
![[TXT]](/icons/text.gif) | 1dcf3e73a00fc054b5829ff7b79961be.txt | 2013-02-17 15:45 | 39K | |
![[TXT]](/icons/text.gif) | 69979b488144531f99614dc91b2791c3.txt | 2013-02-17 15:45 | 39K | |
![[ ]](/icons/layout.gif) | Radial motion into an Einstein–Rosen bridge.pdf | 2013-02-16 19:25 | 206K | |
![[ ]](/icons/layout.gif) | Chain length determination of small double- and single-stranded DNA molecules by polyacrylamide gel electrophoresis.pdf | 2013-02-15 20:50 | 2.2M | |
![[ ]](/icons/layout.gif) | Analysis of resolution in DNA sequencing by capillary gel electrophoresis.pdf | 2013-02-15 20:46 | 1.0M | |
![[TXT]](/icons/text.gif) | 9290087e7f8e79bbfc211b17b085bf8a.txt | 2013-02-15 15:42 | 26K | |
![[TXT]](/icons/text.gif) | f8014bac78038f967709f7cc939d0bd8.txt | 2013-02-15 15:42 | 26K | |
![[TXT]](/icons/text.gif) | c3763bacaf5e38a22fbfdcf01dd8e804.txt | 2013-02-14 18:17 | 28K | |
![[ ]](/icons/layout.gif) | Neuroendocrine and behavioral effects of high-dose anabolic steroid administration in male normal volunteers.pdf | 2013-02-14 17:51 | 83K | |
![[TXT]](/icons/text.gif) | 78289f60d27e97973ee4cf6b2ab0017b.txt | 2013-02-14 17:50 | 45K | |
![[TXT]](/icons/text.gif) | 43db8e819952975eb43e8f6a2c56e002.txt | 2013-02-14 14:42 | 26K | |
![[TXT]](/icons/text.gif) | 47d10e765596d3ec2eed80676266f272.txt | 2013-02-14 14:42 | 26K | |
![[ ]](/icons/layout.gif) | 37083933a3ea7dff998d78616918def6.pdf | 2013-02-14 01:17 | 1.9M | |
![[ ]](/icons/layout.gif) | Buckled-type valves integrated by parylene micro-tubes .pdf | 2013-02-13 18:44 | 482K | |
![[ ]](/icons/layout.gif) | Generation of Induced Pluripotent Stem Cells from Urine.pdf | 2013-02-13 17:35 | 1.2M | |
![[TXT]](/icons/text.gif) | ed47ec5170f7d965b71ed031089e8442.txt | 2013-02-13 17:33 | 77K | |
![[ ]](/icons/layout.gif) | The unreasonable effectiveness of my self-experimentation.pdf | 2013-02-13 16:11 | 262K | |
![[ ]](/icons/layout.gif) | Robust Short-Term Memory without Synaptic Learning.pdf | 2013-02-13 14:57 | 515K | |
![[ ]](/icons/layout.gif) | System-wide Rewiring Underlies Behavioral Differences in Predatory and Bacterial-Feeding Nematodes.pdf | 2013-02-13 14:55 | 1.6M | |
![[ ]](/icons/layout.gif) | d7780918d5a9afbc18cf1b255ef035ce.pdf | 2013-02-13 13:12 | 239K | |
![[ ]](/icons/layout.gif) | 5d621e5501b976c228062d92946b3cde.pdf | 2013-02-13 12:59 | 663K | |
![[ ]](/icons/layout.gif) | edfdd2ce0e54e4ad7e04faac7bf69674.pdf | 2013-02-13 11:24 | 1.7M | |
![[TXT]](/icons/text.gif) | 17afcd9446a32d8bbe3bf3950745e01c.txt | 2013-02-13 11:24 | 8.6K | |
![[ ]](/icons/layout.gif) | a29da6d6b1bab6a6545c1be705004e9e.pdf | 2013-02-13 01:18 | 4.1M | |
![[ ]](/icons/layout.gif) | 7d471dde57f83432846ef4537b4dbf85.pdf | 2013-02-12 10:19 | 6.9M | |
![[ ]](/icons/layout.gif) | Ultrathick SU-8 fabrication for microreciprocating engines.pdf | 2013-02-11 20:21 | 307K | |
![[ ]](/icons/layout.gif) | Microfabrication of ultra-thick SU-8 photoresist for microengines.pdf | 2013-02-11 20:21 | 339K | |
![[ ]](/icons/layout.gif) | Dielectric Properties of Polyelectrolyte Solutions.pdf | 2013-02-11 08:07 | 892K | |
![[ ]](/icons/layout.gif) | 70ef3b455c7ff4bcc04334d138c74196.pdf | 2013-02-11 02:32 | 307K | |
![[TXT]](/icons/text.gif) | f05e72503d68336430aef486bdcae43a.txt | 2013-02-11 02:19 | 121K | |
![[TXT]](/icons/text.gif) | c0d71df0cd1ac8c612802daf86b52512.txt | 2013-02-10 19:20 | 64K | |
![[ ]](/icons/layout.gif) | Connecting a Connectome to Behavior: An Ensemble of Neuroanatomical Models of C. elegans Klinotaxis.pdf | 2013-02-10 15:43 | 2.6M | |
![[ ]](/icons/layout.gif) | 9f951fbbfa16b944fe06c2bee81c5b4c.pdf | 2013-02-10 04:40 | 310K | |
![[ ]](/icons/layout.gif) | 8a1042fadc83848c76d5695b0dd0d735.pdf | 2013-02-10 04:40 | 310K | |
![[TXT]](/icons/text.gif) | d22d75f93c7b2051dbff039c354b43f4.txt | 2013-02-10 04:39 | 13K | |
![[TXT]](/icons/text.gif) | 7c89bfc9f3002f92e97e79fcdbe02a70.txt | 2013-02-10 04:39 | 249 | |
![[TXT]](/icons/text.gif) | b52a7244a7225c0f72b5c28b417abbe2.txt | 2013-02-10 04:38 | 13K | |
![[TXT]](/icons/text.gif) | bbef73ea617b28cd867cd0349f5b27ab.txt | 2013-02-10 04:36 | 13K | |
![[TXT]](/icons/text.gif) | d5377c6dd107cf3e87f9ea67f5ae785d.txt | 2013-02-10 01:23 | 15K | |
![[TXT]](/icons/text.gif) | Basic characteristics and applications of aerosil.txt | 2013-02-10 01:23 | 16K | |
![[ ]](/icons/layout.gif) | Arylsulfonyltetrazoles, new coupling reagents and further improvements in the triester method for the synthesis of deoxyribooligonucleotides..pdf | 2013-02-09 14:33 | 1.8M | |
![[TXT]](/icons/text.gif) | 916cc90de1b21532497745c92b22a024.txt | 2013-02-09 14:30 | 64K | |
![[TXT]](/icons/text.gif) | fd596fd1c03afbb1e4b9376205a24358.txt | 2013-02-09 14:30 | 64K | |
![[ ]](/icons/layout.gif) | 5c1d69cb8d37a5b65d65263f3c38e7f6.pdf | 2013-02-09 06:06 | 333K | |
![[ ]](/icons/layout.gif) | b8ec36532f08bd88de9595fd64aeabdb.pdf | 2013-02-09 06:06 | 333K | |
![[ ]](/icons/layout.gif) | Eddy current measurements on ultrapure molybdenum and rhenium.pdf | 2013-02-09 06:06 | 381K | |
![[TXT]](/icons/text.gif) | e6ea552abbdb443c9cd17824e6ea714f.txt | 2013-02-09 06:04 | 77K | |
![[ ]](/icons/layout.gif) | 4180ba20e49415be9c124b39e06ce85.pdf | 2013-02-09 06:04 | 381K | |
![[TXT]](/icons/text.gif) | 46dd955c976048c8828944f49a5a87b9.txt | 2013-02-09 06:02 | 141K | |
![[ ]](/icons/layout.gif) | b9779d52432e726d93c076fd89f958c.pdf | 2013-02-09 05:48 | 539K | |
![[ ]](/icons/layout.gif) | 1f2af3482983ac6f6b37ac633be47e72.pdf | 2013-02-09 05:41 | 143K | |
![[ ]](/icons/layout.gif) | f2b98fd7b1b8c86d5e4c2857f20d1c78.pdf | 2013-02-09 05:40 | 540K | |
![[TXT]](/icons/text.gif) | bcb8504217d4370ef255135c3cd34296.txt | 2013-02-09 05:30 | 151K | |
![[ ]](/icons/layout.gif) | 4fb2c10c1dda35a323bc087dc4ec07a4.pdf | 2013-02-09 05:29 | 153K | |
![[TXT]](/icons/text.gif) | 7fe76aecea63157653ef16d389c77664.txt | 2013-02-09 05:28 | 77K | |
![[TXT]](/icons/text.gif) | 98c3e9c2e78fda8ce68ef3aaa6aab4fc.txt | 2013-02-09 05:25 | 85K | |
![[TXT]](/icons/text.gif) | fe174418a253c43d0f8a5087f97d0f2c.txt | 2013-02-09 05:24 | 85K | |
![[TXT]](/icons/text.gif) | b81236c659918f1462daeef9734965a.txt | 2013-02-09 01:33 | 44K | |
![[ ]](/icons/layout.gif) | Electrochemical Detection for Paper-Based Microfluidics.pdf | 2013-02-08 17:03 | 3.6M | |
![[TXT]](/icons/text.gif) | 6d9863111a6b756e8e6d9329a176009d.txt | 2013-02-08 13:27 | 21K | |
![[TXT]](/icons/text.gif) | ac4a3a65066eb796250c17ce652809e6.txt | 2013-02-08 13:27 | 7.4K | |
![[ ]](/icons/layout.gif) | b2dcce881ad3694a94e73b44083f8ae5.pdf | 2013-02-08 02:48 | 587K | |
![[ ]](/icons/layout.gif) | da14c25a66a3b15cafbe8565531edeed.pdf | 2013-02-08 02:45 | 587K | |
![[TXT]](/icons/text.gif) | e79cdca39ca8ec78bcc19d72bde32cf5.txt | 2013-02-08 02:42 | 70K | |
![[TXT]](/icons/text.gif) | 91e0d6406031e8fd1da7f4e5c009b8f8.txt | 2013-02-08 02:38 | 1.2K | |
![[TXT]](/icons/text.gif) | b8018746948ad222896cb1d3a5d25377.txt | 2013-02-08 02:33 | 1.2K | |
![[TXT]](/icons/text.gif) | 43fb17ccb213e6ccfd0d3d010f846617.txt | 2013-02-08 02:31 | 1.2K | |
![[TXT]](/icons/text.gif) | b1fcb18f9dae32146c45a84e7a9d617c.txt | 2013-02-08 02:24 | 1.2K | |
![[ ]](/icons/layout.gif) | 411bfb5815fdd38dce64d67a3d4dd59b.pdf | 2013-02-08 02:22 | 587K | |
![[TXT]](/icons/text.gif) | 26cf2eb5ba41c463a16cc7c00823bac1.txt | 2013-02-08 02:22 | 1.2K | |
![[TXT]](/icons/text.gif) | e4f1417cb39f772faeb35a3d56f559f3.txt | 2013-02-08 02:18 | 1.2K | |
![[ ]](/icons/layout.gif) | 3a9428ced5353164aa42c385e823f66a.pdf | 2013-02-08 02:11 | 1.0M | |
![[TXT]](/icons/text.gif) | dbee895ccc30db8fcd5630eebf7184f3.txt | 2013-02-08 02:10 | 1.2K | |
![[ ]](/icons/layout.gif) | 9353712cb2e6e26e9b83725f7c4c20d8.pdf | 2013-02-08 01:22 | 131K | |
![[TXT]](/icons/text.gif) | ef740d96e21a66fc1cc8b219575729fb.txt | 2013-02-08 01:22 | 1.2K | |
![[ ]](/icons/layout.gif) | 645fccb72fee4c4e026e0edff028ed9c.pdf | 2013-02-08 01:16 | 279K | |
![[TXT]](/icons/text.gif) | a28c1eb3c7b19a872e63638fe51da48a.txt | 2013-02-08 01:15 | 1.2K | |
![[TXT]](/icons/text.gif) | 2aaf9554321254c97c3e42030a102efd.txt | 2013-02-07 12:18 | 15K | |
![[TXT]](/icons/text.gif) | Loss of Dickkopf-1 Restores Neurogenesis in Old Age and Counteracts Cognitive Decline.txt | 2013-02-07 12:18 | 16K | |
![[ ]](/icons/layout.gif) | Turn It Up, Dear.pdf | 2013-02-07 01:50 | 101K | |
![[TXT]](/icons/text.gif) | f4cb36d5d802e641d6692aee6ba1e489.txt | 2013-02-06 18:00 | 191K | |
![[ ]](/icons/layout.gif) | 16b9058f19ca6f2d3c953925c8e3347c.pdf | 2013-02-06 17:44 | 884K | |
![[ ]](/icons/layout.gif) | 55f351b7ffafdd49e29774b7ca4713bc.pdf | 2013-02-06 17:05 | 331K | |
![[ ]](/icons/layout.gif) | 84da3887ce9c60f4ecc97d5f8ae7fd67.pdf | 2013-02-06 17:05 | 331K | |
![[TXT]](/icons/text.gif) | 16064b82e1267fcee4426cf5d6ea9c79.txt | 2013-02-06 17:02 | 82K | |
![[TXT]](/icons/text.gif) | 69ff68d3660f85daedfef4e61d4ac60.txt | 2013-02-06 17:02 | 82K | |
![[ ]](/icons/layout.gif) | 135478d226a06302402304edfa253604.pdf | 2013-02-06 16:56 | 797K | |
![[TXT]](/icons/text.gif) | c2aa48ecdb98e83ec39344dac9757dd7.txt | 2013-02-06 16:56 | 182K | |
![[TXT]](/icons/text.gif) | acf488512adcaedd558575a663aadfcc.txt | 2013-02-06 16:55 | 182K | |
![[ ]](/icons/layout.gif) | f25c12796bb3653f76a4c346b5073e16.pdf | 2013-02-06 16:55 | 132K | |
![[ ]](/icons/layout.gif) | 385eeeaebfa783d12e36abdd7a09668b.pdf | 2013-02-06 16:50 | 730K | |
![[TXT]](/icons/text.gif) | 6715f8dabb362e12396200609fa79622.txt | 2013-02-06 16:49 | 489 | |
![[TXT]](/icons/text.gif) | fcb630c94bf47dba0623bbda11bfc5e8.txt | 2013-02-06 16:49 | 489 | |
![[ ]](/icons/layout.gif) | Cardiovascular effects of lightning strikes.pdf | 2013-02-06 16:35 | 1.5M | |
![[ ]](/icons/layout.gif) | Simultaneous control of two rhythmical behaviors. II. Hindlimb walking with paw-shake response in spinal cat.pdf | 2013-02-06 12:28 | 2.0M | |
![[ ]](/icons/layout.gif) | The spatial pattern of light determines the kinetics and modulates backpropagation of optogenetic action potentials.pdf | 2013-02-06 11:35 | 903K | |
![[TXT]](/icons/text.gif) | 8e0e02fa29107d5900b332a6b828c96a.txt | 2013-02-06 00:47 | 46K | |
![[TXT]](/icons/text.gif) | 9784810afd70d575302b0cece186e49e.txt | 2013-02-06 00:46 | 46K | |
![[TXT]](/icons/text.gif) | 5f3b3f81aa6c737eea7dd5f13fa6ba29.txt | 2013-02-06 00:19 | 22K | |
![[TXT]](/icons/text.gif) | a7c08b65e66cfee9cf5eacd82af962c1.txt | 2013-02-06 00:17 | 22K | |
![[ ]](/icons/layout.gif) | output.pdf | 2013-02-05 16:37 | 188K | |
![[TXT]](/icons/text.gif) | dc952baf17a7f692376d750bdecc83a2.txt | 2013-02-05 12:38 | 8.6K | |
![[TXT]](/icons/text.gif) | 8e4c3fe9a8336d045c001672ca34d8b1.txt | 2013-02-05 12:38 | 15K | |
![[TXT]](/icons/text.gif) | Dietary garlic (.txt | 2013-02-05 12:37 | 16K | |
![[ ]](/icons/layout.gif) | 5e74b13008997b5a78da2ad81fd07317.pdf | 2013-02-05 09:17 | 260K | |
![[TXT]](/icons/text.gif) | 490ea454a4b2969c003cd07d32167ffa.txt | 2013-02-05 09:16 | 75K | |
![[ ]](/icons/layout.gif) | S-nitrosylated SHP-2 contributes to NMDA receptor-mediated excitotoxicity in acute ischemic stroke.pdf | 2013-02-05 03:06 | 534K | |
![[TXT]](/icons/text.gif) | fbd7212c4676d5076a49af19adf81d79.txt | 2013-02-05 03:06 | 32K | |
![[TXT]](/icons/text.gif) | 377f62fb967200c298b06ef845e87ca1.txt | 2013-02-04 23:11 | 43K | |
![[TXT]](/icons/text.gif) | cb6aa50444a3fd624734096f4bade85d.txt | 2013-02-04 23:10 | 1.2K | |
![[ ]](/icons/layout.gif) | 9613ef81b6460b0fd8f3614b2b820395.pdf | 2013-02-04 22:56 | 625K | |
![[TXT]](/icons/text.gif) | 6b1950f15c8de1efe14a85289e612602.txt | 2013-02-04 22:55 | 165K | |
![[TXT]](/icons/text.gif) | f57d1c5a6a63aa39442766965db694fc.txt | 2013-02-04 22:53 | 81K | |
![[TXT]](/icons/text.gif) | d101ddbdafb0a9e144d14aa6c57fa30f.txt | 2013-02-04 22:52 | 81K | |
![[TXT]](/icons/text.gif) | cb5db780d93534ed24bfd7baa73fbdf8.txt | 2013-02-04 22:51 | 81K | |
![[ ]](/icons/layout.gif) | blah.pdf | 2013-02-04 21:03 | 682K | |
![[ ]](/icons/layout.gif) | a7132c0d62d7c00e92e8e0553f480556.pdf | 2013-02-04 18:05 | 682K | |
![[TXT]](/icons/text.gif) | 100f612b9a71c951786ddb8adf603344.txt | 2013-02-04 18:04 | 185K | |
![[TXT]](/icons/text.gif) | 7f1988585620f4d53fb0714242410f0f.txt | 2013-02-04 18:04 | 185K | |
![[TXT]](/icons/text.gif) | 37a5e3cb13e920812db5f498dd1be861.txt | 2013-02-04 18:03 | 185K | |
![[TXT]](/icons/text.gif) | abc1772da1e121989b1b4954ae57b747.txt | 2013-02-04 18:03 | 84K | |
![[TXT]](/icons/text.gif) | bd253bfa9ff9c45100d93a68969a7d65.txt | 2013-02-04 18:02 | 84K | |
![[ ]](/icons/layout.gif) | Visual projections routed to the auditory pathway in ferrets: receptive fields of visual neurons in primary auditory cortex.pdf | 2013-02-04 14:45 | 1.5M | |
![[ ]](/icons/layout.gif) | Dendritic Computation.pdf | 2013-02-04 14:31 | 761K | |
![[ ]](/icons/layout.gif) | Clustering of collinear line segments .pdf | 2013-02-04 12:23 | 507K | |
![[ ]](/icons/layout.gif) | A recirculating-flow fluorescent oxygen sensor.pdf | 2013-02-04 11:17 | 370K | |
![[TXT]](/icons/text.gif) | 5af9f56aac1fd70113bae118cd87f210.txt | 2013-02-04 11:05 | 41 | |
![[ ]](/icons/layout.gif) | Terrestrial pesticide exposure of amphibians: An underestimated cause of global decline?.pdf | 2013-02-04 10:04 | 390K | |
![[ ]](/icons/layout.gif) | 245cb9d63eeac6944748c1211a9c77a0.pdf | 2013-02-04 05:29 | 534K | |
![[ ]](/icons/layout.gif) | ab123d6d1d582a07530e3c47c9b8055c.pdf | 2013-02-04 02:30 | 54K | |
![[ ]](/icons/layout.gif) | Quantum interference of large organic molecules.pdf | 2013-02-04 01:05 | 521K | |
![[ ]](/icons/layout.gif) | Real-time single-molecule imaging of quantum interference.pdf | 2013-02-04 01:04 | 2.8M | |
![[ ]](/icons/layout.gif) | Biosynthesis of luminescent quantum dots in an earthworm.pdf | 2013-02-04 00:59 | 3.4M | |
![[ ]](/icons/layout.gif) | fa0aff0321ed7f0cdebe48e861a6470c.pdf | 2013-02-04 00:47 | 1.5M | |
![[TXT]](/icons/text.gif) | 86e2201c35b2fd10f48dafe85e2dd9db.txt | 2013-02-04 00:46 | 22K | |
![[TXT]](/icons/text.gif) | failure.txt | 2013-02-03 19:24 | 50K | |
![[ ]](/icons/layout.gif) | c4339eaef9ff802e246ead3eeebfea67.pdf | 2013-02-03 15:12 | 298K | |
![[TXT]](/icons/text.gif) | 5d1a9732e49dc86a8c60ad96101a973a.txt | 2013-02-03 15:00 | 487 | |
![[ ]](/icons/layout.gif) | Functional Tooth Regeneration Using a Bioengineered Tooth Unit as a Mature Organ Replacement Regenerative Therapy.pdf | 2013-02-03 14:38 | 1.0M | |
![[TXT]](/icons/text.gif) | 84774f9c090636bec97c6cbed2f5974c.txt | 2013-02-03 13:42 | 34K | |
![[TXT]](/icons/text.gif) | 5667af420c5364457bcc2b5a26283b2d.txt | 2013-02-03 13:41 | 86K | |
![[ ]](/icons/layout.gif) | ae31dd2db8492c041c927bacfdde0246.pdf | 2013-02-03 08:59 | 741K | |
![[TXT]](/icons/text.gif) | 8de8dcbb1658d12ed0f41a987a58db05.txt | 2013-02-03 08:59 | 22K | |
![[TXT]](/icons/text.gif) | 3dc211578a6efec51a302440ee911739.txt | 2013-02-03 08:19 | 19K | |
![[ ]](/icons/layout.gif) | Chromosome positioning in the interphase nucleus.pdf | 2013-02-02 23:57 | 2.0M | |
![[ ]](/icons/layout.gif) | Microfluidic PicoArray synthesis of oligodeoxynucleotides and simultaneous assembling of multiple DNA sequences.pdf | 2013-02-02 19:02 | 484K | |
![[ ]](/icons/layout.gif) | Three-Dimensional Printing Using a Photoinitiated Polymer.pdf | 2013-02-02 00:43 | 1.3M | |
![[ ]](/icons/layout.gif) | 573120c756ed8e1f17e60a31d108eb4b.pdf | 2013-02-01 15:52 | 2.2M | |
![[TXT]](/icons/text.gif) | 6747c3b8739cce26eeee745de30f4cb3.txt | 2013-02-01 15:52 | 2.3K | |
![[TXT]](/icons/text.gif) | 683683c421aaa3857474cb4d0290052e.txt | 2013-02-01 15:51 | 21K | |
![[ ]](/icons/layout.gif) | Microprocessing of Liquid Plugs for Bio_chemical Analyses.pdf | 2013-02-01 10:56 | 1.9M | |
![[ ]](/icons/layout.gif) | Schumann Resonances, a plausible biophysical mechanism for the human health effects of Solar.pdf | 2013-01-31 22:02 | 410K | |
![[ ]](/icons/layout.gif) | Effect of humidity on human comfort and productivity after step changes from warm and humid environment.pdf | 2013-01-31 21:11 | 553K | |
![[ ]](/icons/layout.gif) | f17ae3b90479b2f05c6416c154a78e10.pdf | 2013-01-31 21:08 | 130K | |
![[TXT]](/icons/text.gif) | 41e6d0abe8b8b055978f4ed0548c74b1.txt | 2013-01-31 21:07 | 43K | |
![[TXT]](/icons/text.gif) | 673d924ffaf661f04f20962d8c3d3d63.txt | 2013-01-31 13:10 | 111K | |
![[TXT]](/icons/text.gif) | 214b6b5f0ab38d6ceb7ea2f705fa3ee2.txt | 2013-01-31 02:09 | 167K | |
![[ ]](/icons/layout.gif) | Responsive biomimetic networks from polyisocyanopeptide hydrogels.pdf | 2013-01-30 22:08 | 540K | |
![[ ]](/icons/layout.gif) | Implications for human health of the extensive bisphenol A literature showing adverse effects at low doses: A response to attempts to mislead the public.pdf | 2013-01-30 21:13 | 110K | |
![[TXT]](/icons/text.gif) | 1143f64f89caa66206300faee19e5cff.txt | 2013-01-30 09:01 | 35K | |
![[TXT]](/icons/text.gif) | 8239c7f6ddab7ed290d938b8f92a0e89.txt | 2013-01-30 01:06 | 44K | |
![[TXT]](/icons/text.gif) | a3b189e6214b8c78d2953c26e1699657.txt | 2013-01-30 01:05 | 44K | |
![[TXT]](/icons/text.gif) | 43b57384bf3d7b254dd444730db79f6b.txt | 2013-01-29 17:25 | 2.3K | |
![[TXT]](/icons/text.gif) | 5671a1dc192d203b65c396e15c0b85aa.txt | 2013-01-29 17:24 | 21K | |
![[TXT]](/icons/text.gif) | 8d4a00fbad516ff2077a398470ffa3e3.txt | 2013-01-29 14:16 | 275 | |
![[TXT]](/icons/text.gif) | 3e5b73c72c0546bf1e970cf61a1b77c2.txt | 2013-01-29 14:16 | 11K | |
![[ ]](/icons/layout.gif) | Preparing synthetic biology for the world.pdf | 2013-01-29 12:10 | 1.1M | |
![[ ]](/icons/layout.gif) | To Favor Survival Under Food Shortage, the Brain Disables Costly Memory.pdf | 2013-01-29 12:05 | 385K | |
![[ ]](/icons/layout.gif) | Telomerase Reverse Transcriptase Synergizes with Calorie Restriction to Increase Health Span and Extend Mouse Longevity.pdf | 2013-01-29 09:12 | 1.1M | |
![[ ]](/icons/layout.gif) | A neuro-mechanical model for the neural basis of curve walking in the stick insect.pdf | 2013-01-29 02:06 | 1.7M | |
![[ ]](/icons/layout.gif) | Eigenchannel R-matrix calculation of the even-parity 6 pnp and 6 pnf J=0,1, 2 autoionizing levels of barium.pdf | 2013-01-28 16:43 | 801K | |
![[TXT]](/icons/text.gif) | fb01e4c23d540f4572f764869e37d9d0.txt | 2013-01-28 16:42 | 11K | |
![[TXT]](/icons/text.gif) | cdd0419e2e4f18ba2ce77fdded0c6f82.txt | 2013-01-28 16:42 | 18K | |
![[ ]](/icons/layout.gif) | MeCP2 Binds to 5hmC Enriched within Active Genes and Accessible Chromatin in the Nervous System.pdf | 2013-01-28 16:18 | 2.4M | |
![[TXT]](/icons/text.gif) | 347e035bddb0326978f4ada495dceaf1.txt | 2013-01-28 12:51 | 2.3K | |
![[TXT]](/icons/text.gif) | bf4c1ccce7ac0d8af81e01d8f7808caf.txt | 2013-01-28 12:50 | 4.0K | |
![[TXT]](/icons/text.gif) | 404f6b938dc7b584cf87a4b3112ff094.txt | 2013-01-27 19:50 | 15K | |
![[ ]](/icons/layout.gif) | Visualization and Genetic Manipulation of Dendrites and Spines in the Mouse Cerebral Cortex and Hippocampus using In utero Electroporation.pdf | 2013-01-27 19:41 | 489K | |
![[ ]](/icons/layout.gif) | A Visual Description of the Dissection of the Cerebral Surface Vasculature and Associated Meninges and the Choroid Plexus from Rat Brain.pdf | 2013-01-27 19:25 | 314K | |
![[TXT]](/icons/text.gif) | dffaabb6175762ffafcd3064b3853b2b.txt | 2013-01-27 13:51 | 87K | |
![[ ]](/icons/layout.gif) | Nonaqueous Liquid Electrolytes for Lithium-Based Rechargeable Batteries.pdf | 2013-01-27 13:50 | 2.5M | |
![[ ]](/icons/layout.gif) | Experimental Models for Study of Retinal Pigment Epithelial Physiology and Pathophysiology.pdf | 2013-01-26 01:32 | 455K | |
![[ ]](/icons/layout.gif) | Methamphetamine use: A comprehensive review of molecular, preclinical and clinical findings.pdf | 2013-01-25 17:50 | 729K | |
![[TXT]](/icons/text.gif) | 6947699cf4666ab6859af4930cb79869.txt | 2013-01-25 17:49 | 81K | |
![[ ]](/icons/layout.gif) | Green Tea Phenolic Epicatechins Inhibit Hepatitis C Virus Replication via Cycloxygenase-2 and Attenuate Virus-Induced Inflammation.pdf | 2013-01-25 05:19 | 1.2M | |
![[ ]](/icons/layout.gif) | Comprehensive Analysis of DNA Methylation in Head and Neck Squamous Cell Carcinoma Indicates Differences by Survival and Clinicopathologic Characteristics.pdf | 2013-01-25 05:16 | 327K | |
![[ ]](/icons/layout.gif) | 91b4a36a1f5865fa3dafafc17424f297.pdf | 2013-01-24 23:46 | 100K | |
![[TXT]](/icons/text.gif) | 9d4fd987a25957bc6d2fb35a3d0fe34c.txt | 2013-01-24 23:46 | 46K | |
![[TXT]](/icons/text.gif) | 8ba77c47c71e7af13111c9893424d8c1.txt | 2013-01-24 23:05 | 38K | |
![[ ]](/icons/layout.gif) | da067f73a39dd89b9415e8e16a1970f4.pdf | 2013-01-24 22:49 | 127K | |
![[ ]](/icons/layout.gif) | f921dd1a2d465dd9d51435f529504095.pdf | 2013-01-24 22:47 | 743K | |
![[TXT]](/icons/text.gif) | afff1e92a1571a44a4f5f7d7559c3c4c.txt | 2013-01-24 22:47 | 20K | |
![[ ]](/icons/layout.gif) | Amino Acid and Mineral Compositions and Functional Properties of Some Oilseeds.pdf | 2013-01-24 22:46 | 479K | |
![[TXT]](/icons/text.gif) | 427e441340983aee9e748bae43028dc7.txt | 2013-01-24 22:45 | 1.2K | |
![[TXT]](/icons/text.gif) | 40393e18fd6c3bd8c3386bf5c7dbca5d.txt | 2013-01-24 17:43 | 5.6K | |
![[TXT]](/icons/text.gif) | b18ca9cce9d18571cf391d1bd0cb54a7.txt | 2013-01-24 16:25 | 35K | |
![[TXT]](/icons/text.gif) | 988bed95457978a3dfb906075bdb5f05.txt | 2013-01-24 16:23 | 33K | |
![[TXT]](/icons/text.gif) | 250b548d1a94fb02d2e62d743574b1bd.txt | 2013-01-24 14:28 | 73K | |
![[TXT]](/icons/text.gif) | f26f1bded767dc7960a75099f7aab271.txt | 2013-01-24 14:28 | 268K | |
![[ ]](/icons/layout.gif) | The genomic signature of dog domestication reveals adaptation to a starch-rich diet.pdf | 2013-01-24 12:06 | 1.5M | |
![[TXT]](/icons/text.gif) | 8b85d69ac1c405d30e7486d9c49936d1.txt | 2013-01-24 12:06 | 215K | |
![[ ]](/icons/layout.gif) | Structure, Function, and Replication of Saccharomyces Cerevisiae omeres.pdf | 2013-01-24 11:29 | 315K | |
![[ ]](/icons/layout.gif) | 45dfd228f596c74b90981629e8ef6766.pdf | 2013-01-24 08:32 | 146K | |
![[ ]](/icons/layout.gif) | e4eb63abf18fc8286771a1cd2c1a22e7.pdf | 2013-01-24 08:32 | 146K | |
![[TXT]](/icons/text.gif) | fcdf6313b2a00f61f977551d2ddc96e0.txt | 2013-01-24 08:32 | 17K | |
![[TXT]](/icons/text.gif) | bfc7f97c118d4d9d9fdcd81e59869e60.txt | 2013-01-24 08:31 | 17K | |
![[ ]](/icons/layout.gif) | Subunits Modulate Alternatively Spliced, Large Conductance, Calcium-Activated Potassium Channels of Avian Hair Cells.pdf | 2013-01-24 08:28 | 267K | |
![[TXT]](/icons/text.gif) | 501b923955d3b3067f57a7b6c989353f.txt | 2013-01-24 08:26 | 20K | |
![[ ]](/icons/layout.gif) | Laser cooling of a semiconductor by 40 kelvin.pdf | 2013-01-24 06:04 | 945K | |
![[TXT]](/icons/text.gif) | f91d73e31d71c176d8cd14f131e6c1fe.txt | 2013-01-23 23:58 | 48K | |
![[TXT]](/icons/text.gif) | 5cfe6fbe3c75f55e24cba7fcfff43c06.txt | 2013-01-23 18:03 | 340 | |
![[TXT]](/icons/text.gif) | Molecular evolution of vertebrate visual pigments.txt | 2013-01-23 17:56 | 16K | |
![[TXT]](/icons/text.gif) | 357be250dff67866bfb7d18e52484a5f.txt | 2013-01-23 17:31 | 23K | |
![[TXT]](/icons/text.gif) | ea36a218ee1d370ddb6a979b39a15589.txt | 2013-01-23 17:31 | 14K | |
![[ ]](/icons/layout.gif) | The Real Costs of Publishing the .pdf | 2013-01-23 15:20 | 126K | |
![[ ]](/icons/layout.gif) | 770dac7b3f8f5252027e0660d184c5c5.pdf | 2013-01-23 08:06 | 9.2M | |
![[TXT]](/icons/text.gif) | f4d373d64ac8947131d9576886bc7b37.txt | 2013-01-23 04:05 | 419 | |
![[TXT]](/icons/text.gif) | 93566bc215fae014cf36cd22a4cdb0ae.txt | 2013-01-23 04:04 | 419 | |
![[ ]](/icons/layout.gif) | Microfibrillated cellulose and new nanocomposite materials: a review.pdf | 2013-01-22 15:12 | 775K | |
![[ ]](/icons/layout.gif) | Fabrication of 3-Dimensional Cellular Constructs via Microstereolithography Using a Simple, Three-Component, Poly(Ethylene Glycol) Acrylate-Based System.pdf | 2013-01-22 15:06 | 4.4M | |
![[ ]](/icons/layout.gif) | Enzymatic Hydrolysis Combined with Mechanical Shearing and High-Pressure Homogenization for Nanoscale Cellulose Fibrils and Strong Gels.pdf | 2013-01-22 10:01 | 575K | |
![[TXT]](/icons/text.gif) | Enzymatic Hydrolysis Combined with Mechanical Shearing and High-Pressure Homogenization for Nanoscale Cellulose Fibrils and Strong Gels.txt | 2013-01-22 10:01 | 2.5K | |
![[ ]](/icons/layout.gif) | Langmuir–Blodgett films of cellulose nanocrystals: Preparation and characterization.pdf | 2013-01-22 09:45 | 1.0M | |
![[ ]](/icons/layout.gif) | Highly Filled Bionanocomposites from Functionalized Polysaccharide Nanocrystals.pdf | 2013-01-22 09:43 | 610K | |
![[ ]](/icons/layout.gif) | Deformation Responses of a Physically Cross-Linked High Molecular Weight Elastin-Like Protein Polymer.pdf | 2013-01-22 09:41 | 1.8M | |
![[ ]](/icons/layout.gif) | Biosynthesis of an Amphiphilic Silk-Like Polymer.pdf | 2013-01-22 09:39 | 4.7M | |
![[ ]](/icons/layout.gif) | Bionanocomposites based on poly(-caprolactone)-grafted cellulose nanocrystals by ring-opening polymerization.pdf | 2013-01-22 09:36 | 708K | |
![[ ]](/icons/layout.gif) | Error correction in gene synthesis technology.pdf | 2013-01-21 18:23 | 809K | |
![[TXT]](/icons/text.gif) | 5916be7e93f85e2d57c056ad6ef29a39.txt | 2013-01-21 17:16 | 39K | |
![[TXT]](/icons/text.gif) | 8462b4826166058e9cb89f764fce2db5.txt | 2013-01-21 17:14 | 1.2K | |
![[ ]](/icons/layout.gif) | Processing_property_structure interactions in a calcium aluminate-phenol resin composite.pdf | 2013-01-21 16:21 | 1.3M | |
![[TXT]](/icons/text.gif) | 49822e4f85e6d8dee243898823ce6ea7.txt | 2013-01-21 15:52 | 1.2K | |
![[ ]](/icons/layout.gif) | Born to lead? A twin design and genetic association study of leadership role occupancy .pdf | 2013-01-21 15:23 | 1.0M | |
![[ ]](/icons/layout.gif) | A Galactic short gamma-ray burst as cause for the 14C peak in AD 774_5.pdf | 2013-01-21 09:46 | 293K | |
![[ ]](/icons/layout.gif) | a2fde125ece63c808e66ee539a3691a8.pdf | 2013-01-21 09:44 | 211K | |
![[ ]](/icons/layout.gif) | c980122e4f2bcd23efbc3223c1522c22.pdf | 2013-01-20 23:24 | 211K | |
![[ ]](/icons/layout.gif) | The Colorful History of Active DNA Demethylation.pdf | 2013-01-20 20:23 | 446K | |
![[TXT]](/icons/text.gif) | The Colorful History of Active DNA Demethylation.txt | 2013-01-20 20:22 | 78K | |
![[ ]](/icons/layout.gif) | 1a841da774f7154ab34360e0025a4c2e.pdf | 2013-01-20 19:56 | 446K | |
![[TXT]](/icons/text.gif) | 59b417a3f4f35cd07166d8d93d96dc92.txt | 2013-01-20 19:55 | 78K | |
![[TXT]](/icons/text.gif) | b7013a7863ddd5db2317eeeda11b3082.txt | 2013-01-20 19:53 | 78K | |
![[ ]](/icons/layout.gif) | Active DNA demethylation: many roads lead to Rome.pdf | 2013-01-20 19:51 | 1.1M | |
![[ ]](/icons/layout.gif) | The evolution of overconfidence.pdf | 2013-01-20 08:20 | 646K | |
![[TXT]](/icons/text.gif) | e23b82bf83ba512158bd6e667e5c0480.txt | 2013-01-20 08:17 | 12K | |
![[ ]](/icons/layout.gif) | bb504dd855f95c94b67523aa7de3e253.pdf | 2013-01-19 17:30 | 115K | |
![[TXT]](/icons/text.gif) | 9d5742b3263a1b3c7e97fc874a9e3e85.txt | 2013-01-19 17:25 | 151K | |
![[TXT]](/icons/text.gif) | 3ea5b3a8e6204a797b8a76f7929a61cb.txt | 2013-01-19 17:24 | 151K | |
![[TXT]](/icons/text.gif) | 17dfdee14222ffa2871a1874900c0aff.txt | 2013-01-19 15:42 | 31K | |
![[TXT]](/icons/text.gif) | 364967132746e5062defd26ee3724547.txt | 2013-01-19 14:57 | 13K | |
![[ ]](/icons/layout.gif) | A Manual of Paper Chromatography and Paper Electrophoresis..pdf | 2013-01-19 14:54 | 170K | |
![[ ]](/icons/layout.gif) | A Manual of Paper Chromatography and Paper Electrophoresis.pdf | 2013-01-19 14:51 | 177K | |
![[TXT]](/icons/text.gif) | d18b139a3583e8c14ff6eb7615f8bb03.txt | 2013-01-19 14:48 | 35K | |
![[TXT]](/icons/text.gif) | 6c2cf946039e318af63ff057f7ed92bb.txt | 2013-01-19 11:22 | 102K | |
![[ ]](/icons/layout.gif) | Thermal stability and impact and flexural properties of epoxy resins-epoxidized caster oil-nano-caco3 ternary systems.pdf | 2013-01-18 14:02 | 841K | |
![[ ]](/icons/layout.gif) | 9a187cd05989cd616986c3601b897837.pdf | 2013-01-18 14:00 | 457K | |
![[TXT]](/icons/text.gif) | 7825715341c79551bbc50d9a7799589.txt | 2013-01-18 13:59 | 48K | |
![[TXT]](/icons/text.gif) | ccbc84341fc1d5eca5cdb934037f29c8.txt | 2013-01-18 13:55 | 40K | |
![[TXT]](/icons/text.gif) | 97630dbf3506560317498bd1c6673660.txt | 2013-01-18 10:30 | 1.0K | |
![[TXT]](/icons/text.gif) | 73f8f41acaac6bbe88859bf852c66fa8.txt | 2013-01-17 11:28 | 16K | |
![[TXT]](/icons/text.gif) | c782ecd70ce729e93697f7a08f1980f9.txt | 2013-01-17 11:27 | 42K | |
![[TXT]](/icons/text.gif) | f133f089d7b5215b531ea7c88254259f.txt | 2013-01-17 11:27 | 37K | |
![[ ]](/icons/layout.gif) | Look Out New World, Here We Come? Race, Racialization, and Sexuality in Four Children's Animated Films by Disney, Pixar, and DreamWorks.pdf | 2013-01-17 11:26 | 119K | |
![[TXT]](/icons/text.gif) | bf52af3f7c5d9ffc12e80d75feb00975.txt | 2013-01-17 11:25 | 47K | |
![[TXT]](/icons/text.gif) | cd628a1592c77382b9f568284d75d185.txt | 2013-01-17 11:23 | 47K | |
![[ ]](/icons/layout.gif) | e3286dca204d9e335d3185c4452fef50.pdf | 2013-01-17 11:19 | 96K | |
![[TXT]](/icons/text.gif) | f1863b6640c214ec2e8c9899ab2a1418.txt | 2013-01-17 11:18 | 12K | |
![[ ]](/icons/layout.gif) | 6047313d4f920220db95e2f4fc02ec27.pdf | 2013-01-16 12:39 | 2.1M | |
![[TXT]](/icons/text.gif) | 7ea2217596b5bb2ff55af679de9088a2.txt | 2013-01-16 12:37 | 21K | |
![[ ]](/icons/layout.gif) | dcc215f1e6e848487c859acf29fab769.pdf | 2013-01-16 12:36 | 1.2M | |
![[TXT]](/icons/text.gif) | ebf5b63f9921fb575d0c1ec184588aea.txt | 2013-01-16 12:35 | 2.3K | |
![[TXT]](/icons/text.gif) | 12c52da4d67c1f367cad5154293464dd.txt | 2013-01-16 10:27 | 21K | |
![[ ]](/icons/layout.gif) | Structure identification and fermentation characteristics of pinoresinol diglucoside produced by Phomopsis sp. isolated from Eucommia ulmoides Oliv.pdf | 2013-01-16 03:45 | 582K | |
![[TXT]](/icons/text.gif) | bc1e94ffac6fcdac941d0bf390097344.txt | 2013-01-16 03:42 | 48K | |
![[TXT]](/icons/text.gif) | 7332f6a02d437d4ef7ba175b81bb32ec.txt | 2013-01-16 01:05 | 30K | |
![[TXT]](/icons/text.gif) | fa8040ba5be7a5576797d7cc5f8f3fae.txt | 2013-01-16 01:05 | 40K | |
![[ ]](/icons/layout.gif) | Evidence for the absence of amino acid isomerization in microwave-heated milk and infant formulas.pdf | 2013-01-16 00:58 | 374K | |
![[TXT]](/icons/text.gif) | ae7c02039072aa6c98bbf4168d1dc44b.txt | 2013-01-16 00:55 | 89K | |
![[ ]](/icons/layout.gif) | c069b6e351716c3f1818349ef78ab157.pdf | 2013-01-16 00:44 | 172K | |
![[TXT]](/icons/text.gif) | a7fe0971bdf26780f599185105fcb81b.txt | 2013-01-16 00:42 | 1.2K | |
![[ ]](/icons/layout.gif) | A structure in the early Universe at z 1.3 that exceeds the homogeneity scale of the R-W concordance cosmology.pdf | 2013-01-16 00:39 | 1.1M | |
![[ ]](/icons/layout.gif) | A Programmable Dual-RNA–Guided DNA Endonuclease in Adaptive Bacterial Immunity.pdf | 2013-01-16 00:24 | 2.5M | |
![[ ]](/icons/unknown.gif) | bc63e103e8d4cc3df3ac96861fef27fa | 2013-01-15 23:43 | 47K | |
![[ ]](/icons/unknown.gif) | 3e5da6e0d8abe5dc309a344c6a9d6845 | 2013-01-15 13:40 | 570K | |
![[ ]](/icons/unknown.gif) | 2d334c99ceb73cc0fd0bdf5317122594 | 2013-01-15 01:23 | 29K | |
![[ ]](/icons/unknown.gif) | ebf6ef4958f78da45dee563719c15a6f | 2013-01-15 01:22 | 41K | |
![[ ]](/icons/unknown.gif) | ae6bfbe75dd5df08ba4954111c7febce | 2013-01-15 01:21 | 41K | |
![[ ]](/icons/unknown.gif) | 1d32e04267835f336b6faa575081fcbc | 2013-01-14 23:45 | 78K | |
![[ ]](/icons/unknown.gif) | 3f6de87a8074b911bdca0486287debcf | 2013-01-14 22:27 | 1.0M | |
![[ ]](/icons/unknown.gif) | d6ebab62764b27f4704bf0d67ac6f4dc | 2013-01-14 22:26 | 138K | |
![[ ]](/icons/unknown.gif) | 9aead4ed19ce52b86e3fef76d0013baf | 2013-01-14 22:25 | 44K | |
![[ ]](/icons/unknown.gif) | 49d3cad4aea7b964e8c5008c2a797fe6 | 2013-01-14 16:10 | 36K | |
![[ ]](/icons/layout.gif) | Altmetrics: Value all research products.pdf | 2013-01-14 11:45 | 84K | |
![[ ]](/icons/unknown.gif) | 293105c6bfdc3f3d95184ef931393947 | 2013-01-14 10:30 | 3.8M | |
![[ ]](/icons/unknown.gif) | 1e9ee8083534045e107de3879995fe45 | 2013-01-14 10:28 | 5.5M | |
![[ ]](/icons/layout.gif) | Synthetic Lipid Membrane Channels Formed by Designed DNA Nanostructures.pdf | 2013-01-14 10:07 | 4.9M | |
![[ ]](/icons/unknown.gif) | e92df00e68df7c336e7bf8fccf642b32 | 2013-01-14 10:06 | 45K | |
![[ ]](/icons/unknown.gif) | f4612cfb3251a43a730d64439905a0ec | 2013-01-14 00:11 | 27K | |
![[ ]](/icons/unknown.gif) | 393e094b527ea3a521a1a470321182d9 | 2013-01-12 13:42 | 202K | |
![[ ]](/icons/unknown.gif) | b17b59c2c6a68aacf30f8970dde3884d | 2013-01-11 14:42 | 1.1M | |
![[ ]](/icons/unknown.gif) | ffa2113a0f600717fe99a4421fc4b26e | 2013-01-11 14:41 | 195K | |
![[ ]](/icons/unknown.gif) | 1ee92259ca47983cd6ff2bbb3ca115f4 | 2013-01-11 00:21 | 163K | |
![[ ]](/icons/unknown.gif) | 396aef7979855d47559f306d7c379f9 | 2013-01-10 22:36 | 44K | |
![[ ]](/icons/unknown.gif) | 92f4ab157cc6fed1067f6b7800a821da | 2013-01-10 22:36 | 78K | |
![[ ]](/icons/unknown.gif) | c6371daffcba15f114402e0d72166b3d | 2013-01-10 22:30 | 78K | |
![[ ]](/icons/unknown.gif) | 654cc26b966e3b196430516f522b9001 | 2013-01-10 21:54 | 78K | |
![[ ]](/icons/layout.gif) | Spatiotemporal control of cell signalling using a light-switchable protein interaction.pdf | 2013-01-10 21:25 | 925K | |
![[ ]](/icons/layout.gif) | Synthetic biology: Engineering Escherichia coli to see light.pdf | 2013-01-10 21:25 | 297K | |
![[ ]](/icons/unknown.gif) | a6030531f39e37c50af21da306cd6d0b | 2013-01-10 21:15 | 90K | |
![[ ]](/icons/unknown.gif) | 15f42ff8047d5c1e0645957ad8b8c5ae | 2013-01-10 21:15 | 89K | |
![[ ]](/icons/unknown.gif) | 181c74e1532df383f1e955ff55cb82ab | 2013-01-10 21:15 | 89K | |
![[ ]](/icons/unknown.gif) | 759f6807ba37a3d41ec19a7ffa490a98 | 2013-01-10 21:14 | 78K | |
![[ ]](/icons/unknown.gif) | 1049d476a7056082ec7d7a224221515e | 2013-01-10 21:14 | 44K | |
![[ ]](/icons/unknown.gif) | 24755bb78755ebbca8624c7981e5b24e | 2013-01-10 16:59 | 67K | |
![[ ]](/icons/unknown.gif) | 99bd1c1d68e90adc8579cec36239b26c | 2013-01-10 16:59 | 65K | |
![[ ]](/icons/unknown.gif) | 6349030bd291e574d3214baf5b8c4225 | 2013-01-10 16:59 | 89K | |
![[ ]](/icons/unknown.gif) | 817ac186fa13e718507735e2a14ea168 | 2013-01-10 16:57 | 89K | |
![[ ]](/icons/unknown.gif) | ad46125d7eab3ecd91a80eb2c2df9963 | 2013-01-10 12:18 | 116K | |
![[ ]](/icons/unknown.gif) | 5debcfda84728e7505fe5ced4433cd6d | 2013-01-10 11:33 | 172K | |
![[ ]](/icons/unknown.gif) | a62debb36de41c7b52448586d3957375 | 2013-01-10 11:33 | 1.2K | |
![[ ]](/icons/unknown.gif) | eb3b8e8cafbbef255c9fb55b66fee6aa | 2013-01-10 10:16 | 44K | |
![[ ]](/icons/unknown.gif) | 6950396aa0030020d251bdb922d20f55 | 2013-01-10 10:16 | 78K | |
![[ ]](/icons/unknown.gif) | 42212e3ab734bb6b220f9ff9287b5e54 | 2013-01-10 10:15 | 78K | |
![[ ]](/icons/unknown.gif) | d10288b1bc137e1c2f72d785aad584e1 | 2013-01-10 10:13 | 44K | |
![[ ]](/icons/layout.gif) | Negative Absolute Temperature for Motional Degrees of Freedom.pdf | 2013-01-07 22:19 | 3.3M | |
![[ ]](/icons/layout.gif) | Fluoxetine-Induced Cortical Adult Neurogenesis.pdf | 2013-01-07 12:00 | 1.2M | |
![[ ]](/icons/layout.gif) | A vast, thin plane of corotating dwarf galaxies orbiting the Andromeda galaxy.pdf | 2013-01-06 05:46 | 544K | |
![[ ]](/icons/layout.gif) | Heterodyne Characterization of High-Speed Photomixers for the Ultraviolet.pdf | 2013-01-06 04:54 | 5.8M | |
![[ ]](/icons/layout.gif) | Multiferroicity in an organic charge-transfer salt that is suggestive of electric-dipole-driven magnetism.pdf | 2013-01-06 04:43 | 429K | |
![[ ]](/icons/layout.gif) | Structural Basis for dsRNA Recognition, Filament Formation, and Antiviral Signal Activation by MDA5.pdf | 2013-01-06 04:21 | 2.8M | |
![[ ]](/icons/layout.gif) | Solutions of the Klein-Gordon equation in an infinite square-well potential with a moving wall.pdf | 2013-01-06 04:09 | 330K | |
![[ ]](/icons/layout.gif) | Stair and Step Soliton Solutions of the Integrable (2+1) and (3+1)-Dimensional Boiti—Leon—Manna—Pempinelli Equations.pdf | 2013-01-06 04:07 | 4.5M | |
![[ ]](/icons/layout.gif) | Brain of a white-collar worker.pdf | 2012-11-19 04:30 | 99K | |
![[ ]](/icons/layout.gif) | Regeneration and orthotopic transplantation of a bioartificial lung.pdf | 2012-11-12 22:43 | 1.1M | |
![[ ]](/icons/layout.gif) | An Efficient Protocol for Secure Two-Party Computation in the Presence of Malicious Adversaries.pdf | 2010-01-05 03:39 | 4.3M | |
![[ ]](/icons/layout.gif) | 4567910.pdf | 2008-07-17 07:26 | 462K | |
![[ ]](/icons/layout.gif) | 100_years_of_optoelectronics__2_.pdf | 2007-04-03 01:55 | 1.7M | |
|