![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 04-13-07, Fungi1.png | 2009-06-28 17:49 | 3.5K | |
![[ ]](/icons/layout.gif) | 3D Shape Matching by Geodesic Eccentricity.pdf | 2009-04-04 20:57 | 383K | |
![[IMG]](/icons/image2.gif) | 11-1-05, Protein Synthesis - Translation0.png | 2009-06-28 17:49 | 1.3M | |
![[ ]](/icons/layout.gif) | 1989_AMD_Personal_Computer_Products.pdf | 2013-08-07 09:09 | 46M | |
![[ ]](/icons/layout.gif) | 2007-12-Directed_Energy_Beam_weapons_Report.pdf | 2000-04-07 07:12 | 3.5M | |
![[DIR]](/icons/folder.gif) | 2009-03-12/ | 2009-03-12 15:12 | - | |
![[DIR]](/icons/folder.gif) | 2009-03-25/ | 2010-06-18 09:34 | - | |
![[TXT]](/icons/text.gif) | 2009-09-15-rothemund-utexas.html | 2009-09-15 11:28 | 37K | |
![[TXT]](/icons/text.gif) | 2010-01-16.txt | 2010-01-25 22:03 | 7.1K | |
![[TXT]](/icons/text.gif) | 2010-01-21.txt | 2010-01-25 22:01 | 1.0K | |
![[TXT]](/icons/text.gif) | 2010-02-25-plants.txt | 2010-02-25 15:37 | 2.1K | |
![[DIR]](/icons/folder.gif) | 2011-10-21/ | 2011-10-21 17:04 | - | |
![[ ]](/icons/layout.gif) | 2017-10-22-kanzure-reading-list-2017.v0.pdf | 2017-10-22 13:30 | 73M | |
![[ ]](/icons/odf6ots-20x22.png) | 2017-10-22-kanzure-reading-list-2017.v0.pdf.ots | 2017-10-22 11:34 | 265 | |
![[ ]](/icons/layout.gif) | 2017-10-22-superkuh-reading-list-2017.pdf | 2017-10-22 18:55 | 9.5M | |
![[IMG]](/icons/image2.gif) | 8636cov_live-1.jpg | 2009-08-03 20:57 | 103K | |
![[ ]](/icons/layout.gif) | A $10 thermal infrared imager.pdf | 2009-04-26 17:21 | 361K | |
![[ ]](/icons/layout.gif) | AB Levitator and Electricity Storage.pdf | 2009-06-23 10:08 | 682K | |
![[ ]](/icons/layout.gif) | A Dynamic Biomechanical Evaluation of Lifting Maximum Acceptable Loads.pdf | 2009-04-11 09:57 | 1.0M | |
![[DIR]](/icons/folder.gif) | AFM/ | 2016-01-06 15:54 | - | |
![[ ]](/icons/layout.gif) | A Ge-on-Si laser operating at room temperature - Kimerling - 2010.pdf | 2010-02-05 06:39 | 769K | |
![[ ]](/icons/layout.gif) | A Microfabricated PDMS Microbial Fuel Cell.pdf | 2009-04-01 07:49 | 1.7M | |
![[DIR]](/icons/folder.gif) | ANSI/ | 2009-02-27 05:46 | - | |
![[ ]](/icons/layout.gif) | A Programmable $25 Thermal Cycler for PCR.pdf | 2009-02-27 05:46 | 707K | |
![[ ]](/icons/layout.gif) | A Pseudo DNA Cryptography Method.pdf | 2009-03-18 11:32 | 563K | |
![[TXT]](/icons/text.gif) | A Self-Reproducing Interstellar Probe - Freitas.html | 2000-04-07 07:14 | 177K | |
![[ ]](/icons/layout.gif) | AUTOPASS - an automatic programming system for computer controlled mechanical assembly.pdf | 2009-09-05 06:46 | 1.3M | |
![[ ]](/icons/layout.gif) | A_Janko_keyboard_adapter.pdf | 2017-01-29 06:31 | 3.8M | |
![[ ]](/icons/layout.gif) | A bacterial ratchet motor.pdf | 2009-10-19 07:40 | 1.5M | |
![[ ]](/icons/layout.gif) | Absorption Spectrum of DNA for Wavelengths Greater than 300 nm.pdf | 2009-02-27 05:46 | 368K | |
![[ ]](/icons/layout.gif) | A case of unusual autobiographical remembering - Jill Price - Neurocase - AJ_2006.pdf | 2009-03-01 11:47 | 146K | |
![[ ]](/icons/layout.gif) | Accurate high-speed liquid handling of very small biological samples.pdf | 2010-12-12 21:25 | 445K | |
![[ ]](/icons/layout.gif) | Achieving lambda over 20 Resolution by One-Color Initiation and Deactivation of Polymerization.pdf | 2009-04-10 06:16 | 696K | |
![[IMG]](/icons/image2.gif) | A chip-to-chip nanoliter microfluidic dispenser.pdf.gif | 2009-07-24 07:53 | 24K | |
![[ ]](/icons/layout.gif) | A closed solar photobioreactor for cultivation of microalgae under supra-high irradiance and solar concentrators.pdf | 2009-07-29 05:16 | 1.8M | |
![[ ]](/icons/layout.gif) | A comparison of acid-induced cell wall loosening in Valonia ventricosa and in Oat coleoptiles.pdf | 2009-03-01 13:00 | 907K | |
![[ ]](/icons/layout.gif) | A component oriented approach to multidisciplinary simulation of mechatronic systems.pdf | 2009-06-06 20:34 | 200K | |
![[ ]](/icons/layout.gif) | A connector-based hierarchical approach to assembly sequence planning for mechanical assemblies.pdf | 2009-02-27 05:46 | 543K | |
![[ ]](/icons/layout.gif) | A convenient and rapid method for genetic transformation of E. coli with plasmids.pdf | 2009-02-27 05:46 | 92K | |
![[ ]](/icons/layout.gif) | Acoustically driven planar microfluidics.pdf | 2009-04-22 17:18 | 662K | |
![[ ]](/icons/layout.gif) | Acquisition of foreign DNA by natural transformation in Acinetobacter baylyi - introgression process.pdf | 2009-04-19 11:15 | 128K | |
![[IMG]](/icons/image2.gif) | Acquisition of foreign DNA by natural transformation in Acinetobacter baylyi - introgression process.pdf.1.jpg | 2009-04-19 11:10 | 80K | |
![[ ]](/icons/layout.gif) | Activation of auditory cortex during silent lipreading.pdf | 2009-03-26 09:16 | 463K | |
![[ ]](/icons/layout.gif) | Active listening: Rapid, task-related receptive field plasticity and the computation of acoustic salience in ferret auditory cortex.pdf | 2009-05-04 20:51 | 733K | |
![[ ]](/icons/layout.gif) | A curvature-based approach to estimate local gyrification on the cortical surface.pdf | 2009-08-12 07:54 | 381K | |
![[ ]](/icons/layout.gif) | Acute dissociation after 1 night of sleep loss.pdf | 2008-08-02 03:18 | 177K | |
![[ ]](/icons/layout.gif) | Adapted liquid crystal display backlighting unit for densitometry of stained polyacrylamide electrophoresis gels.pdf | 2009-04-14 09:44 | 174K | |
![[ ]](/icons/layout.gif) | Adaptive filtering enhances information transmission in visual cortex.pdf | 2009-05-04 20:48 | 398K | |
![[ ]](/icons/layout.gif) | A data model for the representation of fabrication dependencies concerning micromechanical devices.pdf | 2009-07-27 13:38 | 782K | |
![[ ]](/icons/layout.gif) | A decision support system for material and manufacturing process selection - Giachetti.pdf | 2009-07-27 13:38 | 192K | |
![[ ]](/icons/layout.gif) | A decomposition technique for setting up the symbolic state equations of large-scale analog circuits.pdf | 2009-06-16 07:17 | 107K | |
![[ ]](/icons/layout.gif) | A designer ligand specific for Kv1.3 channels from a scorpion neurotoxin-based library.pdf | 2010-01-26 05:02 | 1.0M | |
![[ ]](/icons/layout.gif) | A diamond-based biosensor for the recording of nueronal activity - mea-users - Ariano - 2008.pdf | 2009-02-27 05:46 | 578K | |
![[ ]](/icons/layout.gif) | A direct-drive pneumatic stepping motor for robots - designs for pipe-inspection microrobots and for human-care robots.pdf | 2009-07-22 12:52 | 1.1M | |
![[ ]](/icons/layout.gif) | Advancements in Dense Plasma Focus (DPF) for space propulsion.pdf | 2010-01-24 18:25 | 454K | |
![[ ]](/icons/layout.gif) | Advances in light microscopy for neuroscience - 2009.pdf | 2009-07-31 14:20 | 4.8M | |
![[TXT]](/icons/text.gif) | Advogato: Distributed Debian Distribution Development.html | 2008-12-13 08:40 | 22K | |
![[ ]](/icons/unknown.gif) | Advogato: Distributed Debian Distribution Development.mht | 2008-12-13 08:40 | 120K | |
![[ ]](/icons/layout.gif) | A framework for creating a function-based design tool for failure mode identification - Stone - DELREPO.pdf | 2009-09-20 09:06 | 340K | |
![[ ]](/icons/layout.gif) | A framework for revitalizing American manufacturing - 2009.pdf | 2010-11-19 10:39 | 209K | |
![[ ]](/icons/layout.gif) | Agar color staining for costless colored filters for microphotography.pdf | 2009-05-05 22:39 | 942K | |
![[ ]](/icons/layout.gif) | A gene determining temperature sensitivity in Paramecium - Preer - 1957.pdf | 2009-05-24 14:07 | 256K | |
![[ ]](/icons/layout.gif) | A graph-constructive approach to solving systems of geometric constraints.pdf | 2009-04-06 13:12 | 579K | |
![[ ]](/icons/layout.gif) | A graph model for face-to-face assembly.pdf | 2009-04-05 15:46 | 310K | |
![[ ]](/icons/layout.gif) | A green light for red patents? Evidence from Soviet domestic and foreign inventive activity, 1962-1991.pdf | 2011-05-31 21:54 | 1.3M | |
![[ ]](/icons/layout.gif) | A home-made inch-scale scanning force microscope.pdf | 2009-05-04 09:45 | 130K | |
![[ ]](/icons/layout.gif) | A humanized version of FOXP2 affects cortico-basal ganglia circuits in mice.pdf | 2009-05-30 05:31 | 704K | |
![[ ]](/icons/layout.gif) | A kitchen centrifuge.pdf | 2010-12-02 19:01 | 282K | |
![[ ]](/icons/layout.gif) | A language for comprehensively supporting the in vitro experimental process in silico.pdf | 2009-07-24 07:53 | 206K | |
![[TXT]](/icons/text.gif) | Albert Cardona - Reading Notes.html | 2008-07-10 04:49 | 182K | |
![[ ]](/icons/layout.gif) | Algae harvesting by froth filtration.pdf | 2008-10-29 09:11 | 1.7M | |
![[ ]](/icons/layout.gif) | A low-cost LED based spectrometer.pdf | 2009-08-12 07:54 | 2.1M | |
![[ ]](/icons/layout.gif) | A maskless photolithographic prototyping system using a low-cost consumer projector and a microscope.pdf | 2009-04-30 14:24 | 663K | |
![[ ]](/icons/layout.gif) | A mathematician's lament - Paul Lockhart.pdf | 2010-03-25 20:02 | 391K | |
![[ ]](/icons/layout.gif) | A method for the automatic identification of contacts in assemblies of cylindrical parts.pdf | 2009-04-05 15:09 | 203K | |
![[ ]](/icons/layout.gif) | A microfabricated atmospheric-pressure microplasma source operating in air.pdf | 2009-05-06 07:08 | 339K | |
![[ ]](/icons/layout.gif) | A microfabricated inductively coupled plasma generator.pdf | 2009-05-06 07:05 | 512K | |
![[ ]](/icons/layout.gif) | Amino Acid Transmitters in the Mammalian Central Nervous System.pdf | 2009-04-21 21:22 | 6.1M | |
![[ ]](/icons/layout.gif) | A model of the assembly of compliant parts.pdf | 2009-04-05 18:13 | 6.5M | |
![[ ]](/icons/layout.gif) | A molecular force probe - 2009.pdf | 2009-04-10 06:08 | 576K | |
![[ ]](/icons/layout.gif) | Amorphous computing.pdf | 2000-04-07 07:13 | 654K | |
![[ ]](/icons/layout.gif) | An AFM or Rotaxane Molecular Reading Head for Sequence-Dependent DNA Structures.pdf | 2009-03-08 07:17 | 597K | |
![[ ]](/icons/layout.gif) | An FPGA-based approach to high-speed simulation of conductance-based neuron models.pdf | 2009-06-21 20:19 | 461K | |
![[ ]](/icons/layout.gif) | An RNA gene expressed during cortical development evolved rapidly in humans.pdf | 2009-08-12 07:54 | 449K | |
![[ ]](/icons/layout.gif) | An_annotated_list_of_experiments_in_phys.pdf | 2009-09-04 20:18 | 1.6M | |
![[ ]](/icons/layout.gif) | Anaerobic digestion of microalge as a necessary step to make microalgal biodiesel sustainable.pdf | 2009-04-15 02:57 | 199K | |
![[ ]](/icons/layout.gif) | An ai approach to poetry generation.pdf | 2009-11-08 19:29 | 89K | |
![[ ]](/icons/layout.gif) | An algorithm for 3D shape matching using spherical sectioning.pdf | 2009-04-05 11:56 | 406K | |
![[ ]](/icons/layout.gif) | Analysis of Siemens WinCC Malware Attacks and Stuxnet.pdf | 2010-09-17 19:07 | 69K | |
![[ ]](/icons/layout.gif) | Analysis of performance and convergence issues for circuit simulation.pdf | 2009-06-16 15:39 | 4.2M | |
![[ ]](/icons/layout.gif) | An anatomy of human mental life.pdf | 2008-07-30 22:16 | 660K | |
![[ ]](/icons/layout.gif) | An assessment of geometric methods in trajectory synthesis for shape-creating manufacturing operations.pdf | 2009-07-27 13:38 | 1.3M | |
![[ ]](/icons/layout.gif) | An attribute-space representation and algorithm for concurrent engineering.pdf | 2009-09-18 19:02 | 82K | |
![[TXT]](/icons/text.gif) | An automated home-built low-cost fermenter suitable for large-scale bacterial expression of proteins in Escherichia coli | Advance Online Publication | BioTechniques®.html | 2008-08-12 19:06 | 66K | |
![[ ]](/icons/layout.gif) | An avalanche-photodiode-based photon-number-resolving detector.pdf | 2009-04-21 21:18 | 262K | |
![[ ]](/icons/layout.gif) | An electrophoretic ink for all-printed reflective electronic displays.pdf | 2009-04-13 06:25 | 275K | |
![[ ]](/icons/layout.gif) | An energy-based model for electrowetting-induced droplet actuation.pdf | 2009-04-22 15:10 | 222K | |
![[ ]](/icons/layout.gif) | A new method for designing a tool database system of automated manufacturing systems.pdf | 2009-03-03 13:40 | 182K | |
![[ ]](/icons/layout.gif) | An excitable gene regulatory circuit induces transient cellular differentiation.pdf | 2009-04-20 06:49 | 536K | |
![[ ]](/icons/layout.gif) | An experimental system for the evaluation of retroviral vector design to diminish the risk for proto-oncogene activation.pdf | 2009-04-15 03:20 | 1.3M | |
![[ ]](/icons/layout.gif) | An information-bearing seed for nucleating algorithmic self-assembly.pdf | 2009-04-10 03:05 | 1.6M | |
![[ ]](/icons/layout.gif) | An interconnect-centric design flow for nanometer technologies.pdf | 2009-04-04 14:36 | 524K | |
![[ ]](/icons/layout.gif) | An ontology for a robot scientist.pdf | 1970-01-01 05:22 | 765K | |
![[ ]](/icons/layout.gif) | An organic electrochemical transistor for printed sensors and logic.pdf | 2000-04-07 07:13 | 1.4M | |
![[ ]](/icons/layout.gif) | A novel and efficient algorithm for scanning all minimal cutsets of a graph.pdf | 2009-06-06 14:32 | 99K | |
![[ ]](/icons/layout.gif) | A novel means of generating assembly sequences using the connector concept.pdf | 2009-04-04 15:55 | 314K | |
![[ ]](/icons/layout.gif) | An ultraviolet-curable mold for sub-100-nm lithography.pdf | 2009-03-24 21:45 | 165K | |
![[ ]](/icons/layout.gif) | A performance map framework for maximizing soldier performance.pdf | 2015-02-05 19:58 | 10M | |
![[ ]](/icons/layout.gif) | A photo-polymerization resist for UV nanoimprint lithography - PMMA - MMA.pdf | 2009-03-23 16:51 | 740K | |
![[ ]](/icons/layout.gif) | A physical map of 30,000 genes.pdf | 2009-12-06 10:52 | 145K | |
![[ ]](/icons/layout.gif) | A port ontology for conceptual design of systems.pdf | 2009-02-27 05:46 | 1.1M | |
![[ ]](/icons/layout.gif) | A power-efficient thermocycler based on induction heating for DNA amplification by polymerase chain reaction (2004).pdf | 2009-07-03 02:11 | 354K | |
![[ ]](/icons/layout.gif) | Apparent Weight of Photons.pdf | 2009-05-16 18:57 | 815K | |
![[ ]](/icons/layout.gif) | Application of infrared light for in vivo neural stimulation.pdf | 2009-04-21 23:22 | 490K | |
![[ ]](/icons/layout.gif) | Application of open source licensing to vaccine and medicine discovery - open source drug discovery - 2010.pdf | 2010-11-15 06:38 | 43K | |
![[ ]](/icons/layout.gif) | Applications of pyroelectric particle accelerators.pdf | 2000-07-21 20:51 | 163K | |
![[ ]](/icons/layout.gif) | A practical engineering method for fuzzy reliability analysis of mechanical structures - 2000.pdf | 2009-09-20 08:49 | 96K | |
![[ ]](/icons/layout.gif) | A production system for design and construction with digital fabrication - instant cabin - MIT - 2005.pdf | 2009-03-26 13:42 | 460K | |
![[ ]](/icons/layout.gif) | A prototype of feature-based design for assembly.pdf | 2009-02-27 05:46 | 1.5M | |
![[ ]](/icons/layout.gif) | A rapid and efficient protocol to purify biologically active recombinant proteins from mammalian cells.pdf | 2010-01-13 09:29 | 445K | |
![[ ]](/icons/layout.gif) | Arrows in comprehending and producing mechanical designs.pdf | 2009-02-27 05:46 | 214K | |
![[ ]](/icons/layout.gif) | Artificial lymph nodes induce potent secondary immune responses in naive and immunodeficient mice.pdf | 2009-07-11 06:37 | 1.7M | |
![[ ]](/icons/layout.gif) | Artificial reporter gene providing MRI contrast based on proton exchange.pdf | 2009-07-11 06:31 | 255K | |
![[ ]](/icons/layout.gif) | A scalable method for multiplex LED-controlled synthesis of DNA in capillaries.pdf | 2009-04-18 10:17 | 1.4M | |
![[ ]](/icons/layout.gif) | A scaling model for electrowetting-on-dielectric microfluidic actuators.pdf | 2009-04-22 13:06 | 753K | |
![[ ]](/icons/layout.gif) | A simple and convenient synthesis of pseudoephedrine from n-methylamphetamine.pdf | 2012-02-29 17:28 | 243K | |
![[ ]](/icons/layout.gif) | Aspects of laser-generated acoustic shock waves in air.pdf | 2009-04-21 21:19 | 214K | |
![[ ]](/icons/layout.gif) | Assembly-part automatic positioning using high-level entities of mating features.pdf | 2009-04-05 14:13 | 1.2M | |
![[ ]](/icons/a.gif) | Assembly and task planning - taxonomy and annotated bibliography - 1993.ps | 2009-01-28 09:53 | 155K | |
![[IMG]](/icons/image2.gif) | AstronautAssignmentsChart.PNG | 2009-07-24 07:53 | 394K | |
![[ ]](/icons/layout.gif) | A synthetic ecoli predator-prey ecosystem.pdf | 2010-03-30 16:37 | 838K | |
![[ ]](/icons/layout.gif) | A synthetic multicellular system for programmed pattern formation.pdf | 2010-03-30 16:37 | 416K | |
![[ ]](/icons/layout.gif) | A systematic approach to integral snap-fit attachment design.pdf | 2009-03-26 09:36 | 1.1M | |
![[ ]](/icons/layout.gif) | A systems approach to structural topology optimization - designing optimal connections.pdf | 2009-04-04 14:47 | 971K | |
![[ ]](/icons/layout.gif) | A technicolour approach to the connectome.pdf | 2009-04-21 12:28 | 1.3M | |
![[ ]](/icons/unknown.gif) | AtlasIntegrationScenarios.doc | 2009-08-03 19:59 | 44K | |
![[ ]](/icons/layout.gif) | A tutorial on CGAL polyhedron for subdivision algorithms.pdf | 2010-08-03 09:09 | 4.2M | |
![[ ]](/icons/layout.gif) | Augmented Reeb graphs for content-based retrieval of 3D mesh models - 2004.pdf | 2009-04-03 15:15 | 1.9M | |
![[ ]](/icons/layout.gif) | A unique nine-gene comY operon in Streptococcus mutans.pdf | 2009-04-19 10:09 | 238K | |
![[ ]](/icons/layout.gif) | Automated Manufacturability Analysis - a survey.pdf | 2009-07-27 13:38 | 296K | |
![[ ]](/icons/layout.gif) | Automated Synthesis and Optimization of Gear Train Topologies - Albert Swantner - 2009.pdf | 2009-04-20 13:30 | 637K | |
![[ ]](/icons/layout.gif) | Automated design of combinatorial logic circuits using genetic algorithms.pdf | 2000-04-07 07:14 | 267K | |
![[ ]](/icons/layout.gif) | Automated discovery and optimization of large irregular tensegrity structures.pdf | 2009-03-26 19:47 | 966K | |
![[ ]](/icons/layout.gif) | Automated generation of interactive 3D exploded view diagrams.pdf | 2009-09-04 09:52 | 4.3M | |
![[ ]](/icons/layout.gif) | Automated manufacturability analysis of machined parts.pdf | 2009-07-27 13:38 | 7.4M | |
![[ ]](/icons/layout.gif) | Automatic design and manufacture of robotic lifeforms.pdf | 2009-09-04 09:54 | 381K | |
![[ ]](/icons/layout.gif) | Automatic fraction collector for column chromatography.pdf | 2009-07-14 06:07 | 2.5M | |
![[ ]](/icons/layout.gif) | Automatic generation and fabrication of designs - 2002.pdf | 2009-03-26 13:26 | 567K | |
![[ ]](/icons/layout.gif) | Automatic generation of assembly instructions using STEP.pdf | 2009-04-05 14:11 | 89K | |
![[ ]](/icons/layout.gif) | Automatic generation of system-level dynamic equations for mechatronic systems.pdf | 2009-06-01 11:40 | 213K | |
![[ ]](/icons/layout.gif) | Automatic reconstruction of 3D CAD models from digital scans.pdf | 2009-08-12 07:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Automating component-based system assembly.pdf | 2009-02-27 05:46 | 300K | |
![[ ]](/icons/layout.gif) | Automating maintenance instructions study.pdf | 2009-09-09 08:44 | 847K | |
![[ ]](/icons/layout.gif) | Autonomous exploration and mapping of abandoned mines.pdf | 2009-02-27 05:46 | 2.8M | |
![[ ]](/icons/layout.gif) | A web broker for component retrieval in mechanical engineering.pdf | 2009-02-27 05:46 | 955K | |
![[TXT]](/icons/text.gif) | Axel Kilian Transcript.html | 2009-03-26 15:50 | 11K | |
![[DIR]](/icons/folder.gif) | BEC/ | 2000-07-21 21:07 | - | |
![[ ]](/icons/layout.gif) | BR__Biomass Performance, high math.pdf | 2009-04-27 20:30 | 1.3M | |
![[ ]](/icons/layout.gif) | Back-scattered detection provides atomic-scale localization precision, stability, and registration in 3D - 2007.pdf | 2009-04-10 06:05 | 945K | |
![[DIR]](/icons/folder.gif) | Baez/ | 2016-01-06 15:46 | - | |
![[ ]](/icons/layout.gif) | Beam-induced damage to the tevattron collimators - analysis and dynamic modeling of beam loss, energy deposition and ablation.pdf | 2010-09-25 20:20 | 2.9M | |
![[ ]](/icons/layout.gif) | Behavioral model composition in simulation-based design - Paredis - interaction models.pdf | 2009-09-18 19:31 | 333K | |
![[ ]](/icons/layout.gif) | Behavioral synthesis in CADET, a case-based design tool.pdf | 2009-05-04 10:04 | 468K | |
![[ ]](/icons/layout.gif) | Bibliography of literature related to tolerances.pdf | 2009-04-05 15:11 | 365K | |
![[ ]](/icons/layout.gif) | Blu-Ray-1-PhysicalFormatSpecs-BD-RE-1.065KB.pdf | 2012-07-09 09:48 | 1.0M | |
![[ ]](/icons/layout.gif) | Bond graph based automated modeling for computer-aided design of dynamic systems.pdf | 2009-04-17 14:54 | 1.2M | |
![[ ]](/icons/layout.gif) | Bouncing of a droplet on a superhydrophobic surface in AC electrowetting.pdf | 2010-01-20 18:01 | 113K | |
![[ ]](/icons/layout.gif) | Box - exploration vs exploitation 1954.pdf | 2009-02-27 05:46 | 4.0M | |
![[TXT]](/icons/text.gif) | Build a 10 buck XY laser scanner.html | 2009-03-25 21:27 | 9.1K | |
![[DIR]](/icons/folder.gif) | Build a 10 buck XY laser scanner_files/ | 2009-03-25 21:27 | - | |
![[ ]](/icons/layout.gif) | Building a Triggered Spark Gap.pdf | 2000-04-07 12:16 | 714K | |
![[ ]](/icons/layout.gif) | Building composable bridges between the conceptual space and the implementation space.pdf | 2009-02-27 05:46 | 972K | |
![[TXT]](/icons/text.gif) | Build your own (hen) egg incubator.html | 2000-04-07 12:17 | 75K | |
![[ ]](/icons/layout.gif) | C-tree decomposition algorithm for 2D and 3D geometric constraint solving.pdf | 2009-04-06 13:19 | 313K | |
![[TXT]](/icons/text.gif) | CAD_CAM.html | 2009-07-29 15:41 | 26K | |
![[ ]](/icons/layout.gif) | CVD diamond: a new technology for the future? - 1995.pdf | 2003-11-05 04:16 | 843K | |
![[ ]](/icons/layout.gif) | Calculation and visualization of the dynamic ability of the human body.pdf | 2009-04-11 16:42 | 3.3M | |
![[TXT]](/icons/text.gif) | Capillarity-induced disassembly of virions in carbon nanotubes.html | 2009-03-31 14:10 | 36K | |
![[ ]](/icons/layout.gif) | Capillarity-induced disassembly of virions in carbon nanotubes.pdf | 2009-03-31 14:12 | 571K | |
![[ ]](/icons/layout.gif) | Capillary flow control using hydrophobic patterns.pdf | 2009-04-25 13:08 | 253K | |
![[ ]](/icons/layout.gif) | Capillary forces between surfaces with nanoscale roughness.pdf | 2009-04-29 07:44 | 407K | |
![[ ]](/icons/layout.gif) | Captain Curiosity - Can water be used to magnify.pdf | 2009-05-04 13:44 | 83K | |
![[ ]](/icons/layout.gif) | Capturing articulation in assemblies from component geometry - Paredis.pdf | 2009-09-18 19:43 | 308K | |
![[ ]](/icons/layout.gif) | Capturing articulation in assemblies from component geometry - part mating.pdf | 2009-02-27 05:46 | 308K | |
![[TXT]](/icons/text.gif) | Cardboard van Leeuwenhoek microscope.html | 2009-09-01 10:02 | 166K | |
![[DIR]](/icons/folder.gif) | Cardboard van Leeuwenhoek microscope_files/ | 2009-09-01 10:02 | - | |
![[ ]](/icons/layout.gif) | Cascadia: A System for Specifying, Detecting, and Managing RFID Events.pdf | 2009-12-16 14:03 | 787K | |
![[ ]](/icons/layout.gif) | Case Studies in the Use of Design Repositories in Mechanical Engineering.pdf | 2009-02-27 05:46 | 138K | |
![[IMG]](/icons/image2.gif) | Cell_membrane_detailed_diagram.svg | 2009-04-27 06:34 | 471K | |
![[ ]](/icons/layout.gif) | Cells Are Plausible Targets for High-Level Spatial Languages.pdf | 2009-05-04 12:04 | 829K | |
![[IMG]](/icons/image2.gif) | Cerebral_angiography,_arteria_vertebralis_sinister_injection.JPG | 2009-07-24 07:53 | 78K | |
![[ ]](/icons/layout.gif) | Challenges for Brain Emulation - why is it so difficult - review - 2012.pdf | 2012-08-20 18:32 | 240K | |
![[ ]](/icons/layout.gif) | Changing the frame of AI futurism: From storytelling to heavy-tailed, high-dimensional probability distributions.pdf | 2013-02-20 08:55 | 264K | |
![[ ]](/icons/layout.gif) | Channelrhodopsin-2 and optical control of excitable cells - Boyden.pdf | 2009-05-27 15:14 | 374K | |
![[ ]](/icons/layout.gif) | Chaperonins govern growth of Escherichia coli at low temperatures.pdf | 2009-05-11 07:23 | 99K | |
![[ ]](/icons/layout.gif) | Characterization and identification of the inhibitory domain of GDF-8 propeptide.pdf | 2009-04-30 07:29 | 675K | |
![[ ]](/icons/layout.gif) | Characterizing alternative movement techniques - quantification of contributions of joint degrees of freedom to the center-of-mass trajectory formulation.pdf | 2009-04-11 13:58 | 238K | |
![[ ]](/icons/layout.gif) | Chinese lattice designs and parametric shape grammars.pdf | 2009-03-26 13:20 | 860K | |
![[ ]](/icons/layout.gif) | Circular multilateral barter.pdf | 2010-10-13 23:25 | 95K | |
![[ ]](/icons/layout.gif) | Circulating neurotransmitters during the different wake–sleep stages in normal subjects.pdf | 2009-04-21 21:21 | 137K | |
![[TXT]](/icons/text.gif) | Coding Horror: The Trouble with PDFs.html | 2008-08-09 02:41 | 165K | |
![[ ]](/icons/layout.gif) | Cognitive enhancement - methods, ethics, regulatory challenges - Bostrom - Sandberg.pdf | 2010-03-21 18:03 | 188K | |
![[ ]](/icons/layout.gif) | Combining information technology components and symbolic equation manipulation in modeling and simulation of mechatronic systems.pdf | 2009-06-01 11:59 | 82K | |
![[TXT]](/icons/text.gif) | CompCook.html | 2008-12-24 21:03 | 87K | |
![[ ]](/icons/layout.gif) | Comparison of probability and possibility for design against catastrophic failure under uncertainty.pdf | 2009-09-19 18:27 | 296K | |
![[ ]](/icons/layout.gif) | Compatibility issues for mechanical system modelling with standard components.pdf | 2009-10-30 19:05 | 1.1M | |
![[ ]](/icons/layout.gif) | Composition for component-based modeling - interaction models - wtf.pdf | 2009-09-18 19:57 | 1.7M | |
![[ ]](/icons/layout.gif) | Comprehensive experimental analysis of automative attack surfaces - vulnerabilities.pdf | 2011-08-07 20:07 | 1.1M | |
![[ ]](/icons/layout.gif) | Computational analysis of galactic exploration with space probes - implications for the Fermi paradox.pdf | 2009-07-30 15:04 | 384K | |
![[ ]](/icons/layout.gif) | Computer-aided design for manufacturing process selection.pdf | 2009-07-27 13:38 | 341K | |
![[ ]](/icons/layout.gif) | Computer-aided process design using food operations oriented design system block library.pdf | 2009-05-19 08:55 | 194K | |
![[ ]](/icons/layout.gif) | Computer evolution of buildable objects for evolutionary design by computers.pdf | 2010-01-12 08:44 | 264K | |
![[ ]](/icons/layout.gif) | Computing the minimum directional distance between two convex polyhedra.pdf | 2009-04-05 15:21 | 491K | |
![[ ]](/icons/layout.gif) | Conceptual design of the Cylindertron, a new electron accelerator.pdf | 2000-07-21 20:51 | 512K | |
![[ ]](/icons/layout.gif) | Connector reliability - overview - Mroczkowski.pdf | 2009-09-19 07:39 | 962K | |
![[ ]](/icons/layout.gif) | ConstrBasedCAD.pdf | 2009-03-19 13:11 | 80K | |
![[ ]](/icons/layout.gif) | Constraint-based interactive assembly planning.pdf | 2009-01-28 10:40 | 226K | |
![[ ]](/icons/layout.gif) | Constructional features of a 15-litre home-made bioreactor for fed-batch fermentations.pdf | 2009-04-27 20:30 | 397K | |
![[ ]](/icons/layout.gif) | Constructive approach to solving 3D geometric constraint systems using dependence analysis.pdf | 2009-04-06 13:17 | 532K | |
![[ ]](/icons/layout.gif) | Continuous flow multi-step organic synthesis.pdf | 2014-06-08 18:14 | 679K | |
![[ ]](/icons/layout.gif) | Continuous flow separation of particles within an asymmetric microfluidic device.pdf | 2009-02-27 05:46 | 372K | |
![[ ]](/icons/layout.gif) | Controlled deposition of picoliter amounts of fluid using an ultrasonically driven micropipette.pdf | 2009-04-13 02:56 | 364K | |
![[ ]](/icons/layout.gif) | Controlled synthesis of nonspherical microparticles using microfluidics.pdf | 2009-04-26 05:56 | 297K | |
![[ ]](/icons/layout.gif) | Control point adjustment for B-spline curve approximation.pdf | 2010-10-02 11:15 | 482K | |
![[ ]](/icons/layout.gif) | Cooling of a particle by coupling to its own reflection.pdf | 2009-04-26 05:56 | 224K | |
![[ ]](/icons/layout.gif) | Coordinated chemomechanical cycles - a mechanism for autonomous molecular motion - Coordinated_chemomechanical_cycles_EPAPS.pdf | 2009-02-27 05:46 | 951K | |
![[ ]](/icons/layout.gif) | Correct-by-construction asynchronous implementation of modular synchronous specifications - Potop-acsd2005.pdf | 2008-09-09 14:33 | 188K | |
![[ ]](/icons/layout.gif) | Correlation between nanosecond X-ray flashes and stick-slip friction in peeling tape.pdf | 2009-03-23 09:20 | 589K | |
![[ ]](/icons/layout.gif) | Coventor - Development and verification of a standard packaging library for advanced MEMS design.pdf | 2010-02-18 21:05 | 584K | |
![[TXT]](/icons/text.gif) | Creation and Use of Infectious Virus Vector .html | 2009-04-18 01:08 | 11K | |
![[ ]](/icons/layout.gif) | Critical reliability aspects of electrical contacts.pdf | 2009-09-19 07:42 | 265K | |
![[ ]](/icons/layout.gif) | Crypto101.pdf | 2014-11-07 06:47 | 15M | |
![[TXT]](/icons/text.gif) | DARPP-32.bib | 2009-04-09 17:15 | 44K | |
![[ ]](/icons/layout.gif) | DIY - a waldne for the millions? - 1958.pdf | 2009-05-05 22:35 | 261K | |
![[ ]](/icons/layout.gif) | DIY STM high school edition.pdf | 2009-06-14 08:54 | 4.2M | |
![[TXT]](/icons/text.gif) | DIY Vacuum Chamber.html | 2009-03-23 14:36 | 6.1K | |
![[ ]](/icons/layout.gif) | DIY_Synthetic_Biology.pdf | 2009-04-27 03:50 | 34M | |
![[ ]](/icons/layout.gif) | DIY latex dip-molding.pdf | 2009-07-24 07:53 | 168K | |
![[ ]](/icons/layout.gif) | DIY measurement of surface tension.pdf | 2009-05-05 22:25 | 246K | |
![[DIR]](/icons/folder.gif) | DNA/ | 2024-06-07 08:09 | - | |
![[ ]](/icons/layout.gif) | DSA2IH0011608.pdf | 2019-11-13 12:27 | 388K | |
![[TXT]](/icons/text.gif) | Debian rides the space shuttle.html | 2008-10-03 13:51 | 9.9K | |
![[ ]](/icons/layout.gif) | Definition of an XML markup language for clinical laboratory procedures - 2006.pdf | 2008-12-26 12:36 | 397K | |
![[ ]](/icons/layout.gif) | Demonstrating emotional processing differences in psychopathy using affective ERP modulation.pdf | 2012-05-03 08:55 | 858K | |
![[ ]](/icons/layout.gif) | Demonstration of two-qubit algorithms with a superconducting quantum processor.pdf | 2009-06-30 08:16 | 601K | |
![[ ]](/icons/layout.gif) | Design for Self Assembly of Building Components using Rapid Prototyping.pdf | 2009-03-26 10:16 | 275K | |
![[ ]](/icons/layout.gif) | Designing Backpacks for High Fidelity Mobile Outdoor Augmented Reality piekarski-ismar-bp-2004.pdf | 2000-04-07 12:17 | 54K | |
![[ ]](/icons/layout.gif) | Designing effective step-by-step assembly instructions.pdf | 2009-02-27 05:46 | 1.2M | |
![[ ]](/icons/layout.gif) | Design of a compact GeV laser plasma accelerator.pdf | 2000-07-21 20:52 | 155K | |
![[ ]](/icons/layout.gif) | Design of experiments optimization of PMMA for LIGA applications.pdf | 2009-03-23 10:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Design of the low energy astrophysics research facility CLAIRE.pdf | 2000-07-21 20:52 | 684K | |
![[ ]](/icons/layout.gif) | Designosaur.pdf | 2009-02-27 05:45 | 633K | |
![[ ]](/icons/layout.gif) | Design rule for optimization of microelectrodes used in electric cell-substrate impedance sensing (ECIS).pdf | 2009-04-15 03:16 | 828K | |
![[ ]](/icons/layout.gif) | Design synthesis with qualitative influence graphs - steps towards multi-state dynamical devices.pdf | 2009-05-04 10:06 | 443K | |
![[ ]](/icons/layout.gif) | Design with uncertain qualitative variables under imperfect knowledge.pdf | 2009-09-18 18:03 | 240K | |
![[ ]](/icons/layout.gif) | Determination of Multiple Sound Sources.pdf | 2009-04-21 21:25 | 575K | |
![[ ]](/icons/layout.gif) | Determining interference between parts in CAD STEP files for automatic assembly planning.pdf | 2009-04-05 15:01 | 113K | |
![[ ]](/icons/layout.gif) | Diffie-Hellman technique - extended to multiple two-party keys and one multi-party key.pdf | 2008-10-09 04:29 | 146K | |
![[TXT]](/icons/text.gif) | Digital Design Fabrication Group - Physical grammars for interlocking parts.html | 2009-03-26 12:56 | 14K | |
![[ ]](/icons/layout.gif) | Direct-write ion beam lithography - review - 2014.pdf | 2015-11-22 06:14 | 11M | |
![[ ]](/icons/layout.gif) | Direct measurement of dopant distribution in an individual vapour-liquid-solid nanowire.pdf | 2009-04-10 06:15 | 644K | |
![[TXT]](/icons/text.gif) | Direct photoresist inkjet printing - Volkan Sahin.html | 2000-04-07 12:17 | 54K | |
![[TXT]](/icons/text.gif) | Dissection of a complex transcriptional response using genome-wide transcriptional modelling.pdf.txt | 2010-02-15 17:51 | 127 | |
![[ ]](/icons/layout.gif) | Distilling free-form natural laws from experimental data.pdf | 2009-05-14 15:46 | 519K | |
![[ ]](/icons/layout.gif) | Do-it-yourself haptics.pdf | 2009-05-05 22:32 | 1.0M | |
![[ ]](/icons/layout.gif) | Dose Safety Margin Enhancement for Chemical Incapacitation and Less-Than-Lethal Targeting.pdf | 2009-07-29 21:35 | 4.7M | |
![[ ]](/icons/layout.gif) | Driver circuit for piezoelectric motor.pdf | 2009-05-11 11:34 | 233K | |
![[ ]](/icons/layout.gif) | Dynamic modelling of mechatronic multibody systems with symbolic computing and linear graph theory - McPhee.pdf | 2009-06-04 19:38 | 390K | |
![[ ]](/icons/layout.gif) | Dynamics of femtosecond laser-induced breakdown in water from femtoseconds to microseconds.pdf | 2009-04-27 10:41 | 488K | |
![[ ]](/icons/layout.gif) | EXPO - an ontology of scientific research.pdf | 1970-01-01 04:55 | 593K | |
![[IMG]](/icons/image2.gif) | EarthlyIdeasLCA.jpg | 2009-01-22 19:26 | 503K | |
![[ ]](/icons/layout.gif) | Economic implications of software minds.pdf | 2010-11-18 19:11 | 121K | |
![[ ]](/icons/layout.gif) | Effort Flow Analysis - Force Flow Analysis.pdf | 2009-03-26 08:08 | 4.0M | |
![[ ]](/icons/layout.gif) | Electropermanent magnetic connectors and actuators - Knaian - 2010.pdf | 2010-12-10 11:32 | 15M | |
![[ ]](/icons/layout.gif) | ElmerTutorials.pdf | 2009-03-27 12:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | Embodiments.2009.05.13.lisp | 2009-05-14 20:24 | 46K | |
![[ ]](/icons/layout.gif) | Enhanced optical properties of chemical vapor deposited single crystal diamond by low-pressure_high-temperature annealing.pdf | 2009-02-27 05:46 | 939K | |
![[ ]](/icons/layout.gif) | Enhancing engineering design and analysis interoperability - constrained objects.pdf | 2009-02-27 05:46 | 395K | |
![[ ]](/icons/layout.gif) | Epoch of plasticity - the metaverse as a vehicle for cognitive enhancement - Natasha Vita-More - 2010.pdf | 2010-11-23 03:58 | 316K | |
![[ ]](/icons/layout.gif) | Estimation and control of swelling in a fuel cell membrane coating line.pdf | 2009-08-01 17:13 | 3.8M | |
![[ ]](/icons/layout.gif) | Estimation of tool wear in orthogonal cutting using finite element analysis.pdf | 2009-07-27 13:38 | 664K | |
![[ ]](/icons/layout.gif) | Euclid at CERN-LEP.pdf | 2010-08-29 19:22 | 464K | |
![[ ]](/icons/layout.gif) | Eugen Leitl - Molecular dynamics modelling of highly charged solvated biosystems (polylysine oligos and phospholipid bilayers).pdf | 2010-07-14 22:24 | 13M | |
![[ ]](/icons/layout.gif) | Evaluation of the micro wobble motor fabricated by concentric build-up process.pdf | 2009-07-22 12:53 | 528K | |
![[ ]](/icons/layout.gif) | Evolutionary structural optimization for connection topology design of multi-component systems.pdf | 2009-04-04 14:44 | 761K | |
![[TXT]](/icons/text.gif) | Evolution as the Recycler of the Cell's Tools | Scientific Blogging.html | 2008-08-19 11:36 | 86K | |
![[ ]](/icons/layout.gif) | Evolving assembly plans for fully automated design and assembly.pdf | 2009-02-27 05:46 | 122K | |
![[ ]](/icons/layout.gif) | Express barcodes - racing from specimen to identification.pdf | 2009-05-18 15:51 | 414K | |
![[ ]](/icons/layout.gif) | FBI-Bitcoin-Report-April-2012.pdf | 2012-05-08 02:18 | 1.8M | |
![[TXT]](/icons/text.gif) | Fabricating needle arrays with a gray-scale x-ray mask: SPIE Newsroom: SPIE.org.html | 2009-03-24 21:04 | 32K | |
![[ ]](/icons/layout.gif) | Fabrication and study of microstructured optical fibers with elliptical holes.pdf | 2009-05-06 00:17 | 581K | |
![[ ]](/icons/layout.gif) | Fabrication of functional microstructured optical fibers through a selective-filling technique.pdf | 2009-05-06 00:17 | 352K | |
![[ ]](/icons/layout.gif) | Fabrication of graphite masks for deep and ultradeep x-ray lithography.pdf | 2009-03-24 22:02 | 949K | |
![[ ]](/icons/layout.gif) | Fabrication of partially double-curved surfaces out of flat sheet materials through a 3d puzzle approach.pdf | 2009-03-26 10:18 | 506K | |
![[ ]](/icons/layout.gif) | Fast filament tracking using graphics hardware.pdf | 2009-12-06 11:04 | 3.6M | |
![[ ]](/icons/layout.gif) | Fast fluorescence microscopy for imaging the dynamics of embryonic development.pdf | 2009-04-21 18:38 | 1.5M | |
![[ ]](/icons/layout.gif) | Fast focusing using a pinned-contact oscillating liquid lens.pdf | 2009-05-04 08:27 | 725K | |
![[ ]](/icons/layout.gif) | Feasibility of Permanent Magnet Design for High Power Microwave Generator.pdf | 2009-04-21 21:28 | 733K | |
![[ ]](/icons/layout.gif) | Feature-based machining system using STEP.pdf | 2009-07-27 13:38 | 52K | |
![[ ]](/icons/layout.gif) | Features, aka the semantics of a formal language of manufacturing - good.pdf | 2009-03-03 13:40 | 2.2M | |
![[ ]](/icons/layout.gif) | Field-effect transistor with recombinant potassium channels - fast and slow response by electrical and chemical interactions .pdf | 2009-06-15 17:31 | 644K | |
![[ ]](/icons/layout.gif) | Field gradient electrophoresis.pdf | 2009-02-27 23:47 | 411K | |
![[ ]](/icons/layout.gif) | Finding all steady state solutions of chemical kinetic models.pdf | 2009-09-25 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Fractional_distillation_lab_apparatus.svg.png | 2009-07-14 06:04 | 29K | |
![[ ]](/icons/layout.gif) | Freeform fabrication of organic electrochemical transistors - Fab@Home - Lipson - 2007.pdf | 2007-10-08 09:41 | 1.1M | |
![[ ]](/icons/layout.gif) | Frey2008BioSensors.pdf | 2009-05-11 13:55 | 1.8M | |
![[ ]](/icons/layout.gif) | Function, behaviour, and structure - Umeda - 1984.pdf | 2009-06-03 13:30 | 2.1M | |
![[ ]](/icons/layout.gif) | Functional Way Server.pdf | 2009-02-27 05:46 | 766K | |
![[ ]](/icons/layout.gif) | Functional nanostructures from surface chemistry patterning - 2006.pdf | 2009-03-19 09:45 | 1.3M | |
![[ ]](/icons/layout.gif) | Fundamental lego lengths.pdf | 2009-07-31 07:08 | 99K | |
![[ ]](/icons/layout.gif) | Fuzzy approach to the selection of metal casting processes.pdf | 2009-07-27 13:38 | 382K | |
![[ ]](/icons/layout.gif) | GA-based design-point performance adaptation and its comparison with ICM-based approach.pdf | 2009-09-21 03:45 | 667K | |
![[ ]](/icons/layout.gif) | GFP_Tsien_1998_anual_reviews.pdf | 2009-05-09 08:28 | 544K | |
![[ ]](/icons/layout.gif) | Gene doping - a review of performance-enhancing genetics.pdf | 2010-02-25 16:19 | 327K | |
![[ ]](/icons/layout.gif) | Generally_Inconvenient_DENT.pdf | 2012-02-29 22:30 | 294K | |
![[ ]](/icons/layout.gif) | Generally inconvenient: the 1624 Statute of Monopolies as political compromise.pdf | 2012-02-29 22:30 | 294K | |
![[ ]](/icons/layout.gif) | Generating Effective Instructions: Knowing When to Stop.pdf | 2009-02-27 05:46 | 4.3M | |
![[ ]](/icons/layout.gif) | Generating alternative interpretations of machining features.pdf | 2009-03-03 13:40 | 754K | |
![[ ]](/icons/layout.gif) | Generation of laser-induced cavitation bubbles with a digital hologram - LCD - spatial light modulator.pdf | 2009-04-18 13:11 | 354K | |
![[ ]](/icons/layout.gif) | Generation of transgenic non-human primates with germline transmission - Sasaki - 2009.pdf | 2009-05-30 05:31 | 850K | |
![[ ]](/icons/layout.gif) | Geometric reasoning about assembly tools.pdf | 2009-04-04 15:20 | 636K | |
![[ ]](/icons/layout.gif) | Giant-Stroke, Superelastic Carbon Nanotube Aerogel Muscles - 2009 - Baughman.pdf | 2009-03-19 09:14 | 272K | |
![[ ]](/icons/layout.gif) | Graph-constructive approach to solving systems of geometric constraints.pdf | 2009-04-06 13:12 | 579K | |
![[TXT]](/icons/text.gif) | Graphite-based x-ray masks for deep and ultradeep x-ray lithography.html | 2009-03-24 21:54 | 44K | |
![[ ]](/icons/layout.gif) | Graph theory with applications.pdf | 2000-03-17 16:59 | 23M | |
![[ ]](/icons/layout.gif) | Growing Machines.pdf | 2009-08-22 11:38 | 10M | |
![[ ]](/icons/layout.gif) | Guiding conceptual design through behavioral reasoning - Welch - Dixon - 1994.pdf | 2009-05-03 19:50 | 2.0M | |
![[ ]](/icons/layout.gif) | H-index ranking of living chemists (April 2010).pdf | 2010-07-24 10:58 | 92K | |
![[IMG]](/icons/image2.gif) | Habitable zones on earth and mars.jpg | 2009-05-08 22:10 | 517K | |
![[ ]](/icons/layout.gif) | Harmonic Skeleton for Realistic Character Animation.pdf | 2009-04-05 11:40 | 3.9M | |
![[ ]](/icons/layout.gif) | Heat Capacity in Magnetic and Electric Fields Near the Ferroelectric Transition in Tri-Glycine Sulfate.pdf | 2000-04-07 12:17 | 167K | |
![[ ]](/icons/layout.gif) | Heat Engine Driven by Shape Memory Alloys__ Prototyping and Design - Shiller.pdf | 2000-04-07 12:17 | 4.5M | |
![[ ]](/icons/layout.gif) | Heat production associated with a propagated impulse in bullfrog myelinated nerve fibers.pdf | 2009-07-29 21:23 | 350K | |
![[IMG]](/icons/image2.gif) | Hermann-Helmholtz_musical_synthesizer.jpg | 2009-07-27 13:38 | 117K | |
![[ ]](/icons/layout.gif) | Herminiimonas glaciei sp. nov., a novel ultramicrobacterium from 3042 m deep Greenland glacial ice.pdf | 2009-06-16 16:22 | 189K | |
![[ ]](/icons/layout.gif) | Hierarchical edge budles - visualization of adjacency relations in hierarchical data.pdf | 2009-10-09 15:09 | 7.9M | |
![[ ]](/icons/layout.gif) | High-efficiency fresnel acoustic lenses.pdf | 2007-04-01 18:57 | 343K | |
![[ ]](/icons/layout.gif) | High-speed tracking of rupture and clustering in freely falling granular streams.pdf | 2009-06-27 11:28 | 1.3M | |
![[ ]](/icons/layout.gif) | History-based binary tree for assemblies.pdf | 2009-02-27 05:46 | 850K | |
![[ ]](/icons/layout.gif) | Hollow-core microstructured polymer optical fiber.pdf | 2009-05-06 05:00 | 363K | |
![[ ]](/icons/layout.gif) | Holo-television system with a single plane.pdf | 2009-03-15 12:57 | 196K | |
![[ ]](/icons/layout.gif) | Host-symbiont coevolution in digital and microbial systems - Zaman - thesis - 2014.pdf | 2015-05-19 10:45 | 6.5M | |
![[TXT]](/icons/text.gif) | How_to_build_a_hydrophone.htm | 2008-10-30 16:43 | 6.1K | |
![[ ]](/icons/layout.gif) | How my predictions are faring - October 2010 - Ray Kurzweil.pdf | 2010-12-23 20:29 | 4.1M | |
![[TXT]](/icons/text.gif) | How to Assemble a Stretcher | Upper Canada Stretchers.html | 2009-03-26 15:22 | 19K | |
![[TXT]](/icons/text.gif) | How to build a plastic AFM.html | 2009-04-21 03:14 | 14K | |
![[ ]](/icons/layout.gif) | Hydrodynamical red-shift phenomena in geophysics.pdf | 2009-02-27 05:46 | 939K | |
![[ ]](/icons/layout.gif) | IGES5-3_forDownload.pdf | 2009-07-14 11:14 | 13M | |
![[ ]](/icons/layout.gif) | IUPAC - Glossary of terms used in photocatalysis and radiocatalysis - peer-review-only - Braslavsky.pdf | 2010-03-01 09:23 | 2.2M | |
![[ ]](/icons/layout.gif) | Identitfication and validation of cognitive design principles for automated generation of assembly instructions.pdf | 2009-02-27 05:46 | 556K | |
![[ ]](/icons/layout.gif) | Imaging the stick-slip peeling of an adhesive tape under a constant load.pdf | 2009-03-23 16:11 | 4.0M | |
![[ ]](/icons/layout.gif) | Improvements on the simple homemade motor.pdf | 2009-05-05 22:25 | 937K | |
![[ ]](/icons/layout.gif) | Impurity analysis of 1,4-dioxane in nonionic surfactants and cosmetics using headspace solid-phase.pdf | 2009-07-14 13:16 | 101K | |
![[ ]](/icons/layout.gif) | Incorporating uncertainty in diagnostic analysis of mechanical systems.pdf | 2009-09-20 09:20 | 308K | |
![[ ]](/icons/layout.gif) | Increasing plant susceptibility to Agrobacterium infection by overexpression of the Arabidopsis nuclear protein VIP1.pdf | 2009-04-27 20:30 | 388K | |
![[ ]](/icons/layout.gif) | Independent scholars - a neglected breed.pdf | 2009-08-18 12:35 | 1.0M | |
![[ ]](/icons/layout.gif) | Inexpensive diode laser modulation at microwave frequencies for sideband generation to use for laser atom cooling and trapping.pdf | 2000-04-07 12:17 | 308K | |
![[ ]](/icons/layout.gif) | Inference in a mechanical design compiler.pdf | 2009-02-27 05:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Influences of pulsed power condition on the machining properties in micro EDM.pdf | 2009-05-15 21:52 | 641K | |
![[ ]](/icons/layout.gif) | Infrared-Guided Laser Stimulation of Neurons in Brain Slices.pdf | 2009-04-22 10:42 | 753K | |
![[ ]](/icons/layout.gif) | Ink-jet-printable phosphorescent organic light-emitting-diode devices.pdf | 2009-04-13 08:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Ink-jet fabrication of electronic components.pdf | 2000-04-07 12:18 | 640K | |
![[ ]](/icons/layout.gif) | Ink-jet printing of doped polymers for organic light emitting devices (LEDs).pdf | 2009-04-13 05:35 | 143K | |
![[ ]](/icons/layout.gif) | Interaction modeling in systems design - Paredis.pdf | 2009-09-18 19:34 | 100K | |
![[ ]](/icons/layout.gif) | Introduction to global macro hedge funds.pdf | 2010-09-22 09:41 | 53K | |
![[ ]](/icons/layout.gif) | Introduction to physical system modelling.pdf | 2009-10-13 11:40 | 2.2M | |
![[ ]](/icons/layout.gif) | Introduction to shape grammars.pdf | 2009-03-26 12:58 | 5.3M | |
![[ ]](/icons/layout.gif) | Isogrid design handbook.pdf | 2005-01-03 12:31 | 8.2M | |
![[ ]](/icons/layout.gif) | It's the DNA that counts - Smolke - 2009.pdf | 2009-05-30 05:31 | 172K | |
![[TXT]](/icons/text.gif) | Joseph Jackson - The Amorality of Preference.htm | 2008-09-30 18:03 | 81K | |
![[ ]](/icons/layout.gif) | KCL and the cut-set law.pdf | 2009-06-16 07:14 | 4.5M | |
![[TXT]](/icons/text.gif) | KSRM-notes.txt | 2009-03-25 07:36 | 8.5K | |
![[ ]](/icons/layout.gif) | Kernel software for efficiently building, re-configuring, and distributing an open CNC controller.pdf | 2009-09-09 08:42 | 1.0M | |
![[ ]](/icons/layout.gif) | Kilian_Embodied Intelligence.pdf | 2009-03-26 11:41 | 4.1M | |
![[IMG]](/icons/image2.gif) | Kingsley_research.jpg | 2000-07-21 21:08 | 312K | |
![[ ]](/icons/layout.gif) | Large-scale assessment of the effect of popularity on the reliability of research.pdf | 2009-10-23 09:52 | 121K | |
![[ ]](/icons/layout.gif) | Lateral dye distribution with ink-jet dye doping of polymer organic light emitting diodes.pdf | 2009-04-13 05:39 | 1.3M | |
![[ ]](/icons/layout.gif) | Letting rip - Sticky-tape X rays powered by triboluminescence.pdf | 2009-03-23 11:51 | 589K | |
![[ ]](/icons/layout.gif) | Ligand-enabled reactivity and selectivity in a synthetically versatile aryl C-H olefination.pdf | 2010-01-21 06:21 | 547K | |
![[ ]](/icons/layout.gif) | LiquiFET_Electrowetting.pdf | 2000-04-07 12:18 | 417K | |
![[ ]](/icons/layout.gif) | Liquid-filled hollow core microstructured polymer optical fiber.pdf | 2009-05-06 00:05 | 168K | |
![[ ]](/icons/layout.gif) | Liquid Film Motor - part 2 - Rotating Electrohydrodynamic Flow in a Suspended Liquid Film.pdf | 2009-02-27 05:46 | 465K | |
![[ ]](/icons/layout.gif) | Liquid Film Motor.pdf | 2009-02-27 05:46 | 410K | |
![[ ]](/icons/layout.gif) | Liquid State Machines and ecoli - making a bucket of water think.pdf | 2009-03-06 08:16 | 1.8M | |
![[TXT]](/icons/text.gif) | Low-hanging fruit for human-level artificial intelligence augmentation - Biohack.html | 2008-07-30 14:52 | 65K | |
![[ ]](/icons/unknown.gif) | Low Temperature Copper-Nanorod Bonding for 3D Integration.PDF | 2009-03-18 13:21 | 3.4M | |
![[ ]](/icons/unknown.gif) | MAKE_Vol7.PDF | 2009-09-17 19:44 | 53M | |
![[TXT]](/icons/text.gif) | Making an XML bill of materials in GNU Make.html | 2008-09-14 15:57 | 61K | |
![[IMG]](/icons/image2.gif) | Making magnetic tape.manufacturing.png | 2009-08-18 10:25 | 38K | |
![[ ]](/icons/layout.gif) | Making magnetic tape.pdf | 2009-08-18 10:23 | 154K | |
![[ ]](/icons/layout.gif) | Managing digital libraries for CAD - Regli.pdf | 2009-02-27 05:46 | 941K | |
![[ ]](/icons/layout.gif) | Manufacturing classification of CAD models using curvature and SVMs - Regli.pdf | 2009-04-04 17:50 | 294K | |
![[ ]](/icons/layout.gif) | Mapping local cavitation events in high intensity ultrasound fields.pdf | 2008-11-05 01:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Maskless fabrication of light-directed oligonucleotide microarrays using a digital micromirror array.pdf | 2010-03-15 12:56 | 570K | |
![[ ]](/icons/layout.gif) | Materials issues in high power accelerators.pdf | 2000-07-21 20:52 | 446K | |
![[ ]](/icons/layout.gif) | Materials of LIGA technology - Ehrfeld.pdf | 2009-03-23 09:55 | 1.5M | |
![[ ]](/icons/layout.gif) | Mathematical models of translational and rotational mechanical elements.pdf | 2009-10-13 11:30 | 930K | |
![[ ]](/icons/layout.gif) | Mathematical terrorism.pdf | 2010-04-09 18:49 | 1.8M | |
![[ ]](/icons/layout.gif) | Mating constraint languages for assembly sequence planning.pdf | 2009-04-05 15:31 | 271K | |
![[ ]](/icons/layout.gif) | Measurement of Cantilever Displacement Using a Compact Disk.pdf | 2009-05-04 05:28 | 271K | |
![[ ]](/icons/layout.gif) | Mechanically assisted liquid lens zoom system for mobile phone cameras.pdf | 2009-05-04 12:53 | 323K | |
![[ ]](/icons/layout.gif) | Merging BSP trees yields polyhedral set operations - Naylor.pdf | 2010-02-16 14:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | Merkle_Hall_Sandberg_Freitas_spike_at_Convergence08.jpg | 2008-11-17 00:45 | 84K | |
![[ ]](/icons/layout.gif) | Method for Providing Low-Cost Wafers for Use as Substrates for Integrated Circuits USPAT 4,147,584 3Apr1979.pdf | 2010-01-25 20:00 | 197K | |
![[ ]](/icons/layout.gif) | Micro-LED arrays - a tool for two-dimensional neuron stimulation.pdf | 2009-04-18 11:51 | 971K | |
![[ ]](/icons/layout.gif) | Micro-channels machined in microstructured optical fibers by femtosecond laser.pdf | 2009-05-06 00:20 | 8.2M | |
![[TXT]](/icons/text.gif) | Micro Journal Club.html | 2009-05-04 20:56 | 61K | |
![[ ]](/icons/layout.gif) | Microbeam generation with capillary optics.pdf | 2009-05-04 12:59 | 598K | |
![[ ]](/icons/layout.gif) | Microcontroller-based full control of ultrasonic motor with frequency and voltage adjusting.pdf | 2009-06-22 06:39 | 1.5M | |
![[ ]](/icons/layout.gif) | Microcontroller based full control of ultrasonic motor with frequency and voltage adjusting.pdf | 2009-06-17 15:38 | 1.5M | |
![[ ]](/icons/layout.gif) | Microfabrication-and-nanomanufacturing-Pulsed water drop micromachining.pdf | 2009-05-07 19:01 | 26M | |
![[ ]](/icons/layout.gif) | Microfabrication of freestanding metal structures using graphite substrate.pdf | 2009-03-24 21:55 | 359K | |
![[ ]](/icons/layout.gif) | Microplasma jet at atmospheric pressure.pdf | 2009-05-06 07:16 | 228K | |
![[ ]](/icons/unknown.gif) | Microsoft Tape Format spe.PDF | 2010-01-08 20:24 | 408K | |
![[ ]](/icons/layout.gif) | Microwave Interaction with Air.pdf | 2009-04-21 21:38 | 1.7M | |
![[ ]](/icons/layout.gif) | Microwave flash sintering of inkjet-printed silver tracks on polymer substrates.pdf | 2009-08-14 03:00 | 300K | |
![[TXT]](/icons/text.gif) | Mike Darwin - why cryonics has failed.html | 2008-08-08 13:47 | 279K | |
![[ ]](/icons/layout.gif) | Milking diatoms - gasoline-secreting diatom solar panels.pdf | 2009-08-03 05:17 | 705K | |
![[ ]](/icons/layout.gif) | Minicircle preprint.2024-03-18.pdf | 2024-04-21 09:26 | 912K | |
![[ ]](/icons/odf6ots-20x22.png) | Minicircle preprint.2024-03-18.pdf.ots | 2024-04-21 09:26 | 381 | |
![[ ]](/icons/layout.gif) | Mining search engine query logs via suggestion sampling.pdf | 2009-10-21 18:50 | 261K | |
![[ ]](/icons/layout.gif) | Misinformation and its correction: Continued influence and successful debiasing - 2012.pdf | 2014-07-29 12:38 | 451K | |
![[TXT]](/icons/text.gif) | MniTalairach.html | 2009-08-03 20:32 | 36K | |
![[ ]](/icons/layout.gif) | Mobile X-Ray Unit.pdf | 2009-04-21 21:38 | 1.4M | |
![[ ]](/icons/layout.gif) | Modeling and Simulation of the Assembly of Snap Joints.pdf | 2009-03-26 07:50 | 190K | |
![[ ]](/icons/layout.gif) | Modeling bolted connections in wood - review.pdf | 2009-09-19 08:36 | 1.1M | |
![[ ]](/icons/layout.gif) | Modeling kinematic cellular automata - NASA Institute for Advanced Concepts - Toth Fejel - 2004.pdf | 2010-11-27 12:30 | 1.7M | |
![[ ]](/icons/layout.gif) | Modeling of micro-diameter-scale liquid core optical fiber filled with various liquids.pdf | 2009-05-06 00:11 | 621K | |
![[ ]](/icons/layout.gif) | Modeling of wear mechanisms in mechanical cutting.pdf | 2009-07-27 13:38 | 1.9M | |
![[ ]](/icons/layout.gif) | Modern circuit analysis - syllabus.pdf | 2009-06-16 07:10 | 128K | |
![[ ]](/icons/layout.gif) | Modern society shocked by its risks.pdf | 2009-06-07 06:45 | 697K | |
![[ ]](/icons/layout.gif) | Molecular scale imaging with a smooth superlens.pdf | 2009-07-29 21:16 | 641K | |
![[ ]](/icons/layout.gif) | Monolithic integrated microfluidic DNA amplification and capillary electrophoresis analysis system.pdf | 2009-03-23 03:25 | 629K | |
![[ ]](/icons/layout.gif) | More efficient algorithms for symbolic network analysis - supernodes and reduced loop analysis - supernode analysis (SNA).pdf | 2009-06-21 11:04 | 863K | |
![[ ]](/icons/layout.gif) | Multi-aspect component models - enabling the reuse of engineering analysis models in sysml - 2008.pdf | 2009-04-06 11:00 | 2.1M | |
![[ ]](/icons/layout.gif) | Multifunctional Nanobiomaterials for Neural Interfaces - 2009.pdf | 2009-03-11 16:14 | 1.7M | |
![[ ]](/icons/layout.gif) | Multiobjective optimization of cyclone separators using genetic algorithm.pdf | 2009-03-30 13:15 | 198K | |
![[ ]](/icons/layout.gif) | Multiple material microstereolithography.pdf | 2009-10-28 08:49 | 11M | |
![[ ]](/icons/layout.gif) | Murphy was an optimist - rare failure modes in Byzantine systems - Kevin R. Driscoll.pdf | 2011-11-16 07:01 | 925K | |
![[ ]](/icons/layout.gif) | Mutual_Banking.pdf | 2009-02-27 05:46 | 2.1M | |
![[ ]](/icons/layout.gif) | My_ISO_job.pdf | 2010-09-18 14:04 | 740K | |
![[ ]](/icons/layout.gif) | NP-complete problems and physical reality - Scott Aaronson.pdf | 2006-11-24 00:51 | 249K | |
![[ ]](/icons/layout.gif) | Nanoelectronics on a pencil tip.pdf | 2009-03-08 14:10 | 66K | |
![[ ]](/icons/layout.gif) | Nanomedicine taxonomy.pdf | 2000-07-21 20:51 | 131K | |
![[ ]](/icons/layout.gif) | Nanometer focusing of hard x rays by phase zone plates.pdf | 2009-03-23 10:02 | 158K | |
![[ ]](/icons/layout.gif) | Nanostructured Cobalt Oxide Clusters in Mesoporous Silica as Efficient Oxygen-Evolving Catalysts.pdf | 2009-03-13 18:04 | 355K | |
![[ ]](/icons/layout.gif) | Near Infra-Red Spectroscopy_ a low cost device.pdf | 2009-04-21 21:37 | 131K | |
![[ ]](/icons/layout.gif) | Nearly diffraction-limit laser focal spot obtained by use of an optically addressed light valve in an adaptive-optics loop - electro-optical adaptive phase plate.pdf | 2009-04-13 03:41 | 1.8M | |
![[ ]](/icons/layout.gif) | Neutrino beam design.pdf | 2000-07-21 20:52 | 694K | |
![[ ]](/icons/layout.gif) | Neutrino factory research and development.pdf | 2000-07-21 20:52 | 637K | |
![[ ]](/icons/layout.gif) | New advances in the functional modeling of electro-mechanical components.pdf | 2009-04-29 14:32 | 562K | |
![[ ]](/icons/layout.gif) | Nucleic acid synthesis in the study of the genetic code - Khorana - 1968 - Nobel Lecture.pdf | 2009-03-08 00:18 | 320K | |
![[ ]](/icons/layout.gif) | Numerical simulations and analysis of lava flow cooling - 2012.pdf | 2012-07-19 14:48 | 4.4M | |
![[ ]](/icons/layout.gif) | Observation of molecular orbital gating.pdf | 2009-12-26 15:10 | 797K | |
![[ ]](/icons/layout.gif) | Observer selection effects.pdf | 2015-12-25 02:47 | 1.2M | |
![[ ]](/icons/layout.gif) | On a group-theoretical approach to the periodic table of chemical elements.pdf | 2009-10-07 08:26 | 322K | |
![[ ]](/icons/layout.gif) | On automatic generation of assembly plans.pdf | 2009-09-01 09:00 | 275K | |
![[TXT]](/icons/text.gif) | On the color image segmentation algorithm based on the thresholding and the fuzzy C-means techniques.html | 2009-03-29 12:19 | 47K | |
![[ ]](/icons/layout.gif) | On the complexity of assembly partitioning.pdf | 2009-01-28 09:39 | 165K | |
![[ ]](/icons/layout.gif) | On the lobe profile design in a cycloid reducer using instant velocity center.pdf | 2009-03-18 19:07 | 722K | |
![[ ]](/icons/layout.gif) | On the maximal quantity of processed information in the physical eschatological context.pdf | 2014-01-09 02:58 | 86K | |
![[ ]](/icons/layout.gif) | On the near impossibility of measuring the returns to advertising.pdf | 2013-05-11 19:11 | 679K | |
![[ ]](/icons/layout.gif) | Ontology and assembly joint topology representation.pdf | 2009-04-05 14:01 | 369K | |
![[ ]](/icons/layout.gif) | Open-Letter-On-Brain-Preservation.pdf | 2010-05-22 09:21 | 173K | |
![[ ]](/icons/layout.gif) | Orientation control of rodlike objects by flow.pdf | 2009-05-04 01:12 | 164K | |
![[ ]](/icons/layout.gif) | Origami Fold as Algebraic Graph Rewriting.pdf | 2009-01-28 02:50 | 179K | |
![[IMG]](/icons/image2.gif) | PDMS_spectral_response.png | 2010-03-08 20:57 | 106K | |
![[IMG]](/icons/image2.gif) | PTD-DRBD_fusion_protein_by_Dowdy_Lab.jpg | 2009-05-17 07:03 | 24K | |
![[ ]](/icons/layout.gif) | Parasolid_XT_format_reference.pdf | 2009-02-27 05:46 | 355K | |
![[ ]](/icons/layout.gif) | Path-planning techniques for the simulation of disassembly tasks.pdf | 2009-09-01 09:09 | 297K | |
![[ ]](/icons/layout.gif) | Pathetically Simple Charge Sensitive Amplifier.pdf | 2009-04-21 21:39 | 17K | |
![[ ]](/icons/layout.gif) | Path planning with spatial and temporal constraints.pdf | 2011-01-28 06:21 | 858K | |
![[TXT]](/icons/text.gif) | Patrick Gunkel Is An Idea Man Who Thinks in Lists.html | 2008-10-05 23:29 | 30K | |
![[ ]](/icons/layout.gif) | Patterning design in color at the submicron scale.pdf | 2011-06-25 12:13 | 678K | |
![[ ]](/icons/layout.gif) | Patterning organic light-emitting diodes by cathode transfer - Hong H Lee.pdf | 2009-04-13 06:38 | 161K | |
![[ ]](/icons/layout.gif) | Pattern recognition of 3D CAD objects - towards an electronic yellow pages of mechanical parts.pdf | 2009-04-05 11:47 | 267K | |
![[ ]](/icons/layout.gif) | Peer-to-peer communication across network address translators (NATs).pdf | 2005-03-14 13:45 | 1.0M | |
![[IMG]](/icons/image2.gif) | Perkin_triangle_distillation_apparatus.svg.png | 2009-07-14 06:05 | 23K | |
![[ ]](/icons/layout.gif) | Photofabrication of Surface Relief Gratings on Azobenzene Polymer Films.pdf | 2009-04-21 21:41 | 762K | |
![[ ]](/icons/layout.gif) | Pick-and-place nanomanipulation using microfabricated grippers.pdf | 2009-04-18 14:04 | 1.1M | |
![[ ]](/icons/layout.gif) | Pink_Army_Cooperative.pdf | 2009-02-11 11:03 | 425K | |
![[TXT]](/icons/text.gif) | Pioneer Organisms Nominated for Terraforming.htm | 2009-05-08 22:09 | 7.6K | |
![[ ]](/icons/layout.gif) | Planning on mistakes - an approach to incorporate error checking into the design process.pdf | 2014-04-24 11:08 | 260K | |
![[ ]](/icons/layout.gif) | Plasma formation and temperature measurement during single-bubble cavitation.pdf | 2009-04-27 10:41 | 351K | |
![[ ]](/icons/layout.gif) | Plasma synthesis of aluminum nanoparticles.pdf | 2000-04-07 12:19 | 156K | |
![[TXT]](/icons/text.gif) | Plastic transistors @ Links.html | 2000-04-07 12:19 | 18K | |
![[ ]](/icons/layout.gif) | Polymer artificial muscles.pdf | 2000-07-21 20:52 | 3.8M | |
![[ ]](/icons/layout.gif) | Port-compatibility and connectability based assembly design.pdf | 2009-02-27 05:46 | 355K | |
![[ ]](/icons/layout.gif) | Predicting change propagation in complex design.pdf | 2009-09-18 20:38 | 166K | |
![[ ]](/icons/layout.gif) | Primer on the Mechanics of Tensegrity Structures.pdf | 2009-04-21 21:41 | 436K | |
![[ ]](/icons/layout.gif) | Principles of asynchronous circuit design - A systems Perspective.pdf | 2014-05-29 20:57 | 1.0M | |
![[ ]](/icons/layout.gif) | Printed optics - 3d printing for embedded optical elements for interactive devices.pdf | 2012-10-01 13:42 | 1.5M | |
![[ ]](/icons/layout.gif) | Proactive instructions for furniture assembly.pdf | 2009-09-01 09:00 | 2.4M | |
![[ ]](/icons/layout.gif) | Progress in epitaxial deposition on low-cost substrates for thin-film crystalline silicon solar cells at IMEC.pdf | 2010-01-25 20:00 | 297K | |
![[ ]](/icons/layout.gif) | Propulsion of a molecular machine by asymmetric distribution of reaction products.pdf | 2009-07-11 06:34 | 122K | |
![[ ]](/icons/layout.gif) | Puerto_Rico_Space_Renaissance_International_Congress.pdf | 2009-12-26 11:37 | 65K | |
![[ ]](/icons/layout.gif) | Push-pull actuation using opto-electrowetting.pdf | 2009-04-22 15:06 | 1.1M | |
![[ ]](/icons/layout.gif) | Python-arsenal-for-RE-1.1.pdf | 2012-06-18 07:51 | 1.2M | |
![[ ]](/icons/layout.gif) | RSGB-Microwave Projects.pdf | 2012-11-16 05:22 | 11M | |
![[ ]](/icons/layout.gif) | Reaction graphs and a construction of reaction networks.pdf | 2009-12-03 07:36 | 670K | |
![[ ]](/icons/layout.gif) | Reading DNA at single-nucleotide resolution with a mutant MspA nanopore and phi29 DNA polymerase - supplement.pdf | 2012-04-16 07:11 | 2.0M | |
![[ ]](/icons/layout.gif) | Reason maintenance: state of the art - 2008.pdf | 2009-03-30 05:14 | 581K | |
![[ ]](/icons/layout.gif) | Reception of Pictures from the Weather Satellites Using Homemade Equipment.pdf | 2009-05-05 22:24 | 1.2M | |
![[ ]](/icons/layout.gif) | Reeb graph based shape retrieval for CAD.pdf | 2009-04-03 15:53 | 3.4M | |
![[ ]](/icons/layout.gif) | Reeb graphs and Morse functions.pdf | 2009-04-03 15:12 | 114K | |
![[ ]](/icons/layout.gif) | Registered growth of mesoporous silica films on graphite.pdf | 2009-03-23 20:30 | 710K | |
![[ ]](/icons/a.gif) | Regli - Clustering techniques for databases of CAD models.ps | 2009-04-04 15:00 | 11M | |
![[ ]](/icons/layout.gif) | Remote excitation of neuronal circuits using low-intensity, low-frequency ultrasound.pdf | 2009-04-13 14:10 | 577K | |
![[ ]](/icons/layout.gif) | Rendering wounds in Left 4 Dead 2.pdf | 2010-08-03 17:31 | 4.3M | |
![[ ]](/icons/layout.gif) | Representing a circle or a sphere with NURBS.pdf | 2010-08-10 15:56 | 69K | |
![[ ]](/icons/layout.gif) | Representing and identifying alternative movement techniques for goal-directed manual tasks.pdf | 2009-04-11 09:43 | 331K | |
![[ ]](/icons/layout.gif) | Research of a cellular automaton simulating logic gates by evolutionary algorithms - Eurogp03.pdf | 2008-07-27 22:36 | 80K | |
![[IMG]](/icons/image2.gif) | Revealing hidden services by their clock skew.2.png | 2009-05-24 20:54 | 124K | |
![[IMG]](/icons/image2.gif) | Revealing hidden services by their clock skew.png | 2009-05-24 20:54 | 113K | |
![[ ]](/icons/layout.gif) | Review - 3D shape searching methods and computational costs - 2005.pdf | 2009-04-05 11:50 | 604K | |
![[ ]](/icons/layout.gif) | Review - A brief on constraint solving - 2005.pdf | 2009-04-06 13:23 | 235K | |
![[ ]](/icons/layout.gif) | Rise of liquids and bubbles in angular capillary tubes.pdf | 2009-04-26 05:56 | 77K | |
![[ ]](/icons/layout.gif) | Robert L. Forward - Dragon's Egg.pdf | 2008-05-15 00:04 | 1.0M | |
![[ ]](/icons/layout.gif) | Robert L. Forward - Starquake.pdf | 2008-05-15 00:03 | 1.1M | |
![[ ]](/icons/layout.gif) | Robust_Adaptive_Control.pdf | 2010-04-12 11:26 | 3.8M | |
![[ ]](/icons/layout.gif) | Round-bale feeder design affects hay waste and economics during horse feeding.pdf | 2011-06-07 23:29 | 58K | |
![[ ]](/icons/layout.gif) | Route Designer.pdf | 2009-05-08 03:55 | 886K | |
![[ ]](/icons/layout.gif) | Route designer - a retrosynthetic analysis tool utilizing automated retrosynthetic rule generation.pdf | 2009-07-09 08:38 | 422K | |
![[ ]](/icons/layout.gif) | SC09_TheCatIsOutofTheBag.pdf | 2009-11-18 10:56 | 2.1M | |
![[ ]](/icons/layout.gif) | Scale, causality, complexity and emergence - rethinking the ontological significance of scale.pdf | 2009-09-10 05:01 | 164K | |
![[ ]](/icons/layout.gif) | Scale-Space Representations and their Applications to 3D Matching of Solid Models.pdf | 2009-04-05 06:22 | 6.6K | |
![[ ]](/icons/unknown.gif) | Scale-Space Representations and their Applications to 3D Matching of Solid Models.ppt | 2009-04-05 06:22 | 4.2M | |
![[ ]](/icons/layout.gif) | Scale-space representation of 3D models and topological matching - Dmitriy Bespalov.pdf | 2009-04-05 06:22 | 661K | |
![[ ]](/icons/layout.gif) | Scanning capacitance microscopy on a 25 nm scale - is not what you think.pdf | 2009-04-19 16:07 | 771K | |
![[ ]](/icons/layout.gif) | Science Magazine Oct 27.2006.pdf | 2000-01-02 16:45 | 18M | |
![[ ]](/icons/layout.gif) | Scientific American Magazine - 2006-04 No 294-4 - Computing With Quantum Knots (Double Page).pdf | 2000-01-02 16:45 | 6.7M | |
![[ ]](/icons/layout.gif) | Sealand, Havenco, and the rule of law.pdf | 2014-05-11 03:51 | 836K | |
![[TXT]](/icons/text.gif) | Seasteading: A Practical Guide To Homesteading The High Seas.html | 2009-02-27 05:46 | 732K | |
![[ ]](/icons/layout.gif) | Self-alignment of glass spheres using the electromeniscus phenomenon.pdf | 2009-03-03 12:18 | 184K | |
![[ ]](/icons/layout.gif) | Self-directed movements of droplets on radially patterned surfaces based on self-assembled monolayers.pdf | 2009-04-25 12:30 | 274K | |
![[TXT]](/icons/text.gif) | Semantic Search Facilitator.html | 2008-10-20 20:33 | 520K | |
![[ ]](/icons/layout.gif) | Semiconductor manufacturing - in no particular order.pdf | 2009-08-30 11:11 | 14M | |
![[ ]](/icons/layout.gif) | Semiconductor production equipment market forces - Jay Stowsky - 1987.pdf | 2014-05-25 14:39 | 1.0M | |
![[ ]](/icons/layout.gif) | Shape optimization for Navier-Stokes flow.pdf | 2009-03-30 13:02 | 293K | |
![[IMG]](/icons/image2.gif) | Short_path_distillation_apparatus.svg | 2009-07-14 06:05 | 21K | |
![[IMG]](/icons/image2.gif) | Simple_distillation_apparatus.svg | 2009-07-14 06:05 | 34K | |
![[ ]](/icons/layout.gif) | Simple and cost-effective fabrication of two-dimensional plastic nanochannels from silica nanowire templates.pdf | 2009-03-19 16:02 | 294K | |
![[ ]](/icons/layout.gif) | Simultaneous shape decomposition and skeletonization via convexity shading.pdf | 2009-04-05 11:40 | 797K | |
![[ ]](/icons/layout.gif) | SingularityStudies.pdf | 2010-02-03 17:23 | 411K | |
![[ ]](/icons/layout.gif) | Size-dependent lens angles for small oil lenses on water.pdf | 2009-05-04 12:27 | 436K | |
![[ ]](/icons/layout.gif) | Smart Buildings Initiative_011210.pdf | 2010-01-12 12:01 | 335K | |
![[ ]](/icons/layout.gif) | Smart Buildings Initiative_ESI_121509.pdf | 2009-12-15 07:46 | 267K | |
![[ ]](/icons/layout.gif) | Snap fits and press fits.pdf | 2009-03-26 12:04 | 257K | |
![[ ]](/icons/layout.gif) | Software architecture of PSET - a page segmentation evaluation toolkit.pdf | 2008-08-13 13:31 | 253K | |
![[ ]](/icons/layout.gif) | Software libraries and their reuse - Entropy, Kolmogorov complexity, Zipf's law - Veldhuizen.pdf | 2000-07-21 20:49 | 917K | |
![[ ]](/icons/layout.gif) | Sonoluminescence - How bubbles turn sound into light.pdf | 2009-03-23 11:50 | 602K | |
![[ ]](/icons/layout.gif) | Sonoporation - Mechanical DNA Delivery by Ultrasonic Cavitation.pdf | 2009-04-22 10:26 | 300K | |
![[ ]](/icons/layout.gif) | Sonoporation of suspension cells with a single cavitation bubble in a microfludici confinement.pdf | 2009-02-27 05:46 | 368K | |
![[TXT]](/icons/text.gif) | So the Whole Earth Catalog is responsible for the colonization of space.html | 2008-07-20 10:47 | 63K | |
![[ ]](/icons/layout.gif) | Spatio-temporal models for estimating click-through rate.pdf | 2009-12-19 15:18 | 2.2M | |
![[ ]](/icons/layout.gif) | Stealthy dopant-level hardware trojans.pdf | 2013-06-07 11:54 | 433K | |
![[IMG]](/icons/image2.gif) | Steam_Distillation.JPG | 2009-07-14 06:04 | 69K | |
![[ ]](/icons/layout.gif) | Step-and-scan maskless lithography for ultra large scale DNA chips.pdf | 2009-02-27 05:46 | 256K | |
![[ ]](/icons/layout.gif) | Stepwise surface encoding for high-throughput assembly of nanoclusters - 2009.pdf | 2009-04-10 06:09 | 936K | |
![[ ]](/icons/unknown.gif) | Stochastic Graph Grammar Algorithm for Interactive Search.pptx | 2009-02-27 05:46 | 813K | |
![[ ]](/icons/layout.gif) | Storage media overview: historic perspectives - 2016.pdf | 2016-05-24 08:55 | 727K | |
![[ ]](/icons/layout.gif) | Structural optimization with FreeFem++.pdf | 2009-03-30 13:00 | 795K | |
![[ ]](/icons/layout.gif) | Sub-100 nm organic light-emitting diodes patterned with room temperature imprint lithography.pdf | 2009-03-06 18:56 | 406K | |
![[ ]](/icons/layout.gif) | Surface plasmon assisted contact scheme nanoscale photolithography using an UV lamp.pdf | 2009-02-27 05:46 | 443K | |
![[ ]](/icons/layout.gif) | Survey of Automated Feature Recognition Techniques - Regli.pdf | 2009-04-04 13:57 | 686K | |
![[ ]](/icons/layout.gif) | Swartz, Aaron Indictment.pdf | 2011-07-19 11:13 | 28K | |
![[ ]](/icons/layout.gif) | Switching from automatic to controlled action by monkey medial frontal cortex.pdf | 2009-05-04 20:48 | 500K | |
![[ ]](/icons/layout.gif) | Symbolic arithmetic knowledge without instruction - 2007.pdf | 2010-01-11 08:54 | 350K | |
![[ ]](/icons/layout.gif) | Symbolic state equations for analog circuit with excess elements.pdf | 2009-06-16 07:18 | 56K | |
![[ ]](/icons/layout.gif) | Synthesis_of_photolabile_2__2_nitropheny.pdf | 2009-06-23 14:15 | 89K | |
![[ ]](/icons/layout.gif) | Synthesis of Novel Phosphoramidite Building Blocks from Pentaerythritol.pdf | 2009-03-08 00:36 | 49K | |
![[ ]](/icons/layout.gif) | Synthesis of a gene for human growth hormone and its expression in Escherichia coli - 1984.pdf | 2009-03-08 00:48 | 1.1M | |
![[ ]](/icons/layout.gif) | Synthesis of mechanical networks - the inerter - 2002.pdf | 2009-10-13 11:50 | 439K | |
![[ ]](/icons/layout.gif) | Synthesis of silicon and germanium crystallites.pdf | 2000-04-07 12:21 | 4.5M | |
![[ ]](/icons/layout.gif) | Synthesis of silicon tetrachloride in melted salts from industrial waste.pdf | 2000-04-07 12:21 | 6.2K | |
![[IMG]](/icons/image2.gif) | TPJ_Helix.jpg | 2009-07-24 07:53 | 15K | |
![[TXT]](/icons/text.gif) | TURBOTOO.html | 2010-03-04 19:57 | 8.7K | |
![[DIR]](/icons/folder.gif) | TURBOTOO_files/ | 2010-03-04 19:57 | - | |
![[TXT]](/icons/text.gif) | Table of thermodynamic equations - Wikipedia, the free encyclopedia.html | 2000-04-07 12:21 | 51K | |
![[ ]](/icons/layout.gif) | Taxonomy of Human Abilities - Fleishman.pdf | 2010-03-08 16:47 | 72K | |
![[TXT]](/icons/text.gif) | Technology Review: A Better Solar Collector - filter photons via lenses.html | 2008-07-12 10:51 | 83K | |
![[ ]](/icons/layout.gif) | Technology roadmap for nanoelectronics.pdf | 2000-07-21 20:51 | 662K | |
![[ ]](/icons/layout.gif) | The Automation of Science.pdf | 2009-04-10 06:03 | 542K | |
![[ ]](/icons/layout.gif) | The Blacksmiths Craft-1952.pdf | 2009-09-05 02:41 | 13M | |
![[ ]](/icons/layout.gif) | The Internet of Things - A critique of ambient technology and the all-seeing network of RFID.pdf | 2010-02-26 16:34 | 3.8M | |
![[ ]](/icons/layout.gif) | The Invariant Set Hypothesis - A New Geometric Framework for the Foundations of Quantum Theory and the Role Played by Gravity.pdf | 2009-03-30 16:44 | 840K | |
![[TXT]](/icons/text.gif) | The Laws That Govern The Cosmos « Sigmund, Carl and Alfred.html | 2010-03-17 09:33 | 48K | |
![[ ]](/icons/layout.gif) | The Legend of Eli Whitney and Interchangeable Parts.pdf | 2009-03-03 13:40 | 471K | |
![[ ]](/icons/layout.gif) | The Luminescence of Adhesive Tape.pdf | 2009-03-23 11:53 | 538K | |
![[TXT]](/icons/text.gif) | The Most Powerful Diesel Engine in the World.html | 2010-02-19 21:12 | 8.7K | |
![[DIR]](/icons/folder.gif) | The Most Powerful Diesel Engine in the World_files/ | 2010-02-19 21:12 | - | |
![[ ]](/icons/layout.gif) | The New Human Genre - Primo Posthuman - Natasha Vita-More.pdf | 2010-07-13 11:11 | 102K | |
![[ ]](/icons/layout.gif) | The Peter principle revisited - strategies for promoting individuals in businesses.pdf | 2009-07-06 05:47 | 214K | |
![[ ]](/icons/layout.gif) | The QED engine system - Direct-electric fusion-powered rocket propulsion systems.pdf | 2010-01-24 19:15 | 941K | |
![[ ]](/icons/layout.gif) | The Resource-Based Paradigm - Configuring Technical Systems from Modular Components - Heinrich.pdf | 2009-02-27 05:46 | 1.1M | |
![[TXT]](/icons/text.gif) | The Virgo Cluster of Galaxies.html | 2000-07-21 20:51 | 12K | |
![[ ]](/icons/layout.gif) | The_C_Programming_Language.pdf | 2011-06-08 11:29 | 897K | |
![[ ]](/icons/layout.gif) | The analysis of potential mating trajectories and grasp sites - 1993.pdf | 2009-04-04 15:09 | 1.1M | |
![[ ]](/icons/layout.gif) | The core structure of presolar graphite onions - Fraundorf.pdf | 2009-03-23 04:50 | 215K | |
![[ ]](/icons/layout.gif) | The effects of corruption on individual communication behavior.pdf | 2013-08-28 12:23 | 829K | |
![[ ]](/icons/layout.gif) | The evolution and development of the universe - 2008.pdf | 2009-12-21 18:21 | 4.1M | |
![[ ]](/icons/layout.gif) | The homebrew industrial revolution - Kevin Carson.pdf | 2010-01-07 12:09 | 539K | |
![[ ]](/icons/layout.gif) | The little book about operating system development.pdf | 2012-05-11 07:45 | 488K | |
![[ ]](/icons/layout.gif) | The physics of information processing superobjects - Anders Sandberg - 1999.pdf | 2000-07-21 20:51 | 376K | |
![[ ]](/icons/layout.gif) | The physics of information processing superobjects - Anders Sandberg.pdf | 2009-04-08 19:58 | 331K | |
![[ ]](/icons/layout.gif) | The potential of a chemical graph transformation system.pdf | 2009-05-07 14:12 | 261K | |
![[ ]](/icons/layout.gif) | Thermodynamic Analysis of Resources Used in Manufacturing Processes - Gutowski - 2009.pdf | 2009-03-18 13:46 | 283K | |
![[ ]](/icons/layout.gif) | Thermodynamics of natural selection I: Energy flow and the limits on organization.pdf | 2009-03-04 12:20 | 411K | |
![[ ]](/icons/layout.gif) | TheseSass2004.pdf | 2004-01-12 07:41 | 6.1M | |
![[ ]](/icons/layout.gif) | The spiral slingatron mass launcher.pdf | 2014-07-28 12:25 | 1.2M | |
![[ ]](/icons/layout.gif) | Thiel on Progress and Stagnation.pdf | 2020-07-26 13:52 | 2.2M | |
![[ ]](/icons/layout.gif) | Think global, act local - projectome estimation with BlueMatter - 2009.pdf | 2009-11-18 10:57 | 1.0M | |
![[ ]](/icons/layout.gif) | Three-dimensional photolithographic patterning of multiple bioactive ligands in poly(ethylene glycol) hydrogels.pdf | 2010-12-28 11:32 | 330K | |
![[ ]](/icons/layout.gif) | Tinkerers.pdf | 2010-11-19 10:15 | 7.0M | |
![[ ]](/icons/layout.gif) | Tolerances in geometric constraint problems.pdf | 2009-04-06 13:21 | 288K | |
![[ ]](/icons/layout.gif) | Topology matching for fully automatic similarity estimation of 3D shapes.pdf | 2009-04-03 16:16 | 416K | |
![[ ]](/icons/layout.gif) | Toward a formal characterization of pragmatic general intelligence - Goertzel - 2009.pdf | 2010-06-04 13:46 | 131K | |
![[ ]](/icons/layout.gif) | Toward a unified representation of mechanical assemblies.pdf | 2009-01-28 10:17 | 963K | |
![[ ]](/icons/layout.gif) | Towards a Spiderman suit - large invisible cables and self-cleaning releasable superadhesive materials.pdf | 2009-04-29 07:44 | 694K | |
![[ ]](/icons/layout.gif) | Towards a general-purpose belief maintenance system.pdf | 2013-04-11 17:00 | 552K | |
![[ ]](/icons/layout.gif) | Towards a general ontology of configuration.pdf | 2009-02-27 05:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Towards a universal knowledge database for design automation - Lipson.pdf | 2009-02-27 05:46 | 282K | |
![[ ]](/icons/layout.gif) | Towards cyclic fabrication systems for modular robotics and rapid manufacturing.pdf | 2009-08-22 04:56 | 2.1M | |
![[ ]](/icons/layout.gif) | Towards efficient MapReduce using MPI.pdf | 2010-03-28 09:15 | 184K | |
![[ ]](/icons/layout.gif) | Towards responsible use of cognitive-enhancing drugs by the healthy.pdf | 2009-04-14 04:37 | 666K | |
![[ ]](/icons/layout.gif) | Tracking minimum distances between curved objects with parametric surfaces in real time.pdf | 2009-04-05 15:19 | 268K | |
![[ ]](/icons/layout.gif) | Transfer function model of a brushless exciter.pdf | 2009-10-13 11:32 | 349K | |
![[ ]](/icons/layout.gif) | Transfer functions - mathematical models of physical systems.pdf | 2009-10-13 11:38 | 600K | |
![[ ]](/icons/layout.gif) | Transfer functions - sample dynamic systems and their mathematical descriptions.pdf | 2009-10-13 11:37 | 1.7M | |
![[ ]](/icons/layout.gif) | Transformational system design based on a formal computational model and skeletons.pdf | 2010-09-08 17:42 | 75K | |
![[ ]](/icons/layout.gif) | Translating biomolecular recognition into nanomechanics - Fritz - 2000.pdf | 2009-05-03 22:22 | 215K | |
![[ ]](/icons/layout.gif) | Trapping cavitation bubbles with a self-focused laser beam.pdf | 2009-04-27 23:26 | 2.2M | |
![[IMG]](/icons/image2.gif) | Tseng_Image_1-prv.jpg | 2010-01-22 16:52 | 130K | |
![[ ]](/icons/layout.gif) | Tunnelling readout of hydrogen-bonding-based recognition.pdf | 2009-03-22 15:26 | 613K | |
![[TXT]](/icons/text.gif) | Two Bits: The Cultural Significance of Free Software » Chapter 2: Protestant Reformers, Polymaths, Transhumanists.html | 2008-08-03 12:45 | 150K | |
![[ ]](/icons/layout.gif) | Ultrasound, a new separation technique to harvest microalgae.pdf | 2009-04-02 12:55 | 1.1M | |
![[ ]](/icons/layout.gif) | Understanding tables in context using standard NLP toolkits.pdf | 2013-07-21 21:25 | 595K | |
![[ ]](/icons/layout.gif) | United Nations Layout Key for Trade Documents.pdf | 2008-12-18 16:41 | 49K | |
![[ ]](/icons/layout.gif) | Unmanned Systems Roadmap.2007-2032.pdf | 2000-04-07 12:21 | 12M | |
![[ ]](/icons/layout.gif) | Using an evolutionary algorithm for catalog design.pdf | 2009-02-27 05:46 | 2.1M | |
![[ ]](/icons/layout.gif) | Using assembly representations to enable evolutionary design of Lego structures - Regli.pdf | 2009-04-04 13:49 | 345K | |
![[ ]](/icons/layout.gif) | Using assembly representations to enable evolutionary design of lego structures.pdf | 2009-09-02 10:29 | 486K | |
![[ ]](/icons/layout.gif) | Using graph theory and symbolic computing to generate efficient models for multi-body vehicle dynamics.pdf | 2009-06-01 12:13 | 777K | |
![[ ]](/icons/layout.gif) | Using linear graph theory and the principle of orthogonality to model multibody, multi-domain systems.pdf | 2009-06-01 12:10 | 572K | |
![[ ]](/icons/layout.gif) | Validation of an integrated Raman- and angular-scattering microscopy system on heterogeneous bead mixtures and single human immune cells.pdf | 2009-04-02 14:14 | 1.2M | |
![[ ]](/icons/layout.gif) | Versatile stepper based maskless microlithography using a liquid crystal display (LCD) for direct write of binary and multilevel microstructures - 2007 - awesome.pdf | 2009-04-13 03:19 | 764K | |
![[ ]](/icons/layout.gif) | Versatile stepper based maskless microlithography using a liquid crystal display for direct write of binary and multilevel microstructures.pdf | 2009-02-27 05:46 | 764K | |
![[ ]](/icons/layout.gif) | Viewing magnetic field patterns in 3D with baby oil bottles.pdf | 2010-10-21 08:50 | 174K | |
![[ ]](/icons/layout.gif) | WWW as a superbrain.pdf | 2000-07-21 20:51 | 26K | |
![[ ]](/icons/layout.gif) | Water-core Fresnel fiber.pdf | 2009-05-06 05:46 | 1.5M | |
![[ ]](/icons/layout.gif) | Water-drop projector.pdf | 2009-05-04 08:19 | 80K | |
![[ ]](/icons/layout.gif) | Water droplet lens microscope and microphotographs.pdf | 2009-05-04 08:16 | 1.4M | |
![[ ]](/icons/layout.gif) | Water in micro-and nanofluidics systems described using the water potential.pdf | 2009-05-06 07:11 | 487K | |
![[ ]](/icons/layout.gif) | Web-based modular interface geometries with constraints in assembly models - products interface geometries table.pdf | 2009-04-05 14:35 | 1.0M | |
![[ ]](/icons/layout.gif) | Wed1430-dover_riscv_jan2016_v3.pdf | 2016-04-09 08:39 | 1.1M | |
![[ ]](/icons/layout.gif) | What are the roles and responsibilities of the media in disseminating health information.pdf | 2009-10-23 09:53 | 294K | |
![[ ]](/icons/layout.gif) | What drives exponential improvements?.pdf | 2013-02-27 17:26 | 260K | |
![[ ]](/icons/layout.gif) | What good is historical epistemology.pdf | 2014-03-14 11:35 | 256K | |
![[ ]](/icons/layout.gif) | What is the surface tension of a lipid bilayer membrane?.pdf | 2009-03-12 17:42 | 315K | |
![[ ]](/icons/layout.gif) | Who steers who steers? A note on identifying vulnerable moral propensities.pdf | 2014-04-25 13:55 | 32K | |
![[ ]](/icons/layout.gif) | Why mechanical design cannot be like VLSI design - Whitney - 1996.pdf | 2009-02-27 05:46 | 85K | |
![[ ]](/icons/layout.gif) | Why objects are not enough.pdf | 2009-02-27 05:46 | 96K | |
![[ ]](/icons/layout.gif) | Wood frame grammar.pdf | 2009-03-26 10:07 | 600K | |
![[ ]](/icons/layout.gif) | Word problems in Russia and America.pdf | 2010-11-06 10:49 | 784K | |
![[ ]](/icons/layout.gif) | Worse is better is worse.pdf | 2012-08-04 13:00 | 56K | |
![[ ]](/icons/layout.gif) | Writing a transfer function for a mechanical system.pdf | 2009-10-13 11:23 | 39K | |
![[TXT]](/icons/text.gif) | [tt] NS: Interview (Donna Haraway): The age of entanglement.html | 2008-07-06 19:31 | 12K | |
![[ ]](/icons/layout.gif) | _Influence_People.pdf | 2009-09-02 02:00 | 466K | |
![[TXT]](/icons/text.gif) | a11.landing.html | 2009-07-24 07:53 | 125K | |
![[DIR]](/icons/folder.gif) | a11.landing_files/ | 2009-07-21 15:49 | - | |
![[DIR]](/icons/folder.gif) | aaronsw/ | 2012-09-20 12:53 | - | |
![[ ]](/icons/layout.gif) | accounting.pdf | 2014-07-14 11:12 | 1.1M | |
![[TXT]](/icons/text.gif) | adl-kanzure-reviewpapers-irrelevant.txt | 2009-06-08 06:49 | 1.0K | |
![[DIR]](/icons/folder.gif) | agriculture/ | 2010-04-19 07:23 | - | |
![[DIR]](/icons/folder.gif) | ai/ | 2023-01-20 11:15 | - | |
![[TXT]](/icons/text.gif) | algacide.txt | 2009-02-27 05:46 | 1.5K | |
![[ ]](/icons/layout.gif) | ambition.pdf | 2016-01-18 11:07 | 14M | |
![[IMG]](/icons/image2.gif) | anaesthesia-machine-schematic.png | 2009-08-30 16:31 | 143K | |
![[IMG]](/icons/image2.gif) | anaesthesia-machines.png | 2009-08-30 16:28 | 180K | |
![[TXT]](/icons/text.gif) | apigenin.txt | 2010-01-16 06:27 | 267 | |
![[ ]](/icons/layout.gif) | arpdendrimernpicwpaper.pdf | 2008-03-08 11:38 | 3.5M | |
![[DIR]](/icons/folder.gif) | assemblies/ | 2009-09-04 09:32 | - | |
![[DIR]](/icons/folder.gif) | assembly-planning/ | 2014-11-13 19:43 | - | |
![[IMG]](/icons/image2.gif) | atherosclerosis-early-etiology.jpg | 2009-06-28 18:05 | 63K | |
![[ ]](/icons/compressed.gif) | ayxuh.zip | 2009-08-03 21:40 | 17M | |
![[DIR]](/icons/folder.gif) | backups/ | 2010-02-25 15:37 | - | |
![[DIR]](/icons/folder.gif) | bacteriorhodopsin_memory/ | 2016-01-06 16:11 | - | |
![[IMG]](/icons/image2.gif) | battery-comparison.png | 2009-04-03 07:27 | 32K | |
![[IMG]](/icons/image2.gif) | bayer-advia-centour-system.png | 2009-08-30 16:26 | 143K | |
![[DIR]](/icons/folder.gif) | bayes/ | 2010-01-25 13:32 | - | |
![[ ]](/icons/layout.gif) | beilstein-db.pdf | 2009-10-09 21:01 | 24K | |
![[DIR]](/icons/folder.gif) | bib.tiera.ru/ | 2012-02-18 20:02 | - | |
![[DIR]](/icons/folder.gif) | bibliographies/ | 2016-01-06 15:22 | - | |
![[IMG]](/icons/image2.gif) | bifurcation.jpg | 2009-02-01 18:26 | 133K | |
![[DIR]](/icons/folder.gif) | bio/ | 2024-06-20 05:50 | - | |
![[DIR]](/icons/folder.gif) | biobricks/ | 2010-07-20 11:03 | - | |
![[IMG]](/icons/image2.gif) | biofab-on-a-chip-2.png | 2010-01-22 16:52 | 588K | |
![[IMG]](/icons/image2.gif) | biofab-on-a-chip.png | 2010-01-22 16:51 | 656K | |
![[IMG]](/icons/image2.gif) | biophysj00092-0246-a.jpg | 2009-04-20 17:01 | 27K | |
![[TXT]](/icons/text.gif) | biopunk_manifesto.txt | 2010-02-02 10:06 | 5.5K | |
![[ ]](/icons/compressed.gif) | bitcoin-papers.2018-06-18.zip | 2018-06-18 07:54 | 254M | |
![[DIR]](/icons/folder.gif) | bitcoin/ | 2023-09-14 10:27 | - | |
![[IMG]](/icons/image2.gif) | bluebrain.png | 2009-05-24 21:00 | 657K | |
![[DIR]](/icons/folder.gif) | body-temperature/ | 2009-07-26 05:13 | - | |
![[DIR]](/icons/folder.gif) | bodybuilding/ | 2023-06-21 08:08 | - | |
![[IMG]](/icons/image2.gif) | boergesenia forbesii.jpg | 2009-03-01 12:49 | 110K | |
![[DIR]](/icons/folder.gif) | bondgraphs/ | 2010-03-14 12:27 | - | |
![[ ]](/icons/layout.gif) | braga_goodenough_solid_state_glass_lithium_battery.pdf | 2017-07-20 18:06 | 2.5M | |
![[ ]](/icons/odf6ots-20x22.png) | braga_goodenough_solid_state_glass_lithium_battery.pdf.ots | 2017-07-20 21:41 | 265 | |
![[ ]](/icons/layout.gif) | brain-emulation-roadmap-report.pdf | 2009-08-14 08:05 | 2.4M | |
![[IMG]](/icons/image2.gif) | brainbow_strategies.png | 2009-05-24 20:51 | 600K | |
![[TXT]](/icons/text.gif) | bubblealgae.txt | 2009-03-01 12:46 | 101 | |
![[DIR]](/icons/folder.gif) | business/ | 2014-05-26 07:14 | - | |
![[DIR]](/icons/folder.gif) | by-email/ | 2010-01-16 07:14 | - | |
![[DIR]](/icons/folder.gif) | cad/ | 2016-01-06 16:18 | - | |
![[IMG]](/icons/image2.gif) | campbell-bondgraphs.png | 2009-05-24 21:00 | 47K | |
![[IMG]](/icons/image2.gif) | campbell-dissertation-diagram-thingy.png | 2009-05-24 21:00 | 53K | |
![[DIR]](/icons/folder.gif) | campbell/ | 2015-12-12 18:50 | - | |
![[DIR]](/icons/folder.gif) | cancer/ | 2010-06-19 18:49 | - | |
![[DIR]](/icons/folder.gif) | capitalism-magazine/ | 2020-01-01 13:56 | - | |
![[DIR]](/icons/folder.gif) | carbon-nanotubes/ | 2016-01-06 16:05 | - | |
![[TXT]](/icons/text.gif) | carlcrott.txt | 2011-08-05 12:30 | 3.9K | |
![[DIR]](/icons/folder.gif) | chemistry/ | 2022-10-08 03:40 | - | |
![[ ]](/icons/layout.gif) | chili peppers revisited1.pdf | 2010-02-25 13:36 | 491K | |
![[ ]](/icons/layout.gif) | chili peppers revisited2.pdf | 2010-02-25 13:36 | 394K | |
![[ ]](/icons/layout.gif) | chili peppers revisited3.pdf | 2010-02-25 13:36 | 394K | |
![[IMG]](/icons/image2.gif) | circular-pcr.png | 2009-04-19 07:51 | 77K | |
![[TXT]](/icons/text.gif) | citestats.user.js | 2009-04-27 20:30 | 2.3K | |
![[IMG]](/icons/image2.gif) | colchromatog.djvu | 2009-07-14 06:05 | 144K | |
![[IMG]](/icons/image2.gif) | cold-form-designs.jpg | 2009-07-27 13:38 | 17K | |
![[TXT]](/icons/text.gif) | compartmentalized_self-replication.txt | 2010-01-26 10:14 | 954 | |
![[DIR]](/icons/folder.gif) | compatibility-issues-paper/ | 2009-09-18 18:25 | - | |
![[ ]](/icons/layout.gif) | compchem-roadmap.pdf | 2000-04-07 12:17 | 511K | |
![[DIR]](/icons/folder.gif) | computer-science/ | 2024-04-26 06:25 | - | |
![[IMG]](/icons/image2.gif) | condenser.jpg | 2009-07-14 06:04 | 13K | |
![[IMG]](/icons/image2.gif) | consumer-reports-scanners.jpg | 2009-07-14 06:04 | 147K | |
![[IMG]](/icons/image2.gif) | contact_angle.png | 2009-05-24 20:52 | 22K | |
![[TXT]](/icons/text.gif) | copper condensor.html | 2009-07-14 06:04 | 86K | |
![[DIR]](/icons/folder.gif) | copper condensor_files/ | 2009-07-12 20:48 | - | |
![[DIR]](/icons/folder.gif) | cpu-design/ | 2014-12-09 13:56 | - | |
![[DIR]](/icons/folder.gif) | cryonics/ | 2022-08-05 05:39 | - | |
![[DIR]](/icons/folder.gif) | curing/ | 2014-06-17 22:48 | - | |
![[IMG]](/icons/image2.gif) | dc-brush-motor-cyclic-fabrication-system.png | 2009-10-13 09:33 | 2.5M | |
![[ ]](/icons/layout.gif) | debian_study.pdf | 2009-02-27 05:46 | 693K | |
![[IMG]](/icons/image2.gif) | design-utility-search.png | 2009-05-24 21:00 | 64K | |
![[DIR]](/icons/folder.gif) | detc/ | 2016-01-06 16:09 | - | |
![[IMG]](/icons/image2.gif) | distillation-by-retort.png | 2009-07-14 06:05 | 92K | |
![[IMG]](/icons/image2.gif) | distillation-schematic.jpg | 2009-07-14 06:05 | 42K | |
![[ ]](/icons/layout.gif) | distilling_laws.pdf | 2009-05-14 15:43 | 519K | |
![[DIR]](/icons/folder.gif) | distributed/ | 2014-03-04 21:32 | - | |
![[DIR]](/icons/folder.gif) | diybio/ | 2021-06-06 12:28 | - | |
![[TXT]](/icons/text.gif) | diytranshuman_projects.txt | 2009-07-14 06:04 | 212 | |
![[TXT]](/icons/text.gif) | diytranshuman_projects.v2.txt | 2009-07-24 11:40 | 1.9K | |
![[TXT]](/icons/text.gif) | diytranshuman_projects.v3.txt | 2011-01-14 10:57 | 2.3K | |
![[TXT]](/icons/text.gif) | diytranshuman_projects.v4.html | 2011-02-11 19:35 | 8.6K | |
![[ ]](/icons/layout.gif) | djfkdadfad.pdf | 2004-12-21 11:44 | 43K | |
![[DIR]](/icons/folder.gif) | drazak/ | 2016-01-06 15:56 | - | |
![[DIR]](/icons/folder.gif) | dreaming/ | 2011-01-13 21:56 | - | |
![[DIR]](/icons/folder.gif) | dy-mo-papers/ | 2011-07-20 02:29 | - | |
![[IMG]](/icons/image2.gif) | dynamic_ability_of_the_human_body.png | 2009-05-24 20:51 | 476K | |
![[IMG]](/icons/image2.gif) | early-electrostatic-generator.png | 2009-08-30 16:32 | 106K | |
![[TXT]](/icons/text.gif) | easy steam distillation is the way to go.html | 2009-07-14 06:04 | 222K | |
![[DIR]](/icons/folder.gif) | easy steam distillation is the way to go_files/ | 2009-07-12 20:44 | - | |
![[IMG]](/icons/image2.gif) | electron-microscopy.gif | 2009-09-04 16:55 | 25K | |
![[TXT]](/icons/text.gif) | electrowetting.bib | 2009-04-22 15:10 | 19K | |
![[TXT]](/icons/text.gif) | electrowetting.html | 2009-04-22 15:10 | 15K | |
![[DIR]](/icons/folder.gif) | ellington/ | 2011-06-27 14:11 | - | |
![[DIR]](/icons/folder.gif) | engineering/ | 2014-04-24 11:25 | - | |
![[ ]](/icons/unknown.gif) | equer.lisp | 2009-05-25 20:20 | 8.1K | |
![[DIR]](/icons/folder.gif) | erythematosus/ | 2010-02-22 14:34 | - | |
![[ ]](/icons/layout.gif) | establishment_of_fetal_bovine_cultures.pdf | 2009-07-24 21:56 | 2.3M | |
![[ ]](/icons/layout.gif) | etch rates.pdf | 2009-11-24 13:36 | 11K | |
![[ ]](/icons/unknown.gif) | f214x.igs | 2009-07-14 11:13 | 12K | |
![[TXT]](/icons/text.gif) | fab_lab_start_up_general_budget.html | 2010-03-04 16:39 | 27K | |
![[IMG]](/icons/image2.gif) | fenn_nanopore_sequencing.png | 2009-05-24 20:54 | 7.0K | |
![[DIR]](/icons/folder.gif) | financial/ | 2020-12-17 06:35 | - | |
![[TXT]](/icons/text.gif) | find-lithography.txt | 2020-02-25 07:30 | 18K | |
![[IMG]](/icons/image2.gif) | floorplan-total-laboratory-automation.png | 2009-08-30 16:27 | 100K | |
![[IMG]](/icons/image2.gif) | fraunhofer-chalmers-centre-volvo.png | 2009-09-05 14:18 | 412K | |
![[DIR]](/icons/folder.gif) | freitas/ | 2023-03-04 18:56 | - | |
![[DIR]](/icons/folder.gif) | frey/ | 2009-12-21 22:16 | - | |
![[DIR]](/icons/folder.gif) | futurism/ | 2019-10-09 15:56 | - | |
![[DIR]](/icons/folder.gif) | gaming/ | 2017-05-02 16:58 | - | |
![[ ]](/icons/layout.gif) | gardia_response_in_epithelial_cells.pdf | 2009-07-24 21:51 | 718K | |
![[DIR]](/icons/folder.gif) | gear-train-topology-optimization/ | 2016-01-06 16:26 | - | |
![[DIR]](/icons/folder.gif) | gene-therapy/ | 2018-04-13 06:31 | - | |
![[IMG]](/icons/image2.gif) | gene_doping_for_sports_enhancement.png | 2010-02-25 16:23 | 133K | |
![[IMG]](/icons/image2.gif) | genehacker-part-stuff.jpg | 2009-09-02 18:07 | 685K | |
![[TXT]](/icons/text.gif) | get.txt | 2018-06-02 07:28 | 769 | |
![[IMG]](/icons/image2.gif) | getting_a_grip_on_spider_attachment.png | 2009-05-24 20:52 | 824K | |
![[IMG]](/icons/image2.gif) | ginkgotransfguide.jpg | 2008-12-30 16:55 | 121K | |
![[VID]](/icons/movie.gif) | golem480x240.wmv | 2009-01-07 14:27 | 16M | |
![[IMG]](/icons/image2.gif) | googleeyemap.jpg | 2010-01-05 12:35 | 15K | |
![[DIR]](/icons/folder.gif) | gpu/ | 2009-09-05 11:12 | - | |
![[IMG]](/icons/image2.gif) | graph1_alternate_agar_formula.png | 2009-05-24 21:01 | 39K | |
![[DIR]](/icons/folder.gif) | graphene/ | 2011-06-11 18:20 | - | |
![[TXT]](/icons/text.gif) | guerrilla_cnc1.html | 2009-09-20 15:34 | 233K | |
![[DIR]](/icons/folder.gif) | gwern.net/ | 2023-01-18 15:16 | - | |
![[ ]](/icons/layout.gif) | haas-vf-6-40tr.pdf | 2009-09-01 13:44 | 1.0M | |
![[IMG]](/icons/image2.gif) | homemade-centrifuge.jpg | 2009-09-06 12:08 | 13K | |
![[TXT]](/icons/text.gif) | homemade-centrifuge.jpg.url.txt | 2009-09-06 12:08 | 92 | |
![[TXT]](/icons/text.gif) | hu body temperature.html | 2009-07-27 13:38 | 69K | |
![[DIR]](/icons/folder.gif) | human-height/ | 2010-06-08 08:09 | - | |
![[ ]](/icons/unknown.gif) | human_brain.yaml | 2009-08-07 15:36 | 26K | |
![[IMG]](/icons/image2.gif) | human_nail_plate.png | 2009-05-24 21:01 | 309K | |
![[ ]](/icons/layout.gif) | human_nail_plate.png_Replication techniques for dry and wet biological surfaces.pdf | 2009-03-23 17:24 | 288K | |
![[IMG]](/icons/image2.gif) | human_strength_vs_position.png | 2009-04-11 13:46 | 45K | |
![[DIR]](/icons/folder.gif) | igem/ | 2009-05-04 20:32 | - | |
![[DIR]](/icons/folder.gif) | incentives/ | 2016-10-25 20:27 | - | |
![[TXT]](/icons/text.gif) | index.2011.txt | 2011-04-25 21:41 | 386K | |
![[TXT]](/icons/text.gif) | index.2016-01-06.old.txt | 2016-01-06 15:02 | 7.6M | |
![[TXT]](/icons/text.gif) | index.2016-01-06.txt | 2016-01-06 16:36 | 1.1M | |
![[ ]](/icons/layout.gif) | infatable_heliostat_sphere.pdf | 2009-05-16 19:10 | 3.5M | |
![[DIR]](/icons/folder.gif) | inkjet/ | 2018-01-15 08:50 | - | |
![[TXT]](/icons/text.gif) | instructions - all glass distillation setup.html | 2009-07-14 06:05 | 92K | |
![[DIR]](/icons/folder.gif) | instructions - all glass distillation setup_files/ | 2009-07-12 13:55 | - | |
![[ ]](/icons/compressed.gif) | instructions-images.zip | 2009-09-16 15:46 | 4.9M | |
![[DIR]](/icons/folder.gif) | instructions/ | 2016-01-06 16:19 | - | |
![[DIR]](/icons/folder.gif) | integrated-chips/ | 2014-06-01 21:25 | - | |
![[TXT]](/icons/text.gif) | interchangeable_parts.txt | 2008-12-30 12:02 | 8.7K | |
![[IMG]](/icons/image2.gif) | internet-malicious-activity-map.png | 2009-12-30 10:09 | 131K | |
![[ ]](/icons/layout.gif) | isru-moon.pdf | 2010-10-26 15:39 | 3.9M | |
![[ ]](/icons/layout.gif) | jcline-ps-tripler1-schematic-REVB-high-voltage-power-supply-for-microbiology.pdf | 2009-06-24 06:38 | 51K | |
![[DIR]](/icons/folder.gif) | jellyfish/ | 2010-07-03 07:18 | - | |
![[TXT]](/icons/text.gif) | journals.txt | 2009-05-30 16:06 | 7.5K | |
![[TXT]](/icons/text.gif) | lantern-lighting.html | 2009-09-04 16:56 | 27K | |
![[DIR]](/icons/folder.gif) | lantern-lighting_files/ | 2009-09-04 16:56 | - | |
![[ ]](/icons/layout.gif) | laurilove-reading-2017-frontpages.pdf | 2017-10-22 11:20 | 57M | |
![[ ]](/icons/layout.gif) | laurilove-reading-2017-frontpages.v2.pdf | 2017-10-22 12:13 | 138M | |
![[DIR]](/icons/folder.gif) | law/ | 2022-09-17 19:26 | - | |
![[ ]](/icons/layout.gif) | lego-fig-patent.pdf | 2009-08-28 10:23 | 78K | |
![[IMG]](/icons/image2.gif) | lego-minifig-dimensions-2.png | 2009-07-31 07:17 | 31K | |
![[IMG]](/icons/image2.gif) | lego-minifig-dimensions.png | 2009-07-31 07:17 | 53K | |
![[ ]](/icons/layout.gif) | lexyacc.pdf | 2010-09-18 08:28 | 127K | |
![[TXT]](/icons/text.gif) | lib_index.archels.txt | 2016-01-06 14:59 | 1.7M | |
![[ ]](/icons/layout.gif) | lipkowitz_photonic_crystal_defects.pdf | 2009-10-23 09:27 | 466K | |
![[DIR]](/icons/folder.gif) | localization/ | 2010-03-01 07:37 | - | |
![[DIR]](/icons/folder.gif) | longevity/ | 2023-11-28 16:57 | - | |
![[ ]](/icons/compressed.gif) | longmeir-arecentarticleofmine.zip | 2010-02-28 11:38 | 1.6M | |
![[ ]](/icons/layout.gif) | luminous.pdf | 2008-05-15 00:46 | 67K | |
![[TXT]](/icons/text.gif) | lysis.bib | 2009-04-08 12:16 | 80K | |
![[TXT]](/icons/text.gif) | lysis.html | 2009-04-08 12:16 | 87K | |
![[TXT]](/icons/text.gif) | lysis_bib.html | 2009-04-08 12:16 | 89K | |
![[DIR]](/icons/folder.gif) | machinery_handbook/ | 2016-01-06 16:21 | - | |
![[DIR]](/icons/folder.gif) | maharbiz/ | 2010-05-22 10:18 | - | |
![[DIR]](/icons/folder.gif) | management/ | 2014-10-18 14:54 | - | |
![[IMG]](/icons/image2.gif) | manufacturing-materials-processes-genehacker.jpg | 2009-10-24 15:15 | 726K | |
![[ ]](/icons/layout.gif) | marble-logic-computing.pdf | 2003-05-13 10:24 | 36K | |
![[DIR]](/icons/folder.gif) | marketing/ | 2014-02-26 09:40 | - | |
![[DIR]](/icons/folder.gif) | math/ | 2018-10-08 02:27 | - | |
![[TXT]](/icons/text.gif) | megastruct.txt | 2000-07-21 20:52 | 21K | |
![[DIR]](/icons/folder.gif) | melatonin/ | 2010-04-03 05:25 | - | |
![[DIR]](/icons/folder.gif) | mems/ | 2018-03-31 08:58 | - | |
![[DIR]](/icons/folder.gif) | merkle/ | 2022-06-11 17:20 | - | |
![[DIR]](/icons/folder.gif) | mesh/ | 2009-08-11 07:53 | - | |
![[IMG]](/icons/image2.gif) | microfluidic-protein-purification-design.png | 2009-07-14 06:14 | 188K | |
![[DIR]](/icons/folder.gif) | microfluidics/ | 2022-09-17 19:28 | - | |
![[IMG]](/icons/image2.gif) | microfluidics_Quake_DNA_synthesizer-20mers-PFPE.png | 2009-05-25 11:41 | 413K | |
![[IMG]](/icons/image2.gif) | microfluidics_Sanger_sequencer.png | 2009-05-25 00:08 | 535K | |
![[ ]](/icons/unknown.gif) | microwave-flash-sintering-of-inkjet-printed-silver-tracks-on-polymer-substrates.pdf | 2009-08-14 02:51 | 300K | |
![[DIR]](/icons/folder.gif) | mobile/ | 2012-11-17 19:54 | - | |
![[ ]](/icons/layout.gif) | mockingbird.pdf | 2009-07-27 13:38 | 2.5M | |
![[ ]](/icons/layout.gif) | model_exploration_Lipson.pdf | 2009-05-16 19:05 | 616K | |
![[DIR]](/icons/folder.gif) | molecular-machines/ | 2011-01-05 11:48 | - | |
![[IMG]](/icons/image2.gif) | morphogenesis_mutations.png | 2009-05-24 20:54 | 85K | |
![[ ]](/icons/layout.gif) | moses_urethane_wax_replicator.pdf | 2009-06-10 11:04 | 2.1M | |
![[ ]](/icons/layout.gif) | mov is Turing-complete.pdf | 2013-07-19 07:59 | 175K | |
![[DIR]](/icons/folder.gif) | myostatin/ | 2016-01-06 16:34 | - | |
![[DIR]](/icons/folder.gif) | mypapers/ | 2022-09-20 07:35 | - | |
![[IMG]](/icons/image2.gif) | n12187829559_6241.jpg | 2009-04-23 15:22 | 7.2K | |
![[TXT]](/icons/text.gif) | nanoshite.html | 2009-09-04 06:11 | 469K | |
![[DIR]](/icons/folder.gif) | nanoshite_files/ | 2009-09-04 06:11 | - | |
![[DIR]](/icons/folder.gif) | nanotech/ | 2023-11-30 17:40 | - | |
![[ ]](/icons/layout.gif) | nasa-esas-appendix.pdf | 2009-05-07 09:36 | 38M | |
![[TXT]](/icons/text.gif) | natural_competence.txt | 2009-04-19 11:10 | 4.5K | |
![[DIR]](/icons/folder.gif) | neuro/ | 2024-06-18 07:41 | - | |
![[TXT]](/icons/text.gif) | nist_lists.txt | 2008-12-23 14:25 | 725 | |
![[DIR]](/icons/folder.gif) | nootropics/ | 2017-02-14 13:51 | - | |
![[DIR]](/icons/folder.gif) | nutrition/ | 2022-07-15 09:39 | - | |
![[TXT]](/icons/text.gif) | ocean_creatures.txt | 2010-03-03 11:07 | 305 | |
![[IMG]](/icons/image2.gif) | old-dutch-microscope.jpg | 2009-09-04 16:57 | 47K | |
![[DIR]](/icons/folder.gif) | open-rtms/ | 2009-09-06 12:12 | - | |
![[DIR]](/icons/folder.gif) | open-source/ | 2015-01-05 11:54 | - | |
![[IMG]](/icons/image2.gif) | optical-micrographs-of-polycarbonate-disk.png | 2009-07-16 08:31 | 188K | |
![[DIR]](/icons/folder.gif) | optics/ | 2022-07-06 16:03 | - | |
![[DIR]](/icons/folder.gif) | organic-tft/ | 2010-02-01 18:38 | - | |
![[ ]](/icons/layout.gif) | origami_fabrication.pdf | 2009-02-27 05:46 | 161K | |
![[DIR]](/icons/folder.gif) | paperbot/ | 2016-10-25 20:29 | - | |
![[TXT]](/icons/text.gif) | paredis.html | 2009-09-16 12:35 | 36K | |
![[DIR]](/icons/folder.gif) | parenting/ | 2019-12-28 18:18 | - | |
![[ ]](/icons/layout.gif) | parieto-frontal-integration-theory-of-intelligence.pdf | 2009-08-04 20:04 | 2.2M | |
![[TXT]](/icons/text.gif) | pdf-hashes.txt | 2016-09-26 22:36 | 1.3M | |
![[DIR]](/icons/folder.gif) | pdfimages-test/ | 2010-01-17 08:31 | - | |
![[TXT]](/icons/text.gif) | pdfs.sh | 2016-09-26 22:27 | 832K | |
![[DIR]](/icons/folder.gif) | philosophy/ | 2015-09-04 05:57 | - | |
![[ ]](/icons/compressed.gif) | phosphoramidites.zip | 2009-06-23 18:44 | 3.2M | |
![[DIR]](/icons/folder.gif) | physics/ | 2016-10-25 20:25 | - | |
![[DIR]](/icons/folder.gif) | polymerase/ | 2018-08-04 06:27 | - | |
![[ ]](/icons/layout.gif) | practical guide to building and using your own interferometer.pdf | 2000-04-07 12:19 | 1.3M | |
![[DIR]](/icons/folder.gif) | prediction-markets/ | 2016-10-11 06:05 | - | |
![[ ]](/icons/layout.gif) | profiles-of-the-fraudster.pdf | 2016-06-17 04:42 | 1.2M | |
![[DIR]](/icons/folder.gif) | programming/ | 2015-01-17 16:56 | - | |
![[DIR]](/icons/folder.gif) | radio/ | 2014-11-04 12:41 | - | |
![[IMG]](/icons/image2.gif) | repositoryData.png | 2009-07-24 11:02 | 105K | |
![[DIR]](/icons/folder.gif) | retrosynthesis/ | 2009-09-07 22:14 | - | |
![[DIR]](/icons/folder.gif) | rfreitas.com/ | 2014-11-30 12:29 | - | |
![[ ]](/icons/layout.gif) | rh-supreme-court-brief-1.pdf | 2009-10-05 15:54 | 240K | |
![[ ]](/icons/layout.gif) | rheinberger-epistemology-stuff.pdf | 2001-06-01 03:53 | 17M | |
![[TXT]](/icons/text.gif) | risk.txt | 2009-06-07 08:01 | 27K | |
![[TXT]](/icons/text.gif) | rothemund.transcript.txt | 2009-09-15 11:13 | 36K | |
![[TXT]](/icons/text.gif) | rsync-cmd.txt | 2009-10-23 10:25 | 334 | |
![[IMG]](/icons/image2.gif) | scihub-Александра-profile-pic.png | 2012-05-30 05:46 | 4.1K | |
![[DIR]](/icons/folder.gif) | security/ | 2022-10-18 07:17 | - | |
![[DIR]](/icons/folder.gif) | self-replication/ | 2024-02-21 06:38 | - | |
![[TXT]](/icons/text.gif) | separation-processes.txt | 2009-07-12 16:06 | 2.2K | |
![[TXT]](/icons/text.gif) | sirt1-activators.txt | 2010-01-16 06:24 | 1.1K | |
![[TXT]](/icons/text.gif) | snp-redheads.html | 2009-08-12 03:40 | 16K | |
![[DIR]](/icons/folder.gif) | social/ | 2016-01-13 09:35 | - | |
![[DIR]](/icons/folder.gif) | software-engineering/ | 2020-11-16 06:45 | - | |
![[DIR]](/icons/folder.gif) | solidworks/ | 2010-09-08 07:18 | - | |
![[DIR]](/icons/folder.gif) | sound/ | 2010-07-13 11:48 | - | |
![[DIR]](/icons/folder.gif) | space/ | 2024-07-12 06:02 | - | |
![[DIR]](/icons/folder.gif) | spin-coater/ | 2009-07-15 18:16 | - | |
![[DIR]](/icons/folder.gif) | springerwat/ | 2015-12-29 10:03 | - | |
![[IMG]](/icons/image2.gif) | steam_distillation_schematic.jpg | 2009-07-12 20:44 | 14K | |
![[TXT]](/icons/text.gif) | steam distillation made EZ.html | 2009-07-12 15:59 | 240K | |
![[DIR]](/icons/folder.gif) | steam distillation made EZ_files/ | 2009-07-12 15:59 | - | |
![[DIR]](/icons/folder.gif) | stem-cells/ | 2018-05-06 13:42 | - | |
![[IMG]](/icons/image2.gif) | stereotactic_frame.jpg | 2009-08-03 19:53 | 46K | |
![[DIR]](/icons/folder.gif) | stoicescu/ | 2009-12-26 08:07 | - | |
![[DIR]](/icons/folder.gif) | submarines/ | 2014-08-21 11:45 | - | |
![[ ]](/icons/layout.gif) | systemantics.pdf | 2014-02-03 12:05 | 28M | |
![[DIR]](/icons/folder.gif) | technical-writing/ | 2009-12-21 09:07 | - | |
![[ ]](/icons/layout.gif) | temp.pdf | 2011-06-25 12:55 | 678K | |
![[TXT]](/icons/text.gif) | teuscher-suggested-reading.html | 2010-01-22 17:38 | 30K | |
![[ ]](/icons/layout.gif) | the-anorexic-startup.pdf | 2012-01-10 04:43 | 296K | |
![[IMG]](/icons/image2.gif) | threads.png | 2009-10-13 11:19 | 12K | |
![[TXT]](/icons/text.gif) | to-get.txt | 2010-01-16 06:23 | 1.5K | |
![[TXT]](/icons/text.gif) | tools-and-reagents--nature-protocols.html | 2009-08-10 17:52 | 74K | |
![[DIR]](/icons/folder.gif) | tools-and-reagents--nature-protocols_files/ | 2009-08-10 17:52 | - | |
![[DIR]](/icons/folder.gif) | transhumanism/ | 2023-11-28 14:29 | - | |
![[DIR]](/icons/folder.gif) | typing/ | 2014-03-27 09:51 | - | |
![[DIR]](/icons/folder.gif) | ultrasound/ | 2018-02-10 08:01 | - | |
![[ ]](/icons/layout.gif) | unix-phil_draft.pdf | 2010-04-12 07:32 | 74K | |
![[TXT]](/icons/text.gif) | url.txt | 2017-10-23 04:07 | 1.0K | |
![[TXT]](/icons/text.gif) | warez.html | 2009-10-11 15:20 | 11K | |
![[DIR]](/icons/folder.gif) | warez_files/ | 2009-10-11 15:20 | - | |
![[ ]](/icons/layout.gif) | wikipedia-mechanical-engineering.pdf | 2009-08-31 13:51 | 26M | |
![[DIR]](/icons/folder.gif) | winfree/ | 2011-06-11 17:40 | - | |
![[TXT]](/icons/text.gif) | wireless_papers.html | 2010-04-01 21:15 | 47K | |
![[IMG]](/icons/image2.gif) | world_of_r_and_d_2005.jpg | 2009-08-09 18:12 | 147K | |
![[ ]](/icons/layout.gif) | ycombinator_startup_library.pdf | 2009-12-30 12:41 | 13M | |
![[DIR]](/icons/folder.gif) | year-of-science/ | 2017-10-26 12:43 | - | |
![[DIR]](/icons/folder.gif) | za3k/ | 2014-10-17 12:05 | - | |
|