![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Recent developments in linker design.pdf | 2009-06-19 06:54 | 221K | |
| Photoremovable protecting groups - reaction mechanisms and applications.pdf | 2009-06-19 06:56 | 483K | |
| Photolabile protecting groups for nucleosides - Synthesis and photodeprotection rates.pdf | 2009-06-19 06:45 | 931K | |
| Photolabile protecting groups and linkers.pdf | 2009-06-19 06:47 | 533K | |
| Oligosaccharide mimetics obtained by novel, rapid screening of carboxylic acid encoded gylcopeptide libraries.pdf | 2009-06-19 06:50 | 117K | |
| Comparison of methods for photochemical phosphoramidite-based DNA synthesis.pdf | 2009-06-19 07:08 | 1.0M | |
| Comparison of methods for photochemical phosphoramidite-based DNA synthesis.page | 2009-06-19 06:58 | 30K | |