![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Photoelectromechanical synthesis of low-cost DNA microarrays - thesis - 2008.pdf | 2010-12-15 13:01 | 42M | |
![[ ]](/icons/layout.gif) | combination.pdf | 2012-02-13 10:12 | 41M | |
![[ ]](/icons/layout.gif) | DNA brick crystals with prescribed depths - supplementary info.pdf | 2014-10-24 06:48 | 29M | |
![[ ]](/icons/unknown.gif) | John Lund - Identification of Oligonucleotides - Direct Electronic Identification of Oligonucleotides with Inelastic Electron Tunneling Spectroscopy.ppt | 2011-06-11 16:55 | 8.7M | |
![[ ]](/icons/layout.gif) | Folding and cutting DNA into reconfigurable topological nanostructures.pdf | 2013-05-23 21:12 | 7.6M | |
![[ ]](/icons/layout.gif) | A rapid and simple method for DNA engineering using cycled ligation assembly.pdf | 2014-09-16 10:42 | 4.9M | |
![[ ]](/icons/layout.gif) | Shotgun DNA synthesis for the high-throughput construction of large DNA molecules.pdf | 2015-07-13 11:07 | 4.0M | |
![[ ]](/icons/layout.gif) | Photoremovable protecting groups in chemistry and biology - reaction mechanisms and efficiency.pdf | 2013-01-25 13:35 | 3.9M | |
![[ ]](/icons/layout.gif) | In situ synthesis of DNA microarray on functionalized cyclic olefin copolymer substrate.pdf | 2013-08-31 00:45 | 3.6M | |
![[ ]](/icons/layout.gif) | An epigenetics-inspired DNA-based data storage system - 2016.pdf | 2016-12-03 01:14 | 3.4M | |
![[ ]](/icons/layout.gif) | Efficiency, error and yield in light-directed maskless synthesis of DNA microarrays.pdf | 2014-06-02 18:25 | 3.3M | |
![[ ]](/icons/layout.gif) | High-fidelity gene synthesis by retrieval of sequence-verified DNA identified using high-throughput pyrosequencing - supplementary.pdf | 2010-12-13 08:21 | 3.2M | |
![[ ]](/icons/layout.gif) | Review - Conjugates of oligonucleotides and modified oligonucleotides - a review of their synthesis and properties - John Goodchild - 1990.pdf | 2009-03-08 00:08 | 3.1M | |
![[ ]](/icons/layout.gif) | Entropic cages for trapping DNA near a nanopore - 2015.pdf | 2017-09-25 08:35 | 3.0M | |
![[ ]](/icons/layout.gif) | A microfluidic oligonucleotide synthesizer - 2009.pdf | 2011-07-16 10:24 | 2.9M | |
![[ ]](/icons/layout.gif) | Chemoenzymatic transformations in nucleoside chemistry.pdf | 2016-06-08 06:49 | 2.8M | |
![[ ]](/icons/layout.gif) | glenresearch-catalog-2017.pdf | 2017-07-20 10:41 | 2.7M | |
![[ ]](/icons/layout.gif) | Error correction of microchip synthesized genes using Surveyor nuclease.pdf | 2014-04-23 20:39 | 2.5M | |
![[ ]](/icons/layout.gif) | Gene synthesis by assembly of short oligonucleotides - Horspool thesis - 2009.pdf | 2011-06-24 12:04 | 2.3M | |
![[ ]](/icons/layout.gif) | Synthetic DNA synthesis and assembly: Putting the synthetic in synthetic biology - 2017.pdf | 2018-03-27 19:32 | 2.3M | |
![[ ]](/icons/layout.gif) | Molecular threading: Mechanical extraction, stretching and placement of DNA molecules from a liquid-air interface - Halcyon - Andregg - Marblestone - Church - Hamalainen - Kemmish - 2013.pdf | 2014-03-26 05:12 | 2.2M | |
![[ ]](/icons/layout.gif) | The discovery of rolling circle amplification and rolling circle transcription - 2017.pdf | 2017-12-25 11:34 | 2.0M | |
![[ ]](/icons/layout.gif) | Preparation of information-containing macromolecules by ligation of dyad-encoded oligomers - Lutz - 2015.pdf | 2017-09-16 14:20 | 2.0M | |
![[ ]](/icons/layout.gif) | POSaM: a fast, flexible, open-source, inkjet oligonucleotide synthesizer and microarrayer.pdf | 2010-05-06 09:02 | 2.0M | |
![[ ]](/icons/layout.gif) | A systematic comparison of error correction enzymes by next-generation sequencing - 2017.pdf | 2017-08-01 12:47 | 1.9M | |
![[ ]](/icons/layout.gif) | Enzymatic DNA synthesis for digital information storage - 2018 - Church.pdf | 2018-06-16 20:31 | 1.9M | |
![[ ]](/icons/layout.gif) | Template-independent enzymatic oligonucleotide synthesis (TiEOS): Its history, prospects, and challenges - 2018.pdf | 2018-03-22 08:05 | 1.8M | |
![[ ]](/icons/layout.gif) | Polymerase-DNA interactions and enzymatic activity: multi-parameter analysis with electro-switchable biosurfaces - 2015.pdf | 2017-12-25 11:20 | 1.6M | |
![[ ]](/icons/layout.gif) | Label-free luminescent oligonucleotide-based probes - 2013.pdf | 2016-10-17 07:09 | 1.5M | |
![[ ]](/icons/layout.gif) | Investigation of the 'n-1' impurity in phosphorothioate oligodeoxynucleotides synthesized by the solid-phase beta-cyanoethyl phosphoramidite method using stepwise sulfurization.pdf | 2009-07-30 07:30 | 1.5M | |
![[ ]](/icons/layout.gif) | Electronic control of DNA polymerase binding and unbinding to single DNA molecules.pdf | 2014-06-03 12:02 | 1.4M | |
![[ ]](/icons/layout.gif) | Synthesis of oligonucleotides on cellulose by a phosphotriester method.pdf | 2009-03-08 00:44 | 1.4M | |
![[ ]](/icons/layout.gif) | A scalable method for multiplex LED-controlled synthesis of DNA in capillaries.pdf | 2010-12-15 10:02 | 1.4M | |
![[ ]](/icons/layout.gif) | In situ DNA synthesis on glass substrate for microarray fabrication using self-focusing acoustic transducer.pdf | 2011-06-11 16:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Of toasters and molecular ticker tapes - Kording - 2011.pdf | 2014-03-25 23:41 | 1.4M | |
![[ ]](/icons/layout.gif) | A simple method for extracting DNA from old skeletal material.pdf | 2009-08-22 07:38 | 1.4M | |
![[ ]](/icons/layout.gif) | STM control of chemical reactions: Single-molecule synthesis.pdf | 2015-03-22 10:59 | 1.3M | |
![[ ]](/icons/layout.gif) | Solid phase click ligation for the synthesis of very long oligonucleotides.pdf | 2014-06-02 17:35 | 1.3M | |
![[ ]](/icons/layout.gif) | DNA dissolves single-walled carbon nanotubes (SWCNTs) in water.pdf | 2009-04-18 14:04 | 1.3M | |
![[ ]](/icons/layout.gif) | Fast copper-free click DNA ligation by the ring-strain promoted alkyne-azide cycloaddition reaction - 2011.pdf | 2012-03-13 04:24 | 1.3M | |
![[ ]](/icons/layout.gif) | Photoelectrochemical synthesis of DNA microarrays.pdf | 2014-06-04 13:18 | 1.2M | |
![[ ]](/icons/layout.gif) | Gene synthesis machines - DNA chemistry and its uses - 1985.pdf | 2010-01-20 15:12 | 1.2M | |
![[ ]](/icons/layout.gif) | Synthesis of high-quality libraries of long (150mer) oligonucleotides by a novel depurination controlled process - Agilent - Caruthers - 2010.pdf | 2014-06-02 18:16 | 1.2M | |
![[ ]](/icons/layout.gif) | Genome engineering - Carr - Church - 2009.pdf | 2010-12-15 11:20 | 1.2M | |
![[ ]](/icons/layout.gif) | MoSS.pdf | 2016-12-23 09:36 | 1.2M | |
![[ ]](/icons/layout.gif) | A DNA nanoscope via auto-cycling proximity recording - 2017.pdf | 2017-09-19 15:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Electrical and electrochemical monitoring of nucleic acid amplification - 2015.pdf | 2017-12-31 18:45 | 1.0M | |
![[ ]](/icons/layout.gif) | Novel algorithms for in vitro gene synthesis.pdf | 2009-03-01 16:56 | 1.0M | |
![[ ]](/icons/layout.gif) | Toward an Ideal Synthesis of Oligonucleotides - Development of a Novel Phosphoramidite Method with High Capability.pdf | 2009-03-08 00:35 | 1.0M | |
![[ ]](/icons/layout.gif) | Real-time DNA sequencing from single polymerase molecules.pdf | 2010-06-18 09:48 | 963K | |
![[ ]](/icons/layout.gif) | Error correction in gene synthesis technology.pdf | 2015-04-23 03:32 | 956K | |
![[ ]](/icons/layout.gif) | Fabrication of DNA polymer brush arrays by destructive micropatterning and rolling circle amplification - 2012.pdf | 2017-12-25 10:59 | 955K | |
![[ ]](/icons/layout.gif) | A transition to a compact form of DNA in polymer solutions - Lerman - 1971.pdf | 2007-08-17 16:32 | 914K | |
![[ ]](/icons/layout.gif) | Future DNA synthesis technologies - 2017-10-22.pdf | 2018-04-16 09:07 | 888K | |
![[ ]](/icons/layout.gif) | Instability and decay of the primary structure of DNA.pdf | 2012-05-14 10:23 | 887K | |
![[ ]](/icons/layout.gif) | Duplex structure of a minimal nucleic acid.pdf | 2010-01-07 03:10 | 875K | |
![[ ]](/icons/layout.gif) | Electrochemically directed synthesis of oligonucleotides for DNA microarray fabrication.pdf | 2009-04-12 20:28 | 831K | |
![[ ]](/icons/layout.gif) | Sequence-specific detection of individual DNA strands using engineered nanopores - Howorka - 2001.pdf | 2009-03-08 07:06 | 830K | |
![[ ]](/icons/layout.gif) | Recent progress in atomistic simulation of electrical current DNA sequencing - 2015.pdf | 2014-11-13 17:09 | 827K | |
![[ ]](/icons/layout.gif) | Syringe method for stepwise chemical synthesis of oligonucleotides.pdf | 2009-03-08 00:46 | 820K | |
![[ ]](/icons/layout.gif) | Automated forward and reverse ratcheting of DNA in a nanopore - Cherf - 2012 - supplement.pdf | 2012-07-10 13:08 | 788K | |
![[ ]](/icons/layout.gif) | Large scale, liquid phase synthesis of oligonucleotides by the phosphoramidite approach - 1993.pdf | 2010-12-15 10:50 | 787K | |
![[ ]](/icons/layout.gif) | Review - Gene synthesis demystified - 2008.pdf | 2009-03-23 03:47 | 785K | |
![[ ]](/icons/layout.gif) | Gene synthesis demystified - Czar - J. Christopher Anderson - 2009.pdf | 2009-02-02 13:50 | 785K | |
![[ ]](/icons/layout.gif) | Improvements in the phosphoramidite procedure for the synthesis of oligodeoxyribonucleotides.pdf | 2010-12-15 10:23 | 760K | |
![[ ]](/icons/layout.gif) | Automated forward and reverse ratcheting of DNA in a nanopore - Cherf - 2012.pdf | 2012-07-10 13:07 | 740K | |
![[ ]](/icons/layout.gif) | Progress in sequencing DNA with an AFM.pdf | 2011-06-11 17:23 | 732K | |
![[ ]](/icons/layout.gif) | Physical approaches to DNA sequencing and detection - 2007.pdf | 2009-03-08 07:08 | 705K | |
![[ ]](/icons/layout.gif) | Parallel on-chip gene synthesis and application to optimization of protein expression - supplementary.pdf | 2011-07-16 10:28 | 698K | |
![[ ]](/icons/layout.gif) | Wang_Trau_Oligo synthesis and detection_BB_26_2011.pdf | 2011-02-22 00:06 | 696K | |
![[ ]](/icons/layout.gif) | Synthesis of DNA RNA and their analogs via phosphoramidite and h-phosphonate chemistries - Caruthers - 2013.pdf | 2013-11-18 03:28 | 680K | |
![[ ]](/icons/layout.gif) | Parallel on-chip gene synthesis and application to optimization of protein expression.pdf | 2011-05-31 12:33 | 665K | |
![[ ]](/icons/layout.gif) | Chemical_Synthesis_of_Oligonucleotides.pdf | 2009-03-08 11:34 | 656K | |
![[ ]](/icons/layout.gif) | Large-scale de novo DNA synthesis: technologies and applications - Church - 2014.pdf | 2014-06-11 05:36 | 645K | |
![[ ]](/icons/layout.gif) | Hierarchical gene synthesis using DNA microchip oligonucleotides - 2011.pdf | 2011-06-24 12:05 | 627K | |
![[ ]](/icons/layout.gif) | High-quality gene assembly directly from unpurified mixtures of microarray-synthesized oligonucleotides - 2010.pdf | 2014-11-03 07:24 | 620K | |
![[ ]](/icons/layout.gif) | Nobel lecture - Solid phase synthesis - 1984 - Merrifield.pdf | 2010-12-15 10:30 | 617K | |
![[ ]](/icons/layout.gif) | A flexible light-directed DNA chip synthesis gated by deprotection using solution photogenerated acids.pdf | 2013-04-18 05:37 | 601K | |
![[ ]](/icons/layout.gif) | Oligo- and poly-nucleotides - 50 years of chemical synthesis - 2005.pdf | 2010-12-15 10:26 | 587K | |
![[ ]](/icons/layout.gif) | High-fidelity gene synthesis by retrieval of sequence-verified DNA identified using high-throughput pyrosequencing - Matzas - Church - 2010.pdf | 2011-04-22 05:12 | 583K | |
![[ ]](/icons/layout.gif) | High-fidelity gene synthesis by retrieval of sequence-verified DNA identified using high-throughput pyrosequencing - 2010.pdf | 2011-06-24 12:03 | 583K | |
![[ ]](/icons/layout.gif) | Enzymatic synthesis of DNA on glycerol nucleic acid templates without stable duplex formation between product and template - Szostak.pdf | 2011-06-11 16:35 | 577K | |
![[ ]](/icons/layout.gif) | Photolithographic synthesis of high-density DNA and RNA arrays on flexible, transparent, and easily subdivided plastic substrates - 2015.pdf | 2017-08-13 14:49 | 562K | |
![[ ]](/icons/layout.gif) | Extracting DNA from old and burned bone.pdf | 2011-06-11 16:38 | 552K | |
![[ ]](/icons/layout.gif) | Nucleic acid memory - Church - 2016.pdf | 2016-04-25 10:27 | 548K | |
![[ ]](/icons/layout.gif) | De novo DNA synthesis using polymerase-nucleotide conjugates - 2018.pdf | 2018-06-18 09:56 | 544K | |
![[ ]](/icons/layout.gif) | Atomic-scale imaging of DNA using scanning tunnelling microscopy - 1990.pdf | 2010-12-09 16:26 | 542K | |
![[ ]](/icons/layout.gif) | NAA-modified DNA oligonucleotides with zwitterionic backbones: stereoselective synthesis of A–T phosphoramidite building blocks.pdf | 2015-07-15 16:51 | 542K | |
![[ ]](/icons/layout.gif) | Light-directed synthesis of high-density oligonucleotide arrays using semiconductor photoresists - 1996.pdf | 2003-04-08 04:51 | 518K | |
![[ ]](/icons/layout.gif) | Enzymatic protecting group techniques.pdf | 2014-12-25 18:01 | 518K | |
![[ ]](/icons/layout.gif) | Controlling oligonucleotide surface density in light-directed DNA array fabrication.pdf | 2009-04-13 02:01 | 511K | |
![[ ]](/icons/layout.gif) | Replication by a single DNA polymerase of a stretched single-stranded DNA.pdf | 2009-03-08 07:06 | 499K | |
![[ ]](/icons/layout.gif) | Origin of impurities in oligonucleotides.pdf | 2009-03-08 11:48 | 488K | |
![[ ]](/icons/layout.gif) | Novel methods for synthesis of high quality oligonucleotides - A Semenyuk - 2006.pdf | 2010-12-15 10:51 | 488K | |
![[ ]](/icons/layout.gif) | Direct analysis of gene synthesis reactions using solid-state nanopores - 2015.pdf | 2017-09-25 08:34 | 445K | |
![[ ]](/icons/layout.gif) | The Efficiency of Light-Directed Synthesis of DNA Arrays on Glass Substrates.pdf | 2009-04-14 04:31 | 436K | |
![[ ]](/icons/layout.gif) | Replacing nucleobases in DNA with designer molecules - 2002.pdf | 2009-05-29 04:23 | 423K | |
![[ ]](/icons/layout.gif) | Single-step assembly of a gene and entire plasmid from large numbers of oligodeoxyribonucleotides.pdf | 2009-03-23 03:24 | 420K | |
![[IMG]](/icons/image2.gif) | enzymaticSynthesisCycle.png | 2012-02-16 20:31 | 419K | |
![[ ]](/icons/layout.gif) | Spontaneous Insertion of DNA Oligonucleotides into Carbon Nanotubes.pdf | 2009-03-31 14:04 | 401K | |
![[ ]](/icons/layout.gif) | Oligonucleotide on-chip synthesis using PDMS stamp.pdf | 2009-04-12 20:27 | 400K | |
![[ ]](/icons/layout.gif) | A highly convenient procedure for oligodeoxynucleotide purification.pdf | 2014-10-27 23:11 | 399K | |
![[ ]](/icons/layout.gif) | Solid-phase synthesis of base-sensitive oligonucleotides.pdf | 2010-12-15 13:54 | 389K | |
![[ ]](/icons/layout.gif) | Total synthesis of long DNA sequences - synthesis of a contiguous 32-kb polyketide synthase gene cluster - PNAS-2004-Kodumal-15573-8.pdf | 2009-03-07 18:02 | 376K | |
![[ ]](/icons/layout.gif) | Nonenzymatic labeling of 5-hydroxymethylcytosine in nanopore sequencing - 2013.pdf | 2017-09-22 18:33 | 371K | |
![[ ]](/icons/layout.gif) | Recursive construction of perfect DNA molecules from imperfect oligonucleotides - Linshiz - 2008.pdf | 2010-12-15 16:40 | 362K | |
![[ ]](/icons/layout.gif) | twist-bioscience-dna-data-storage-whitepaper.pdf | 2017-10-23 03:59 | 361K | |
![[ ]](/icons/unknown.gif) | A microfluidic oligonucleotide synthesizer - 2009 - supplementary.doc | 2010-02-21 22:28 | 359K | |
![[ ]](/icons/layout.gif) | Solid-phase oligodeoxynucleotide synthesis - a two-step cycle using peroxy anion deprotection.pdf | 2010-12-15 12:41 | 358K | |
![[ ]](/icons/layout.gif) | Advancing high-throughput gene synthesis technology - 2009.pdf | 2009-04-21 13:34 | 357K | |
![[ ]](/icons/layout.gif) | Isolation of single DNA molecule in a picoliter-sized droplet formed by liquid dielectrophoresis.pdf | 2008-08-21 04:44 | 354K | |
![[ ]](/icons/layout.gif) | Manual manufacturing of oligonucleotide, DNA, and protein microchips.pdf | 2009-09-01 09:01 | 341K | |
![[ ]](/icons/layout.gif) | A short history of oligonucleotide synthesis - 2006.pdf | 2010-12-15 10:52 | 340K | |
![[ ]](/icons/layout.gif) | Electrochemically generated acid and its containment to 100 micron reaction areas for the production of DNA microarrays.pdf | 2015-07-13 14:29 | 335K | |
![[ ]](/icons/layout.gif) | DNA analogues: from supramolecular principles to biological properties.pdf | 2014-06-03 11:43 | 310K | |
![[ ]](/icons/layout.gif) | Synthesis of oligonucleotides via monomers with unprotected bases.pdf | 2009-03-08 00:41 | 294K | |
![[ ]](/icons/layout.gif) | Mechanical separation of the complementary strands of DNA.pdf | 2009-04-18 14:04 | 272K | |
![[ ]](/icons/layout.gif) | Synthesis of glycol nucleic acids - atom economical solution for a functional nucleic acid backbone - 2006.pdf | 2009-05-29 04:29 | 268K | |
![[ ]](/icons/layout.gif) | Circular Polymerase Extension cloning of complex gene libraries and pathways - 2009.pdf | 2011-07-16 10:30 | 250K | |
![[ ]](/icons/layout.gif) | Gene assembly from chip-synthesized oligonucleotides.pdf | 2013-10-21 01:47 | 241K | |
![[ ]](/icons/layout.gif) | Accurate multiplex gene synthesis from programmable DNA microchips.pdf | 2009-03-23 03:42 | 239K | |
![[ ]](/icons/layout.gif) | Effects of stray light on the fidelity of photodirected oligonucleotide array synthesis.pdf | 2009-03-08 00:12 | 222K | |
![[ ]](/icons/layout.gif) | Frontiers and approaches to chemical synthesis of oligodeoxyribonucleotides - 2013.pdf | 2014-06-02 17:24 | 218K | |
![[ ]](/icons/layout.gif) | DNA extraction from stem cells.pdf | 2011-06-11 16:24 | 205K | |
![[ ]](/icons/layout.gif) | High-throughput gene synthesis - IEEE student paper - 2005.pdf | 2006-10-16 14:40 | 201K | |
![[ ]](/icons/layout.gif) | patent - 2003 - Precursors for two-step polynucleotide synthesis - Dellinger.pdf | 2010-12-15 13:34 | 179K | |
![[IMG]](/icons/image2.gif) | oligonucleotide-synthesis-using-h-phosphonate-method.jpg | 2014-06-04 01:35 | 172K | |
![[ ]](/icons/layout.gif) | Improved phosphoramidite building blocks for the synthesis of the simplified nucleic acid GNA.pdf | 2009-08-03 03:47 | 171K | |
![[ ]](/icons/layout.gif) | Synthesis of photolabile 5'-O-phosphoramidites for the photolithographic production of microarrays of inversely oriented oligonucleotides.pdf | 2011-01-05 11:41 | 157K | |
![[ ]](/icons/layout.gif) | The mechanism of the phosphoramidite synthesis of polynucleotides.pdf | 2009-03-08 00:37 | 148K | |
![[ ]](/icons/layout.gif) | Internalizing DNA.pdf | 2011-06-11 16:53 | 148K | |
![[ ]](/icons/layout.gif) | Sequence-dependent mechanics of single DNA molecules.pdf | 2009-03-08 07:04 | 136K | |
![[IMG]](/icons/image2.gif) | oligonucleotide-synthesis-by-phosphoramidite-method-cycle-diagram.png | 2015-07-15 16:09 | 134K | |
![[ ]](/icons/layout.gif) | Authenticating DNA extracted from ancient skeletal remains.pdf | 2009-08-22 07:44 | 127K | |
![[ ]](/icons/layout.gif) | Effects of base mismatches on joining of short oligodeoxynucleotides by DNA ligases.pdf | 2012-03-07 23:00 | 124K | |
![[IMG]](/icons/image2.gif) | dna_printer_EWOD_oligo_resuspension_linear.png | 2015-07-19 08:40 | 114K | |
![[ ]](/icons/layout.gif) | A hypothetical protocol for DIYBIO DNA synthesis.pdf | 2016-05-29 15:44 | 114K | |
![[ ]](/icons/layout.gif) | Regioselective acylation of nucleosides catalyzed by Candida antarctica lipase B: enzyme substrate recognition.pdf | 2008-11-17 16:59 | 103K | |
![[ ]](/icons/layout.gif) | Single-molecule, motion-based DNA sequencing using RNA polymerase - 2006.pdf | 2010-12-15 18:42 | 96K | |
![[ ]](/icons/layout.gif) | Error analysis of chemically synthesized polynucleotides.pdf | 2009-03-08 13:01 | 85K | |
![[IMG]](/icons/image2.gif) | nicking-library-method.jpg | 2012-02-06 18:16 | 68K | |
![[IMG]](/icons/image2.gif) | dna_printer_EWOD_oligo_resuspension.png | 2015-07-19 07:54 | 67K | |
![[ ]](/icons/layout.gif) | TNA synthesis by DNA polymerase - Szostak - 2003.pdf | 2003-11-10 12:30 | 54K | |
![[ ]](/icons/layout.gif) | Synthesis of novel phosphoramidite building blocks from pentaerythritol.pdf | 2009-05-29 03:52 | 49K | |
![[IMG]](/icons/image2.gif) | coupling-of-dC-to-polymer-support.png | 2012-02-13 23:08 | 42K | |
![[TXT]](/icons/text.gif) | IngentaConnect Nucleotide synthesis via methods without nucleoside-base protecti....html | 2009-03-08 00:41 | 37K | |
![[IMG]](/icons/image2.gif) | phosphite-triester-method.png | 2012-02-13 23:29 | 30K | |
![[IMG]](/icons/image2.gif) | khorana-phosphodiester-coupling-method.png | 2012-02-13 21:40 | 30K | |
![[TXT]](/icons/text.gif) | synthesis.html | 2012-02-14 10:31 | 28K | |
![[IMG]](/icons/image2.gif) | phosphotriester-approach.png | 2012-02-13 23:16 | 28K | |
![[IMG]](/icons/image2.gif) | exocyclic-amine-protecting-groups.png | 2012-02-13 22:22 | 27K | |
![[IMG]](/icons/image2.gif) | tritylabsorbance.png | 2012-02-13 21:53 | 26K | |
![[IMG]](/icons/image2.gif) | 1h-tetrazole-scheme.png | 2012-02-13 19:30 | 22K | |
![[IMG]](/icons/image2.gif) | phosphoramidite_synthesis_diagram.png | 2012-02-13 18:27 | 22K | |
![[IMG]](/icons/image2.gif) | michelsonandtodd55.png | 2012-02-13 21:04 | 19K | |
![[IMG]](/icons/image2.gif) | Internalizing_DNA.pdf.B_subtilis_competence_proteins.gif | 2011-06-11 16:53 | 18K | |
![[IMG]](/icons/image2.gif) | 3-3-adduct.png | 2012-02-14 00:01 | 17K | |
![[TXT]](/icons/text.gif) | Error analysis of chemically synthesized polynucleotides.html | 2009-03-08 11:33 | 13K | |
![[IMG]](/icons/image2.gif) | flood-groups.png | 2015-07-18 14:51 | 11K | |
![[IMG]](/icons/image2.gif) | oligonucleotide-synthesis-using-phosphoramidite-method.png | 2013-10-04 06:00 | 10K | |
![[IMG]](/icons/image2.gif) | trigonal-bipyrimidal-intermediate.png | 2012-02-13 23:48 | 8.9K | |
![[TXT]](/icons/text.gif) | _synthesis.txt | 2010-12-15 11:35 | 8.7K | |
![[TXT]](/icons/text.gif) | Tsukamoto: Strategies Useful for the Chemical Synthesis of Oligonucleotides and Related Compounds - Google Scholar.html | 2009-03-08 00:38 | 8.5K | |
![[TXT]](/icons/text.gif) | get.txt | 2017-12-31 18:46 | 7.1K | |
![[TXT]](/icons/text.gif) | notes.txt | 2015-07-15 16:50 | 4.5K | |
![[TXT]](/icons/text.gif) | chemistry-hiring-ad.txt | 2015-07-19 15:13 | 2.9K | |
![[TXT]](/icons/text.gif) | 2018-03-22-dna-synthesis-tech-development-recommendations.txt | 2018-03-22 17:36 | 2.0K | |
![[TXT]](/icons/text.gif) | url.txt | 2018-06-16 20:31 | 1.9K | |
![[TXT]](/icons/text.gif) | meh_get.txt | 2010-12-15 13:30 | 819 | |
![[TXT]](/icons/text.gif) | patents.txt | 2010-12-15 13:57 | 100 | |
![[TXT]](/icons/text.gif) | journals.txt | 2012-03-19 20:00 | 87 | |
![[DIR]](/icons/folder.gif) | posam/ | 2015-07-08 08:29 | - | |
![[DIR]](/icons/folder.gif) | phosphoramidites/ | 2009-07-11 22:45 | - | |
![[DIR]](/icons/folder.gif) | nucleosides/ | 2009-06-19 07:08 | - | |
![[DIR]](/icons/folder.gif) | data-storage/ | 2017-12-23 18:29 | - | |
![[DIR]](/icons/folder.gif) | click-ligation/ | 2012-03-21 18:35 | - | |
![[DIR]](/icons/folder.gif) | cambrian-genomics/ | 2015-07-18 09:57 | - | |
![[DIR]](/icons/folder.gif) | bits/ | 2012-09-07 13:23 | - | |
![[DIR]](/icons/folder.gif) | ancient/ | 2016-11-18 12:58 | - | |
![[DIR]](/icons/folder.gif) | abi391/ | 2015-07-16 16:18 | - | |
![[DIR]](/icons/folder.gif) | POSAM/ | 2017-08-24 06:37 | - | |
![[DIR]](/icons/folder.gif) | GNA/ | 2012-02-04 11:14 | - | |
|