![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | hermite.pdf | 2007-04-10 08:35 | 58K | |
| Yuan Y., Fitting smooth subdivision surfaces with normal control.pdf | 2008-12-11 06:43 | 198K | |
| Yu J., Fitting system using loop subdivision surfaces for distributed mesh generation.pdf | 2008-12-11 06:12 | 122K | |
| Yan L., Efficient method for point based rendering on GPUs.pdf | 2008-12-11 05:37 | 270K | |
| Shewchuk J., What is a good linear finite element.pdf | 2008-05-09 12:54 | 1.1M | |
| Shewchuk J., An introduction to CG.pdf | 2007-11-22 16:15 | 503K | |
| Shewchuck J., Giving an Academic Talk.pdf | 2007-03-21 02:46 | 164K | |
| Sclaroff S., Generalized implicit functions for computer graphics.pdf | 2008-07-03 11:30 | 3.3M | |
| Sarti A., Multiresolution implicit object modeling.pdf | 2006-03-30 01:13 | 1.4M | |
| Rosinger E., Gap in nonlinear equivalence for numerical methods for PDEs.pdf | 2009-02-28 03:36 | 117K | |
| Reagan M.T., Quantifying uncertainty in chemical systems modeling.pdf | 2008-06-25 08:24 | 389K | |
| Persson P.O., Implementation of finite element based Navier-Stokes solver.pdf | 2005-09-22 04:08 | 1.0M | |
| Okon E.E., finite difference approximations for the three-dimensional Laplacian in irregular grids.pdf | 2008-11-07 03:39 | 678K | |
| Nesme M., Elements finis robustes pour l'animation interactive de solides deformables.pdf | 2004-11-12 07:29 | 631K | |
| Monnier J., Modelisation et simulation de la propagation d'un polluant.pdf | 2002-10-24 01:17 | 1.0M | |
| Min C., Geometric integration over irregular domains with application to level set methods.pdf | 2008-03-30 05:24 | 603K | |
| McKee S., The MAC method.pdf | 2009-02-11 05:25 | 1.3M | |
| Kw_blake_c.pdf | 2007-03-22 07:48 | 488K | |
| Jiang G.S., High-resolution nonoscillatory central schemes.pdf | 2007-11-23 05:45 | 2.1M | |
| Harten A., Multiresoltion representation and numerical algorithms.pdf | 2007-11-23 05:36 | 1.2M | |
| Freytag M., Field modeling with sampled distances.pdf | 2007-10-01 06:20 | 644K | |
| French D.A., Continuous Galerkin finite element methods for a forward-backward heat equation.pdf | 2008-01-18 14:22 | 187K | |
| Fernandez F.A., A simple finite difference approach using unstructured meshes from FEM mesh generators.pdf | 2009-02-10 11:30 | 189K | |
| Donea J., Arbitrary Lagrangian-Eulerian methods.pdf | 2007-12-06 10:19 | 1.1M | |
| Despres B., The Vofire method for multi component flows on unstructured meshes.pdf | 2008-01-13 03:19 | 1.5M | |
| Cohen A., Multiresolution schemes on triangles for scalar conservation laws.pdf | 2007-11-23 05:41 | 552K | |
| Cohen-Steiner D., Variational shape approximation.pdf | 2004-07-29 13:17 | 11M | |
| Carpentier R., Schema de haute precision en maillage quadrangulaire structure.pdf | 2007-11-22 10:15 | 510K | |
| Campbell J.C., Mimetic finite difference operators for second-order tensors on unstructured grids.pdf | 2008-11-07 04:20 | 290K | |
| Bukhgeim A.L., Unique continuation for hyperbolic equations with memory.pdf | 2008-05-15 08:11 | 1.0M | |
| Aubert G., Image segmentation using active contours.pdf | 2008-01-24 04:12 | 382K | |
| Arioli M., A stopping criterion for the CG algorithm.pdf | 2007-11-22 16:20 | 434K | |
| Ahmadi A., Differentes approches pour le calcul du gradient.pdf | 2008-01-21 09:30 | 2.4M | |
| Abgrall R., Multiresolution representation in unstructured meshes.pdf | 2005-01-28 07:40 | 718K | |
|
|---|