![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Zhang Y., Vertex based diffusion for 3d mesh denoising.pdf | 2008-05-09 08:47 | 1.8M | |
| Zhang Y., Srface smoothing and quality improvement of quad:hex meshes.pdf | 2006-07-04 05:19 | 4.3M | |
| Zhang Y., 3d finite element meshing from imaging data.pdf | 2005-09-06 03:06 | 1.3M | |
| Yu Y., Mesh editing with Poisson based gradient field manipulation.pdf | 2008-01-15 04:35 | 3.8M | |
| Xu G., Curvature computations of 2-manifolds.pdf | 2007-01-15 01:30 | 206K | |
| Xu G., Convergent discrete Laplace Beltrami operators over triangulated surfaces.pdf | 2006-07-04 05:29 | 1.0M | |
| Wood Z.J., Semi regular mesh extraction from volumes.pdf | 2000-09-01 11:44 | 3.8M | |
| Wei G., An implicit method to solve problems of rigid body motion coupled with fluid flow.pdf | 2007-12-09 04:41 | 449K | |
| Wang Y., Brain surface parameterization using Riemann surface structure.pdf | 2008-12-11 04:54 | 8.2M | |
| Wang D., EQSM, an efficient high quality surface grid generation method based on remeshing.pdf | 2007-02-08 00:12 | 972K | |
| Wan J., Automated adaptive forming simulations.pdf | 2007-12-11 04:54 | 3.3M | |
| Vartziotis D., mesh smoothing using the geometric element transformation method.pdf | 2008-06-06 08:34 | 5.2M | |
| Tezduyar T.E., Interface tracking and interface capturing techniques for finite element computation.pdf | 2006-09-22 07:19 | 462K | |
| Taubin G., Optimal surface smoothing as filter design.pdf | 2007-08-11 03:11 | 777K | |
| Taubin G., Linear anisotropic mesh filtering.pdf | 2007-08-11 03:13 | 777K | |
| Taubin G., Estimating the tensor of curvature of a surface from a polyedral approximation.pdf | 2006-03-27 23:50 | 599K | |
| Taubin G., Curve and surface smoothing without shrinkage.pdf | 2007-08-11 03:11 | 619K | |
| Taubin G., A signal processing approach to fair surface design.pdf | 2007-08-11 03:08 | 3.8M | |
| Taubin G., An accurate algorithm for resterizing algebraic curves.pdf | 2007-08-11 03:12 | 1.0M | |
| Tasdizen T., Geometric surface smoothing via anisotropic diffusion of normals.pdf | 2008-07-30 08:50 | 2.5M | |
| Tang H., A moving mesh method for the Euler flow calculations.pdf | 2007-08-11 02:56 | 2.6M | |
| Surazhsky V., Isotropic remeshing of surfaces.pdf | 2008-11-06 16:50 | 2.8M | |
| Sorkine O., Bounded distortion piecewise mesh parameterization.pdf | 2008-12-11 04:51 | 3.2M | |
| Sirois Y., Mesh smoothing based on Riemannian metric non conformity minimization.pdf | 2008-05-19 14:04 | 7.1M | |
| Sheffer A., Surface parameterization for meshing by triangulation flattening.pdf | 2008-12-11 04:56 | 13M | |
| Selmin V., Fully anisotropic unstructured grid generation.pdf | 2006-09-13 04:04 | 2.3M | |
| Schneider R., Improved biLaplacian mesh fairing.pdf | 2006-03-31 05:04 | 409K | |
| Saksono P.H., An adaptive remeshing strategy for ļ¬%82ows with moving boundaries and ļ¬%82uidā%80%93structure interaction.pdf | 2009-03-05 14:33 | 1.9M | |
| Sahni O., Efficient anisotropic adaptive discretization of the cardiovascular system.pdf | 2007-02-08 00:13 | 1.5M | |
| Rueda A., A fast mesh deformation method for neuroanatomical surface inflated representations.pdf | 2007-08-23 09:31 | 1.1M | |
| Remacle J.F., Transient mesh adaptation using conforming and non conforming mesh modifications.pdf | 2002-10-07 12:40 | 1.0M | |
| Razdan A., Curvature estimation scheme for triangle meshes.pdf | 2006-03-27 23:46 | 298K | |
| Pippa S., GradH correction.pdf | 2005-09-26 07:08 | 423K | |
| Picasso M., Existence a priori and a posteriori error estimates.pdf | 2008-03-23 07:59 | 220K | |
| Picasso M., Adaptive finite elements with large aspect ratio based on an anisotropic error estimator.pdf | 2007-02-08 00:09 | 1.1M | |
| Persson P.O., PDE-based gradient limiting for mesh size functions.pdf | 2007-12-03 03:21 | 1.2M | |
| Persson P.O., Mesh size functions for implicit geometries and PDE-based gradiet limiting.pdf | 2006-10-12 02:42 | 2.0M | |
| Persson P.O., A simple mesh generator in Matlab.pdf | 2008-03-25 07:30 | 684K | |
| Pebay P., Planar quadrilateral quality measures.pdf | 2008-06-25 08:22 | 190K | |
| Pebay P., A non split projection strategy for low mach number flows.pdf | 2008-06-25 08:23 | 371K | |
| Pebay P., Analysis of triangle quality measures.pdf | 2008-06-25 08:22 | 162K | |
| Page D.L., Normal vector voting.pdf | 2006-03-27 23:49 | 672K | |
| Oudot S., Meshing volumes bounded by smooth surfaces.pdf | 2005-09-26 02:41 | 1.0M | |
| Ong B., A new h-r hybrid moving mesh level set method.pdf | 2007-10-08 07:52 | 5.4M | |
| Ohtake Y., Dynamic meshes for accurate polygonization of isosurfaces.pdf | 2006-09-29 10:39 | 745K | |
| Nemitz O., Anisotropic curvature motion for structure enhancing smoothing.pdf | 2006-07-04 05:20 | 8.0M | |
| Mustafa M., Improvement for mesh optimization algorithms.pdf | 2007-05-30 22:04 | 445K | |
| Moreau L., Remaillage adaptatif pour la mise en forme des toles minces.pdf | 2007-12-11 04:35 | 366K | |
| Molino N., A cristalline red green strategy for meshing highly deformable objects with tetrahedra.pdf | 2008-11-06 16:48 | 724K | |
| Meyer M., Discrete differential geometry operators for triangulated 2-manifolds.pdf | 2006-07-04 08:56 | 5.4M | |
| Lipnikov K., Error estimates for hessian-based mesh adaptation algorithms with control of adaptivity.pdf | 2007-04-04 23:56 | 307K | |
| Lipnikov K., Analysis of Hessian recovery methods for generating adaptive meshes.pdf | 2007-10-25 05:30 | 2.1M | |
| Liao G., A deformation method for moving grid generation.pdf | 2007-11-26 04:38 | 1.0M | |
| Li R., A moving mesh finite element algorithm for singular problems.pdf | 2007-10-08 05:23 | 1.7M | |
| Lewiner T., Curvature and torsion estimators based on parametric curve fitting.pdf | 2007-11-01 05:18 | 927K | |
| Lersevoisier D., Metrique continue et optimisation de maillage.pdf | 2006-09-28 04:43 | 241K | |
| Legrand S., Delaunay mesh generation for an unstructured grid ocean general circulation model.pdf | 2009-02-13 07:31 | 881K | |
| Labelle F., Anisotropic Voronoi diagrams and guaranteed-quality anisotropic mesh generation.pdf | 2008-07-22 05:24 | 278K | |
| Kunert G., Zienkiewicz-Zhu error estimators on anisotropic meshes.pdf | 2008-03-23 08:18 | 513K | |
| Kunert G., Robust local problem error estimation.pdf | 2008-01-11 06:56 | 331K | |
| Krysl P., Generation of terahedral finite element meshes.pdf | 2007-02-21 04:43 | 1.0M | |
| Knupp P., Updating meshes on deforming domains.pdf | 2007-12-14 05:54 | 471K | |
| Knupp P., Achieving FE mesh quality via optimization o the Jacobian matrix (2).pdf | 2009-03-05 04:02 | 215K | |
| Knupp P., Achieving ō%8F°£nite element mesh quality via optimization of the Jacobian matrix norm (1).pdf | 2009-03-05 04:10 | 202K | |
| Knobbe E.M., Mesh movement governed by entropy production.pdf | 2007-04-04 23:55 | 325K | |
| Klingner B.M., Aggressive tetrahedral mesh improvement.pdf | 2008-11-06 16:46 | 2.7M | |
| Karbacher S., A nonlinear subdivision scheme for triangle meshes.pdf | 2007-12-20 04:15 | 600K | |
| Jiao X., Anisotropic mesh adaptation for evolving triangulated surfaces.pdf | 2007-12-18 04:31 | 3.3M | |
| Ito Y., Octree-based reasonable-quality hexahedral mesh generation using a new set of reļ¬%81nement templates.pdf | 2009-03-05 04:09 | 1.0M | |
| Idelsohn S.R., To mesh or nor to mesh.pdf | 2007-02-08 23:39 | 1.0M | |
| Huang W., Metric tensors for anisotropic mesh generation.pdf | 2007-12-27 05:36 | 1.2M | |
| Huang W., Anisotropic mesh adaptation and movement.pdf | 2007-03-22 01:15 | 3.6M | |
| Hoppe H., Mesh optimization.pdf | 2007-05-30 22:04 | 2.6M | |
| Helenbrook B.T., Mesh deformation using the biharmonic operator.pdf | 2007-03-22 01:17 | 863K | |
| George P.L., Premieres experiences de maillage automatique par une methode de Delaunay anisotrope.pdf | 2005-04-02 11:28 | 358K | |
| Gavriliu M., Fast extraction of adaptive multiresolution meshes.pdf | 2003-09-09 03:27 | 9.5M | |
| Freitag L.A., Tetrahedral element shape optimization via the Jacobian determinant.pdf | 2008-05-29 06:10 | 1.0M | |
| Freitag L., Tetrahedral mesh improvement via optimization of the element condition number.pdf | 2009-03-05 04:05 | 289K | |
| Floater M., Hormann K., Surface parameterization, a tutorial and survey.pdf | 2008-12-11 04:15 | 560K | |
| Fisher M., An algorithm for the construction of intrinsic Delaunay triangulations.pdf | 2006-07-04 08:46 | 2.0M | |
| ElAlaoui L., Residual and hierarchical a posteriori error estimates.pdf | 2008-03-21 15:38 | 939K | |
| Edelsbrunner H., An experimental study of sliver exudation.pdf | 2006-01-11 08:07 | 771K | |
| Dyn N., Optimizing 3d triangulations using discrete curvature analysis.pdf | 2006-03-31 00:03 | 767K | |
| Dwight R., Robust mesh deformation using the linear elasticity equations.pdf | 2008-07-31 12:33 | 1.5M | |
| Dunne Th., An eulerian approach to fluid-stdructure interaction and goal oriented mesh adaptation.pdf | 2007-12-18 04:11 | 376K | |
| Di Y., Moving mesh finite element methods.pdf | 2008-02-17 03:38 | 3.7M | |
| Desbrun M., Intrinsic paametrizations of surface meshes.pdf | 2006-03-31 04:31 | 6.7M | |
| Desbrun M., Implicit fairing of irregular meshes using diffusion and curvature flow.pdf | 2006-07-04 08:43 | 1.7M | |
| Degener P., An adaptable surface parameterization method.pdf | 2008-12-11 04:44 | 1.5M | |
| DeGoes F., A simple and flexible framework to adapt dynamic meshes.pdf | 2008-06-24 08:51 | 1.6M | |
| DeAraujo B., Curvature dependent polygonization of implicit surfaces.pdf | 2005-10-27 02:44 | 3.4M | |
| Coupez T., Metric map and anisotropic mesh adaptation for static and moving surfaces.pdf | 2007-12-17 13:56 | 1.3M | |
| Compere G., Transient adaptivity applied to two-phase incompressible flows.pdf | 2007-12-24 11:07 | 3.5M | |
| Cohen-Steiner D., Restricted Delaunay triangulations and normal cycles.pdf | 2005-09-26 04:16 | 362K | |
| Cohen-Steiner D., Inequalities for the curvature of curves and surfaces.pdf | 2005-09-26 04:19 | 123K | |
| Cohen-Steiner D., Approximation of the curvature measures of a smooth surface endowed with a mesh.pdf | 2005-09-26 07:44 | 258K | |
| Chernikov A., Three dimensional semi generalized point placement method for Delaunay mesh refinement.pdf | 2008-07-22 05:26 | 422K | |
| Chen L., Optimal anisotropic meshes for minimizing interpolation errors.pdf | 2007-10-25 05:32 | 941K | |
| Chen L., Mesh smoothing schemes based on optimal Delaunay triangulations.pdf | 2006-03-03 01:36 | 500K | |
| Cao W., An interpolation error estimate.pdf | 2008-01-02 09:58 | 920K | |
| Bridson R., Adaptive physics based tetrahedral mesh generation using level sets.pdf | 2004-11-19 00:13 | 1.8M | |
| Brewer M., Obtaining smooth transtions using vertex optimization.pdf | 2008-07-17 09:58 | 739K | |
| Branets L., A local cell quality metric and variational grid smoothing algorithm.pdf | 2008-05-19 12:46 | 1.3M | |
| Bousetta R., Adptive remshing based on a posteriori error estimation for forging simulation.pdf | 2007-02-08 00:10 | 1.6M | |
| Bourgault Y., On the use of anisotropic a posteriori error estimators for the adaptive solution of 3d inviscid compressible flows.pdf | 2008-07-17 08:57 | 1.3M | |
| Borrelli V., On the angular defect of triangulations and the pointwise approximation of curvatures.pdf | 2005-09-26 07:42 | 416K | |
| Borouchaki H., Adaptive remeshing for ductile fracture prediction in metal forming.pdf | 2007-12-11 04:30 | 668K | |
| Bobenko A.I., Discrete Willmore flow.pdf | 2006-07-04 05:17 | 2.4M | |
| Bobenko A.I., A discrete Laplace-Beltrami perator for simplicial surfaces.pdf | 2006-03-30 23:45 | 213K | |
| Baker T.J., Mesh movement and metamorphosis.pdf | 2006-10-24 06:12 | 651K | |
| Baker T.J., Identification and preservation of surface features.pdf | 2007-04-04 23:49 | 358K | |
| Apel T., Interpolation of non smooth functions on anisotropic finite element meshes.pdf | 2008-01-11 06:56 | 344K | |
| Aiffa M., A geometrical approach to mesh smoothing.pdf | 2006-09-22 07:33 | 285K | |
|
|---|